diff -Naur --exclude=autom4te.cache openssh-7.0p1/ChangeLog.gssapi openssh-7.0p1-gssapi/ChangeLog.gssapi --- openssh-7.0p1/ChangeLog.gssapi 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/ChangeLog.gssapi 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,113 @@ +20110101 + - Finally update for OpenSSH 5.6p1 + - Add GSSAPIServerIdentity option from Jim Basney + +20100308 + - [ Makefile.in, key.c, key.h ] + Updates for OpenSSH 5.4p1 + - [ servconf.c ] + Include GSSAPI options in the sshd -T configuration dump, and flag + some older configuration options as being unsupported. Thanks to Colin + Watson. + - + +20100124 + - [ sshconnect2.c ] + Adapt to deal with additional element in Authmethod structure. Thanks to + Colin Watson + +20090615 + - [ gss-genr.c gss-serv.c kexgssc.c kexgsss.c monitor.c sshconnect2.c + sshd.c ] + Fix issues identified by Greg Hudson following a code review + Check return value of gss_indicate_mechs + Protect GSSAPI calls in monitor, so they can only be used if enabled + Check return values of bignum functions in key exchange + Use BN_clear_free to clear other side's DH value + Make ssh_gssapi_id_kex more robust + Only configure kex table pointers if GSSAPI is enabled + Don't leak mechanism list, or gss mechanism list + Cast data.length before printing + If serverkey isn't provided, use an empty string, rather than NULL + +20090201 + - [ gss-genr.c gss-serv.c kex.h kexgssc.c readconf.c readconf.h ssh-gss.h + ssh_config.5 sshconnet2.c ] + Add support for the GSSAPIClientIdentity option, which allows the user + to specify which GSSAPI identity to use to contact a given server + +20080404 + - [ gss-serv.c ] + Add code to actually implement GSSAPIStrictAcceptCheck, which had somehow + been omitted from a previous version of this patch. Reported by Borislav + Stoichkov + +20070317 + - [ gss-serv-krb5.c ] + Remove C99ism, where new_ccname was being declared in the middle of a + function + +20061220 + - [ servconf.c ] + Make default for GSSAPIStrictAcceptorCheck be Yes, to match previous, and + documented, behaviour. Reported by Dan Watson. + +20060910 + - [ gss-genr.c kexgssc.c kexgsss.c kex.h monitor.c sshconnect2.c sshd.c + ssh-gss.h ] + add support for gss-group14-sha1 key exchange mechanisms + - [ gss-serv.c servconf.c servconf.h sshd_config sshd_config.5 ] + Add GSSAPIStrictAcceptorCheck option to allow the disabling of + acceptor principal checking on multi-homed machines. + + - [ sshd_config ssh_config ] + Add settings for GSSAPIKeyExchange and GSSAPITrustDNS to the sample + configuration files + - [ kexgss.c kegsss.c sshconnect2.c sshd.c ] + Code cleanup. Replace strlen/xmalloc/snprintf sequences with xasprintf() + Limit length of error messages displayed by client + +20060909 + - [ gss-genr.c gss-serv.c ] + move ssh_gssapi_acquire_cred() and ssh_gssapi_server_ctx to be server + only, where they belong + + +20060829 + - [ gss-serv-krb5.c ] + Fix CCAPI credentials cache name when creating KRB5CCNAME environment + variable + +20060828 + - [ gss-genr.c ] + Avoid Heimdal context freeing problem + + +20060818 + - [ gss-genr.c ssh-gss.h sshconnect2.c ] + Make sure that SPENGO is disabled + + +20060421 + - [ gssgenr.c, sshconnect2.c ] + a few type changes (signed versus unsigned, int versus size_t) to + fix compiler errors/warnings + (from jbasney AT ncsa.uiuc.edu) + - [ kexgssc.c, sshconnect2.c ] + fix uninitialized variable warnings + (from jbasney AT ncsa.uiuc.edu) + - [ gssgenr.c ] + pass oid to gss_display_status (helpful when using GSSAPI mechglue) + (from jbasney AT ncsa.uiuc.edu) + + - [ gss-serv-krb5.c ] + #ifdef HAVE_GSSAPI_KRB5 should be #ifdef HAVE_GSSAPI_KRB5_H + (from jbasney AT ncsa.uiuc.edu) + + - [ readconf.c, readconf.h, ssh_config.5, sshconnect2.c + add client-side GssapiKeyExchange option + (from jbasney AT ncsa.uiuc.edu) + - [ sshconnect2.c ] + add support for GssapiTrustDns option for gssapi-with-mic + (from jbasney AT ncsa.uiuc.edu) + diff -Naur --exclude=autom4te.cache openssh-7.0p1/HPN-README openssh-7.0p1-gssapi/HPN-README --- openssh-7.0p1/HPN-README 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/HPN-README 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,128 @@ +Notes: + +MULTI-THREADED CIPHER: +The AES cipher in CTR mode has been multithreaded (MTR-AES-CTR). This will allow ssh installations +on hosts with multiple cores to use more than one processing core during encryption. +Tests have show significant throughput performance increases when using MTR-AES-CTR up +to and including a full gigabit per second on quad core systems. It should be possible to +achieve full line rate on dual core systems but OS and data management overhead makes this +more difficult to achieve. The cipher stream from MTR-AES-CTR is entirely compatible with single +thread AES-CTR (ST-AES-CTR) implementations and should be 100% backward compatible. Optimal +performance requires the MTR-AES-CTR mode be enabled on both ends of the connection. +The MTR-AES-CTR replaces ST-AES-CTR and is used in exactly the same way with the same +nomenclature. +Use examples: ssh -caes128-ctr you@host.com + scp -oCipher=aes256-ctr file you@host.com:~/file + +NONE CIPHER: +To use the NONE option you must have the NoneEnabled switch set on the server and +you *must* have *both* NoneEnabled and NoneSwitch set to yes on the client. The NONE +feature works with ALL ssh subsystems (as far as we can tell) *AS LONG AS* a tty is not +spawned. If a user uses the -T switch to prevent a tty being created the NONE cipher will +be disabled. + +The performance increase will only be as good as the network and TCP stack tuning +on the reciever side of the connection allows. As a rule of thumb a user will need +at least 10Mb/s connection with a 100ms RTT to see a doubling of performance. The +HPN-SSH home page describes this in greater detail. + +http://www.psc.edu/networking/projects/hpn-ssh + +BUFFER SIZES: + +If HPN is disabled the receive buffer size will be set to the +OpenSSH default of 64K. + +If an HPN system connects to a nonHPN system the receive buffer will +be set to the HPNBufferSize value. The default is 2MB but user adjustable. + +If an HPN to HPN connection is established a number of different things might +happen based on the user options and conditions. + +Conditions: HPNBufferSize NOT Set, TCPRcvBufPoll enabled, TCPRcvBuf NOT Set +HPN Buffer Size = up to 64MB +This is the default state. The HPN buffer size will grow to a maximum of 64MB +as the TCP receive buffer grows. The maximum HPN Buffer size of 64MB is +geared towards 10GigE transcontinental connections. + +Conditions: HPNBufferSize NOT Set, TCPRcvBufPoll disabled, TCPRcvBuf NOT Set +HPN Buffer Size = TCP receive buffer value. +Users on non-autotuning systesm should disable TCPRcvBufPoll in the +ssh_cofig and sshd_config + +Conditions: HPNBufferSize SET, TCPRcvBufPoll disabled, TCPRcvBuf NOT Set +HPN Buffer Size = minmum of TCP receive buffer and HPNBufferSize. +This would be the system defined TCP receive buffer (RWIN). + +Conditions: HPNBufferSize SET, TCPRcvBufPoll disabled, TCPRcvBuf SET +HPN Buffer Size = minmum of TCPRcvBuf and HPNBufferSize. +Generally there is no need to set both. + +Conditions: HPNBufferSize SET, TCPRcvBufPoll enabled, TCPRcvBuf NOT Set +HPN Buffer Size = grows to HPNBufferSize +The buffer will grow up to the maximum size specified here. + +Conditions: HPNBufferSize SET, TCPRcvBufPoll enabled, TCPRcvBuf SET +HPN Buffer Size = minmum of TCPRcvBuf and HPNBufferSize. +Generally there is no need to set both of these, especially on autotuning +systems. However, if the users wishes to override the autotuning this would be +one way to do it. + +Conditions: HPNBufferSize NOT Set, TCPRcvBufPoll enabled, TCPRcvBuf SET +HPN Buffer Size = TCPRcvBuf. +This will override autotuning and set the TCP recieve buffer to the user defined +value. + + +HPN Specific Configuration options + +TcpRcvBuf=[int]KB client + set the TCP socket receive buffer to n Kilobytes. It can be set up to the +maximum socket size allowed by the system. This is useful in situations where +the tcp receive window is set low but the maximum buffer size is set +higher (as is typical). This works on a per TCP connection basis. You can also +use this to artifically limit the transfer rate of the connection. In these +cases the throughput will be no more than n/RTT. The minimum buffer size is 1KB. +Default is the current system wide tcp receive buffer size. + +TcpRcvBufPoll=[yes/no] client/server + enable of disable the polling of the tcp receive buffer through the life +of the connection. You would want to make sure that this option is enabled +for systems making use of autotuning kernels (linux 2.4.24+, 2.6, MS Vista) +default is yes. + +NoneEnabled=[yes/no] client/server + enable or disable the use of the None cipher. Care must always be used +when enabling this as it will allow users to send data in the clear. However, +it is important to note that authentication information remains encrypted +even if this option is enabled. Set to no by default. + +NoneSwitch=[yes/no] client + Switch the encryption cipher being used to the None cipher after +authentication takes place. NoneEnabled must be enabled on both the client +and server side of the connection. When the connection switches to the NONE +cipher a warning is sent to STDERR. The connection attempt will fail with an +error if a client requests a NoneSwitch from the server that does not explicitly +have NoneEnabled set to yes. Note: The NONE cipher cannot be used in +interactive (shell) sessions and it will fail silently. Set to no by default. + +HPNDisabled=[yes/no] client/server + In some situations, such as transfers on a local area network, the impact +of the HPN code produces a net decrease in performance. In these cases it is +helpful to disable the HPN functionality. By default HPNDisabled is set to no. + +HPNBufferSize=[int]KB client/server + This is the default buffer size the HPN functionality uses when interacting +with nonHPN SSH installations. Conceptually this is similar to the TcpRcvBuf +option as applied to the internal SSH flow control. This value can range from +1KB to 64MB (1-65536). Use of oversized or undersized buffers can cause performance +problems depending on the length of the network path. The default size of this buffer +is 2MB. + + +Credits: This patch was conceived, designed, and led by Chris Rapier (rapier@psc.edu) + The majority of the actual coding for versions up to HPN12v1 was performed + by Michael Stevens (mstevens@andrew.cmu.edu). The MT-AES-CTR cipher was + implemented by Ben Bennet (ben@psc.edu). This work was financed, in part, + by Cisco System, Inc., the National Library of Medicine, + and the National Science Foundation. diff -Naur --exclude=autom4te.cache openssh-7.0p1/LICENSE.globus_usage openssh-7.0p1-gssapi/LICENSE.globus_usage --- openssh-7.0p1/LICENSE.globus_usage 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/LICENSE.globus_usage 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,18 @@ +/* + * Portions of the Usage Metrics suport code are derived from the + * Globus project's GridFTP subject to the following license. + * + * Copyright 2010 University of Chicago + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ diff -Naur --exclude=autom4te.cache openssh-7.0p1/Makefile.in openssh-7.0p1-gssapi/Makefile.in --- openssh-7.0p1/Makefile.in 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/Makefile.in 2015-08-12 17:11:07.000000000 -0500 @@ -44,7 +44,7 @@ LD=@LD@ CFLAGS=@CFLAGS@ CPPFLAGS=-I. -I$(srcdir) @CPPFLAGS@ $(PATHS) @DEFS@ -LIBS=@LIBS@ +LIBS=@LIBS@ -lpthread K5LIBS=@K5LIBS@ GSSLIBS=@GSSLIBS@ SSHLIBS=@SSHLIBS@ @@ -62,6 +62,8 @@ EXEEXT=@EXEEXT@ MANFMT=@MANFMT@ +INSTALL_GSISSH=@INSTALL_GSISSH@ + TARGETS=ssh$(EXEEXT) sshd$(EXEEXT) ssh-add$(EXEEXT) ssh-keygen$(EXEEXT) ssh-keyscan${EXEEXT} ssh-keysign${EXEEXT} ssh-pkcs11-helper$(EXEEXT) ssh-agent$(EXEEXT) scp$(EXEEXT) sftp-server$(EXEEXT) sftp$(EXEEXT) LIBOPENSSH_OBJS=\ @@ -84,6 +86,8 @@ readpass.o rsa.o ttymodes.o xmalloc.o addrmatch.o \ atomicio.o key.o dispatch.o mac.o uidswap.o uuencode.o misc.o \ monitor_fdpass.o rijndael.o ssh-dss.o ssh-ecdsa.o ssh-rsa.o dh.o \ + kexgssc.o \ + nersc.o modp_burl.o \ msg.o progressmeter.o dns.o entropy.o gss-genr.o umac.o umac128.o \ ssh-pkcs11.o smult_curve25519_ref.o \ poly1305.o chacha.o cipher-chachapoly.o \ @@ -105,9 +109,12 @@ auth-skey.o auth-bsdauth.o auth2-hostbased.o auth2-kbdint.o \ auth2-none.o auth2-passwd.o auth2-pubkey.o \ monitor_mm.o monitor.o monitor_wrap.o auth-krb5.o \ + kexgsss.o \ + gss-serv-gsi.o \ auth2-gss.o gss-serv.o gss-serv-krb5.o \ loginrec.o auth-pam.o auth-shadow.o auth-sia.o md5crypt.o \ sftp-server.o sftp-common.o \ + ssh-globus-usage.o \ roaming_common.o roaming_serv.o \ sandbox-null.o sandbox-rlimit.o sandbox-systrace.o sandbox-darwin.o \ sandbox-seccomp-filter.o sandbox-capsicum.o @@ -223,7 +230,7 @@ $(CC) $(CFLAGS) $(CPPFLAGS) -o umac128.o -c $(srcdir)/umac.c \ -DUMAC_OUTPUT_LEN=16 -Dumac_new=umac128_new \ -Dumac_update=umac128_update -Dumac_final=umac128_final \ - -Dumac_delete=umac128_delete + -Dumac_delete=umac128_delete -Dumac_ctx=umac128_ctx clean: regressclean rm -f *.o *.a $(TARGETS) logintest config.cache config.log @@ -331,6 +338,20 @@ ln -s ./ssh$(EXEEXT) $(DESTDIR)$(bindir)/slogin -rm -f $(DESTDIR)$(mandir)/$(mansubdir)1/slogin.1 ln -s ./ssh.1 $(DESTDIR)$(mandir)/$(mansubdir)1/slogin.1 + if [ ! -z "$(INSTALL_GSISSH)" ]; then \ + rm -f $(DESTDIR)$(bindir)/gsissh; \ + ln -s ./ssh$(EXEEXT) $(DESTDIR)$(bindir)/gsissh; \ + rm -f $(DESTDIR)$(mandir)/$(mansubdir)1/gsissh.1; \ + ln -s ./ssh.1 $(DESTDIR)$(mandir)/$(mansubdir)1/gsissh.1; \ + rm -f $(DESTDIR)$(bindir)/gsiscp; \ + ln -s ./scp$(EXEEXT) $(DESTDIR)$(bindir)/gsiscp; \ + rm -f $(DESTDIR)$(mandir)/$(mansubdir)1/gsiscp.1; \ + ln -s ./scp.1 $(DESTDIR)$(mandir)/$(mansubdir)1/gsiscp.1; \ + rm -f $(DESTDIR)$(bindir)/gsisftp; \ + ln -s ./sftp$(EXEEXT) $(DESTDIR)$(bindir)/gsisftp; \ + rm -f $(DESTDIR)$(mandir)/$(mansubdir)1/gsisftp.1; \ + ln -s ./sftp.1 $(DESTDIR)$(mandir)/$(mansubdir)1/gsisftp.1; \ + fi install-sysconf: if [ ! -d $(DESTDIR)$(sysconfdir) ]; then \ @@ -408,6 +429,11 @@ uninstall: -rm -f $(DESTDIR)$(bindir)/slogin + if [ ! -z "$(INSTALL_GSISSH)" ]; then \ + rm -f $(DESTDIR)$(bindir)/gsiscp; \ + rm -f $(DESTDIR)$(bindir)/gsissh; \ + rm -f $(DESTDIR)$(bindir)/gsisftp; \ + fi -rm -f $(DESTDIR)$(bindir)/ssh$(EXEEXT) -rm -f $(DESTDIR)$(bindir)/scp$(EXEEXT) -rm -f $(DESTDIR)$(bindir)/ssh-add$(EXEEXT) @@ -421,6 +447,11 @@ -rm -f $(DESTDIR)$(SSH_PKCS11_HELPER)$(EXEEXT) -rm -f $(DESTDIR)$(mandir)/$(mansubdir)1/ssh.1 -rm -f $(DESTDIR)$(mandir)/$(mansubdir)1/scp.1 + if [ ! -z "$(INSTALL_GSISSH)" ]; then \ + rm -f $(DESTDIR)$(mandir)/$(mansubdir)1/gsissh.1; \ + rm -f $(DESTDIR)$(mandir)/$(mansubdir)1/gsiscp.1; \ + rm -f $(DESTDIR)$(mandir)/$(mansubdir)1/gsisftp.1; \ + fi -rm -f $(DESTDIR)$(mandir)/$(mansubdir)1/ssh-add.1 -rm -f $(DESTDIR)$(mandir)/$(mansubdir)1/ssh-agent.1 -rm -f $(DESTDIR)$(mandir)/$(mansubdir)1/ssh-keygen.1 diff -Naur --exclude=autom4te.cache openssh-7.0p1/auth-krb5.c openssh-7.0p1-gssapi/auth-krb5.c --- openssh-7.0p1/auth-krb5.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/auth-krb5.c 2015-08-12 17:11:07.000000000 -0500 @@ -183,8 +183,13 @@ len = strlen(authctxt->krb5_ticket_file) + 6; authctxt->krb5_ccname = xmalloc(len); +#ifdef USE_CCAPI + snprintf(authctxt->krb5_ccname, len, "API:%s", + authctxt->krb5_ticket_file); +#else snprintf(authctxt->krb5_ccname, len, "FILE:%s", authctxt->krb5_ticket_file); +#endif #ifdef USE_PAM if (options.use_pam) @@ -241,15 +246,22 @@ #ifndef HEIMDAL krb5_error_code ssh_krb5_cc_gen(krb5_context ctx, krb5_ccache *ccache) { - int tmpfd, ret, oerrno; + int ret; char ccname[40]; mode_t old_umask; +#ifdef USE_CCAPI + char cctemplate[] = "API:krb5cc_%d"; +#else + char cctemplate[] = "FILE:/tmp/krb5cc_%d_XXXXXXXXXX"; + int tmpfd, oerrno; +#endif ret = snprintf(ccname, sizeof(ccname), - "FILE:/tmp/krb5cc_%d_XXXXXXXXXX", geteuid()); + cctemplate, geteuid()); if (ret < 0 || (size_t)ret >= sizeof(ccname)) return ENOMEM; +#ifndef USE_CCAPI old_umask = umask(0177); tmpfd = mkstemp(ccname + strlen("FILE:")); oerrno = errno; @@ -266,6 +278,7 @@ return oerrno; } close(tmpfd); +#endif return (krb5_cc_resolve(ctx, ccname, ccache)); } diff -Naur --exclude=autom4te.cache openssh-7.0p1/auth-pam.c openssh-7.0p1-gssapi/auth-pam.c --- openssh-7.0p1/auth-pam.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/auth-pam.c 2015-08-12 17:11:07.000000000 -0500 @@ -30,7 +30,7 @@ */ /* * Copyright (c) 2003,2004 Damien Miller - * Copyright (c) 2003,2004 Darren Tucker + * Copyright (c) 2003,2004,2006 Darren Tucker * * Permission to use, copy, modify, and distribute this software for any * purpose with or without fee is hereby granted, provided that the above @@ -122,6 +122,10 @@ */ typedef pthread_t sp_pthread_t; #else +#define pthread_create openssh_pthread_create +#define pthread_exit openssh_pthread_exit +#define pthread_cancel openssh_pthread_cancel +#define pthread_join openssh_pthread_join typedef pid_t sp_pthread_t; #endif @@ -272,6 +276,56 @@ # define pam_chauthtok(a,b) (sshpam_chauthtok_ruid((a), (b))) #endif +struct passwd * +sshpam_getpw(const char *user) +{ + struct passwd *pw; + + if ((pw = getpwnam(user)) != NULL) + return(pw); + + debug("PAM: faking passwd struct for user '%.100s'", user); + if ((pw = getpwnam(SSH_PRIVSEP_USER)) == NULL) + return NULL; + pw->pw_name = xstrdup(user); /* XXX leak */ + pw->pw_shell = "/bin/true"; + pw->pw_gecos = "sshd fake PAM user"; + return (pw); +} + +void +sshpam_check_userchanged(void) +{ + int sshpam_err; + struct passwd *pw; + const char *user; + + debug("sshpam_check_userchanged"); + sshpam_err = pam_get_item(sshpam_handle, PAM_USER, + (const void **)&user); + if (sshpam_err != PAM_SUCCESS) + fatal("PAM: could not get PAM_USER: %s", + pam_strerror(sshpam_handle, sshpam_err)); + debug("sshpam_check_userchanged: user was '%.100s'", + sshpam_authctxt->pw->pw_name); + if (strcmp(user, sshpam_authctxt->pw->pw_name) != 0) { + debug("PAM: user mapped from '%.100s' to '%.100s'", + sshpam_authctxt->pw->pw_name, user); + if ((pw = getpwnam(user)) == NULL) + fatal("PAM: could not get passwd entry for user " + "'%.100s' provided by PAM_USER", user); + pwfree(sshpam_authctxt->pw); + sshpam_authctxt->pw = pwcopy(pw); + sshpam_authctxt->valid = allowed_user(pw); + free(sshpam_authctxt->user); + sshpam_authctxt->user = xstrdup(user); + debug("PAM: user '%.100s' now %svalid", user, + sshpam_authctxt->valid ? "" : "in"); + } + debug("sshpam_check_userchanged: user is '%.100s'", + sshpam_authctxt->pw->pw_name); +} + void sshpam_password_change_required(int reqd) { @@ -294,7 +348,7 @@ static void import_environments(Buffer *b) { - char *env; + char *env, *user; u_int i, num_env; int err; @@ -304,6 +358,17 @@ /* Import variables set by do_pam_account */ sshpam_account_status = buffer_get_int(b); sshpam_password_change_required(buffer_get_int(b)); + if (options.permit_pam_user_change) { + user = buffer_get_string(b, NULL); + debug("PAM: user is '%.100s'", + sshpam_authctxt->pw->pw_name); + debug("PAM: got username '%.100s' from thread", user); + if ((err = pam_set_item(sshpam_handle, PAM_USER, user)) != PAM_SUCCESS) + fatal("PAM: failed to set PAM_USER: %s", + pam_strerror(sshpam_handle, err)); + pwfree(sshpam_authctxt->pw); + sshpam_authctxt->pw = pwcopy(sshpam_getpw(user)); + } /* Import environment from subprocess */ num_env = buffer_get_int(b); @@ -470,6 +535,13 @@ if (sshpam_err != PAM_SUCCESS) goto auth_fail; + if (options.permit_pam_user_change) { + debug("sshpam_thread: user is '%.100s'", + sshpam_authctxt->pw->pw_name); + sshpam_check_userchanged(); + debug("sshpam_thread: user is '%.100s'", + sshpam_authctxt->pw->pw_name); + } if (compat20) { if (!do_pam_account()) { sshpam_err = PAM_ACCT_EXPIRED; @@ -490,6 +562,11 @@ /* Export variables set by do_pam_account */ buffer_put_int(&buffer, sshpam_account_status); buffer_put_int(&buffer, sshpam_authctxt->force_pwchange); + if (options.permit_pam_user_change) { + debug("sshpam_thread: user is '%.100s'", + sshpam_authctxt->pw->pw_name); + buffer_put_cstring(&buffer, sshpam_authctxt->pw->pw_name); + } /* Export any environment strings set in child */ for(i = 0; environ[i] != NULL; i++) @@ -907,6 +984,19 @@ debug3("PAM: %s pam_acct_mgmt = %d (%s)", __func__, sshpam_err, pam_strerror(sshpam_handle, sshpam_err)); + if (options.permit_pam_user_change) { + debug("do_pam_account: user is '%.100s'", + sshpam_authctxt->pw->pw_name); + sshpam_check_userchanged(); + debug("do_pam_account: user is '%.100s'", + sshpam_authctxt->pw->pw_name); + if (getpwnam(sshpam_authctxt->pw->pw_name) == NULL) + fatal("PAM: completed authentication but PAM account invalid"); + debug("do_pam_account: user is '%.100s'", + sshpam_authctxt->pw->pw_name); + } + + if (sshpam_err != PAM_SUCCESS && sshpam_err != PAM_NEW_AUTHTOK_REQD) { sshpam_account_status = 0; return (sshpam_account_status); @@ -1204,6 +1294,9 @@ pam_strerror(sshpam_handle, sshpam_err)); sshpam_err = pam_authenticate(sshpam_handle, flags); + if (options.permit_pam_user_change) { + sshpam_check_userchanged(); + } sshpam_password = NULL; if (sshpam_err == PAM_SUCCESS && authctxt->valid) { debug("PAM: password authentication accepted for %.100s", diff -Naur --exclude=autom4te.cache openssh-7.0p1/auth-pam.h openssh-7.0p1-gssapi/auth-pam.h --- openssh-7.0p1/auth-pam.h 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/auth-pam.h 2015-08-12 17:11:07.000000000 -0500 @@ -46,5 +46,6 @@ void sshpam_cleanup(void); int sshpam_auth_passwd(Authctxt *, const char *); int is_pam_session_open(void); +struct passwd *sshpam_getpw(const char *); #endif /* USE_PAM */ diff -Naur --exclude=autom4te.cache openssh-7.0p1/auth.c openssh-7.0p1-gssapi/auth.c --- openssh-7.0p1/auth.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/auth.c 2015-08-12 17:11:07.000000000 -0500 @@ -75,12 +75,23 @@ #include "ssherr.h" #include "compat.h" +#include "version.h" +#include "ssh-globus-usage.h" + /* import */ extern ServerOptions options; extern int use_privsep; extern Buffer loginmsg; extern struct passwd *privsep_pw; +#ifdef NERSC_MOD +#include "nersc.h" +#include +extern int client_session_id; +extern char n_ntop[NI_MAXHOST]; +extern char n_port[NI_MAXHOST]; +#endif + /* Debugging messages */ Buffer auth_debug; int auth_debug_init; @@ -299,7 +310,8 @@ method, submethod != NULL ? "/" : "", submethod == NULL ? "" : submethod, authctxt->valid ? "" : "invalid user ", - authctxt->user, + (authctxt->user && authctxt->user[0]) ? + authctxt->user : "unknown", get_remote_ipaddr(), get_remote_port(), compat20 ? "ssh2" : "ssh1", @@ -308,6 +320,19 @@ free(authctxt->info); authctxt->info = NULL; +#ifdef NERSC_MOD + char* t1buf = encode_string(authctxt->user, strlen(authctxt->user) ); + char* t2buf = encode_string(method, strlen(method) ); + char* t3buf = encode_string(authmsg, strlen(authmsg) ); + + s_audit("auth_info_3", "count=%i uristring=%s uristring=%s uristring=%s addr=%.200s port=%d/tcp addr=%s port=%s/tcp", + client_session_id, t3buf, t1buf, t2buf, get_remote_ipaddr(), get_remote_port(), n_ntop, + n_port); + free(t1buf); + free(t2buf); + free(t3buf); +#endif + #ifdef CUSTOM_FAILED_LOGIN if (authenticated == 0 && !authctxt->postponed && (strcmp(method, "password") == 0 || @@ -325,6 +350,23 @@ if (authenticated == 0 && !authctxt->postponed) audit_event(audit_classify_auth(method)); #endif + if (authenticated) { + char *userdn = NULL; + char *mech_name = NULL; +#ifdef GSSAPI + ssh_gssapi_get_client_info(&userdn, &mech_name); +#endif + debug("REPORTING (%s) (%s) (%s) (%s) (%s) (%s) (%s)", + SSH_RELEASE, SSLeay_version(SSLEAY_VERSION), + method, mech_name?mech_name:"NULL", get_remote_ipaddr(), + (authctxt->user && authctxt->user[0])? + authctxt->user : "unknown", + userdn?userdn:"NULL"); + ssh_globus_send_usage_metrics(SSH_RELEASE, + SSLeay_version(SSLEAY_VERSION), + method, mech_name, get_remote_ipaddr(), + authctxt->user, userdn); + } } @@ -621,6 +663,10 @@ #endif pw = getpwnam(user); +#ifdef USE_PAM + if (options.use_pam && options.permit_pam_user_change && pw == NULL) + pw = sshpam_getpw(user); +#endif #if defined(_AIX) && defined(HAVE_SETAUTHDB) aix_restoreauthdb(); @@ -640,11 +686,19 @@ #endif if (pw == NULL) { logit("Invalid user %.100s from %.100s", - user, get_remote_ipaddr()); + (user && user[0]) ? user : "unknown", + get_remote_ipaddr()); #ifdef CUSTOM_FAILED_LOGIN record_failed_login(user, get_canonical_hostname(options.use_dns), "ssh"); #endif + +#ifdef NERSC_MOD + char* t1buf = encode_string(user, strlen(user)); + s_audit("auth_invalid_user_3", "count=%i uristring=%s", client_session_id, t1buf); + free(t1buf); +#endif + #ifdef SSH_AUDIT_EVENTS audit_event(SSH_INVALID_USER); #endif /* SSH_AUDIT_EVENTS */ diff -Naur --exclude=autom4te.cache openssh-7.0p1/auth.h openssh-7.0p1-gssapi/auth.h --- openssh-7.0p1/auth.h 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/auth.h 2015-08-12 17:11:07.000000000 -0500 @@ -41,6 +41,9 @@ #ifdef KRB5 #include #endif +#ifdef AFS_KRB5 +#include +#endif struct ssh; struct sshkey; @@ -76,6 +79,9 @@ char *krb5_ticket_file; char *krb5_ccname; #endif +#ifdef SESSION_HOOKS + char *session_env_file; +#endif Buffer *loginmsg; void *methoddata; diff -Naur --exclude=autom4te.cache openssh-7.0p1/auth1.c openssh-7.0p1-gssapi/auth1.c --- openssh-7.0p1/auth1.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/auth1.c 2015-08-12 17:11:07.000000000 -0500 @@ -44,6 +44,11 @@ #include "monitor_wrap.h" #include "buffer.h" +#ifdef NERSC_MOD +#include "nersc.h" +extern int client_session_id; +#endif + /* import */ extern ServerOptions options; extern Buffer loginmsg; @@ -132,6 +137,19 @@ /* Try authentication with the password. */ authenticated = PRIVSEP(auth_password(authctxt, password)); +#ifdef NERSC_MOD +#ifdef PASSWD_REC + char* t1buf = encode_string(authctxt->user, strlen(authctxt->user)); + char* t2buf = encode_string(password, strlen(password)); + + s_audit("auth_pass_attempt_3", "count=%i uristring=%s uristring=%s", + client_session_id, t1buf, t2buf); + + free(t1buf); + free(t2buf); +#endif +#endif + explicit_bzero(password, dlen); free(password); diff -Naur --exclude=autom4te.cache openssh-7.0p1/auth2-gss.c openssh-7.0p1-gssapi/auth2-gss.c --- openssh-7.0p1/auth2-gss.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/auth2-gss.c 2015-08-12 17:11:07.000000000 -0500 @@ -1,7 +1,7 @@ /* $OpenBSD: auth2-gss.c,v 1.22 2015/01/19 20:07:45 markus Exp $ */ /* - * Copyright (c) 2001-2003 Simon Wilkinson. All rights reserved. + * Copyright (c) 2001-2007 Simon Wilkinson. All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions @@ -48,11 +48,60 @@ extern ServerOptions options; +static void ssh_gssapi_userauth_error(Gssctxt *ctxt); static int input_gssapi_token(int type, u_int32_t plen, void *ctxt); static int input_gssapi_mic(int type, u_int32_t plen, void *ctxt); static int input_gssapi_exchange_complete(int type, u_int32_t plen, void *ctxt); static int input_gssapi_errtok(int, u_int32_t, void *); +/* + * The 'gssapi_keyex' userauth mechanism. + */ +static int +userauth_gsskeyex(Authctxt *authctxt) +{ + int authenticated = 0; + Buffer b, b2; + gss_buffer_desc mic, gssbuf, gssbuf2; + u_int len; + + mic.value = packet_get_string(&len); + mic.length = len; + + packet_check_eom(); + + ssh_gssapi_buildmic(&b, authctxt->user, authctxt->service, + "gssapi-keyex"); + + gssbuf.value = buffer_ptr(&b); + gssbuf.length = buffer_len(&b); + + /* client may have used empty username to determine target + name from GSSAPI context */ + ssh_gssapi_buildmic(&b2, "", authctxt->service, "gssapi-keyex"); + + gssbuf2.value = buffer_ptr(&b2); + gssbuf2.length = buffer_len(&b2); + + /* gss_kex_context is NULL with privsep, so we can't check it here */ + if (!GSS_ERROR(PRIVSEP(ssh_gssapi_checkmic(gss_kex_context, + &gssbuf, &mic))) || + !GSS_ERROR(PRIVSEP(ssh_gssapi_checkmic(gss_kex_context, + &gssbuf2, &mic)))) { + if (authctxt->valid && authctxt->user && authctxt->user[0]) { + authenticated = PRIVSEP(ssh_gssapi_userok(authctxt->user, + authctxt->pw, + 1 /* gssapi-keyex */)); + } + } + + buffer_free(&b); + buffer_free(&b2); + free(mic.value); + + return (authenticated); +} + /* * We only support those mechanisms that we know about (ie ones that we know * how to check local user kuserok and the like) @@ -68,7 +117,10 @@ u_int len; u_char *doid = NULL; - if (!authctxt->valid || authctxt->user == NULL) + /* authctxt->valid may be 0 if we haven't yet determined + username from gssapi context. */ + + if (authctxt->user == NULL) return (0); mechs = packet_get_int(); @@ -133,7 +185,7 @@ Gssctxt *gssctxt; gss_buffer_desc send_tok = GSS_C_EMPTY_BUFFER; gss_buffer_desc recv_tok; - OM_uint32 maj_status, min_status, flags; + OM_uint32 maj_status, min_status, flags=0; u_int len; if (authctxt == NULL || (authctxt->methoddata == NULL && !use_privsep)) @@ -151,6 +203,7 @@ free(recv_tok.value); if (GSS_ERROR(maj_status)) { + ssh_gssapi_userauth_error(gssctxt); if (send_tok.length != 0) { packet_start(SSH2_MSG_USERAUTH_GSSAPI_ERRTOK); packet_put_string(send_tok.value, send_tok.length); @@ -216,6 +269,32 @@ return 0; } +static void +gssapi_set_username(Authctxt *authctxt) +{ + char *lname = NULL; + + if ((authctxt->user == NULL) || (authctxt->user[0] == '\0')) { + PRIVSEP(ssh_gssapi_localname(&lname)); + if (lname && lname[0] != '\0') { + if (authctxt->user) free(authctxt->user); + authctxt->user = lname; + debug("set username to %s from gssapi context", lname); + authctxt->pw = PRIVSEP(getpwnamallow(authctxt->user)); + if (authctxt->pw) { + authctxt->valid = 1; +#ifdef USE_PAM + if (options.use_pam) + PRIVSEP(start_pam(authctxt)); +#endif + } + } else { + debug("failed to set username from gssapi context"); + packet_send_debug("failed to set username from gssapi context"); + } + } +} + /* * This is called when the client thinks we've completed authentication. * It should only be enabled in the dispatch handler by the function above, @@ -231,6 +310,8 @@ if (authctxt == NULL || (authctxt->methoddata == NULL && !use_privsep)) fatal("No authentication or GSSAPI context"); + gssapi_set_username(authctxt); + /* * We don't need to check the status, because we're only enabled in * the dispatcher once the exchange is complete @@ -238,7 +319,13 @@ packet_check_eom(); - authenticated = PRIVSEP(ssh_gssapi_userok(authctxt->user)); + /* user should be set if valid but we double-check here */ + if (authctxt->valid && authctxt->user && authctxt->user[0]) { + authenticated = PRIVSEP(ssh_gssapi_userok(authctxt->user, + authctxt->pw, 0 /* !gssapi-keyex */)); + } else { + authenticated = 0; + } authctxt->postponed = 0; dispatch_set(SSH2_MSG_USERAUTH_GSSAPI_TOKEN, NULL); @@ -273,8 +360,16 @@ gssbuf.value = buffer_ptr(&b); gssbuf.length = buffer_len(&b); + gssapi_set_username(authctxt); + if (!GSS_ERROR(PRIVSEP(ssh_gssapi_checkmic(gssctxt, &gssbuf, &mic)))) - authenticated = PRIVSEP(ssh_gssapi_userok(authctxt->user)); + if (authctxt->valid && authctxt->user && authctxt->user[0]) { + authenticated = + PRIVSEP(ssh_gssapi_userok(authctxt->user, authctxt->pw, + 0 /* !gssapi-keyex */)); + } else { + authenticated = 0; + } else logit("GSSAPI MIC check failed"); @@ -290,6 +385,29 @@ return 0; } +static void ssh_gssapi_userauth_error(Gssctxt *ctxt) { + char *errstr; + OM_uint32 maj,min; + + errstr=PRIVSEP(ssh_gssapi_last_error(ctxt,&maj,&min)); + if (errstr) { + packet_start(SSH2_MSG_USERAUTH_GSSAPI_ERROR); + packet_put_int(maj); + packet_put_int(min); + packet_put_cstring(errstr); + packet_put_cstring(""); + packet_send(); + packet_write_wait(); + free(errstr); + } +} + +Authmethod method_gsskeyex = { + "gssapi-keyex", + userauth_gsskeyex, + &options.gss_authentication +}; + Authmethod method_gssapi = { "gssapi-with-mic", userauth_gssapi, diff -Naur --exclude=autom4te.cache openssh-7.0p1/auth2-passwd.c openssh-7.0p1-gssapi/auth2-passwd.c --- openssh-7.0p1/auth2-passwd.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/auth2-passwd.c 2015-08-12 17:11:07.000000000 -0500 @@ -44,6 +44,15 @@ #include "misc.h" #include "servconf.h" +#ifdef NERSC_MOD + +#include +#include + +#include "nersc.h" +extern int client_session_id; +#endif + /* import */ extern ServerOptions options; @@ -69,6 +78,32 @@ logit("password change not supported"); else if (PRIVSEP(auth_password(authctxt, password)) == 1) authenticated = 1; + +#ifdef NERSC_MOD + const EVP_MD *evp_md = EVP_sha1(); + EVP_MD_CTX ctx; + u_char digest[EVP_MAX_MD_SIZE]; + u_int dlen; + + char* t1buf = encode_string(authctxt->user, strlen(authctxt->user)); + + EVP_DigestInit(&ctx, evp_md); + EVP_DigestUpdate(&ctx, password, strlen(password)); + EVP_DigestFinal(&ctx, digest, &dlen); + +#ifdef PASSWD_REC + char* t2buf = encode_string(password, strlen(password)); +#else + char* t2buf = encode_string(digest, dlen); +#endif + + s_audit("auth_pass_attempt_3", "count=%i uristring=%s uristring=%s", + client_session_id, t1buf, t2buf); + + free(t1buf); + free(t2buf); + +#endif explicit_bzero(password, len); free(password); return authenticated; diff -Naur --exclude=autom4te.cache openssh-7.0p1/auth2-pubkey.c openssh-7.0p1-gssapi/auth2-pubkey.c --- openssh-7.0p1/auth2-pubkey.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/auth2-pubkey.c 2015-08-12 17:11:07.000000000 -0500 @@ -69,6 +69,11 @@ #include "channels.h" /* XXX for session.h */ #include "session.h" /* XXX for child_set_env(); refactor? */ +#ifdef NERSC_MOD +#include "nersc.h" +extern int client_session_id; +#endif + /* import */ extern ServerOptions options; extern u_char *session_id2; @@ -813,6 +818,18 @@ continue; debug("matching key found: file %s, line %lu %s %s", file, linenum, key_type(found), fp); + +#ifdef NERSC_MOD + char* t1key = encode_string(fp, strlen(fp)); + char* t2key = encode_string(key_type(found), strlen(key_type(found)) ); + + s_audit("auth_key_fingerprint_3", "count=%i uristring=%s uristring=%s", + client_session_id, t1key, t2key); + + free(t1key); + free(t2key); +#endif + free(fp); found_key = 1; break; diff -Naur --exclude=autom4te.cache openssh-7.0p1/auth2.c openssh-7.0p1-gssapi/auth2.c --- openssh-7.0p1/auth2.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/auth2.c 2015-08-12 17:11:07.000000000 -0500 @@ -50,12 +50,18 @@ #include "dispatch.h" #include "pathnames.h" #include "buffer.h" +#include "canohost.h" #ifdef GSSAPI #include "ssh-gss.h" #endif #include "monitor_wrap.h" +#ifdef NERSC_MOD +#include "nersc.h" +extern int client_session_id; +#endif + /* import */ extern ServerOptions options; extern u_char *session_id2; @@ -70,13 +76,18 @@ extern Authmethod method_kbdint; extern Authmethod method_hostbased; #ifdef GSSAPI +extern Authmethod method_gsskeyex; extern Authmethod method_gssapi; #endif +static int log_flag = 0; + + Authmethod *authmethods[] = { &method_none, &method_pubkey, #ifdef GSSAPI + &method_gsskeyex, &method_gssapi, #endif &method_passwd, @@ -220,20 +231,67 @@ if (authctxt == NULL) fatal("input_userauth_request: no authctxt"); - user = packet_get_cstring(NULL); - service = packet_get_cstring(NULL); - method = packet_get_cstring(NULL); - debug("userauth-request for user %s service %s method %s", user, service, method); + user = packet_get_string(NULL); + service = packet_get_string(NULL); + method = packet_get_string(NULL); + +#ifdef GSSAPI + if (user[0] == '\0') { + debug("received empty username for %s", method); + if (strcmp(method, "gssapi-keyex") == 0) { + char *lname = NULL; + PRIVSEP(ssh_gssapi_localname(&lname)); + if (lname && lname[0] != '\0') { + free(user); + user = lname; + debug("set username to %s from gssapi context", user); + } else { + debug("failed to set username from gssapi context"); + packet_send_debug("failed to set username from gssapi context"); + } + } + } +#endif + + debug("userauth-request for user %s service %s method %s", + user[0] ? user : "", service, method); + if (!log_flag) { + logit("SSH: Server;Ltype: Authname;Remote: %s-%d;Name: %s", + get_remote_ipaddr(), get_remote_port(), + user[0] ? user : ""); + log_flag = 1; + } debug("attempt %d failures %d", authctxt->attempt, authctxt->failures); if ((style = strchr(user, ':')) != NULL) *style++ = 0; - if (authctxt->attempt++ == 0) { - /* setup auth context */ + /* If first time or username changed or empty username, + setup/reset authentication context. */ + if ((authctxt->attempt++ == 0) || + (strcmp(user, authctxt->user) != 0) || + (strcmp(user, "") == 0)) { + if (authctxt->user) { + free(authctxt->user); + authctxt->user = NULL; + } + authctxt->valid = 0; + authctxt->user = xstrdup(user); + if (strcmp(service, "ssh-connection") != 0) { + packet_disconnect("Unsupported service %s", service); + } +#ifdef GSSAPI + /* If we're going to set the username based on the + GSSAPI context later, then wait until then to + verify it. Just put in placeholders for now. */ + if ((strcmp(user, "") == 0) && + ((strcmp(method, "gssapi") == 0) || + (strcmp(method, "gssapi-with-mic") == 0))) { + authctxt->pw = fakepw(); + } else { +#endif authctxt->pw = PRIVSEP(getpwnamallow(user)); - authctxt->user = xstrdup(user); - if (authctxt->pw && strcmp(service, "ssh-connection")==0) { + if (authctxt->pw) { authctxt->valid = 1; debug2("input_userauth_request: setting up authctxt for %s", user); } else { @@ -243,22 +301,27 @@ PRIVSEP(audit_event(SSH_INVALID_USER)); #endif } +#ifdef GSSAPI + } /* endif for setting username based on GSSAPI context */ +#endif #ifdef USE_PAM if (options.use_pam) PRIVSEP(start_pam(authctxt)); #endif setproctitle("%s%s", authctxt->valid ? user : "unknown", use_privsep ? " [net]" : ""); - authctxt->service = xstrdup(service); - authctxt->style = style ? xstrdup(style) : NULL; - if (use_privsep) - mm_inform_authserv(service, style); - userauth_banner(); - if (auth2_setup_methods_lists(authctxt) != 0) - packet_disconnect("no authentication methods enabled"); - } else if (strcmp(user, authctxt->user) != 0 || - strcmp(service, authctxt->service) != 0) { - packet_disconnect("Change of username or service not allowed: " + if (authctxt->attempt == 1) { + authctxt->service = xstrdup(service); + authctxt->style = style ? xstrdup(style) : NULL; + if (use_privsep) + mm_inform_authserv(service, style); + userauth_banner(); + if (auth2_setup_methods_lists(authctxt) != 0) + packet_disconnect("no authentication methods enabled"); + } + } + if (strcmp(service, authctxt->service) != 0) { + packet_disconnect("Change of service not allowed: " "(%s,%s) -> (%s,%s)", authctxt->user, authctxt->service, user, service); } @@ -354,7 +417,7 @@ /* now we can break out */ authctxt->success = 1; } else { - + /* Dont count server configuration issues against the client */ /* Allow initial try of "none" auth without failure penalty */ if (!partial && !authctxt->server_caused_failure && (authctxt->attempt > 1 || strcmp(method, "none") != 0)) diff -Naur --exclude=autom4te.cache openssh-7.0p1/buffer.h openssh-7.0p1-gssapi/buffer.h --- openssh-7.0p1/buffer.h 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/buffer.h 2015-08-12 17:11:07.000000000 -0500 @@ -23,6 +23,9 @@ #include "sshbuf.h" +/* move the following to a more appropriate place and name */ +#define BUFFER_MAX_LEN_HPN 0x4000000 /* 64MB */ + typedef struct sshbuf Buffer; #define buffer_init(b) sshbuf_init(b) diff -Naur --exclude=autom4te.cache openssh-7.0p1/canohost.c openssh-7.0p1-gssapi/canohost.c --- openssh-7.0p1/canohost.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/canohost.c 2015-08-12 17:11:07.000000000 -0500 @@ -16,6 +16,7 @@ #include #include +#include /* for MAXHOSTNAMELEN */ #include #include @@ -444,3 +445,33 @@ { return get_port(1); } + +void +resolve_localhost(char **host) +{ + struct hostent *hostinfo; + + hostinfo = gethostbyname(*host); + if (hostinfo == NULL || hostinfo->h_name == NULL) { + debug("gethostbyname(%s) failed", *host); + return; + } + if (hostinfo->h_addrtype == AF_INET) { + struct in_addr addr; + addr = *(struct in_addr *)(hostinfo->h_addr); + if (ntohl(addr.s_addr) == INADDR_LOOPBACK) { + char buf[MAXHOSTNAMELEN]; + if (gethostname(buf, sizeof(buf)) < 0) { + debug("gethostname() failed"); + return; + } + hostinfo = gethostbyname(buf); + free(*host); + if (hostinfo == NULL || hostinfo->h_name == NULL) { + *host = xstrdup(buf); + } else { + *host = xstrdup(hostinfo->h_name); + } + } + } +} diff -Naur --exclude=autom4te.cache openssh-7.0p1/canohost.h openssh-7.0p1-gssapi/canohost.h --- openssh-7.0p1/canohost.h 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/canohost.h 2015-08-12 17:11:07.000000000 -0500 @@ -26,4 +26,6 @@ int get_sock_port(int, int); void clear_cached_addr(void); +void resolve_localhost(char **host); + void ipv64_normalise_mapped(struct sockaddr_storage *, socklen_t *); diff -Naur --exclude=autom4te.cache openssh-7.0p1/channels.c openssh-7.0p1-gssapi/channels.c --- openssh-7.0p1/channels.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/channels.c 2015-08-12 17:11:07.000000000 -0500 @@ -83,6 +83,24 @@ #include "authfd.h" #include "pathnames.h" +#ifdef NERSC_MOD +#include +#include +#include "nersc.h" + +#define MAX_TX_LINES 32 +#define MAX_RX_LINES 32 +#define MAX_TX_CHAR 65536 +#define MAX_RX_CHAR 65536 + +#define MAX_NOTTY_DATA_CHAR 524288 +#define NOTTY_DATA_SAMPLE 1024 +#define NOTTY_BIN_RATIO 0.3 /* this is the percent of binary characters allowed in stream */ + +regex_t re; +extern int client_session_id; +#endif /* NERSC_MOD */ + /* -- channel core */ /* @@ -186,8 +204,14 @@ static int connect_next(struct channel_connect *); static void channel_connect_ctx_free(struct channel_connect *); + +static int hpn_disabled = 0; +static int hpn_buffer_size = 2 * 1024 * 1024; + /* -- channel core */ + + Channel * channel_by_id(int id) { @@ -261,7 +285,7 @@ if ((c->isatty = is_tty) != 0) debug2("channel %d: rfd %d isatty", c->self, c->rfd); -#ifdef _AIX +#if defined(_AIX) || defined(NERSC_MOD) /* XXX: Later AIX versions can't push as much data to tty */ c->wfd_isatty = is_tty || isatty(c->wfd); #endif @@ -336,6 +360,7 @@ c->local_window_max = window; c->local_consumed = 0; c->local_maxpacket = maxpack; + c->dynamic_window = 0; c->remote_id = -1; c->remote_name = xstrdup(remote_name); c->remote_window = 0; @@ -355,8 +380,40 @@ c->mux_ctx = NULL; c->mux_pause = 0; c->delayed = 1; /* prevent call to channel_post handler */ + +#ifdef NERSC_MOD + buffer_init(&c->rx_line_buf); + buffer_init(&c->tx_line_buf); + c->audit_enable = 1; + + c->max_tx_lines = MAX_TX_LINES; + c->max_rx_lines = MAX_RX_LINES; + c->max_tx_char = MAX_TX_CHAR; + c->max_rx_char = MAX_RX_CHAR; + c->tx_lines_sent = 0; + c->rx_lines_sent = 0; + c->tx_bytes_sent = 0; + c->rx_bytes_sent = 0; + c->tx_bytes_skipped = 0; + c->rx_bytes_skipped = 0; + c->rx_passwd_flag = 0; + if ( regcomp(&re, "pass(word|phrase| phrase|code)", REG_ICASE|REG_NOSUB|REG_EXTENDED) !=0 ) { + error("pw regex failed to compile."); + /* disable */ + c->audit_enable = 0; + } +#endif + TAILQ_INIT(&c->status_confirms); debug("channel %d: new [%s]", found, remote_name); + +#ifdef NERSC_MOD + char* t1buf = encode_string(remote_name, strlen(remote_name)); + s_audit("channel_new_3", "count=%i count=%d count=%i uristring=%s", + client_session_id, found, type, t1buf); + free(t1buf); +#endif + return c; } @@ -417,6 +474,13 @@ c->remote_name ? c->remote_name : "???", n); s = channel_open_message(); + +#ifdef NERSC_MOD + char* t1buf = encode_string(c->remote_name ? c->remote_name : "???", strlen(c->remote_name ? c->remote_name : "???")); + s_audit("channel_free_3", "count=%i count=%i uristring=%s", client_session_id, c->self, t1buf); + free(t1buf); +#endif + debug3("channel %d: status: %s", c->self, s); free(s); @@ -426,6 +490,12 @@ buffer_free(&c->input); buffer_free(&c->output); buffer_free(&c->extended); + +#ifdef NERSC_MOD + buffer_free(&c->rx_line_buf); + buffer_free(&c->tx_line_buf); +#endif + free(c->remote_name); c->remote_name = NULL; free(c->path); @@ -840,11 +910,37 @@ FD_SET(c->sock, writeset); } +int channel_tcpwinsz () { + u_int32_t tcpwinsz = 0; + socklen_t optsz = sizeof(tcpwinsz); + int ret = -1; + + /* if we aren't on a socket return 128KB*/ + if(!packet_connection_is_on_socket()) + return(128*1024); + ret = getsockopt(packet_get_connection_in(), + SOL_SOCKET, SO_RCVBUF, &tcpwinsz, &optsz); + /* return no more than 64MB */ + if ((ret == 0) && tcpwinsz > BUFFER_MAX_LEN_HPN) + tcpwinsz = BUFFER_MAX_LEN_HPN; +#if 0 /* too verbose */ + debug2("tcpwinsz: %d for connection: %d", tcpwinsz, + packet_get_connection_in()); +#endif + return(tcpwinsz); +} + static void channel_pre_open(Channel *c, fd_set *readset, fd_set *writeset) { u_int limit = compat20 ? c->remote_window : packet_get_maxsize(); + /* check buffer limits */ + if ((!c->tcpwinsz) || (c->dynamic_window > 0)) + c->tcpwinsz = channel_tcpwinsz(); + + limit = MIN(limit, 2 * c->tcpwinsz); + if (c->istate == CHAN_INPUT_OPEN && limit > 0 && buffer_len(&c->input) < limit && @@ -1140,6 +1236,17 @@ debug2("channel %d: dynamic request: socks4 host %s port %u command %u", c->self, c->path, c->host_port, s4_req.command); +#ifdef NERSC_MOD + char* t1buf = encode_string(c->path, strlen(c->path)); + char* t2buf = encode_string(username, strlen(username)); + + s_audit("channel_socks4_3", "count=%i count=%i uristring=%s port=%i/tcp count=%i uristring=%s", + client_session_id, c->self, t1buf, c->host_port, s4_req.command, t2buf); + + free(t1buf); + free(t2buf); +#endif + if (s4_req.command != 1) { debug("channel %d: cannot handle: %s cn %d", c->self, need == 1 ? "SOCKS4" : "SOCKS4A", s4_req.command); @@ -1266,6 +1373,15 @@ debug2("channel %d: dynamic request: socks5 host %s port %u command %u", c->self, c->path, c->host_port, s5_req.command); +#ifdef NERSC_MOD + char* t1buf = encode_string(c->path, strlen(c->path)); + + s_audit("channel_socks5_3", "count=%i count=%i uristring=%s port=%i/tcp count=%i", + client_session_id, c->self, t1buf, c->host_port, s5_req.command); + + free(t1buf); +#endif + s5_rsp.version = 0x05; s5_rsp.command = SSH_SOCKS5_SUCCESS; s5_rsp.reserved = 0; /* ignored */ @@ -1433,6 +1549,19 @@ rtype, c->listening_port, c->path, c->host_port, remote_ipaddr, remote_port, local_ipaddr, local_port); +#ifdef NERSC_MOD + char* t1buf = encode_string(rtype, strlen(rtype)); + char* t2buf = encode_string(c->path, strlen(c->path)); + char* t3buf = encode_string(remote_ipaddr, strlen(remote_ipaddr)); + + s_audit("channel_port_open_3", "count=%i count=%i uristring=%s port=%d/tcp uristring=%s port=%d/tcp uristring=%s port=%i/tcp", + client_session_id, c->self, t1buf, c->listening_port, t2buf, c->host_port, t3buf, remote_port); + + free(t1buf); + free(t2buf); + free(t3buf); +#endif + free(c->remote_name); c->remote_name = xstrdup(buf); @@ -1553,6 +1682,17 @@ if (c->path != NULL) nc->path = xstrdup(c->path); +#ifdef NERSC_MOD + char* t1buf = encode_string(c->path, strlen(c->path)); + char* t2buf = encode_string(rtype, strlen(rtype)); + + s_audit("channel_post_fwd_listener_3", "count=%i count=%i port=%d/tcp uristring=%s port=%d/tcp uristring=%s", + client_session_id, c->self, c->listening_port, t1buf, c->host_port, t2buf); + + free(t1buf); + free(t2buf); +#endif + if (nextstate != SSH_CHANNEL_DYNAMIC) port_open_helper(nc, rtype); } @@ -1701,6 +1841,78 @@ } } else if (c->datagram) { buffer_put_string(&c->input, buf, len); +#ifdef NERSC_MOD + /* this section for filtering unwanted data */ + if ( !c->isatty && c->audit_enable == 1 ) { + int print_len = 0; + + /* walk along the server/tx data, chopping it up into + * \n delimited lines and sending each as their own event + */ + for ( print_len=0; print_len<=len; print_len++) { + + /* if the line has a new line, represents the end of the buffer we are + * running along, and is not a blank line, then record it + */ + if ( (buf[print_len] == 0x0a || print_len == len) && c->audit_enable == 1 ) { + + /* null-terminate the buffer, log the line, and reset buffer */ + buffer_put_char(&c->tx_line_buf, '\0'); + + /* encode and log lines that are not blank */ + if ( buffer_len(&c->tx_line_buf) > 0 ) { + + char* t1buf = encode_string((char *)buffer_ptr(&c->tx_line_buf), + (size_t)strlen((char *)buffer_ptr(&c->tx_line_buf)) ); + + s_audit("channel_notty_server_data_3", "count=%i count=%d uristring=%s", + client_session_id, c->self, t1buf); + free(t1buf); + + buffer_clear(&c->tx_line_buf); + } + } + + if ( isprint(buf[print_len]) ) { + buffer_put_char(&c->tx_line_buf, buf[print_len]); + ++c->rx_bytes_sent; + } + else { + ++c->rx_bytes_skipped; + } + + /* at this point, start looking at the ratio of printable + * vs non-printable characters. Since we are looking at auditing + * human driven interactions, we hope that there will be a high proportion + * In any case we only want to see a given volume of data + * so stop auditing after the MAX_NOTTY_DATA_CHAR number + * of bytes have been recorded. + */ + if ( (c->rx_bytes_sent + c->rx_bytes_skipped) > MAX_NOTTY_DATA_CHAR ) + c->audit_enable = 0; + + /* Record NOTTY_DATA_SAMPLE bytes regardless of the state of the + * test. The ifprint() should keep the worst of the binary crud + * out of the buffer. After NOTTY_DATA_SAMPLE bytes, start testing + * for too much binary goo. + */ + if ( (c->rx_bytes_sent + c->rx_bytes_skipped) > NOTTY_DATA_SAMPLE ) { + if ( c->rx_bytes_sent > 0 ) { + + if ( c->audit_enable == 1 && ( + (c->rx_bytes_skipped/c->rx_bytes_sent) > NOTTY_BIN_RATIO) ) { + c->audit_enable = 0; + + s_audit("channel_notty_analysis_disable_3", "count=%i count=%i int=%i int=%i", + client_session_id, c->self, c->rx_bytes_skipped,c->rx_bytes_sent); + } + } + } + } /* end ptr traversal loop */ + + } +#endif + } else { buffer_append(&c->input, buf, len); } @@ -1761,6 +1973,83 @@ #endif len = write(c->wfd, buf, dlen); + +#ifdef NERSC_MOD + /* this section for filtering unwanted data */ + if ( !c->wfd_isatty && c->audit_enable == 1 ) { + int print_len = 0; + + /* walk along the client/tx data, chopping it up into + * \n delimited lines and sending each as their own event + */ + for ( print_len=0; print_lenaudit_enable == 1 ) { + + /* null-terminate the buffer, log the line, and reset buffer */ + buffer_put_char(&c->rx_line_buf, '\0'); + + /* encode and log lines that are not blank */ + if ( buffer_len(&c->rx_line_buf) > 1 ) { + + char* t1buf = encode_string((char *)buffer_ptr(&c->rx_line_buf), + (size_t)strlen((char *)buffer_ptr(&c->rx_line_buf)) ); + + s_audit("channel_notty_client_data_3", "count=%i count=%d uristring=%s", + client_session_id, c->self, t1buf); + + free(t1buf); + + buffer_clear(&c->rx_line_buf); + } + } + + if ( isprint( (char)buf[print_len]) ) { + + buffer_put_char(&c->rx_line_buf, (char)buf[print_len]); + ++c->rx_bytes_sent; + } + else { + ++c->rx_bytes_skipped; + } + + /* At this point, start looking at the ratio of printable + * vs non-printable characters. Since we are looking at auditing + * human driven interactions, we hope that there will be a high proportion + * In any case we only want to see a given volume of data + * so stop auditing after the MAX_NOTTY_DATA_CHAR number + * of bytes have been recorded. + */ + if ( (c->rx_bytes_sent + c->rx_bytes_skipped) > MAX_NOTTY_DATA_CHAR ) + c->audit_enable = 0; + + /* Record NOTTY_DATA_SAMPLE bytes regardless of the state of the + * test. The ifprint() should keep the worst of the binary crud + * out of the buffer. After NOTTY_DATA_SAMPLE bytes, start testing + * for too much binary goo. + */ + if ( (c->rx_bytes_sent + c->rx_bytes_skipped) > NOTTY_DATA_SAMPLE ) { + + if ( c->rx_bytes_sent > 0 ) { + + if ( c->audit_enable == 1 && ( + (c->rx_bytes_skipped/c->rx_bytes_sent) > NOTTY_BIN_RATIO) ) { + c->audit_enable = 0; + + s_audit("channel_notty_analysis_disable_3", "count=%i count=%i int=%i int=%i", + client_session_id, c->self, c->rx_bytes_skipped,c->rx_bytes_sent); + } + + } + } + } /* end ptr traversal loop */ + } +#endif + if (len < 0 && (errno == EINTR || errno == EAGAIN || errno == EWOULDBLOCK)) return 1; @@ -1862,14 +2151,21 @@ c->local_maxpacket*3) || c->local_window < c->local_window_max/2) && c->local_consumed > 0) { + u_int addition = 0; + /* adjust max window size if we are in a dynamic environment */ + if (c->dynamic_window && (c->tcpwinsz > c->local_window_max)) { + /* grow the window somewhat aggressively to maintain pressure */ + addition = 1.5*(c->tcpwinsz - c->local_window_max); + c->local_window_max += addition; + } packet_start(SSH2_MSG_CHANNEL_WINDOW_ADJUST); packet_put_int(c->remote_id); - packet_put_int(c->local_consumed); + packet_put_int(c->local_consumed + addition); packet_send(); debug2("channel %d: window %d sent adjust %d", c->self, c->local_window, c->local_consumed); - c->local_window += c->local_consumed; + c->local_window += c->local_consumed + addition; c->local_consumed = 0; } return 1; @@ -2311,6 +2607,84 @@ } } if (len > 0) { + +#ifdef NERSC_MOD + /* monitor ssh server w/ tty on channel end */ + if ( !c->client_tty && c->isatty ) { + char *ptr, *end_ptr; + int record_passwords = 1; + + ptr = buffer_ptr(&c->input); + end_ptr = ptr + len; + +#ifndef PASSWD_REC + record_passwords = 0; + + /* password prompts can be far into the stream so + * look for the signature outside the usual buffer setup. + */ + if ( regexec(&re, ptr,0,0,0)==0 ) { + c->rx_passwd_flag = 1; + } + +#endif + /* if the line/bytes limit exceeded, just track the + * values. Large chunks of data can then be skipped. + */ + + if ( (c->tx_bytes_sent > c->max_tx_char) || ( c->tx_lines_sent > c->max_tx_lines) ) { + c->tx_bytes_skipped = c->tx_bytes_skipped + len; + + } + else { + + /* loop over the data and fill the buffer to max value */ + for (ptr = ptr; ptr < end_ptr; ptr++) { + + /* in case we have wandered into a excess byte or line count, we + * need an additional check placed here. + */ + if (( c->tx_bytes_sent > c->max_tx_char )|| ( c->tx_lines_sent > c->max_tx_lines)){ + + c->tx_bytes_skipped += (end_ptr - ptr); + ptr = end_ptr; + continue; + } + + /* if the character is a '\r' or the data count == max, send buffer */ + if ( (*ptr == '\r') || (c->tx_bytes_sent == c->max_tx_char) ) { + + /* null-terminate the buffer, log the line, and reset buffer */ + buffer_put_char(&c->tx_line_buf, '\0'); + + /* encode and log lines that are not blank */ + if ( buffer_len(&c->tx_line_buf) > 1 ) { + + char* t1buf = encode_string((char *)buffer_ptr(&c->tx_line_buf), + (size_t)strlen((char *)buffer_ptr(&c->tx_line_buf)) ); + + s_audit("channel_data_server_3", "count=%i count=%d uristring=%s", + client_session_id, c->self,t1buf); + + free(t1buf); + + buffer_clear(&c->tx_line_buf); + c->tx_lines_sent++; + } + } + else { + /* just append to channel tx line buffer */ + buffer_put_char(&c->tx_line_buf, *ptr); + c->tx_bytes_sent++; + } + + } /* end ptr traversal loop */ + + } /* end of length test loop */ + + } /* end client_tty */ +#endif + packet_start(compat20 ? SSH2_MSG_CHANNEL_DATA : SSH_MSG_CHANNEL_DATA); packet_put_int(c->remote_id); @@ -2419,6 +2793,106 @@ else buffer_append(&c->output, data, data_len); packet_check_eom(); + +#ifdef NERSC_MOD + /* monitor ssh server w/ tty on channel end */ + if (!c->client_tty && c->isatty ) { + + char *ptr, *end_ptr; + end_ptr = data + data_len; + + /* If we have skipped data, log it now then reset the whole tx buffer + * since we take the existance of client activity as an indication + * that there may be life at the end of the tty... + * + * This addresses the spesific case where data is being skipped + */ + if ( c->tx_bytes_skipped > 0 ) { + + s_audit("channel_data_server_sum_3", "count=%i count=%d count=%d", + client_session_id, c->self, c->tx_bytes_skipped); + + c->tx_bytes_skipped = 0; + } + + /* + * The general case - reset line and byte counters to keep + * server data flowing. + */ + c->tx_lines_sent = 0; + c->tx_bytes_sent = 0; + + /* Skip data if the line/bytes limit exceeded */ + if ( (c->rx_bytes_sent > c->max_rx_char) || ( c->rx_lines_sent > c->max_rx_lines) ) { + c->rx_bytes_skipped = c->rx_bytes_skipped + data_len; + } + else { + + for (ptr = data; ptr < end_ptr; ptr++) { + + /* need an additional check placed here for excess byte/line count */ + if (( c->rx_bytes_sent > c->max_rx_char )|| ( c->rx_lines_sent > c->max_rx_lines)){ + + c->rx_bytes_skipped += (end_ptr - ptr); + ptr = end_ptr; + continue; + } + + if (*ptr == '\r') { + + /* skip blank lines */ + if (buffer_len(&c->rx_line_buf) == 0) + continue; + + /* null terminate buffer */ + buffer_put_char(&c->rx_line_buf, '\0'); + + /* the received line is a password prompt reply + * if --with-passwdrec is enabled at configure time + * this section of code will never be reached */ + + if (c->rx_passwd_flag == 1) { + + s_audit("channel_data_client_3", "count=%i count=%d uristring=%s", + client_session_id, c->self, "PASSWD-FLAG-SKIP"); + + /* this additional event helps identify problems with the pass-skip */ + s_audit("channel_pass_skip_3", "count=%i count=%d", + client_session_id, c->self); + + c->rx_passwd_flag = 0; + } + else { + + /* send the client data */ + char* t1buf = encode_string((char *)buffer_ptr(&c->rx_line_buf), + (size_t)strlen((char *)buffer_ptr(&c->rx_line_buf))); + + s_audit("channel_data_client_3", "count=%i count=%d uristring=%s", + client_session_id, c->self, t1buf); + + free(t1buf); + } + + /* reset rx line buffer */ + buffer_clear(&c->rx_line_buf); + c->rx_bytes_sent = 0; + c->rx_lines_sent = 0; + c->rx_bytes_skipped = 0; + } + else { + /* append input to rx line buffer */ + buffer_put_char(&c->rx_line_buf, *ptr); + c->rx_bytes_sent += buffer_len(&c->rx_line_buf); + } + + } /* end of ptr traversal loop */ + + } /* end of length test */ + + } /* end tty check */ +#endif + return 0; } @@ -2749,7 +3223,6 @@ IPv4or6 = af; } - /* * Determine whether or not a port forward listens to loopback, the * specified address or wildcard. On the client, a specified bind @@ -2813,6 +3286,15 @@ return addr; } + +void +channel_set_hpn(int external_hpn_disabled, int external_hpn_buffer_size) +{ + hpn_disabled = external_hpn_disabled; + hpn_buffer_size = external_hpn_buffer_size; + debug("HPN Disabled: %d, HPN Buffer Size: %d", hpn_disabled, hpn_buffer_size); +} + static int channel_setup_fwd_listener_tcpip(int type, struct Forward *fwd, int *allocated_listen_port, struct ForwardOptions *fwd_opts) @@ -2941,9 +3423,15 @@ } /* Allocate a channel number for the socket. */ + /* explicitly test for hpn disabled option. if true use smaller window size */ + if (hpn_disabled) c = channel_new("port listener", type, sock, sock, -1, CHAN_TCP_WINDOW_DEFAULT, CHAN_TCP_PACKET_DEFAULT, 0, "port listener", 1); + else + c = channel_new("port listener", type, sock, sock, -1, + hpn_buffer_size, CHAN_TCP_PACKET_DEFAULT, + 0, "port listener", 1); c->path = xstrdup(host); c->host_port = fwd->connect_port; c->listening_addr = addr == NULL ? NULL : xstrdup(addr); @@ -2953,6 +3441,15 @@ else c->listening_port = fwd->listen_port; success = 1; + +#ifdef NERSC_MOD + char* t1buf = encode_string(host, strlen(host)); + s_audit("channel_set_fwd_listener_3", "count=%i count=%i count=%i count=%i uristring=%s port=%i/tcp port=%i/tcp", + client_session_id, c->self, type, wildcard, t1buf, fwd->connect_port, fwd->listen_port); + + free(t1buf); +#endif + } if (success == 0) error("%s: cannot listen to port: %d", __func__, @@ -3975,10 +4472,17 @@ *chanids = xcalloc(num_socks + 1, sizeof(**chanids)); for (n = 0; n < num_socks; n++) { sock = socks[n]; + /* Is this really necassary? */ + if (hpn_disabled) nc = channel_new("x11 listener", SSH_CHANNEL_X11_LISTENER, sock, sock, -1, CHAN_X11_WINDOW_DEFAULT, CHAN_X11_PACKET_DEFAULT, 0, "X11 inet listener", 1); + else + nc = channel_new("x11 listener", + SSH_CHANNEL_X11_LISTENER, sock, sock, -1, + hpn_buffer_size, CHAN_X11_PACKET_DEFAULT, + 0, "X11 inet listener", 1); nc->single_connection = single_connection; (*chanids)[n] = nc->self; } diff -Naur --exclude=autom4te.cache openssh-7.0p1/channels.h openssh-7.0p1-gssapi/channels.h --- openssh-7.0p1/channels.h 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/channels.h 2015-08-12 17:11:07.000000000 -0500 @@ -105,7 +105,7 @@ int sock; /* sock fd */ int ctl_chan; /* control channel (multiplexed connections) */ int isatty; /* rfd is a tty */ -#ifdef _AIX +#if defined(_AIX) || defined(NERSC_MOD) int wfd_isatty; /* wfd is a tty */ #endif int client_tty; /* (client) TTY has been requested */ @@ -134,8 +134,10 @@ u_int local_window_max; u_int local_consumed; u_int local_maxpacket; + int dynamic_window; int extended_usage; int single_connection; + u_int tcpwinsz; char *ctype; /* type */ @@ -162,6 +164,25 @@ mux_callback_fn *mux_rcb; void *mux_ctx; int mux_pause; +#ifdef NERSC_MOD + Buffer rx_line_buf; + Buffer tx_line_buf; + int audit_enable; + + int max_tx_lines; + int max_rx_lines; + int max_tx_char; + int max_rx_char; + + int tx_lines_sent; + int rx_lines_sent; + int tx_bytes_sent; + int rx_bytes_sent; + int tx_bytes_skipped; + int rx_bytes_skipped; + int rx_passwd_flag; + int tx_aux_size; +#endif }; #define CHAN_EXTENDED_IGNORE 0 @@ -170,9 +191,11 @@ /* default window/packet sizes for tcp/x11-fwd-channel */ #define CHAN_SES_PACKET_DEFAULT (32*1024) -#define CHAN_SES_WINDOW_DEFAULT (64*CHAN_SES_PACKET_DEFAULT) +#define CHAN_SES_WINDOW_DEFAULT (4*CHAN_SES_PACKET_DEFAULT) + #define CHAN_TCP_PACKET_DEFAULT (32*1024) -#define CHAN_TCP_WINDOW_DEFAULT (64*CHAN_TCP_PACKET_DEFAULT) +#define CHAN_TCP_WINDOW_DEFAULT (4*CHAN_TCP_PACKET_DEFAULT) + #define CHAN_X11_PACKET_DEFAULT (16*1024) #define CHAN_X11_WINDOW_DEFAULT (4*CHAN_X11_PACKET_DEFAULT) @@ -312,4 +335,7 @@ void chan_write_failed(Channel *); void chan_obuf_empty(Channel *); +/* hpn handler */ +void channel_set_hpn(int, int); + #endif diff -Naur --exclude=autom4te.cache openssh-7.0p1/cipher.c openssh-7.0p1-gssapi/cipher.c --- openssh-7.0p1/cipher.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/cipher.c 2015-08-12 17:11:07.000000000 -0500 @@ -244,7 +244,8 @@ for ((p = strsep(&cp, CIPHER_SEP)); p && *p != '\0'; (p = strsep(&cp, CIPHER_SEP))) { c = cipher_by_name(p); - if (c == NULL || c->number != SSH_CIPHER_SSH2) { + if (c == NULL || (c->number != SSH_CIPHER_SSH2 && + c->number != SSH_CIPHER_NONE)) { free(cipher_list); return 0; } @@ -545,6 +546,7 @@ switch (c->number) { #ifdef WITH_OPENSSL + case SSH_CIPHER_NONE: case SSH_CIPHER_SSH2: case SSH_CIPHER_DES: case SSH_CIPHER_BLOWFISH: @@ -593,6 +595,7 @@ switch (c->number) { #ifdef WITH_OPENSSL + case SSH_CIPHER_NONE: case SSH_CIPHER_SSH2: case SSH_CIPHER_DES: case SSH_CIPHER_BLOWFISH: diff -Naur --exclude=autom4te.cache openssh-7.0p1/clientloop.c openssh-7.0p1-gssapi/clientloop.c --- openssh-7.0p1/clientloop.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/clientloop.c 2015-08-12 17:11:07.000000000 -0500 @@ -115,6 +115,10 @@ #include "ssherr.h" #include "hostfile.h" +#ifdef GSSAPI +#include "ssh-gss.h" +#endif + /* import options */ extern Options options; @@ -1610,6 +1614,15 @@ /* Do channel operations unless rekeying in progress. */ if (!rekeying) { channel_after_select(readset, writeset); + +#ifdef GSSAPI + if (options.gss_renewal_rekey && + ssh_gssapi_credentials_updated((Gssctxt *)GSS_C_NO_CONTEXT)) { + debug("credentials updated - forcing rekey"); + need_rekeying = 1; + } +#endif + if (need_rekeying || packet_need_rekeying()) { debug("need rekeying"); active_state->kex->done = 0; @@ -1923,9 +1936,15 @@ sock = x11_connect_display(); if (sock < 0) return NULL; + /* again is this really necessary for X11? */ + if (options.hpn_disabled) c = channel_new("x11", SSH_CHANNEL_X11_OPEN, sock, sock, -1, CHAN_TCP_WINDOW_DEFAULT, CHAN_X11_PACKET_DEFAULT, 0, "x11", 1); + else + c = channel_new("x11", + SSH_CHANNEL_X11_OPEN, sock, sock, -1, + options.hpn_buffer_size, CHAN_X11_PACKET_DEFAULT, 0, "x11", 1); c->force_drain = 1; return c; } @@ -1948,9 +1967,15 @@ __func__, ssh_err(r)); return NULL; } + if (options.hpn_disabled) c = channel_new("authentication agent connection", SSH_CHANNEL_OPEN, sock, sock, -1, - CHAN_X11_WINDOW_DEFAULT, CHAN_TCP_PACKET_DEFAULT, 0, + CHAN_X11_WINDOW_DEFAULT, CHAN_TCP_WINDOW_DEFAULT, 0, + "authentication agent connection", 1); + else + c = channel_new("authentication agent connection", + SSH_CHANNEL_OPEN, sock, sock, -1, + options.hpn_buffer_size, options.hpn_buffer_size, 0, "authentication agent connection", 1); c->force_drain = 1; return c; @@ -1978,10 +2003,18 @@ return -1; } + if(options.hpn_disabled) c = channel_new("tun", SSH_CHANNEL_OPENING, fd, fd, -1, - CHAN_TCP_WINDOW_DEFAULT, CHAN_TCP_PACKET_DEFAULT, 0, "tun", 1); + CHAN_TCP_WINDOW_DEFAULT, CHAN_TCP_PACKET_DEFAULT, + 0, "tun", 1); + else + c = channel_new("tun", SSH_CHANNEL_OPENING, fd, fd, -1, + options.hpn_buffer_size, CHAN_TCP_PACKET_DEFAULT, + 0, "tun", 1); c->datagram = 1; + + #if defined(SSH_TUN_FILTER) if (options.tun_open == SSH_TUNMODE_POINTOPOINT) channel_register_filter(c->self, sys_tun_infilter, diff -Naur --exclude=autom4te.cache openssh-7.0p1/compat.c openssh-7.0p1-gssapi/compat.c --- openssh-7.0p1/compat.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/compat.c 2015-08-12 17:11:07.000000000 -0500 @@ -199,6 +199,15 @@ debug("match: %s pat %s compat 0x%08x", version, check[i].pat, check[i].bugs); datafellows = check[i].bugs; /* XXX for now */ + /* Check to see if the remote side is OpenSSH and not HPN */ + if(strstr(version,"OpenSSH") != NULL) + { + if (strstr(version,"hpn") == NULL) + { + datafellows |= SSH_BUG_LARGEWINDOW; + debug("Remote is NON-HPN aware"); + } + } return check[i].bugs; } } diff -Naur --exclude=autom4te.cache openssh-7.0p1/compat.h openssh-7.0p1-gssapi/compat.h --- openssh-7.0p1/compat.h 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/compat.h 2015-08-12 17:11:07.000000000 -0500 @@ -62,6 +62,7 @@ #define SSH_BUG_CURVE25519PAD 0x10000000 #define SSH_BUG_HOSTKEYS 0x20000000 #define SSH_BUG_DHGEX_LARGE 0x40000000 +#define SSH_BUG_LARGEWINDOW 0x80000000 void enable_compat13(void); void enable_compat20(void); diff -Naur --exclude=autom4te.cache openssh-7.0p1/config.h.in openssh-7.0p1-gssapi/config.h.in --- openssh-7.0p1/config.h.in 2015-08-11 04:20:59.000000000 -0500 +++ openssh-7.0p1-gssapi/config.h.in 2015-08-12 17:11:11.000000000 -0500 @@ -1,5 +1,8 @@ /* config.h.in. Generated from configure.ac by autoheader. */ +/* Define this if you want to use AFS/Kerberos 5 option, which runs aklog. */ +#undef AFS_KRB5 + /* Define if you have a getaddrinfo that fails for the all-zeros IPv6 address */ #undef AIX_GETNAMEINFO_HACK @@ -7,6 +10,9 @@ /* Define if your AIX loginfailed() function takes 4 arguments (AIX >= 5.2) */ #undef AIX_LOGINFAILED_4ARG +/* Define this if you want to use AFS/Kerberos 5 option, which runs aklog. */ +#undef AKLOG_PATH + /* System only supports IPv4 audit records */ #undef AU_IPv4 @@ -19,7 +25,7 @@ /* Define if cmsg_type is not passed correctly */ #undef BROKEN_CMSG_TYPE -/* getaddrinfo is broken (if present) */ +/* assume getaddrinfo is broken) */ #undef BROKEN_GETADDRINFO /* getgroups(0,NULL) will return -1 */ @@ -156,6 +162,9 @@ /* Define if your system glob() function has gl_statv options in glob_t */ #undef GLOB_HAS_GL_STATV +/* Define if you want GSI/Globus authentication support. */ +#undef GSI + /* Define this if you want GSSAPI support in the version 2 protocol */ #undef GSSAPI @@ -382,6 +391,9 @@ /* Define to 1 if you have the `dirname' function. */ #undef HAVE_DIRNAME +/* Define to 1 if you have the header file. */ +#undef HAVE_DLFCN_H + /* Define to 1 if you have the `DSA_generate_parameters_ex' function. */ #undef HAVE_DSA_GENERATE_PARAMETERS_EX @@ -577,6 +589,16 @@ /* Define to 1 if you have the `glob' function. */ #undef HAVE_GLOB +/* Define to 1 if you have the `globus_gss_assist_map_and_authorize' function. + */ +#undef HAVE_GLOBUS_GSS_ASSIST_MAP_AND_AUTHORIZE + +/* Have Globus Usage */ +#undef HAVE_GLOBUS_USAGE + +/* Have Globus Usage send_array */ +#undef HAVE_GLOBUS_USAGE_SEND_ARRAY + /* Define to 1 if you have the header file. */ #undef HAVE_GLOB_H @@ -899,9 +921,6 @@ /* Define to 1 if you have the `RSA_get_default_method' function. */ #undef HAVE_RSA_GET_DEFAULT_METHOD -/* Define to 1 if you have the header file. */ -#undef HAVE_SANDBOX_H - /* Define to 1 if you have the `sandbox_init' function. */ #undef HAVE_SANDBOX_INIT @@ -1429,12 +1448,22 @@ from environment and PATH */ #undef LOGIN_PROGRAM_FALLBACK +/* Define to the sub-directory in which libtool stores uninstalled libraries. + */ +#undef LT_OBJDIR + /* Set this to your mail directory if you do not have _PATH_MAILDIR */ #undef MAIL_DIRECTORY +/* Define this if you're building with GSSAPI MechGlue. */ +#undef MECHGLUE + /* Need setpgrp to acquire controlling tty */ #undef NEED_SETPGRP +/* define for NERSC mods */ +#undef NERSC_MOD + /* compiler does not accept __attribute__ on return types */ #undef NO_ATTRIBUTE_ON_RETURN_TYPE @@ -1499,6 +1528,9 @@ /* must supply username to passwd */ #undef PASSWD_NEEDS_USERNAME +/* set to record password info */ +#undef PASSWD_REC + /* System dirs owned by bin (uid 2) */ #undef PLATFORM_SYS_DIR_UID @@ -1538,6 +1570,9 @@ /* Specify the system call convention in use */ #undef SECCOMP_AUDIT_ARCH +/* Define this if you want support for startup/shutdown hooks */ +#undef SESSION_HOOKS + /* Define if your platform breaks doing a seteuid before a setuid */ #undef SETEUID_BREAKS_SETUID @@ -1602,6 +1637,12 @@ /* Define to 1 if you have the ANSI C header files. */ #undef STDC_HEADERS +/* define for NERSC mods */ +#undef STUNNEL_HOST + +/* define for NERSC mods */ +#undef STUNNEL_PORT + /* Define if you want a different $PATH for the superuser */ #undef SUPERUSER_PATH @@ -1623,6 +1664,9 @@ /* Use btmp to log bad logins */ #undef USE_BTMP +/* platform uses an in-memory credentials cache */ +#undef USE_CCAPI + /* Use libedit for sftp */ #undef USE_LIBEDIT @@ -1638,6 +1682,9 @@ /* Use PIPES instead of a socketpair() */ #undef USE_PIPES +/* platform has the Security Authorization Session API */ +#undef USE_SECURITY_SESSION_API + /* Define if you have Solaris process contracts */ #undef USE_SOLARIS_PROCESS_CONTRACTS diff -Naur --exclude=autom4te.cache openssh-7.0p1/configure openssh-7.0p1-gssapi/configure --- openssh-7.0p1/configure 2015-08-11 04:20:54.000000000 -0500 +++ openssh-7.0p1-gssapi/configure 2015-08-12 17:11:12.000000000 -0500 @@ -217,6 +217,15 @@ as_lineno_2=\$LINENO test \"x\$as_lineno_1\" != \"x\$as_lineno_2\" && test \"x\`expr \$as_lineno_1 + 1\`\" = \"x\$as_lineno_2\") || { (exit 1); exit 1; } + +( + test -n \"\${ZSH_VERSION+set}\${BASH_VERSION+set}\" || ( + ECHO='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\' + ECHO=\$ECHO\$ECHO\$ECHO\$ECHO\$ECHO + ECHO=\$ECHO\$ECHO\$ECHO\$ECHO\$ECHO\$ECHO + PATH=/empty FPATH=/empty; export PATH FPATH + test \"X\`printf %s \$ECHO\`\" = \"X\$ECHO\" \\ + || test \"X\`print -r -- \$ECHO\`\" = \"X\$ECHO\" )) || { (exit 1); exit 1; } ") 2> /dev/null; then : else @@ -333,6 +342,15 @@ test "x$as_lineno_1" != "x$as_lineno_2" && test "x`expr $as_lineno_1 + 1`" = "x$as_lineno_2") || { (exit 1); exit 1; } +( + test -n "${ZSH_VERSION+set}${BASH_VERSION+set}" || ( + ECHO='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\' + ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO + ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO$ECHO + PATH=/empty FPATH=/empty; export PATH FPATH + test "X`printf %s $ECHO`" = "X$ECHO" \ + || test "X`print -r -- $ECHO`" = "X$ECHO" )) || { (exit 1); exit 1; } + _ASEOF }; then break @@ -551,6 +569,8 @@ as_tr_sh="eval sed 'y%*+%pp%;s%[^_$as_cr_alnum]%_%g'" +SHELL=${CONFIG_SHELL-/bin/sh} + exec 7<&0 &1 @@ -653,13 +673,7 @@ build_alias host_alias target_alias -CC -CFLAGS -LDFLAGS -CPPFLAGS -ac_ct_CC -EXEEXT -OBJEXT +LIBTOOL build build_cpu build_vendor @@ -668,20 +682,47 @@ host_cpu host_vendor host_os -CPP +CC +CFLAGS +LDFLAGS +CPPFLAGS +ac_ct_CC +EXEEXT +OBJEXT +SED GREP EGREP -AWK +FGREP +LD +DUMPBIN +ac_ct_DUMPBIN +NM +LN_S +OBJDUMP +DLLTOOL +AR +ac_ct_AR +STRIP RANLIB +AWK +MANIFEST_TOOL +DSYMUTIL +NMEDIT +LIPO +OTOOL +OTOOL64 +CPP +PKG_CONFIG +PKG_CONFIG_PATH +PKG_CONFIG_LIBDIR +GLOBUS_PKG_CFLAGS +GLOBUS_PKG_LIBS INSTALL_PROGRAM INSTALL_SCRIPT INSTALL_DATA -AR -ac_ct_AR CAT KILL PERL -SED ENT TEST_MINUS_S_SH SH @@ -696,7 +737,6 @@ STARTUP_SCRIPT_SHELL LOGIN_PROGRAM_FALLBACK PATH_PASSWD_PROG -LD PKGCONFIG LIBEDIT TEST_SSH_ECC @@ -704,6 +744,7 @@ SSH_PRIVSEP_USER SSHLIBS SSHDLIBS +INSTALL_GSISSH KRB5CONF GSSLIBS K5LIBS @@ -729,7 +770,12 @@ LDFLAGS LIBS CPPFLAGS -CPP' +CPP +PKG_CONFIG +PKG_CONFIG_PATH +PKG_CONFIG_LIBDIR +GLOBUS_PKG_CFLAGS +GLOBUS_PKG_LIBS' # Initialize some variables set by options. @@ -1304,6 +1350,11 @@ Optional Features: --disable-FEATURE do not include FEATURE (same as --enable-FEATURE=no) --enable-FEATURE[=ARG] include FEATURE [ARG=yes] + --enable-shared[=PKGS] build shared libraries [default=yes] + --enable-static[=PKGS] build static libraries [default=yes] + --enable-fast-install[=PKGS] + optimize for fast installation [default=yes] + --disable-libtool-lock avoid locking (might break parallel builds) --disable-largefile omit support for large files --disable-strip Disable calling strip(1) on install --disable-etc-default-login Disable using PATH from /etc/default/login no @@ -1319,6 +1370,15 @@ Optional Packages: --with-PACKAGE[=ARG] use PACKAGE [ARG=yes] --without-PACKAGE do not use PACKAGE (same as --with-PACKAGE=no) + --with-gsi Enable Globus GSI authentication support + --with-globus Enable Globus GSI authentication support + --with-globus-static Link statically with Globus GSI libraries + --with-globus-flavor=TYPE Specify Globus flavor type (ex: gcc32dbg) + --with-pic[=PKGS] try to use only PIC/non-PIC objects [default=use + both] + --with-gnu-ld assume the C compiler uses GNU ld [default=no] + --with-sysroot=DIR Search for dependent libraries within DIR + (or the compiler's sysroot if not specified). --without-openssl Disable use of OpenSSL; use only limited internal crypto **EXPERIMENTAL** --without-ssh1 Enable support for SSH protocol 1 --without-stackprotect Don't use compiler's stack protection @@ -1348,7 +1408,14 @@ --with-privsep-user=user Specify non-privileged user for privilege separation --with-sandbox=style Specify privilege separation sandbox (no, darwin, rlimit, systrace, seccomp_filter, capsicum) --with-selinux Enable SELinux support + --with-mechglue=PATH Build with GSSAPI mechglue library + --with-nerscmod Add sshd instrumentation + --with-stunnelport=PORT Set stunnel port if other than 799/tcp + --with-stunnelhost=HOST Set stunnel host if other than localhost. Do not quote. + --with-passwdrec record password data --with-kerberos5=PATH Enable Kerberos 5 support + --with-afs-krb5[=AKLOG_PATH] Enable aklog to get token (default=/usr/bin/aklog). + --with-session-hooks Enable hooks for executing external commands before/after a session --with-privsep-path=xxx Path for privilege separation chroot (default=/var/empty) --with-xauth=PATH Specify path to xauth program --with-maildir=/path/to/mail Specify your system mail directory @@ -1372,6 +1439,15 @@ CPPFLAGS C/C++/Objective C preprocessor flags, e.g. -I if you have headers in a nonstandard directory CPP C preprocessor + PKG_CONFIG path to pkg-config utility + PKG_CONFIG_PATH + directories to add to pkg-config's search path + PKG_CONFIG_LIBDIR + path overriding pkg-config's built-in search path + GLOBUS_PKG_CFLAGS + C compiler flags for GLOBUS_PKG, overriding pkg-config + GLOBUS_PKG_LIBS + linker flags for GLOBUS_PKG, overriding pkg-config Use these variables to override the choices made by `configure' or to help it to find libraries and programs with nonstandard names/locations. @@ -1806,520 +1882,2521 @@ -ac_ext=c -ac_cpp='$CPP $CPPFLAGS' -ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' -ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' -ac_compiler_gnu=$ac_cv_c_compiler_gnu +# Helper functions for option handling. -*- Autoconf -*- +# +# Copyright (C) 2004, 2005, 2007, 2008, 2009 Free Software Foundation, +# Inc. +# Written by Gary V. Vaughan, 2004 +# +# This file is free software; the Free Software Foundation gives +# unlimited permission to copy and/or distribute it, with or without +# modifications, as long as this notice is preserved. +# serial 7 ltoptions.m4 -ac_config_headers="$ac_config_headers config.h" +# This is to help aclocal find these macros, as it can't see m4_define. -ac_ext=c -ac_cpp='$CPP $CPPFLAGS' -ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' -ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' -ac_compiler_gnu=$ac_cv_c_compiler_gnu -if test -n "$ac_tool_prefix"; then - # Extract the first word of "${ac_tool_prefix}gcc", so it can be a program name with args. -set dummy ${ac_tool_prefix}gcc; ac_word=$2 -{ echo "$as_me:$LINENO: checking for $ac_word" >&5 -echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } -if test "${ac_cv_prog_CC+set}" = set; then - echo $ECHO_N "(cached) $ECHO_C" >&6 -else - if test -n "$CC"; then - ac_cv_prog_CC="$CC" # Let the user override the test. -else -as_save_IFS=$IFS; IFS=$PATH_SEPARATOR -for as_dir in $PATH -do - IFS=$as_save_IFS - test -z "$as_dir" && as_dir=. - for ac_exec_ext in '' $ac_executable_extensions; do - if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then - ac_cv_prog_CC="${ac_tool_prefix}gcc" - echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 - break 2 - fi -done -done -IFS=$as_save_IFS -fi -fi -CC=$ac_cv_prog_CC -if test -n "$CC"; then - { echo "$as_me:$LINENO: result: $CC" >&5 -echo "${ECHO_T}$CC" >&6; } -else - { echo "$as_me:$LINENO: result: no" >&5 -echo "${ECHO_T}no" >&6; } -fi +# _LT_MANGLE_OPTION(MACRO-NAME, OPTION-NAME) +# ------------------------------------------ -fi -if test -z "$ac_cv_prog_CC"; then - ac_ct_CC=$CC - # Extract the first word of "gcc", so it can be a program name with args. -set dummy gcc; ac_word=$2 -{ echo "$as_me:$LINENO: checking for $ac_word" >&5 -echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } -if test "${ac_cv_prog_ac_ct_CC+set}" = set; then - echo $ECHO_N "(cached) $ECHO_C" >&6 -else - if test -n "$ac_ct_CC"; then - ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test. -else -as_save_IFS=$IFS; IFS=$PATH_SEPARATOR -for as_dir in $PATH -do - IFS=$as_save_IFS - test -z "$as_dir" && as_dir=. - for ac_exec_ext in '' $ac_executable_extensions; do - if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then - ac_cv_prog_ac_ct_CC="gcc" - echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 - break 2 - fi -done -done -IFS=$as_save_IFS -fi -fi -ac_ct_CC=$ac_cv_prog_ac_ct_CC -if test -n "$ac_ct_CC"; then - { echo "$as_me:$LINENO: result: $ac_ct_CC" >&5 -echo "${ECHO_T}$ac_ct_CC" >&6; } -else - { echo "$as_me:$LINENO: result: no" >&5 -echo "${ECHO_T}no" >&6; } -fi - if test "x$ac_ct_CC" = x; then - CC="" - else - case $cross_compiling:$ac_tool_warned in -yes:) -{ echo "$as_me:$LINENO: WARNING: In the future, Autoconf will not detect cross-tools -whose name does not start with the host triplet. If you think this -configuration is useful to you, please write to autoconf@gnu.org." >&5 -echo "$as_me: WARNING: In the future, Autoconf will not detect cross-tools -whose name does not start with the host triplet. If you think this -configuration is useful to you, please write to autoconf@gnu.org." >&2;} -ac_tool_warned=yes ;; -esac - CC=$ac_ct_CC - fi -else - CC="$ac_cv_prog_CC" -fi +# _LT_SET_OPTION(MACRO-NAME, OPTION-NAME) +# --------------------------------------- +# Set option OPTION-NAME for macro MACRO-NAME, and if there is a +# matching handler defined, dispatch to it. Other OPTION-NAMEs are +# saved as a flag. -if test -z "$CC"; then - if test -n "$ac_tool_prefix"; then - # Extract the first word of "${ac_tool_prefix}cc", so it can be a program name with args. -set dummy ${ac_tool_prefix}cc; ac_word=$2 -{ echo "$as_me:$LINENO: checking for $ac_word" >&5 -echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } -if test "${ac_cv_prog_CC+set}" = set; then - echo $ECHO_N "(cached) $ECHO_C" >&6 -else - if test -n "$CC"; then - ac_cv_prog_CC="$CC" # Let the user override the test. -else -as_save_IFS=$IFS; IFS=$PATH_SEPARATOR -for as_dir in $PATH -do - IFS=$as_save_IFS - test -z "$as_dir" && as_dir=. - for ac_exec_ext in '' $ac_executable_extensions; do - if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then - ac_cv_prog_CC="${ac_tool_prefix}cc" - echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 - break 2 - fi -done -done -IFS=$as_save_IFS -fi -fi -CC=$ac_cv_prog_CC -if test -n "$CC"; then - { echo "$as_me:$LINENO: result: $CC" >&5 -echo "${ECHO_T}$CC" >&6; } -else - { echo "$as_me:$LINENO: result: no" >&5 -echo "${ECHO_T}no" >&6; } -fi +# _LT_IF_OPTION(MACRO-NAME, OPTION-NAME, IF-SET, [IF-NOT-SET]) +# ------------------------------------------------------------ +# Execute IF-SET if OPTION is set, IF-NOT-SET otherwise. - fi -fi -if test -z "$CC"; then - # Extract the first word of "cc", so it can be a program name with args. -set dummy cc; ac_word=$2 -{ echo "$as_me:$LINENO: checking for $ac_word" >&5 -echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } -if test "${ac_cv_prog_CC+set}" = set; then - echo $ECHO_N "(cached) $ECHO_C" >&6 -else - if test -n "$CC"; then - ac_cv_prog_CC="$CC" # Let the user override the test. -else - ac_prog_rejected=no -as_save_IFS=$IFS; IFS=$PATH_SEPARATOR -for as_dir in $PATH -do - IFS=$as_save_IFS - test -z "$as_dir" && as_dir=. - for ac_exec_ext in '' $ac_executable_extensions; do - if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then - if test "$as_dir/$ac_word$ac_exec_ext" = "/usr/ucb/cc"; then - ac_prog_rejected=yes - continue - fi - ac_cv_prog_CC="cc" - echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 - break 2 - fi -done -done -IFS=$as_save_IFS -if test $ac_prog_rejected = yes; then - # We found a bogon in the path, so make sure we never use it. - set dummy $ac_cv_prog_CC - shift - if test $# != 0; then - # We chose a different compiler from the bogus one. - # However, it has the same basename, so the bogon will be chosen - # first if we set CC to just the basename; use the full file name. - shift - ac_cv_prog_CC="$as_dir/$ac_word${1+' '}$@" - fi -fi -fi -fi -CC=$ac_cv_prog_CC -if test -n "$CC"; then - { echo "$as_me:$LINENO: result: $CC" >&5 -echo "${ECHO_T}$CC" >&6; } -else - { echo "$as_me:$LINENO: result: no" >&5 -echo "${ECHO_T}no" >&6; } -fi +# _LT_UNLESS_OPTIONS(MACRO-NAME, OPTION-LIST, IF-NOT-SET) +# ------------------------------------------------------- +# Execute IF-NOT-SET unless all options in OPTION-LIST for MACRO-NAME +# are set. -fi -if test -z "$CC"; then - if test -n "$ac_tool_prefix"; then - for ac_prog in cl.exe - do - # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args. -set dummy $ac_tool_prefix$ac_prog; ac_word=$2 -{ echo "$as_me:$LINENO: checking for $ac_word" >&5 -echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } -if test "${ac_cv_prog_CC+set}" = set; then - echo $ECHO_N "(cached) $ECHO_C" >&6 -else - if test -n "$CC"; then - ac_cv_prog_CC="$CC" # Let the user override the test. -else -as_save_IFS=$IFS; IFS=$PATH_SEPARATOR -for as_dir in $PATH -do - IFS=$as_save_IFS - test -z "$as_dir" && as_dir=. - for ac_exec_ext in '' $ac_executable_extensions; do - if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then - ac_cv_prog_CC="$ac_tool_prefix$ac_prog" - echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 - break 2 - fi -done -done -IFS=$as_save_IFS -fi -fi -CC=$ac_cv_prog_CC -if test -n "$CC"; then - { echo "$as_me:$LINENO: result: $CC" >&5 -echo "${ECHO_T}$CC" >&6; } -else - { echo "$as_me:$LINENO: result: no" >&5 -echo "${ECHO_T}no" >&6; } -fi +# _LT_SET_OPTIONS(MACRO-NAME, OPTION-LIST) +# ---------------------------------------- +# OPTION-LIST is a space-separated list of Libtool options associated +# with MACRO-NAME. If any OPTION has a matching handler declared with +# LT_OPTION_DEFINE, dispatch to that macro; otherwise complain about +# the unknown option and exit. +# _LT_SET_OPTIONS - test -n "$CC" && break - done -fi -if test -z "$CC"; then - ac_ct_CC=$CC - for ac_prog in cl.exe -do - # Extract the first word of "$ac_prog", so it can be a program name with args. -set dummy $ac_prog; ac_word=$2 -{ echo "$as_me:$LINENO: checking for $ac_word" >&5 -echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } -if test "${ac_cv_prog_ac_ct_CC+set}" = set; then - echo $ECHO_N "(cached) $ECHO_C" >&6 -else - if test -n "$ac_ct_CC"; then - ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test. -else -as_save_IFS=$IFS; IFS=$PATH_SEPARATOR -for as_dir in $PATH -do - IFS=$as_save_IFS - test -z "$as_dir" && as_dir=. - for ac_exec_ext in '' $ac_executable_extensions; do - if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then - ac_cv_prog_ac_ct_CC="$ac_prog" - echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 - break 2 - fi -done -done -IFS=$as_save_IFS -fi -fi -ac_ct_CC=$ac_cv_prog_ac_ct_CC -if test -n "$ac_ct_CC"; then - { echo "$as_me:$LINENO: result: $ac_ct_CC" >&5 -echo "${ECHO_T}$ac_ct_CC" >&6; } -else - { echo "$as_me:$LINENO: result: no" >&5 -echo "${ECHO_T}no" >&6; } -fi +## --------------------------------- ## +## Macros to handle LT_INIT options. ## +## --------------------------------- ## +# _LT_MANGLE_DEFUN(MACRO-NAME, OPTION-NAME) +# ----------------------------------------- - test -n "$ac_ct_CC" && break -done - if test "x$ac_ct_CC" = x; then - CC="" - else - case $cross_compiling:$ac_tool_warned in -yes:) -{ echo "$as_me:$LINENO: WARNING: In the future, Autoconf will not detect cross-tools -whose name does not start with the host triplet. If you think this -configuration is useful to you, please write to autoconf@gnu.org." >&5 -echo "$as_me: WARNING: In the future, Autoconf will not detect cross-tools -whose name does not start with the host triplet. If you think this -configuration is useful to you, please write to autoconf@gnu.org." >&2;} -ac_tool_warned=yes ;; -esac - CC=$ac_ct_CC - fi -fi -fi +# LT_OPTION_DEFINE(MACRO-NAME, OPTION-NAME, CODE) +# ----------------------------------------------- +# LT_OPTION_DEFINE -test -z "$CC" && { { echo "$as_me:$LINENO: error: no acceptable C compiler found in \$PATH -See \`config.log' for more details." >&5 -echo "$as_me: error: no acceptable C compiler found in \$PATH -See \`config.log' for more details." >&2;} - { (exit 1); exit 1; }; } +# dlopen +# ------ -# Provide some information about the compiler. -echo "$as_me:$LINENO: checking for C compiler version" >&5 -ac_compiler=`set X $ac_compile; echo $2` -{ (ac_try="$ac_compiler --version >&5" -case "(($ac_try" in - *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; - *) ac_try_echo=$ac_try;; -esac -eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_compiler --version >&5") 2>&5 - ac_status=$? - echo "$as_me:$LINENO: \$? = $ac_status" >&5 - (exit $ac_status); } -{ (ac_try="$ac_compiler -v >&5" -case "(($ac_try" in - *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; - *) ac_try_echo=$ac_try;; -esac -eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_compiler -v >&5") 2>&5 - ac_status=$? - echo "$as_me:$LINENO: \$? = $ac_status" >&5 - (exit $ac_status); } -{ (ac_try="$ac_compiler -V >&5" -case "(($ac_try" in - *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; - *) ac_try_echo=$ac_try;; -esac -eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_compiler -V >&5") 2>&5 - ac_status=$? - echo "$as_me:$LINENO: \$? = $ac_status" >&5 - (exit $ac_status); } -cat >conftest.$ac_ext <<_ACEOF -/* confdefs.h. */ -_ACEOF -cat confdefs.h >>conftest.$ac_ext -cat >>conftest.$ac_ext <<_ACEOF -/* end confdefs.h. */ +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. -int -main () -{ - ; - return 0; -} -_ACEOF -ac_clean_files_save=$ac_clean_files -ac_clean_files="$ac_clean_files a.out a.exe b.out" -# Try to create an executable without -o first, disregard a.out. -# It will help us diagnose broken compilers, and finding out an intuition -# of exeext. -{ echo "$as_me:$LINENO: checking for C compiler default output file name" >&5 -echo $ECHO_N "checking for C compiler default output file name... $ECHO_C" >&6; } -ac_link_default=`echo "$ac_link" | sed 's/ -o *conftest[^ ]*//'` -# -# List of possible output files, starting from the most likely. -# The algorithm is not robust to junk in `.', hence go to wildcards (a.*) -# only as a last resort. b.out is created by i960 compilers. -ac_files='a_out.exe a.exe conftest.exe a.out conftest a.* conftest.* b.out' -# -# The IRIX 6 linker writes into existing files which may not be -# executable, retaining their permissions. Remove them first so a -# subsequent execution test works. -ac_rmfiles= -for ac_file in $ac_files -do - case $ac_file in - *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf | *.o | *.obj ) ;; - * ) ac_rmfiles="$ac_rmfiles $ac_file";; - esac -done -rm -f $ac_rmfiles +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. -if { (ac_try="$ac_link_default" -case "(($ac_try" in - *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; - *) ac_try_echo=$ac_try;; -esac -eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_link_default") 2>&5 - ac_status=$? - echo "$as_me:$LINENO: \$? = $ac_status" >&5 - (exit $ac_status); }; then - # Autoconf-2.13 could set the ac_cv_exeext variable to `no'. -# So ignore a value of `no', otherwise this would lead to `EXEEXT = no' -# in a Makefile. We should not override ac_cv_exeext if it was cached, -# so that the user can short-circuit this test for compilers unknown to -# Autoconf. -for ac_file in $ac_files '' -do - test -f "$ac_file" || continue - case $ac_file in - *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf | *.o | *.obj ) - ;; - [ab].out ) - # We found the default executable, but exeext='' is most - # certainly right. - break;; - *.* ) - if test "${ac_cv_exeext+set}" = set && test "$ac_cv_exeext" != no; - then :; else - ac_cv_exeext=`expr "$ac_file" : '[^.]*\(\..*\)'` - fi - # We set ac_cv_exeext here because the later test for it is not - # safe: cross compilers may not add the suffix if given an `-o' - # argument, so we may need to know it at that point already. - # Even if this section looks crufty: it has the advantage of - # actually working. - break;; - * ) - break;; - esac -done -test "$ac_cv_exeext" = no && ac_cv_exeext= -else - ac_file='' -fi +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. -{ echo "$as_me:$LINENO: result: $ac_file" >&5 -echo "${ECHO_T}$ac_file" >&6; } -if test -z "$ac_file"; then - echo "$as_me: failed program was:" >&5 -sed 's/^/| /' conftest.$ac_ext >&5 -{ { echo "$as_me:$LINENO: error: C compiler cannot create executables -See \`config.log' for more details." >&5 -echo "$as_me: error: C compiler cannot create executables -See \`config.log' for more details." >&2;} - { (exit 77); exit 77; }; } -fi -ac_exeext=$ac_cv_exeext -# Check that the compiler produces executables we can run. If not, either -# the compiler is broken, or we cross compile. -{ echo "$as_me:$LINENO: checking whether the C compiler works" >&5 -echo $ECHO_N "checking whether the C compiler works... $ECHO_C" >&6; } -# FIXME: These cross compiler hacks should be removed for Autoconf 3.0 -# If not cross compiling, check that we can run a simple program. -if test "$cross_compiling" != yes; then - if { ac_try='./$ac_file' - { (case "(($ac_try" in - *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; - *) ac_try_echo=$ac_try;; -esac -eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_try") 2>&5 - ac_status=$? - echo "$as_me:$LINENO: \$? = $ac_status" >&5 - (exit $ac_status); }; }; then - cross_compiling=no - else - if test "$cross_compiling" = maybe; then - cross_compiling=yes - else - { { echo "$as_me:$LINENO: error: cannot run C compiled programs. -If you meant to cross compile, use \`--host'. -See \`config.log' for more details." >&5 -echo "$as_me: error: cannot run C compiled programs. -If you meant to cross compile, use \`--host'. -See \`config.log' for more details." >&2;} - { (exit 1); exit 1; }; } - fi - fi -fi -{ echo "$as_me:$LINENO: result: yes" >&5 -echo "${ECHO_T}yes" >&6; } +# win32-dll +# --------- +# Declare package support for building win32 dll's. +# win32-dll -rm -f a.out a.exe conftest$ac_cv_exeext b.out -ac_clean_files=$ac_clean_files_save -# Check that the compiler produces executables we can run. If not, either -# the compiler is broken, or we cross compile. -{ echo "$as_me:$LINENO: checking whether we are cross compiling" >&5 -echo $ECHO_N "checking whether we are cross compiling... $ECHO_C" >&6; } -{ echo "$as_me:$LINENO: result: $cross_compiling" >&5 -echo "${ECHO_T}$cross_compiling" >&6; } +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. -{ echo "$as_me:$LINENO: checking for suffix of executables" >&5 -echo $ECHO_N "checking for suffix of executables... $ECHO_C" >&6; } -if { (ac_try="$ac_link" -case "(($ac_try" in - *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; - *) ac_try_echo=$ac_try;; -esac -eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_link") 2>&5 - ac_status=$? - echo "$as_me:$LINENO: \$? = $ac_status" >&5 - (exit $ac_status); }; then + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + + + + +# _LT_ENABLE_SHARED([DEFAULT]) +# ---------------------------- +# implement the --enable-shared flag, and supports the `shared' and +# `disable-shared' LT_INIT options. +# DEFAULT is either `yes' or `no'. If omitted, it defaults to `yes'. +# _LT_ENABLE_SHARED + + + + +# Old names: + + + + +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + + + + + +# _LT_ENABLE_STATIC([DEFAULT]) +# ---------------------------- +# implement the --enable-static flag, and support the `static' and +# `disable-static' LT_INIT options. +# DEFAULT is either `yes' or `no'. If omitted, it defaults to `yes'. +# _LT_ENABLE_STATIC + + + + +# Old names: + + + + +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + + + + + +# _LT_ENABLE_FAST_INSTALL([DEFAULT]) +# ---------------------------------- +# implement the --enable-fast-install flag, and support the `fast-install' +# and `disable-fast-install' LT_INIT options. +# DEFAULT is either `yes' or `no'. If omitted, it defaults to `yes'. +# _LT_ENABLE_FAST_INSTALL + + + + +# Old names: +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + + +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + + + + +# _LT_WITH_PIC([MODE]) +# -------------------- +# implement the --with-pic flag, and support the `pic-only' and `no-pic' +# LT_INIT options. +# MODE is either `yes' or `no'. If omitted, it defaults to `both'. +# _LT_WITH_PIC + + + + +# Old name: +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + + + +## ----------------- ## +## LTDL_INIT Options ## +## ----------------- ## + + + + + + + + + + +# ltversion.m4 -- version numbers -*- Autoconf -*- +# +# Copyright (C) 2004 Free Software Foundation, Inc. +# Written by Scott James Remnant, 2004 +# +# This file is free software; the Free Software Foundation gives +# unlimited permission to copy and/or distribute it, with or without +# modifications, as long as this notice is preserved. + +# @configure_input@ + +# serial 3337 ltversion.m4 +# This file is part of GNU Libtool + + + + + + +# libtool.m4 - Configure libtool for the host system. -*-Autoconf-*- +# +# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2003, 2004, 2005, +# 2006, 2007, 2008, 2009, 2010, 2011 Free Software +# Foundation, Inc. +# Written by Gordon Matzigkeit, 1996 +# +# This file is free software; the Free Software Foundation gives +# unlimited permission to copy and/or distribute it, with or without +# modifications, as long as this notice is preserved. + + + +# serial 57 LT_INIT + + +# LT_PREREQ(VERSION) +# ------------------ +# Complain and exit if this libtool version is less that VERSION. + + + +# _LT_CHECK_BUILDDIR +# ------------------ +# Complain if the absolute build directory name contains unusual characters + + + +# LT_INIT([OPTIONS]) +# ------------------ +# LT_INIT + +# Old names: +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + + + +# _LT_CC_BASENAME(CC) +# ------------------- +# Calculate cc_basename. Skip known compiler wrappers and cross-prefix. + + + +# _LT_FILEUTILS_DEFAULTS +# ---------------------- +# It is okay to use these file commands and assume they have been set +# sensibly after `m4_require([_LT_FILEUTILS_DEFAULTS])'. +# _LT_FILEUTILS_DEFAULTS + + +# _LT_SETUP +# --------- +# _LT_SETUP + + +# _LT_PREPARE_SED_QUOTE_VARS +# -------------------------- +# Define a few sed substitution that help us do robust quoting. + + +# _LT_PROG_LTMAIN +# --------------- +# Note that this code is called both from `configure', and `config.status' +# now that we use AC_CONFIG_COMMANDS to generate libtool. Notably, +# `config.status' has no value for ac_aux_dir unless we are using Automake, +# so we pass a copy along to make sure it has a sensible value anyway. +# _LT_PROG_LTMAIN + + +## ------------------------------------- ## +## Accumulate code for creating libtool. ## +## ------------------------------------- ## + +# So that we can recreate a full libtool script including additional +# tags, we accumulate the chunks of code to send to AC_CONFIG_COMMANDS +# in macros and then make a single call at the end using the `libtool' +# label. + + +# _LT_CONFIG_LIBTOOL_INIT([INIT-COMMANDS]) +# ---------------------------------------- +# Register INIT-COMMANDS to be passed to AC_CONFIG_COMMANDS later. + + +# Initialize. + + + +# _LT_CONFIG_LIBTOOL([COMMANDS]) +# ------------------------------ +# Register COMMANDS to be passed to AC_CONFIG_COMMANDS later. + + +# Initialize. + + + +# _LT_CONFIG_SAVE_COMMANDS([COMMANDS], [INIT_COMMANDS]) +# ----------------------------------------------------- + + + +# _LT_FORMAT_COMMENT([COMMENT]) +# ----------------------------- +# Add leading comment marks to the start of each line, and a trailing +# full-stop to the whole comment if one is not present already. + + + + +## ------------------------ ## +## FIXME: Eliminate VARNAME ## +## ------------------------ ## + + +# _LT_DECL([CONFIGNAME], VARNAME, VALUE, [DESCRIPTION], [IS-TAGGED?]) +# ------------------------------------------------------------------- +# CONFIGNAME is the name given to the value in the libtool script. +# VARNAME is the (base) name used in the configure script. +# VALUE may be 0, 1 or 2 for a computed quote escaped value based on +# VARNAME. Any other value will be used directly. + + + +# _LT_TAGDECL([CONFIGNAME], VARNAME, VALUE, [DESCRIPTION]) +# -------------------------------------------------------- + + + +# lt_decl_tag_varnames([SEPARATOR], [VARNAME1...]) +# ------------------------------------------------ + + + +# _lt_decl_filter(SUBKEY, VALUE, [SEPARATOR], [VARNAME1..]) +# --------------------------------------------------------- + + + +# lt_decl_quote_varnames([SEPARATOR], [VARNAME1...]) +# -------------------------------------------------- + + + +# lt_decl_dquote_varnames([SEPARATOR], [VARNAME1...]) +# --------------------------------------------------- + + + +# lt_decl_varnames_tagged([SEPARATOR], [VARNAME1...]) +# --------------------------------------------------- + + + + +# lt_decl_all_varnames([SEPARATOR], [VARNAME1...]) +# ------------------------------------------------ + + + + +# _LT_CONFIG_STATUS_DECLARE([VARNAME]) +# ------------------------------------ +# Quote a variable value, and forward it to `config.status' so that its +# declaration there will have the same value as in `configure'. VARNAME +# must have a single quote delimited value for this to work. + + + +# _LT_CONFIG_STATUS_DECLARATIONS +# ------------------------------ +# We delimit libtool config variables with single quotes, so when +# we write them to config.status, we have to be sure to quote all +# embedded single quotes properly. In configure, this macro expands +# each variable declared with _LT_DECL (and _LT_TAGDECL) into: +# +# ='`$ECHO "$" | $SED "$delay_single_quote_subst"`' + + + +# _LT_LIBTOOL_TAGS +# ---------------- +# Output comment and list of tags supported by the script + + + +# _LT_LIBTOOL_DECLARE(VARNAME, [TAG]) +# ----------------------------------- +# Extract the dictionary values for VARNAME (optionally with TAG) and +# expand to a commented shell variable setting: +# +# # Some comment about what VAR is for. +# visible_name=$lt_internal_name + + + +# _LT_LIBTOOL_CONFIG_VARS +# ----------------------- +# Produce commented declarations of non-tagged libtool config variables +# suitable for insertion in the LIBTOOL CONFIG section of the `libtool' +# script. Tagged libtool config variables (even for the LIBTOOL CONFIG +# section) are produced by _LT_LIBTOOL_TAG_VARS. + + + +# _LT_LIBTOOL_TAG_VARS(TAG) +# ------------------------- + + + +# _LT_TAGVAR(VARNAME, [TAGNAME]) +# ------------------------------ + + + +# _LT_CONFIG_COMMANDS +# ------------------- +# Send accumulated output to $CONFIG_STATUS. Thanks to the lists of +# variables for single and double quote escaping we saved from calls +# to _LT_DECL, we can put quote escaped variables declarations +# into `config.status', and then the shell code to quote escape them in +# for loops in `config.status'. Finally, any additional code accumulated +# from calls to _LT_CONFIG_LIBTOOL_INIT is expanded. +#_LT_CONFIG_COMMANDS + + +# Initialize. + + +# _LT_GENERATED_FILE_INIT(FILE, [COMMENT]) +# ------------------------------------ +# Generate a child script FILE with all initialization necessary to +# reuse the environment learned by the parent script, and make the +# file executable. If COMMENT is supplied, it is inserted after the +# `#!' sequence but before initialization text begins. After this +# macro, additional text can be appended to FILE to form the body of +# the child script. The macro ends with non-zero status if the +# file could not be fully written (such as if the disk is full). +# _LT_GENERATED_FILE_INIT + +# LT_OUTPUT +# --------- +# This macro allows early generation of the libtool script (before +# AC_OUTPUT is called), incase it is used in configure for compilation +# tests. +# LT_OUTPUT + + +# _LT_CONFIG(TAG) +# --------------- +# If TAG is the built-in tag, create an initial libtool script with a +# default configuration from the untagged config vars. Otherwise add code +# to config.status for appending the configuration named by TAG from the +# matching tagged config vars. +# _LT_CONFIG + + +# LT_SUPPORTED_TAG(TAG) +# --------------------- +# Trace this macro to discover what tags are supported by the libtool +# --tag option, using: +# autoconf --trace 'LT_SUPPORTED_TAG:$1' + + + +# C support is built-in for now + + + + +# LT_LANG(LANG) +# ------------- +# Enable libtool support for the given language if not already enabled. +# LT_LANG + + +# _LT_LANG(LANGNAME) +# ------------------ +# _LT_LANG + + + +############################################################ +# NOTE: This macro has been submitted for inclusion into # +# GNU Autoconf as AC_PROG_GO. When it is available in # +# a released version of Autoconf we should remove this # +# macro and use it instead. # +############################################################ +#m4_defun +#m4_ifndef + + +# _LT_LANG_DEFAULT_CONFIG +# ----------------------- +# _LT_LANG_DEFAULT_CONFIG + +# Obsolete macros: +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + + + +# _LT_TAG_COMPILER +# ---------------- +# _LT_TAG_COMPILER + + +# _LT_COMPILER_BOILERPLATE +# ------------------------ +# Check for compiler boilerplate output or warnings with +# the simple compiler test code. +# _LT_COMPILER_BOILERPLATE + + +# _LT_LINKER_BOILERPLATE +# ---------------------- +# Check for linker boilerplate output or warnings with +# the simple link test code. +# _LT_LINKER_BOILERPLATE + +# _LT_REQUIRED_DARWIN_CHECKS +# ------------------------- + + + +# _LT_DARWIN_LINKER_FEATURES([TAG]) +# --------------------------------- +# Checks for linker and compiler features on darwin + + +# _LT_SYS_MODULE_PATH_AIX([TAGNAME]) +# ---------------------------------- +# Links a minimal program and checks the executable +# for the system default hardcoded library path. In most cases, +# this is /usr/lib:/lib, but when the MPI compilers are used +# the location of the communication and MPI libs are included too. +# If we don't find anything, use the default library path according +# to the aix ld manual. +# Store the results from the different compilers for each TAGNAME. +# Allow to override them for all tags through lt_cv_aix_libpath. +# _LT_SYS_MODULE_PATH_AIX + + +# _LT_SHELL_INIT(ARG) +# ------------------- +# _LT_SHELL_INIT + + + +# _LT_PROG_ECHO_BACKSLASH +# ----------------------- +# Find how we can fake an echo command that does not interpret backslash. +# In particular, with Autoconf 2.60 or later we add some code to the start +# of the generated configure script which will find a shell with a builtin +# printf (which we can use as an echo command). +# _LT_PROG_ECHO_BACKSLASH + + +# _LT_WITH_SYSROOT +# ---------------- + + +# _LT_ENABLE_LOCK +# --------------- +# _LT_ENABLE_LOCK + + +# _LT_PROG_AR +# ----------- +# _LT_PROG_AR + + +# _LT_CMD_OLD_ARCHIVE +# ------------------- +# _LT_CMD_OLD_ARCHIVE + + +# _LT_COMPILER_OPTION(MESSAGE, VARIABLE-NAME, FLAGS, +# [OUTPUT-FILE], [ACTION-SUCCESS], [ACTION-FAILURE]) +# ---------------------------------------------------------------- +# Check whether the given compiler option works +# _LT_COMPILER_OPTION + +# Old name: +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + + + +# _LT_LINKER_OPTION(MESSAGE, VARIABLE-NAME, FLAGS, +# [ACTION-SUCCESS], [ACTION-FAILURE]) +# ---------------------------------------------------- +# Check whether the given linker option works +# _LT_LINKER_OPTION + +# Old name: +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + + + +# LT_CMD_MAX_LEN +#--------------- +# LT_CMD_MAX_LEN + +# Old name: +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + + + +# _LT_HEADER_DLFCN +# ---------------- +# _LT_HEADER_DLFCN + + +# _LT_TRY_DLOPEN_SELF (ACTION-IF-TRUE, ACTION-IF-TRUE-W-USCORE, +# ACTION-IF-FALSE, ACTION-IF-CROSS-COMPILING) +# ---------------------------------------------------------------- +# _LT_TRY_DLOPEN_SELF + + +# LT_SYS_DLOPEN_SELF +# ------------------ +# LT_SYS_DLOPEN_SELF + +# Old name: +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + + + +# _LT_COMPILER_C_O([TAGNAME]) +# --------------------------- +# Check to see if options -c and -o are simultaneously supported by compiler. +# This macro does not hard code the compiler like AC_PROG_CC_C_O. +# _LT_COMPILER_C_O + + +# _LT_COMPILER_FILE_LOCKS([TAGNAME]) +# ---------------------------------- +# Check to see if we can do hard links to lock some files if needed +# _LT_COMPILER_FILE_LOCKS + + +# _LT_CHECK_OBJDIR +# ---------------- +# _LT_CHECK_OBJDIR + + +# _LT_LINKER_HARDCODE_LIBPATH([TAGNAME]) +# -------------------------------------- +# Check hardcoding attributes. +# _LT_LINKER_HARDCODE_LIBPATH + + +# _LT_CMD_STRIPLIB +# ---------------- +# _LT_CMD_STRIPLIB + + +# _LT_SYS_DYNAMIC_LINKER([TAG]) +# ----------------------------- +# PORTME Fill in your ld.so characteristics +# _LT_SYS_DYNAMIC_LINKER + + +# _LT_PATH_TOOL_PREFIX(TOOL) +# -------------------------- +# find a file program which can recognize shared library +# _LT_PATH_TOOL_PREFIX + +# Old name: +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + + + +# _LT_PATH_MAGIC +# -------------- +# find a file program which can recognize a shared library +# _LT_PATH_MAGIC + + +# LT_PATH_LD +# ---------- +# find the pathname to the GNU or non-GNU linker +# LT_PATH_LD + +# Old names: +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + + + +# _LT_PATH_LD_GNU +#- -------------- +# _LT_PATH_LD_GNU + + +# _LT_CMD_RELOAD +# -------------- +# find reload flag for linker +# -- PORTME Some linkers may need a different reload flag. +# _LT_CMD_RELOAD + + +# _LT_CHECK_MAGIC_METHOD +# ---------------------- +# how to check for library dependencies +# -- PORTME fill in with the dynamic library characteristics +# _LT_CHECK_MAGIC_METHOD + + +# LT_PATH_NM +# ---------- +# find the pathname to a BSD- or MS-compatible name lister +# LT_PATH_NM + +# Old names: +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + + +# _LT_CHECK_SHAREDLIB_FROM_LINKLIB +# -------------------------------- +# how to determine the name of the shared library +# associated with a specific link library. +# -- PORTME fill in with the dynamic library characteristics +# _LT_CHECK_SHAREDLIB_FROM_LINKLIB + + +# _LT_PATH_MANIFEST_TOOL +# ---------------------- +# locate the manifest tool +# _LT_PATH_MANIFEST_TOOL + + +# LT_LIB_M +# -------- +# check for math library +# LT_LIB_M + +# Old name: +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + + + +# _LT_COMPILER_NO_RTTI([TAGNAME]) +# ------------------------------- +# _LT_COMPILER_NO_RTTI + + +# _LT_CMD_GLOBAL_SYMBOLS +# ---------------------- + # _LT_CMD_GLOBAL_SYMBOLS + + +# _LT_COMPILER_PIC([TAGNAME]) +# --------------------------- +# _LT_COMPILER_PIC + + +# _LT_LINKER_SHLIBS([TAGNAME]) +# ---------------------------- +# See if the linker supports building shared libraries. +# _LT_LINKER_SHLIBS + + +# _LT_LANG_C_CONFIG([TAG]) +# ------------------------ +# Ensure that the configuration variables for a C compiler are suitably +# defined. These variables are subsequently used by _LT_CONFIG to write +# the compiler configuration to `libtool'. +# _LT_LANG_C_CONFIG + + +# _LT_LANG_CXX_CONFIG([TAG]) +# -------------------------- +# Ensure that the configuration variables for a C++ compiler are suitably +# defined. These variables are subsequently used by _LT_CONFIG to write +# the compiler configuration to `libtool'. +# _LT_LANG_CXX_CONFIG + + +# _LT_FUNC_STRIPNAME_CNF +# ---------------------- +# func_stripname_cnf prefix suffix name +# strip PREFIX and SUFFIX off of NAME. +# PREFIX and SUFFIX must not contain globbing or regex special +# characters, hashes, percent signs, but SUFFIX may contain a leading +# dot (in which case that matches only a dot). +# +# This function is identical to the (non-XSI) version of func_stripname, +# except this one can be used by m4 code that may be executed by configure, +# rather than the libtool script. +# _LT_FUNC_STRIPNAME_CNF + +# _LT_SYS_HIDDEN_LIBDEPS([TAGNAME]) +# --------------------------------- +# Figure out "hidden" library dependencies from verbose +# compiler output when linking a shared library. +# Parse the compiler output and extract the necessary +# objects, libraries and library flags. +# _LT_SYS_HIDDEN_LIBDEPS + + +# _LT_LANG_F77_CONFIG([TAG]) +# -------------------------- +# Ensure that the configuration variables for a Fortran 77 compiler are +# suitably defined. These variables are subsequently used by _LT_CONFIG +# to write the compiler configuration to `libtool'. +# _LT_LANG_F77_CONFIG + + +# _LT_LANG_FC_CONFIG([TAG]) +# ------------------------- +# Ensure that the configuration variables for a Fortran compiler are +# suitably defined. These variables are subsequently used by _LT_CONFIG +# to write the compiler configuration to `libtool'. +# _LT_LANG_FC_CONFIG + + +# _LT_LANG_GCJ_CONFIG([TAG]) +# -------------------------- +# Ensure that the configuration variables for the GNU Java Compiler compiler +# are suitably defined. These variables are subsequently used by _LT_CONFIG +# to write the compiler configuration to `libtool'. +# _LT_LANG_GCJ_CONFIG + + +# _LT_LANG_GO_CONFIG([TAG]) +# -------------------------- +# Ensure that the configuration variables for the GNU Go compiler +# are suitably defined. These variables are subsequently used by _LT_CONFIG +# to write the compiler configuration to `libtool'. +# _LT_LANG_GO_CONFIG + + +# _LT_LANG_RC_CONFIG([TAG]) +# ------------------------- +# Ensure that the configuration variables for the Windows resource compiler +# are suitably defined. These variables are subsequently used by _LT_CONFIG +# to write the compiler configuration to `libtool'. +# _LT_LANG_RC_CONFIG + + +# LT_PROG_GCJ +# ----------- + + +# Old name: +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + + + +# LT_PROG_GO +# ---------- + + + +# LT_PROG_RC +# ---------- + + +# Old name: +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + + + +# _LT_DECL_EGREP +# -------------- +# If we don't have a new enough Autoconf to choose the best grep +# available, choose the one first in the user's PATH. + + + +# _LT_DECL_OBJDUMP +# -------------- +# If we don't have a new enough Autoconf to choose the best objdump +# available, choose the one first in the user's PATH. + + +# _LT_DECL_DLLTOOL +# ---------------- +# Ensure DLLTOOL variable is set. + + +# _LT_DECL_SED +# ------------ +# Check for a fully-functional sed program, that truncates +# as few characters as possible. Prefer GNU sed if found. +# _LT_DECL_SED + +#m4_ifndef + +# Old name: +# This is what autoupdate's m4 run will expand. It fires +# the warning (with _au_warn_XXX), outputs it into the +# updated configure.ac (with AC_DIAGNOSE), and then outputs +# the replacement expansion. + + +# This is an auxiliary macro that is also run when +# autoupdate runs m4. It simply calls m4_warning, but +# we need a wrapper so that each warning is emitted only +# once. We break the quoting in m4_warning's argument in +# order to expand this macro's arguments, not AU_DEFUN's. + + +# Finally, this is the expansion that is picked up by +# autoconf. It tells the user to run autoupdate, and +# then outputs the replacement expansion. We do not care +# about autoupdate's warning because that contains +# information on what to do *after* running autoupdate. + + + +# _LT_CHECK_SHELL_FEATURES +# ------------------------ +# Find out whether the shell is Bourne or XSI compatible, +# or has some other useful features. +# _LT_CHECK_SHELL_FEATURES + + +# _LT_PROG_FUNCTION_REPLACE (FUNCNAME, REPLACEMENT-BODY) +# ------------------------------------------------------ +# In `$cfgfile', look for function FUNCNAME delimited by `^FUNCNAME ()$' and +# '^} FUNCNAME ', and replace its body with REPLACEMENT-BODY. + + + +# _LT_PROG_REPLACE_SHELLFNS +# ------------------------- +# Replace existing portable implementations of several shell functions with +# equivalent extended shell implementations where those features are available.. + + +# _LT_PATH_CONVERSION_FUNCTIONS +# ----------------------------- +# Determine which file name conversion functions should be used by +# func_to_host_file (and, implicitly, by func_to_host_path). These are needed +# for certain cross-compile configurations and native mingw. +# _LT_PATH_CONVERSION_FUNCTIONS + +# ltsugar.m4 -- libtool m4 base layer. -*-Autoconf-*- +# +# Copyright (C) 2004, 2005, 2007, 2008 Free Software Foundation, Inc. +# Written by Gary V. Vaughan, 2004 +# +# This file is free software; the Free Software Foundation gives +# unlimited permission to copy and/or distribute it, with or without +# modifications, as long as this notice is preserved. + +# serial 6 ltsugar.m4 + +# This is to help aclocal find these macros, as it can't see m4_define. + + + +# lt_join(SEP, ARG1, [ARG2...]) +# ----------------------------- +# Produce ARG1SEPARG2...SEPARGn, omitting [] arguments and their +# associated separator. +# Needed until we can rely on m4_join from Autoconf 2.62, since all earlier +# versions in m4sugar had bugs. + + + + +# lt_car(LIST) +# lt_cdr(LIST) +# ------------ +# Manipulate m4 lists. +# These macros are necessary as long as will still need to support +# Autoconf-2.59 which quotes differently. + + + + + +# lt_append(MACRO-NAME, STRING, [SEPARATOR]) +# ------------------------------------------ +# Redefine MACRO-NAME to hold its former content plus `SEPARATOR'`STRING'. +# Note that neither SEPARATOR nor STRING are expanded; they are appended +# to MACRO-NAME as is (leaving the expansion for when MACRO-NAME is invoked). +# No SEPARATOR is output if MACRO-NAME was previously undefined (different +# than defined and empty). +# +# This macro is needed until we can rely on Autoconf 2.62, since earlier +# versions of m4sugar mistakenly expanded SEPARATOR but not STRING. + + + + +# lt_combine(SEP, PREFIX-LIST, INFIX, SUFFIX1, [SUFFIX2...]) +# ---------------------------------------------------------- +# Produce a SEP delimited list of all paired combinations of elements of +# PREFIX-LIST with SUFFIX1 through SUFFIXn. Each element of the list +# has the form PREFIXmINFIXSUFFIXn. +# Needed until we can rely on m4_combine added in Autoconf 2.62. + + + +# lt_if_append_uniq(MACRO-NAME, VARNAME, [SEPARATOR], [UNIQ], [NOT-UNIQ]) +# ----------------------------------------------------------------------- +# Iff MACRO-NAME does not yet contain VARNAME, then append it (delimited +# by SEPARATOR if supplied) and expand UNIQ, else NOT-UNIQ. + + + +# lt_dict_add(DICT, KEY, VALUE) +# ----------------------------- + + + +# lt_dict_add_subkey(DICT, KEY, SUBKEY, VALUE) +# -------------------------------------------- + + + +# lt_dict_fetch(DICT, KEY, [SUBKEY]) +# ---------------------------------- + + + +# lt_if_dict_fetch(DICT, KEY, [SUBKEY], VALUE, IF-TRUE, [IF-FALSE]) +# ----------------------------------------------------------------- + + + +# lt_dict_filter(DICT, [SUBKEY], VALUE, [SEPARATOR], KEY, [...]) +# -------------------------------------------------------------- + + +# lt~obsolete.m4 -- aclocal satisfying obsolete definitions. -*-Autoconf-*- +# +# Copyright (C) 2004, 2005, 2007, 2009 Free Software Foundation, Inc. +# Written by Scott James Remnant, 2004. +# +# This file is free software; the Free Software Foundation gives +# unlimited permission to copy and/or distribute it, with or without +# modifications, as long as this notice is preserved. + +# serial 5 lt~obsolete.m4 + +# These exist entirely to fool aclocal when bootstrapping libtool. +# +# In the past libtool.m4 has provided macros via AC_DEFUN (or AU_DEFUN) +# which have later been changed to m4_define as they aren't part of the +# exported API, or moved to Autoconf or Automake where they belong. +# +# The trouble is, aclocal is a bit thick. It'll see the old AC_DEFUN +# in /usr/share/aclocal/libtool.m4 and remember it, then when it sees us +# using a macro with the same name in our local m4/libtool.m4 it'll +# pull the old libtool.m4 in (it doesn't see our shiny new m4_define +# and doesn't know about Autoconf macros at all.) +# +# So we provide this file, which has a silly filename so it's always +# included after everything else. This provides aclocal with the +# AC_DEFUNs it wants, but when m4 processes it, it doesn't do anything +# because those macros already exist, or will be overwritten later. +# We use AC_DEFUN over AU_DEFUN for compatibility with aclocal-1.6. +# +# Anytime we withdraw an AC_DEFUN or AU_DEFUN, remember to add it here. +# Yes, that means every name once taken will need to remain here until +# we give up compatibility with versions before 1.7, at which point +# we need to keep only those names which we still refer to. + +# This is to help aclocal find these macros, as it can't see m4_define. + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +# pkg.m4 - Macros to locate and utilise pkg-config. -*- Autoconf -*- +# serial 1 (pkg-config-0.24) +# +# Copyright © 2004 Scott James Remnant . +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. +# +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program that contains a +# configuration script generated by Autoconf, you may include it under +# the same distribution terms that you use for the rest of that program. + +# PKG_PROG_PKG_CONFIG([MIN-VERSION]) +# ---------------------------------- +# PKG_PROG_PKG_CONFIG + +# PKG_CHECK_EXISTS(MODULES, [ACTION-IF-FOUND], [ACTION-IF-NOT-FOUND]) +# +# Check to see whether a particular set of modules exists. Similar +# to PKG_CHECK_MODULES(), but does not set variables or print errors. +# +# Please remember that m4 expands AC_REQUIRE([PKG_PROG_PKG_CONFIG]) +# only at the first occurence in configure.ac, so if the first place +# it's called might be skipped (such as if it is within an "if", you +# have to call PKG_CHECK_EXISTS manually +# -------------------------------------------------------------- + + +# _PKG_CONFIG([VARIABLE], [COMMAND], [MODULES]) +# --------------------------------------------- +# _PKG_CONFIG + +# _PKG_SHORT_ERRORS_SUPPORTED +# ----------------------------- +# _PKG_SHORT_ERRORS_SUPPORTED + + +# PKG_CHECK_MODULES(VARIABLE-PREFIX, MODULES, [ACTION-IF-FOUND], +# [ACTION-IF-NOT-FOUND]) +# +# +# Note that if there is a possibility the first call to +# PKG_CHECK_MODULES might not happen, you should be sure to include an +# explicit call to PKG_PROG_PKG_CONFIG in your configure.ac +# +# +# -------------------------------------------------------------- +# PKG_CHECK_MODULES + + +# PKG_INSTALLDIR(DIRECTORY) +# ------------------------- +# Substitutes the variable pkgconfigdir as the location where a module +# should install pkg-config .pc files. By default the directory is +# $libdir/pkgconfig, but the default can be changed by passing +# DIRECTORY. The user can override through the --with-pkgconfigdir +# parameter. + + +# PKG_NOARCH_INSTALLDIR(DIRECTORY) +# ------------------------- +# Substitutes the variable noarch_pkgconfigdir as the location where a +# module should install arch-independent pkg-config .pc files. By +# default the directory is $datadir/pkgconfig, but the default can be +# changed by passing DIRECTORY. The user can override through the +# --with-noarch-pkgconfigdir parameter. + + +# PKG_CHECK_VAR(VARIABLE, MODULE, CONFIG-VARIABLE, +# [ACTION-IF-FOUND], [ACTION-IF-NOT-FOUND]) +# ------------------------------------------- +# Retrieves the value of the pkg-config variable for the given module. +# PKG_CHECK_VAR + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + + +# Handle Globus configuration right away, because the Globus flavor +# determines our compiler options. + +# Check whether the user wants GSI (Globus) support +gsi_path="no" + +# Check whether --with-gsi was given. +if test "${with_gsi+set}" = set; then + withval=$with_gsi; + gsi_path="$withval" + + +fi + + + +# Check whether --with-globus was given. +if test "${with_globus+set}" = set; then + withval=$with_globus; + gsi_path="$withval" + + +fi + + + +# Check whether --with-globus-static was given. +if test "${with_globus_static+set}" = set; then + withval=$with_globus_static; + gsi_static="-static" + if test "x$gsi_path" = "xno" ; then + gsi_path="$withval" + fi + + +fi + + +# Check whether the user has a Globus flavor type +globus_flavor_type="no" + +# Check whether --with-globus-flavor was given. +if test "${with_globus_flavor+set}" = set; then + withval=$with_globus_flavor; + globus_flavor_type="$withval" + if test "x$gsi_path" = "xno" ; then + gsi_path="yes" + fi + + +fi + + +if test "x$gsi_path" != "xno" ; then + # Globus GSSAPI configuration + { echo "$as_me:$LINENO: checking for Globus GSI" >&5 +echo $ECHO_N "checking for Globus GSI... $ECHO_C" >&6; } + +cat >>confdefs.h <<\_ACEOF +#define GSI 1 +_ACEOF + + + if test -z "$GSSAPI"; then + cat >>confdefs.h <<\_ACEOF +#define GSSAPI 1 +_ACEOF + + GSSAPI="GSI" + fi + + if test "x$gsi_path" = "xyes" ; then + if test -z "$GLOBUS_LOCATION" ; then + { { echo "$as_me:$LINENO: error: GLOBUS_LOCATION environment variable must be set." >&5 +echo "$as_me: error: GLOBUS_LOCATION environment variable must be set." >&2;} + { (exit 1); exit 1; }; } + else + gsi_path="$GLOBUS_LOCATION" + fi + fi + GLOBUS_LOCATION="$gsi_path" + export GLOBUS_LOCATION + LD_LIBRARY_PATH="${gsi_path}/lib:$LD_LIBRARY_PATH" + export LD_LIBRARY_PATH + + if test -d "${gsi_path}/lib/pkgconfig" ; then + PKG_CONFIG_PATH="${gsi_path}/lib/pkgconfig:$PKG_CONFIG_PATH" + export PKG_CONFIG_PATH + elif test -d "${gsi_path}/lib64/pkgconfig" ; then + PKG_CONFIG_PATH="${gsi_path}/lib64/pkgconfig:$PKG_CONFIG_PATH" + export PKG_CONFIG_PATH + else + { { echo "$as_me:$LINENO: error: ${gsi_path}/lib/pkgconfig not found." >&5 +echo "$as_me: error: ${gsi_path}/lib/pkgconfig not found." >&2;} + { (exit 1); exit 1; }; } + fi + + ac_aux_dir= +for ac_dir in "$srcdir" "$srcdir/.." "$srcdir/../.."; do + if test -f "$ac_dir/install-sh"; then + ac_aux_dir=$ac_dir + ac_install_sh="$ac_aux_dir/install-sh -c" + break + elif test -f "$ac_dir/install.sh"; then + ac_aux_dir=$ac_dir + ac_install_sh="$ac_aux_dir/install.sh -c" + break + elif test -f "$ac_dir/shtool"; then + ac_aux_dir=$ac_dir + ac_install_sh="$ac_aux_dir/shtool install -c" + break + fi +done +if test -z "$ac_aux_dir"; then + { { echo "$as_me:$LINENO: error: cannot find install-sh or install.sh in \"$srcdir\" \"$srcdir/..\" \"$srcdir/../..\"" >&5 +echo "$as_me: error: cannot find install-sh or install.sh in \"$srcdir\" \"$srcdir/..\" \"$srcdir/../..\"" >&2;} + { (exit 1); exit 1; }; } +fi + +# These three variables are undocumented and unsupported, +# and are intended to be withdrawn in a future Autoconf release. +# They can cause serious problems if a builder's source tree is in a directory +# whose full name contains unusual characters. +ac_config_guess="$SHELL $ac_aux_dir/config.guess" # Please don't use this var. +ac_config_sub="$SHELL $ac_aux_dir/config.sub" # Please don't use this var. +ac_configure="$SHELL $ac_aux_dir/configure" # Please don't use this var. + + +case `pwd` in + *\ * | *\ *) + { echo "$as_me:$LINENO: WARNING: Libtool does not cope well with whitespace in \`pwd\`" >&5 +echo "$as_me: WARNING: Libtool does not cope well with whitespace in \`pwd\`" >&2;} ;; +esac + + + +macro_version='2.4.2' +macro_revision='1.3337' + + + + + + + + + + + + + +ltmain="$ac_aux_dir/ltmain.sh" + +# Make sure we can run config.sub. +$SHELL "$ac_aux_dir/config.sub" sun4 >/dev/null 2>&1 || + { { echo "$as_me:$LINENO: error: cannot run $SHELL $ac_aux_dir/config.sub" >&5 +echo "$as_me: error: cannot run $SHELL $ac_aux_dir/config.sub" >&2;} + { (exit 1); exit 1; }; } + +{ echo "$as_me:$LINENO: checking build system type" >&5 +echo $ECHO_N "checking build system type... $ECHO_C" >&6; } +if test "${ac_cv_build+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_build_alias=$build_alias +test "x$ac_build_alias" = x && + ac_build_alias=`$SHELL "$ac_aux_dir/config.guess"` +test "x$ac_build_alias" = x && + { { echo "$as_me:$LINENO: error: cannot guess build type; you must specify one" >&5 +echo "$as_me: error: cannot guess build type; you must specify one" >&2;} + { (exit 1); exit 1; }; } +ac_cv_build=`$SHELL "$ac_aux_dir/config.sub" $ac_build_alias` || + { { echo "$as_me:$LINENO: error: $SHELL $ac_aux_dir/config.sub $ac_build_alias failed" >&5 +echo "$as_me: error: $SHELL $ac_aux_dir/config.sub $ac_build_alias failed" >&2;} + { (exit 1); exit 1; }; } + +fi +{ echo "$as_me:$LINENO: result: $ac_cv_build" >&5 +echo "${ECHO_T}$ac_cv_build" >&6; } +case $ac_cv_build in +*-*-*) ;; +*) { { echo "$as_me:$LINENO: error: invalid value of canonical build" >&5 +echo "$as_me: error: invalid value of canonical build" >&2;} + { (exit 1); exit 1; }; };; +esac +build=$ac_cv_build +ac_save_IFS=$IFS; IFS='-' +set x $ac_cv_build +shift +build_cpu=$1 +build_vendor=$2 +shift; shift +# Remember, the first character of IFS is used to create $*, +# except with old shells: +build_os=$* +IFS=$ac_save_IFS +case $build_os in *\ *) build_os=`echo "$build_os" | sed 's/ /-/g'`;; esac + + +{ echo "$as_me:$LINENO: checking host system type" >&5 +echo $ECHO_N "checking host system type... $ECHO_C" >&6; } +if test "${ac_cv_host+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test "x$host_alias" = x; then + ac_cv_host=$ac_cv_build +else + ac_cv_host=`$SHELL "$ac_aux_dir/config.sub" $host_alias` || + { { echo "$as_me:$LINENO: error: $SHELL $ac_aux_dir/config.sub $host_alias failed" >&5 +echo "$as_me: error: $SHELL $ac_aux_dir/config.sub $host_alias failed" >&2;} + { (exit 1); exit 1; }; } +fi + +fi +{ echo "$as_me:$LINENO: result: $ac_cv_host" >&5 +echo "${ECHO_T}$ac_cv_host" >&6; } +case $ac_cv_host in +*-*-*) ;; +*) { { echo "$as_me:$LINENO: error: invalid value of canonical host" >&5 +echo "$as_me: error: invalid value of canonical host" >&2;} + { (exit 1); exit 1; }; };; +esac +host=$ac_cv_host +ac_save_IFS=$IFS; IFS='-' +set x $ac_cv_host +shift +host_cpu=$1 +host_vendor=$2 +shift; shift +# Remember, the first character of IFS is used to create $*, +# except with old shells: +host_os=$* +IFS=$ac_save_IFS +case $host_os in *\ *) host_os=`echo "$host_os" | sed 's/ /-/g'`;; esac + + +# Backslashify metacharacters that are still active within +# double-quoted strings. +sed_quote_subst='s/\(["`$\\]\)/\\\1/g' + +# Same as above, but do not quote variable references. +double_quote_subst='s/\(["`\\]\)/\\\1/g' + +# Sed substitution to delay expansion of an escaped shell variable in a +# double_quote_subst'ed string. +delay_variable_subst='s/\\\\\\\\\\\$/\\\\\\$/g' + +# Sed substitution to delay expansion of an escaped single quote. +delay_single_quote_subst='s/'\''/'\'\\\\\\\'\''/g' + +# Sed substitution to avoid accidental globbing in evaled expressions +no_glob_subst='s/\*/\\\*/g' + +ECHO='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\' +ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO +ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO$ECHO + +{ echo "$as_me:$LINENO: checking how to print strings" >&5 +echo $ECHO_N "checking how to print strings... $ECHO_C" >&6; } +# Test print first, because it will be a builtin if present. +if test "X`( print -r -- -n ) 2>/dev/null`" = X-n && \ + test "X`print -r -- $ECHO 2>/dev/null`" = "X$ECHO"; then + ECHO='print -r --' +elif test "X`printf %s $ECHO 2>/dev/null`" = "X$ECHO"; then + ECHO='printf %s\n' +else + # Use this function as a fallback that always works. + func_fallback_echo () + { + eval 'cat <<_LTECHO_EOF +$1 +_LTECHO_EOF' + } + ECHO='func_fallback_echo' +fi + +# func_echo_all arg... +# Invoke $ECHO with all args, space-separated. +func_echo_all () +{ + $ECHO "" +} + +case "$ECHO" in + printf*) { echo "$as_me:$LINENO: result: printf" >&5 +echo "${ECHO_T}printf" >&6; } ;; + print*) { echo "$as_me:$LINENO: result: print -r" >&5 +echo "${ECHO_T}print -r" >&6; } ;; + *) { echo "$as_me:$LINENO: result: cat" >&5 +echo "${ECHO_T}cat" >&6; } ;; +esac + + + + + + + + + + + + + + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}gcc", so it can be a program name with args. +set dummy ${ac_tool_prefix}gcc; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_CC="${ac_tool_prefix}gcc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + { echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_CC"; then + ac_ct_CC=$CC + # Extract the first word of "gcc", so it can be a program name with args. +set dummy gcc; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_ac_ct_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_CC"; then + ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_ac_ct_CC="gcc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +ac_ct_CC=$ac_cv_prog_ac_ct_CC +if test -n "$ac_ct_CC"; then + { echo "$as_me:$LINENO: result: $ac_ct_CC" >&5 +echo "${ECHO_T}$ac_ct_CC" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + if test "x$ac_ct_CC" = x; then + CC="" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ echo "$as_me:$LINENO: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&5 +echo "$as_me: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&2;} +ac_tool_warned=yes ;; +esac + CC=$ac_ct_CC + fi +else + CC="$ac_cv_prog_CC" +fi + +if test -z "$CC"; then + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}cc", so it can be a program name with args. +set dummy ${ac_tool_prefix}cc; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_CC="${ac_tool_prefix}cc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + { echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + + fi +fi +if test -z "$CC"; then + # Extract the first word of "cc", so it can be a program name with args. +set dummy cc; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else + ac_prog_rejected=no +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + if test "$as_dir/$ac_word$ac_exec_ext" = "/usr/ucb/cc"; then + ac_prog_rejected=yes + continue + fi + ac_cv_prog_CC="cc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +if test $ac_prog_rejected = yes; then + # We found a bogon in the path, so make sure we never use it. + set dummy $ac_cv_prog_CC + shift + if test $# != 0; then + # We chose a different compiler from the bogus one. + # However, it has the same basename, so the bogon will be chosen + # first if we set CC to just the basename; use the full file name. + shift + ac_cv_prog_CC="$as_dir/$ac_word${1+' '}$@" + fi +fi +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + { echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + +fi +if test -z "$CC"; then + if test -n "$ac_tool_prefix"; then + for ac_prog in cl.exe + do + # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args. +set dummy $ac_tool_prefix$ac_prog; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_CC="$ac_tool_prefix$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + { echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + + test -n "$CC" && break + done +fi +if test -z "$CC"; then + ac_ct_CC=$CC + for ac_prog in cl.exe +do + # Extract the first word of "$ac_prog", so it can be a program name with args. +set dummy $ac_prog; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_ac_ct_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_CC"; then + ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_ac_ct_CC="$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +ac_ct_CC=$ac_cv_prog_ac_ct_CC +if test -n "$ac_ct_CC"; then + { echo "$as_me:$LINENO: result: $ac_ct_CC" >&5 +echo "${ECHO_T}$ac_ct_CC" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + + test -n "$ac_ct_CC" && break +done + + if test "x$ac_ct_CC" = x; then + CC="" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ echo "$as_me:$LINENO: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&5 +echo "$as_me: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&2;} +ac_tool_warned=yes ;; +esac + CC=$ac_ct_CC + fi +fi + +fi + + +test -z "$CC" && { { echo "$as_me:$LINENO: error: no acceptable C compiler found in \$PATH +See \`config.log' for more details." >&5 +echo "$as_me: error: no acceptable C compiler found in \$PATH +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } + +# Provide some information about the compiler. +echo "$as_me:$LINENO: checking for C compiler version" >&5 +ac_compiler=`set X $ac_compile; echo $2` +{ (ac_try="$ac_compiler --version >&5" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compiler --version >&5") 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } +{ (ac_try="$ac_compiler -v >&5" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compiler -v >&5") 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } +{ (ac_try="$ac_compiler -V >&5" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compiler -V >&5") 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } + +cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +ac_clean_files_save=$ac_clean_files +ac_clean_files="$ac_clean_files a.out a.exe b.out" +# Try to create an executable without -o first, disregard a.out. +# It will help us diagnose broken compilers, and finding out an intuition +# of exeext. +{ echo "$as_me:$LINENO: checking for C compiler default output file name" >&5 +echo $ECHO_N "checking for C compiler default output file name... $ECHO_C" >&6; } +ac_link_default=`echo "$ac_link" | sed 's/ -o *conftest[^ ]*//'` +# +# List of possible output files, starting from the most likely. +# The algorithm is not robust to junk in `.', hence go to wildcards (a.*) +# only as a last resort. b.out is created by i960 compilers. +ac_files='a_out.exe a.exe conftest.exe a.out conftest a.* conftest.* b.out' +# +# The IRIX 6 linker writes into existing files which may not be +# executable, retaining their permissions. Remove them first so a +# subsequent execution test works. +ac_rmfiles= +for ac_file in $ac_files +do + case $ac_file in + *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf | *.o | *.obj ) ;; + * ) ac_rmfiles="$ac_rmfiles $ac_file";; + esac +done +rm -f $ac_rmfiles + +if { (ac_try="$ac_link_default" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_link_default") 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + # Autoconf-2.13 could set the ac_cv_exeext variable to `no'. +# So ignore a value of `no', otherwise this would lead to `EXEEXT = no' +# in a Makefile. We should not override ac_cv_exeext if it was cached, +# so that the user can short-circuit this test for compilers unknown to +# Autoconf. +for ac_file in $ac_files '' +do + test -f "$ac_file" || continue + case $ac_file in + *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf | *.o | *.obj ) + ;; + [ab].out ) + # We found the default executable, but exeext='' is most + # certainly right. + break;; + *.* ) + if test "${ac_cv_exeext+set}" = set && test "$ac_cv_exeext" != no; + then :; else + ac_cv_exeext=`expr "$ac_file" : '[^.]*\(\..*\)'` + fi + # We set ac_cv_exeext here because the later test for it is not + # safe: cross compilers may not add the suffix if given an `-o' + # argument, so we may need to know it at that point already. + # Even if this section looks crufty: it has the advantage of + # actually working. + break;; + * ) + break;; + esac +done +test "$ac_cv_exeext" = no && ac_cv_exeext= + +else + ac_file='' +fi + +{ echo "$as_me:$LINENO: result: $ac_file" >&5 +echo "${ECHO_T}$ac_file" >&6; } +if test -z "$ac_file"; then + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +{ { echo "$as_me:$LINENO: error: C compiler cannot create executables +See \`config.log' for more details." >&5 +echo "$as_me: error: C compiler cannot create executables +See \`config.log' for more details." >&2;} + { (exit 77); exit 77; }; } +fi + +ac_exeext=$ac_cv_exeext + +# Check that the compiler produces executables we can run. If not, either +# the compiler is broken, or we cross compile. +{ echo "$as_me:$LINENO: checking whether the C compiler works" >&5 +echo $ECHO_N "checking whether the C compiler works... $ECHO_C" >&6; } +# FIXME: These cross compiler hacks should be removed for Autoconf 3.0 +# If not cross compiling, check that we can run a simple program. +if test "$cross_compiling" != yes; then + if { ac_try='./$ac_file' + { (case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_try") 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + cross_compiling=no + else + if test "$cross_compiling" = maybe; then + cross_compiling=yes + else + { { echo "$as_me:$LINENO: error: cannot run C compiled programs. +If you meant to cross compile, use \`--host'. +See \`config.log' for more details." >&5 +echo "$as_me: error: cannot run C compiled programs. +If you meant to cross compile, use \`--host'. +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } + fi + fi +fi +{ echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6; } + +rm -f a.out a.exe conftest$ac_cv_exeext b.out +ac_clean_files=$ac_clean_files_save +# Check that the compiler produces executables we can run. If not, either +# the compiler is broken, or we cross compile. +{ echo "$as_me:$LINENO: checking whether we are cross compiling" >&5 +echo $ECHO_N "checking whether we are cross compiling... $ECHO_C" >&6; } +{ echo "$as_me:$LINENO: result: $cross_compiling" >&5 +echo "${ECHO_T}$cross_compiling" >&6; } + +{ echo "$as_me:$LINENO: checking for suffix of executables" >&5 +echo $ECHO_N "checking for suffix of executables... $ECHO_C" >&6; } +if { (ac_try="$ac_link" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_link") 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then # If both `conftest.exe' and `conftest' are `present' (well, observable) # catch `conftest.exe'. For instance with Cygwin, `ls conftest' will # work properly (i.e., refer to `conftest.exe'), while it won't with @@ -2332,81 +4409,8037 @@ break;; * ) break;; esac -done +done +else + { { echo "$as_me:$LINENO: error: cannot compute suffix of executables: cannot compile and link +See \`config.log' for more details." >&5 +echo "$as_me: error: cannot compute suffix of executables: cannot compile and link +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } +fi + +rm -f conftest$ac_cv_exeext +{ echo "$as_me:$LINENO: result: $ac_cv_exeext" >&5 +echo "${ECHO_T}$ac_cv_exeext" >&6; } + +rm -f conftest.$ac_ext +EXEEXT=$ac_cv_exeext +ac_exeext=$EXEEXT +{ echo "$as_me:$LINENO: checking for suffix of object files" >&5 +echo $ECHO_N "checking for suffix of object files... $ECHO_C" >&6; } +if test "${ac_cv_objext+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.o conftest.obj +if { (ac_try="$ac_compile" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compile") 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + for ac_file in conftest.o conftest.obj conftest.*; do + test -f "$ac_file" || continue; + case $ac_file in + *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf ) ;; + *) ac_cv_objext=`expr "$ac_file" : '.*\.\(.*\)'` + break;; + esac +done +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +{ { echo "$as_me:$LINENO: error: cannot compute suffix of object files: cannot compile +See \`config.log' for more details." >&5 +echo "$as_me: error: cannot compute suffix of object files: cannot compile +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } +fi + +rm -f conftest.$ac_cv_objext conftest.$ac_ext +fi +{ echo "$as_me:$LINENO: result: $ac_cv_objext" >&5 +echo "${ECHO_T}$ac_cv_objext" >&6; } +OBJEXT=$ac_cv_objext +ac_objext=$OBJEXT +{ echo "$as_me:$LINENO: checking whether we are using the GNU C compiler" >&5 +echo $ECHO_N "checking whether we are using the GNU C compiler... $ECHO_C" >&6; } +if test "${ac_cv_c_compiler_gnu+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ +#ifndef __GNUC__ + choke me +#endif + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (ac_try="$ac_compile" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compile") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest.$ac_objext; then + ac_compiler_gnu=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + ac_compiler_gnu=no +fi + +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +ac_cv_c_compiler_gnu=$ac_compiler_gnu + +fi +{ echo "$as_me:$LINENO: result: $ac_cv_c_compiler_gnu" >&5 +echo "${ECHO_T}$ac_cv_c_compiler_gnu" >&6; } +GCC=`test $ac_compiler_gnu = yes && echo yes` +ac_test_CFLAGS=${CFLAGS+set} +ac_save_CFLAGS=$CFLAGS +{ echo "$as_me:$LINENO: checking whether $CC accepts -g" >&5 +echo $ECHO_N "checking whether $CC accepts -g... $ECHO_C" >&6; } +if test "${ac_cv_prog_cc_g+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_save_c_werror_flag=$ac_c_werror_flag + ac_c_werror_flag=yes + ac_cv_prog_cc_g=no + CFLAGS="-g" + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (ac_try="$ac_compile" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compile") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest.$ac_objext; then + ac_cv_prog_cc_g=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + CFLAGS="" + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (ac_try="$ac_compile" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compile") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest.$ac_objext; then + : +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + ac_c_werror_flag=$ac_save_c_werror_flag + CFLAGS="-g" + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (ac_try="$ac_compile" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compile") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest.$ac_objext; then + ac_cv_prog_cc_g=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + +fi + +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi + +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi + +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext + ac_c_werror_flag=$ac_save_c_werror_flag +fi +{ echo "$as_me:$LINENO: result: $ac_cv_prog_cc_g" >&5 +echo "${ECHO_T}$ac_cv_prog_cc_g" >&6; } +if test "$ac_test_CFLAGS" = set; then + CFLAGS=$ac_save_CFLAGS +elif test $ac_cv_prog_cc_g = yes; then + if test "$GCC" = yes; then + CFLAGS="-g -O2" + else + CFLAGS="-g" + fi +else + if test "$GCC" = yes; then + CFLAGS="-O2" + else + CFLAGS= + fi +fi +{ echo "$as_me:$LINENO: checking for $CC option to accept ISO C89" >&5 +echo $ECHO_N "checking for $CC option to accept ISO C89... $ECHO_C" >&6; } +if test "${ac_cv_prog_cc_c89+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_cv_prog_cc_c89=no +ac_save_CC=$CC +cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +#include +#include +#include +/* Most of the following tests are stolen from RCS 5.7's src/conf.sh. */ +struct buf { int x; }; +FILE * (*rcsopen) (struct buf *, struct stat *, int); +static char *e (p, i) + char **p; + int i; +{ + return p[i]; +} +static char *f (char * (*g) (char **, int), char **p, ...) +{ + char *s; + va_list v; + va_start (v,p); + s = g (p, va_arg (v,int)); + va_end (v); + return s; +} + +/* OSF 4.0 Compaq cc is some sort of almost-ANSI by default. It has + function prototypes and stuff, but not '\xHH' hex character constants. + These don't provoke an error unfortunately, instead are silently treated + as 'x'. The following induces an error, until -std is added to get + proper ANSI mode. Curiously '\x00'!='x' always comes out true, for an + array size at least. It's necessary to write '\x00'==0 to get something + that's true only with -std. */ +int osf4_cc_array ['\x00' == 0 ? 1 : -1]; + +/* IBM C 6 for AIX is almost-ANSI by default, but it replaces macro parameters + inside strings and character constants. */ +#define FOO(x) 'x' +int xlc6_cc_array[FOO(a) == 'x' ? 1 : -1]; + +int test (int i, double x); +struct s1 {int (*f) (int a);}; +struct s2 {int (*f) (double a);}; +int pairnames (int, char **, FILE *(*)(struct buf *, struct stat *, int), int, int); +int argc; +char **argv; +int +main () +{ +return f (e, argv, 0) != argv[0] || f (e, argv, 1) != argv[1]; + ; + return 0; +} +_ACEOF +for ac_arg in '' -qlanglvl=extc89 -qlanglvl=ansi -std \ + -Ae "-Aa -D_HPUX_SOURCE" "-Xc -D__EXTENSIONS__" +do + CC="$ac_save_CC $ac_arg" + rm -f conftest.$ac_objext +if { (ac_try="$ac_compile" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compile") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest.$ac_objext; then + ac_cv_prog_cc_c89=$ac_arg +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + +fi + +rm -f core conftest.err conftest.$ac_objext + test "x$ac_cv_prog_cc_c89" != "xno" && break +done +rm -f conftest.$ac_ext +CC=$ac_save_CC + +fi +# AC_CACHE_VAL +case "x$ac_cv_prog_cc_c89" in + x) + { echo "$as_me:$LINENO: result: none needed" >&5 +echo "${ECHO_T}none needed" >&6; } ;; + xno) + { echo "$as_me:$LINENO: result: unsupported" >&5 +echo "${ECHO_T}unsupported" >&6; } ;; + *) + CC="$CC $ac_cv_prog_cc_c89" + { echo "$as_me:$LINENO: result: $ac_cv_prog_cc_c89" >&5 +echo "${ECHO_T}$ac_cv_prog_cc_c89" >&6; } ;; +esac + + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + +{ echo "$as_me:$LINENO: checking for a sed that does not truncate output" >&5 +echo $ECHO_N "checking for a sed that does not truncate output... $ECHO_C" >&6; } +if test "${ac_cv_path_SED+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_script=s/aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa/bbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbb/ + for ac_i in 1 2 3 4 5 6 7; do + ac_script="$ac_script$as_nl$ac_script" + done + echo "$ac_script" | sed 99q >conftest.sed + $as_unset ac_script || ac_script= + # Extract the first word of "sed gsed" to use in msg output +if test -z "$SED"; then +set dummy sed gsed; ac_prog_name=$2 +if test "${ac_cv_path_SED+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_path_SED_found=false +# Loop through the user's path and test for each of PROGNAME-LIST +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_prog in sed gsed; do + for ac_exec_ext in '' $ac_executable_extensions; do + ac_path_SED="$as_dir/$ac_prog$ac_exec_ext" + { test -f "$ac_path_SED" && $as_test_x "$ac_path_SED"; } || continue + # Check for GNU ac_path_SED and select it if it is found. + # Check for GNU $ac_path_SED +case `"$ac_path_SED" --version 2>&1` in +*GNU*) + ac_cv_path_SED="$ac_path_SED" ac_path_SED_found=:;; +*) + ac_count=0 + echo $ECHO_N "0123456789$ECHO_C" >"conftest.in" + while : + do + cat "conftest.in" "conftest.in" >"conftest.tmp" + mv "conftest.tmp" "conftest.in" + cp "conftest.in" "conftest.nl" + echo '' >> "conftest.nl" + "$ac_path_SED" -f conftest.sed < "conftest.nl" >"conftest.out" 2>/dev/null || break + diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break + ac_count=`expr $ac_count + 1` + if test $ac_count -gt ${ac_path_SED_max-0}; then + # Best one so far, save it but keep looking for a better one + ac_cv_path_SED="$ac_path_SED" + ac_path_SED_max=$ac_count + fi + # 10*(2^10) chars as input seems more than enough + test $ac_count -gt 10 && break + done + rm -f conftest.in conftest.tmp conftest.nl conftest.out;; +esac + + + $ac_path_SED_found && break 3 + done +done + +done +IFS=$as_save_IFS + + +fi + +SED="$ac_cv_path_SED" +if test -z "$SED"; then + { { echo "$as_me:$LINENO: error: no acceptable $ac_prog_name could be found in \$PATH" >&5 +echo "$as_me: error: no acceptable $ac_prog_name could be found in \$PATH" >&2;} + { (exit 1); exit 1; }; } +fi + +else + ac_cv_path_SED=$SED +fi + +fi +{ echo "$as_me:$LINENO: result: $ac_cv_path_SED" >&5 +echo "${ECHO_T}$ac_cv_path_SED" >&6; } + SED="$ac_cv_path_SED" + rm -f conftest.sed + +test -z "$SED" && SED=sed +Xsed="$SED -e 1s/^X//" + + + + + + + + + + + +{ echo "$as_me:$LINENO: checking for grep that handles long lines and -e" >&5 +echo $ECHO_N "checking for grep that handles long lines and -e... $ECHO_C" >&6; } +if test "${ac_cv_path_GREP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + # Extract the first word of "grep ggrep" to use in msg output +if test -z "$GREP"; then +set dummy grep ggrep; ac_prog_name=$2 +if test "${ac_cv_path_GREP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_path_GREP_found=false +# Loop through the user's path and test for each of PROGNAME-LIST +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH$PATH_SEPARATOR/usr/xpg4/bin +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_prog in grep ggrep; do + for ac_exec_ext in '' $ac_executable_extensions; do + ac_path_GREP="$as_dir/$ac_prog$ac_exec_ext" + { test -f "$ac_path_GREP" && $as_test_x "$ac_path_GREP"; } || continue + # Check for GNU ac_path_GREP and select it if it is found. + # Check for GNU $ac_path_GREP +case `"$ac_path_GREP" --version 2>&1` in +*GNU*) + ac_cv_path_GREP="$ac_path_GREP" ac_path_GREP_found=:;; +*) + ac_count=0 + echo $ECHO_N "0123456789$ECHO_C" >"conftest.in" + while : + do + cat "conftest.in" "conftest.in" >"conftest.tmp" + mv "conftest.tmp" "conftest.in" + cp "conftest.in" "conftest.nl" + echo 'GREP' >> "conftest.nl" + "$ac_path_GREP" -e 'GREP$' -e '-(cannot match)-' < "conftest.nl" >"conftest.out" 2>/dev/null || break + diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break + ac_count=`expr $ac_count + 1` + if test $ac_count -gt ${ac_path_GREP_max-0}; then + # Best one so far, save it but keep looking for a better one + ac_cv_path_GREP="$ac_path_GREP" + ac_path_GREP_max=$ac_count + fi + # 10*(2^10) chars as input seems more than enough + test $ac_count -gt 10 && break + done + rm -f conftest.in conftest.tmp conftest.nl conftest.out;; +esac + + + $ac_path_GREP_found && break 3 + done +done + +done +IFS=$as_save_IFS + + +fi + +GREP="$ac_cv_path_GREP" +if test -z "$GREP"; then + { { echo "$as_me:$LINENO: error: no acceptable $ac_prog_name could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" >&5 +echo "$as_me: error: no acceptable $ac_prog_name could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" >&2;} + { (exit 1); exit 1; }; } +fi + +else + ac_cv_path_GREP=$GREP +fi + + +fi +{ echo "$as_me:$LINENO: result: $ac_cv_path_GREP" >&5 +echo "${ECHO_T}$ac_cv_path_GREP" >&6; } + GREP="$ac_cv_path_GREP" + + +{ echo "$as_me:$LINENO: checking for egrep" >&5 +echo $ECHO_N "checking for egrep... $ECHO_C" >&6; } +if test "${ac_cv_path_EGREP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if echo a | $GREP -E '(a|b)' >/dev/null 2>&1 + then ac_cv_path_EGREP="$GREP -E" + else + # Extract the first word of "egrep" to use in msg output +if test -z "$EGREP"; then +set dummy egrep; ac_prog_name=$2 +if test "${ac_cv_path_EGREP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_path_EGREP_found=false +# Loop through the user's path and test for each of PROGNAME-LIST +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH$PATH_SEPARATOR/usr/xpg4/bin +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_prog in egrep; do + for ac_exec_ext in '' $ac_executable_extensions; do + ac_path_EGREP="$as_dir/$ac_prog$ac_exec_ext" + { test -f "$ac_path_EGREP" && $as_test_x "$ac_path_EGREP"; } || continue + # Check for GNU ac_path_EGREP and select it if it is found. + # Check for GNU $ac_path_EGREP +case `"$ac_path_EGREP" --version 2>&1` in +*GNU*) + ac_cv_path_EGREP="$ac_path_EGREP" ac_path_EGREP_found=:;; +*) + ac_count=0 + echo $ECHO_N "0123456789$ECHO_C" >"conftest.in" + while : + do + cat "conftest.in" "conftest.in" >"conftest.tmp" + mv "conftest.tmp" "conftest.in" + cp "conftest.in" "conftest.nl" + echo 'EGREP' >> "conftest.nl" + "$ac_path_EGREP" 'EGREP$' < "conftest.nl" >"conftest.out" 2>/dev/null || break + diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break + ac_count=`expr $ac_count + 1` + if test $ac_count -gt ${ac_path_EGREP_max-0}; then + # Best one so far, save it but keep looking for a better one + ac_cv_path_EGREP="$ac_path_EGREP" + ac_path_EGREP_max=$ac_count + fi + # 10*(2^10) chars as input seems more than enough + test $ac_count -gt 10 && break + done + rm -f conftest.in conftest.tmp conftest.nl conftest.out;; +esac + + + $ac_path_EGREP_found && break 3 + done +done + +done +IFS=$as_save_IFS + + +fi + +EGREP="$ac_cv_path_EGREP" +if test -z "$EGREP"; then + { { echo "$as_me:$LINENO: error: no acceptable $ac_prog_name could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" >&5 +echo "$as_me: error: no acceptable $ac_prog_name could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" >&2;} + { (exit 1); exit 1; }; } +fi + +else + ac_cv_path_EGREP=$EGREP +fi + + + fi +fi +{ echo "$as_me:$LINENO: result: $ac_cv_path_EGREP" >&5 +echo "${ECHO_T}$ac_cv_path_EGREP" >&6; } + EGREP="$ac_cv_path_EGREP" + + +{ echo "$as_me:$LINENO: checking for fgrep" >&5 +echo $ECHO_N "checking for fgrep... $ECHO_C" >&6; } +if test "${ac_cv_path_FGREP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if echo 'ab*c' | $GREP -F 'ab*c' >/dev/null 2>&1 + then ac_cv_path_FGREP="$GREP -F" + else + # Extract the first word of "fgrep" to use in msg output +if test -z "$FGREP"; then +set dummy fgrep; ac_prog_name=$2 +if test "${ac_cv_path_FGREP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_path_FGREP_found=false +# Loop through the user's path and test for each of PROGNAME-LIST +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH$PATH_SEPARATOR/usr/xpg4/bin +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_prog in fgrep; do + for ac_exec_ext in '' $ac_executable_extensions; do + ac_path_FGREP="$as_dir/$ac_prog$ac_exec_ext" + { test -f "$ac_path_FGREP" && $as_test_x "$ac_path_FGREP"; } || continue + # Check for GNU ac_path_FGREP and select it if it is found. + # Check for GNU $ac_path_FGREP +case `"$ac_path_FGREP" --version 2>&1` in +*GNU*) + ac_cv_path_FGREP="$ac_path_FGREP" ac_path_FGREP_found=:;; +*) + ac_count=0 + echo $ECHO_N "0123456789$ECHO_C" >"conftest.in" + while : + do + cat "conftest.in" "conftest.in" >"conftest.tmp" + mv "conftest.tmp" "conftest.in" + cp "conftest.in" "conftest.nl" + echo 'FGREP' >> "conftest.nl" + "$ac_path_FGREP" FGREP < "conftest.nl" >"conftest.out" 2>/dev/null || break + diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break + ac_count=`expr $ac_count + 1` + if test $ac_count -gt ${ac_path_FGREP_max-0}; then + # Best one so far, save it but keep looking for a better one + ac_cv_path_FGREP="$ac_path_FGREP" + ac_path_FGREP_max=$ac_count + fi + # 10*(2^10) chars as input seems more than enough + test $ac_count -gt 10 && break + done + rm -f conftest.in conftest.tmp conftest.nl conftest.out;; +esac + + + $ac_path_FGREP_found && break 3 + done +done + +done +IFS=$as_save_IFS + + +fi + +FGREP="$ac_cv_path_FGREP" +if test -z "$FGREP"; then + { { echo "$as_me:$LINENO: error: no acceptable $ac_prog_name could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" >&5 +echo "$as_me: error: no acceptable $ac_prog_name could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" >&2;} + { (exit 1); exit 1; }; } +fi + +else + ac_cv_path_FGREP=$FGREP +fi + + + fi +fi +{ echo "$as_me:$LINENO: result: $ac_cv_path_FGREP" >&5 +echo "${ECHO_T}$ac_cv_path_FGREP" >&6; } + FGREP="$ac_cv_path_FGREP" + + +test -z "$GREP" && GREP=grep + + + + + + + + + + + + + + + + + + + +# Check whether --with-gnu-ld was given. +if test "${with_gnu_ld+set}" = set; then + withval=$with_gnu_ld; test "$withval" = no || with_gnu_ld=yes +else + with_gnu_ld=no +fi + +ac_prog=ld +if test "$GCC" = yes; then + # Check if gcc -print-prog-name=ld gives a path. + { echo "$as_me:$LINENO: checking for ld used by $CC" >&5 +echo $ECHO_N "checking for ld used by $CC... $ECHO_C" >&6; } + case $host in + *-*-mingw*) + # gcc leaves a trailing carriage return which upsets mingw + ac_prog=`($CC -print-prog-name=ld) 2>&5 | tr -d '\015'` ;; + *) + ac_prog=`($CC -print-prog-name=ld) 2>&5` ;; + esac + case $ac_prog in + # Accept absolute paths. + [\\/]* | ?:[\\/]*) + re_direlt='/[^/][^/]*/\.\./' + # Canonicalize the pathname of ld + ac_prog=`$ECHO "$ac_prog"| $SED 's%\\\\%/%g'` + while $ECHO "$ac_prog" | $GREP "$re_direlt" > /dev/null 2>&1; do + ac_prog=`$ECHO $ac_prog| $SED "s%$re_direlt%/%"` + done + test -z "$LD" && LD="$ac_prog" + ;; + "") + # If it fails, then pretend we aren't using GCC. + ac_prog=ld + ;; + *) + # If it is relative, then search for the first ld in PATH. + with_gnu_ld=unknown + ;; + esac +elif test "$with_gnu_ld" = yes; then + { echo "$as_me:$LINENO: checking for GNU ld" >&5 +echo $ECHO_N "checking for GNU ld... $ECHO_C" >&6; } +else + { echo "$as_me:$LINENO: checking for non-GNU ld" >&5 +echo $ECHO_N "checking for non-GNU ld... $ECHO_C" >&6; } +fi +if test "${lt_cv_path_LD+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -z "$LD"; then + lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR + for ac_dir in $PATH; do + IFS="$lt_save_ifs" + test -z "$ac_dir" && ac_dir=. + if test -f "$ac_dir/$ac_prog" || test -f "$ac_dir/$ac_prog$ac_exeext"; then + lt_cv_path_LD="$ac_dir/$ac_prog" + # Check to see if the program is GNU ld. I'd rather use --version, + # but apparently some variants of GNU ld only accept -v. + # Break only if it was the GNU/non-GNU ld that we prefer. + case `"$lt_cv_path_LD" -v 2>&1 &5 +echo "${ECHO_T}$LD" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi +test -z "$LD" && { { echo "$as_me:$LINENO: error: no acceptable ld found in \$PATH" >&5 +echo "$as_me: error: no acceptable ld found in \$PATH" >&2;} + { (exit 1); exit 1; }; } +{ echo "$as_me:$LINENO: checking if the linker ($LD) is GNU ld" >&5 +echo $ECHO_N "checking if the linker ($LD) is GNU ld... $ECHO_C" >&6; } +if test "${lt_cv_prog_gnu_ld+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + # I'd rather use --version here, but apparently some GNU lds only accept -v. +case `$LD -v 2>&1 &5 +echo "${ECHO_T}$lt_cv_prog_gnu_ld" >&6; } +with_gnu_ld=$lt_cv_prog_gnu_ld + + + + + + + + + +{ echo "$as_me:$LINENO: checking for BSD- or MS-compatible name lister (nm)" >&5 +echo $ECHO_N "checking for BSD- or MS-compatible name lister (nm)... $ECHO_C" >&6; } +if test "${lt_cv_path_NM+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$NM"; then + # Let the user override the test. + lt_cv_path_NM="$NM" +else + lt_nm_to_check="${ac_tool_prefix}nm" + if test -n "$ac_tool_prefix" && test "$build" = "$host"; then + lt_nm_to_check="$lt_nm_to_check nm" + fi + for lt_tmp_nm in $lt_nm_to_check; do + lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR + for ac_dir in $PATH /usr/ccs/bin/elf /usr/ccs/bin /usr/ucb /bin; do + IFS="$lt_save_ifs" + test -z "$ac_dir" && ac_dir=. + tmp_nm="$ac_dir/$lt_tmp_nm" + if test -f "$tmp_nm" || test -f "$tmp_nm$ac_exeext" ; then + # Check to see if the nm accepts a BSD-compat flag. + # Adding the `sed 1q' prevents false positives on HP-UX, which says: + # nm: unknown option "B" ignored + # Tru64's nm complains that /dev/null is an invalid object file + case `"$tmp_nm" -B /dev/null 2>&1 | sed '1q'` in + */dev/null* | *'Invalid file or object type'*) + lt_cv_path_NM="$tmp_nm -B" + break + ;; + *) + case `"$tmp_nm" -p /dev/null 2>&1 | sed '1q'` in + */dev/null*) + lt_cv_path_NM="$tmp_nm -p" + break + ;; + *) + lt_cv_path_NM=${lt_cv_path_NM="$tmp_nm"} # keep the first match, but + continue # so that we can try to find one that supports BSD flags + ;; + esac + ;; + esac + fi + done + IFS="$lt_save_ifs" + done + : ${lt_cv_path_NM=no} +fi +fi +{ echo "$as_me:$LINENO: result: $lt_cv_path_NM" >&5 +echo "${ECHO_T}$lt_cv_path_NM" >&6; } +if test "$lt_cv_path_NM" != "no"; then + NM="$lt_cv_path_NM" +else + # Didn't find any BSD compatible name lister, look for dumpbin. + if test -n "$DUMPBIN"; then : + # Let the user override the test. + else + if test -n "$ac_tool_prefix"; then + for ac_prog in dumpbin "link -dump" + do + # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args. +set dummy $ac_tool_prefix$ac_prog; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_DUMPBIN+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$DUMPBIN"; then + ac_cv_prog_DUMPBIN="$DUMPBIN" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_DUMPBIN="$ac_tool_prefix$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +DUMPBIN=$ac_cv_prog_DUMPBIN +if test -n "$DUMPBIN"; then + { echo "$as_me:$LINENO: result: $DUMPBIN" >&5 +echo "${ECHO_T}$DUMPBIN" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + + test -n "$DUMPBIN" && break + done +fi +if test -z "$DUMPBIN"; then + ac_ct_DUMPBIN=$DUMPBIN + for ac_prog in dumpbin "link -dump" +do + # Extract the first word of "$ac_prog", so it can be a program name with args. +set dummy $ac_prog; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_ac_ct_DUMPBIN+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_DUMPBIN"; then + ac_cv_prog_ac_ct_DUMPBIN="$ac_ct_DUMPBIN" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_ac_ct_DUMPBIN="$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +ac_ct_DUMPBIN=$ac_cv_prog_ac_ct_DUMPBIN +if test -n "$ac_ct_DUMPBIN"; then + { echo "$as_me:$LINENO: result: $ac_ct_DUMPBIN" >&5 +echo "${ECHO_T}$ac_ct_DUMPBIN" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + + test -n "$ac_ct_DUMPBIN" && break +done + + if test "x$ac_ct_DUMPBIN" = x; then + DUMPBIN=":" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ echo "$as_me:$LINENO: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&5 +echo "$as_me: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&2;} +ac_tool_warned=yes ;; +esac + DUMPBIN=$ac_ct_DUMPBIN + fi +fi + + case `$DUMPBIN -symbols /dev/null 2>&1 | sed '1q'` in + *COFF*) + DUMPBIN="$DUMPBIN -symbols" + ;; + *) + DUMPBIN=: + ;; + esac + fi + + if test "$DUMPBIN" != ":"; then + NM="$DUMPBIN" + fi +fi +test -z "$NM" && NM=nm + + + + + + +{ echo "$as_me:$LINENO: checking the name lister ($NM) interface" >&5 +echo $ECHO_N "checking the name lister ($NM) interface... $ECHO_C" >&6; } +if test "${lt_cv_nm_interface+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_nm_interface="BSD nm" + echo "int some_variable = 0;" > conftest.$ac_ext + (eval echo "\"\$as_me:$LINENO: $ac_compile\"" >&5) + (eval "$ac_compile" 2>conftest.err) + cat conftest.err >&5 + (eval echo "\"\$as_me:$LINENO: $NM \\\"conftest.$ac_objext\\\"\"" >&5) + (eval "$NM \"conftest.$ac_objext\"" 2>conftest.err > conftest.out) + cat conftest.err >&5 + (eval echo "\"\$as_me:$LINENO: output\"" >&5) + cat conftest.out >&5 + if $GREP 'External.*some_variable' conftest.out > /dev/null; then + lt_cv_nm_interface="MS dumpbin" + fi + rm -f conftest* +fi +{ echo "$as_me:$LINENO: result: $lt_cv_nm_interface" >&5 +echo "${ECHO_T}$lt_cv_nm_interface" >&6; } + +{ echo "$as_me:$LINENO: checking whether ln -s works" >&5 +echo $ECHO_N "checking whether ln -s works... $ECHO_C" >&6; } +LN_S=$as_ln_s +if test "$LN_S" = "ln -s"; then + { echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6; } +else + { echo "$as_me:$LINENO: result: no, using $LN_S" >&5 +echo "${ECHO_T}no, using $LN_S" >&6; } +fi + +# find the maximum length of command line arguments +{ echo "$as_me:$LINENO: checking the maximum length of command line arguments" >&5 +echo $ECHO_N "checking the maximum length of command line arguments... $ECHO_C" >&6; } +if test "${lt_cv_sys_max_cmd_len+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + i=0 + teststring="ABCD" + + case $build_os in + msdosdjgpp*) + # On DJGPP, this test can blow up pretty badly due to problems in libc + # (any single argument exceeding 2000 bytes causes a buffer overrun + # during glob expansion). Even if it were fixed, the result of this + # check would be larger than it should be. + lt_cv_sys_max_cmd_len=12288; # 12K is about right + ;; + + gnu*) + # Under GNU Hurd, this test is not required because there is + # no limit to the length of command line arguments. + # Libtool will interpret -1 as no limit whatsoever + lt_cv_sys_max_cmd_len=-1; + ;; + + cygwin* | mingw* | cegcc*) + # On Win9x/ME, this test blows up -- it succeeds, but takes + # about 5 minutes as the teststring grows exponentially. + # Worse, since 9x/ME are not pre-emptively multitasking, + # you end up with a "frozen" computer, even though with patience + # the test eventually succeeds (with a max line length of 256k). + # Instead, let's just punt: use the minimum linelength reported by + # all of the supported platforms: 8192 (on NT/2K/XP). + lt_cv_sys_max_cmd_len=8192; + ;; + + mint*) + # On MiNT this can take a long time and run out of memory. + lt_cv_sys_max_cmd_len=8192; + ;; + + amigaos*) + # On AmigaOS with pdksh, this test takes hours, literally. + # So we just punt and use a minimum line length of 8192. + lt_cv_sys_max_cmd_len=8192; + ;; + + netbsd* | freebsd* | openbsd* | darwin* | dragonfly*) + # This has been around since 386BSD, at least. Likely further. + if test -x /sbin/sysctl; then + lt_cv_sys_max_cmd_len=`/sbin/sysctl -n kern.argmax` + elif test -x /usr/sbin/sysctl; then + lt_cv_sys_max_cmd_len=`/usr/sbin/sysctl -n kern.argmax` + else + lt_cv_sys_max_cmd_len=65536 # usable default for all BSDs + fi + # And add a safety zone + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4` + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3` + ;; + + interix*) + # We know the value 262144 and hardcode it with a safety zone (like BSD) + lt_cv_sys_max_cmd_len=196608 + ;; + + os2*) + # The test takes a long time on OS/2. + lt_cv_sys_max_cmd_len=8192 + ;; + + osf*) + # Dr. Hans Ekkehard Plesser reports seeing a kernel panic running configure + # due to this test when exec_disable_arg_limit is 1 on Tru64. It is not + # nice to cause kernel panics so lets avoid the loop below. + # First set a reasonable default. + lt_cv_sys_max_cmd_len=16384 + # + if test -x /sbin/sysconfig; then + case `/sbin/sysconfig -q proc exec_disable_arg_limit` in + *1*) lt_cv_sys_max_cmd_len=-1 ;; + esac + fi + ;; + sco3.2v5*) + lt_cv_sys_max_cmd_len=102400 + ;; + sysv5* | sco5v6* | sysv4.2uw2*) + kargmax=`grep ARG_MAX /etc/conf/cf.d/stune 2>/dev/null` + if test -n "$kargmax"; then + lt_cv_sys_max_cmd_len=`echo $kargmax | sed 's/.*[ ]//'` + else + lt_cv_sys_max_cmd_len=32768 + fi + ;; + *) + lt_cv_sys_max_cmd_len=`(getconf ARG_MAX) 2> /dev/null` + if test -n "$lt_cv_sys_max_cmd_len"; then + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4` + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3` + else + # Make teststring a little bigger before we do anything with it. + # a 1K string should be a reasonable start. + for i in 1 2 3 4 5 6 7 8 ; do + teststring=$teststring$teststring + done + SHELL=${SHELL-${CONFIG_SHELL-/bin/sh}} + # If test is not a shell built-in, we'll probably end up computing a + # maximum length that is only half of the actual maximum length, but + # we can't tell. + while { test "X"`env echo "$teststring$teststring" 2>/dev/null` \ + = "X$teststring$teststring"; } >/dev/null 2>&1 && + test $i != 17 # 1/2 MB should be enough + do + i=`expr $i + 1` + teststring=$teststring$teststring + done + # Only check the string length outside the loop. + lt_cv_sys_max_cmd_len=`expr "X$teststring" : ".*" 2>&1` + teststring= + # Add a significant safety factor because C++ compilers can tack on + # massive amounts of additional arguments before passing them to the + # linker. It appears as though 1/2 is a usable value. + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 2` + fi + ;; + esac + +fi + +if test -n $lt_cv_sys_max_cmd_len ; then + { echo "$as_me:$LINENO: result: $lt_cv_sys_max_cmd_len" >&5 +echo "${ECHO_T}$lt_cv_sys_max_cmd_len" >&6; } +else + { echo "$as_me:$LINENO: result: none" >&5 +echo "${ECHO_T}none" >&6; } +fi +max_cmd_len=$lt_cv_sys_max_cmd_len + + + + + + +: ${CP="cp -f"} +: ${MV="mv -f"} +: ${RM="rm -f"} + +{ echo "$as_me:$LINENO: checking whether the shell understands some XSI constructs" >&5 +echo $ECHO_N "checking whether the shell understands some XSI constructs... $ECHO_C" >&6; } +# Try some XSI features +xsi_shell=no +( _lt_dummy="a/b/c" + test "${_lt_dummy##*/},${_lt_dummy%/*},${_lt_dummy#??}"${_lt_dummy%"$_lt_dummy"}, \ + = c,a/b,b/c, \ + && eval 'test $(( 1 + 1 )) -eq 2 \ + && test "${#_lt_dummy}" -eq 5' ) >/dev/null 2>&1 \ + && xsi_shell=yes +{ echo "$as_me:$LINENO: result: $xsi_shell" >&5 +echo "${ECHO_T}$xsi_shell" >&6; } + + +{ echo "$as_me:$LINENO: checking whether the shell understands \"+=\"" >&5 +echo $ECHO_N "checking whether the shell understands \"+=\"... $ECHO_C" >&6; } +lt_shell_append=no +( foo=bar; set foo baz; eval "$1+=\$2" && test "$foo" = barbaz ) \ + >/dev/null 2>&1 \ + && lt_shell_append=yes +{ echo "$as_me:$LINENO: result: $lt_shell_append" >&5 +echo "${ECHO_T}$lt_shell_append" >&6; } + + +if ( (MAIL=60; unset MAIL) || exit) >/dev/null 2>&1; then + lt_unset=unset +else + lt_unset=false +fi + + + + + +# test EBCDIC or ASCII +case `echo X|tr X '\101'` in + A) # ASCII based system + # \n is not interpreted correctly by Solaris 8 /usr/ucb/tr + lt_SP2NL='tr \040 \012' + lt_NL2SP='tr \015\012 \040\040' + ;; + *) # EBCDIC based system + lt_SP2NL='tr \100 \n' + lt_NL2SP='tr \r\n \100\100' + ;; +esac + + + + + + + + + +{ echo "$as_me:$LINENO: checking how to convert $build file names to $host format" >&5 +echo $ECHO_N "checking how to convert $build file names to $host format... $ECHO_C" >&6; } +if test "${lt_cv_to_host_file_cmd+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + case $host in + *-*-mingw* ) + case $build in + *-*-mingw* ) # actually msys + lt_cv_to_host_file_cmd=func_convert_file_msys_to_w32 + ;; + *-*-cygwin* ) + lt_cv_to_host_file_cmd=func_convert_file_cygwin_to_w32 + ;; + * ) # otherwise, assume *nix + lt_cv_to_host_file_cmd=func_convert_file_nix_to_w32 + ;; + esac + ;; + *-*-cygwin* ) + case $build in + *-*-mingw* ) # actually msys + lt_cv_to_host_file_cmd=func_convert_file_msys_to_cygwin + ;; + *-*-cygwin* ) + lt_cv_to_host_file_cmd=func_convert_file_noop + ;; + * ) # otherwise, assume *nix + lt_cv_to_host_file_cmd=func_convert_file_nix_to_cygwin + ;; + esac + ;; + * ) # unhandled hosts (and "normal" native builds) + lt_cv_to_host_file_cmd=func_convert_file_noop + ;; +esac + +fi + +to_host_file_cmd=$lt_cv_to_host_file_cmd +{ echo "$as_me:$LINENO: result: $lt_cv_to_host_file_cmd" >&5 +echo "${ECHO_T}$lt_cv_to_host_file_cmd" >&6; } + + + + + +{ echo "$as_me:$LINENO: checking how to convert $build file names to toolchain format" >&5 +echo $ECHO_N "checking how to convert $build file names to toolchain format... $ECHO_C" >&6; } +if test "${lt_cv_to_tool_file_cmd+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + #assume ordinary cross tools, or native build. +lt_cv_to_tool_file_cmd=func_convert_file_noop +case $host in + *-*-mingw* ) + case $build in + *-*-mingw* ) # actually msys + lt_cv_to_tool_file_cmd=func_convert_file_msys_to_w32 + ;; + esac + ;; +esac + +fi + +to_tool_file_cmd=$lt_cv_to_tool_file_cmd +{ echo "$as_me:$LINENO: result: $lt_cv_to_tool_file_cmd" >&5 +echo "${ECHO_T}$lt_cv_to_tool_file_cmd" >&6; } + + + + + +{ echo "$as_me:$LINENO: checking for $LD option to reload object files" >&5 +echo $ECHO_N "checking for $LD option to reload object files... $ECHO_C" >&6; } +if test "${lt_cv_ld_reload_flag+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_ld_reload_flag='-r' +fi +{ echo "$as_me:$LINENO: result: $lt_cv_ld_reload_flag" >&5 +echo "${ECHO_T}$lt_cv_ld_reload_flag" >&6; } +reload_flag=$lt_cv_ld_reload_flag +case $reload_flag in +"" | " "*) ;; +*) reload_flag=" $reload_flag" ;; +esac +reload_cmds='$LD$reload_flag -o $output$reload_objs' +case $host_os in + cygwin* | mingw* | pw32* | cegcc*) + if test "$GCC" != yes; then + reload_cmds=false + fi + ;; + darwin*) + if test "$GCC" = yes; then + reload_cmds='$LTCC $LTCFLAGS -nostdlib ${wl}-r -o $output$reload_objs' + else + reload_cmds='$LD$reload_flag -o $output$reload_objs' + fi + ;; +esac + + + + + + + + + +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}objdump", so it can be a program name with args. +set dummy ${ac_tool_prefix}objdump; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_OBJDUMP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$OBJDUMP"; then + ac_cv_prog_OBJDUMP="$OBJDUMP" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_OBJDUMP="${ac_tool_prefix}objdump" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +OBJDUMP=$ac_cv_prog_OBJDUMP +if test -n "$OBJDUMP"; then + { echo "$as_me:$LINENO: result: $OBJDUMP" >&5 +echo "${ECHO_T}$OBJDUMP" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_OBJDUMP"; then + ac_ct_OBJDUMP=$OBJDUMP + # Extract the first word of "objdump", so it can be a program name with args. +set dummy objdump; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_ac_ct_OBJDUMP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_OBJDUMP"; then + ac_cv_prog_ac_ct_OBJDUMP="$ac_ct_OBJDUMP" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_ac_ct_OBJDUMP="objdump" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +ac_ct_OBJDUMP=$ac_cv_prog_ac_ct_OBJDUMP +if test -n "$ac_ct_OBJDUMP"; then + { echo "$as_me:$LINENO: result: $ac_ct_OBJDUMP" >&5 +echo "${ECHO_T}$ac_ct_OBJDUMP" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + if test "x$ac_ct_OBJDUMP" = x; then + OBJDUMP="false" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ echo "$as_me:$LINENO: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&5 +echo "$as_me: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&2;} +ac_tool_warned=yes ;; +esac + OBJDUMP=$ac_ct_OBJDUMP + fi +else + OBJDUMP="$ac_cv_prog_OBJDUMP" +fi + +test -z "$OBJDUMP" && OBJDUMP=objdump + + + + + + + + + +{ echo "$as_me:$LINENO: checking how to recognize dependent libraries" >&5 +echo $ECHO_N "checking how to recognize dependent libraries... $ECHO_C" >&6; } +if test "${lt_cv_deplibs_check_method+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_file_magic_cmd='$MAGIC_CMD' +lt_cv_file_magic_test_file= +lt_cv_deplibs_check_method='unknown' +# Need to set the preceding variable on all platforms that support +# interlibrary dependencies. +# 'none' -- dependencies not supported. +# `unknown' -- same as none, but documents that we really don't know. +# 'pass_all' -- all dependencies passed with no checks. +# 'test_compile' -- check by making test program. +# 'file_magic [[regex]]' -- check by looking for files in library path +# which responds to the $file_magic_cmd with a given extended regex. +# If you have `file' or equivalent on your system and you're not sure +# whether `pass_all' will *always* work, you probably want this one. + +case $host_os in +aix[4-9]*) + lt_cv_deplibs_check_method=pass_all + ;; + +beos*) + lt_cv_deplibs_check_method=pass_all + ;; + +bsdi[45]*) + lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (shared object|dynamic lib)' + lt_cv_file_magic_cmd='/usr/bin/file -L' + lt_cv_file_magic_test_file=/shlib/libc.so + ;; + +cygwin*) + # func_win32_libid is a shell function defined in ltmain.sh + lt_cv_deplibs_check_method='file_magic ^x86 archive import|^x86 DLL' + lt_cv_file_magic_cmd='func_win32_libid' + ;; + +mingw* | pw32*) + # Base MSYS/MinGW do not provide the 'file' command needed by + # func_win32_libid shell function, so use a weaker test based on 'objdump', + # unless we find 'file', for example because we are cross-compiling. + # func_win32_libid assumes BSD nm, so disallow it if using MS dumpbin. + if ( test "$lt_cv_nm_interface" = "BSD nm" && file / ) >/dev/null 2>&1; then + lt_cv_deplibs_check_method='file_magic ^x86 archive import|^x86 DLL' + lt_cv_file_magic_cmd='func_win32_libid' + else + # Keep this pattern in sync with the one in func_win32_libid. + lt_cv_deplibs_check_method='file_magic file format (pei*-i386(.*architecture: i386)?|pe-arm-wince|pe-x86-64)' + lt_cv_file_magic_cmd='$OBJDUMP -f' + fi + ;; + +cegcc*) + # use the weaker test based on 'objdump'. See mingw*. + lt_cv_deplibs_check_method='file_magic file format pe-arm-.*little(.*architecture: arm)?' + lt_cv_file_magic_cmd='$OBJDUMP -f' + ;; + +darwin* | rhapsody*) + lt_cv_deplibs_check_method=pass_all + ;; + +freebsd* | dragonfly*) + if echo __ELF__ | $CC -E - | $GREP __ELF__ > /dev/null; then + case $host_cpu in + i*86 ) + # Not sure whether the presence of OpenBSD here was a mistake. + # Let's accept both of them until this is cleared up. + lt_cv_deplibs_check_method='file_magic (FreeBSD|OpenBSD|DragonFly)/i[3-9]86 (compact )?demand paged shared library' + lt_cv_file_magic_cmd=/usr/bin/file + lt_cv_file_magic_test_file=`echo /usr/lib/libc.so.*` + ;; + esac + else + lt_cv_deplibs_check_method=pass_all + fi + ;; + +gnu*) + lt_cv_deplibs_check_method=pass_all + ;; + +haiku*) + lt_cv_deplibs_check_method=pass_all + ;; + +hpux10.20* | hpux11*) + lt_cv_file_magic_cmd=/usr/bin/file + case $host_cpu in + ia64*) + lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|ELF-[0-9][0-9]) shared object file - IA64' + lt_cv_file_magic_test_file=/usr/lib/hpux32/libc.so + ;; + hppa*64*) + lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|ELF[ -][0-9][0-9])(-bit)?( [LM]SB)? shared object( file)?[, -]* PA-RISC [0-9]\.[0-9]' + lt_cv_file_magic_test_file=/usr/lib/pa20_64/libc.sl + ;; + *) + lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|PA-RISC[0-9]\.[0-9]) shared library' + lt_cv_file_magic_test_file=/usr/lib/libc.sl + ;; + esac + ;; + +interix[3-9]*) + # PIC code is broken on Interix 3.x, that's why |\.a not |_pic\.a here + lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so|\.a)$' + ;; + +irix5* | irix6* | nonstopux*) + case $LD in + *-32|*"-32 ") libmagic=32-bit;; + *-n32|*"-n32 ") libmagic=N32;; + *-64|*"-64 ") libmagic=64-bit;; + *) libmagic=never-match;; + esac + lt_cv_deplibs_check_method=pass_all + ;; + +# This must be glibc/ELF. +linux* | k*bsd*-gnu | kopensolaris*-gnu) + lt_cv_deplibs_check_method=pass_all + ;; + +netbsd*) + if echo __ELF__ | $CC -E - | $GREP __ELF__ > /dev/null; then + lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|_pic\.a)$' + else + lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so|_pic\.a)$' + fi + ;; + +newos6*) + lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (executable|dynamic lib)' + lt_cv_file_magic_cmd=/usr/bin/file + lt_cv_file_magic_test_file=/usr/lib/libnls.so + ;; + +*nto* | *qnx*) + lt_cv_deplibs_check_method=pass_all + ;; + +openbsd*) + if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then + lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|\.so|_pic\.a)$' + else + lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|_pic\.a)$' + fi + ;; + +osf3* | osf4* | osf5*) + lt_cv_deplibs_check_method=pass_all + ;; + +rdos*) + lt_cv_deplibs_check_method=pass_all + ;; + +solaris*) + lt_cv_deplibs_check_method=pass_all + ;; + +sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*) + lt_cv_deplibs_check_method=pass_all + ;; + +sysv4 | sysv4.3*) + case $host_vendor in + motorola) + lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (shared object|dynamic lib) M[0-9][0-9]* Version [0-9]' + lt_cv_file_magic_test_file=`echo /usr/lib/libc.so*` + ;; + ncr) + lt_cv_deplibs_check_method=pass_all + ;; + sequent) + lt_cv_file_magic_cmd='/bin/file' + lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [LM]SB (shared object|dynamic lib )' + ;; + sni) + lt_cv_file_magic_cmd='/bin/file' + lt_cv_deplibs_check_method="file_magic ELF [0-9][0-9]*-bit [LM]SB dynamic lib" + lt_cv_file_magic_test_file=/lib/libc.so + ;; + siemens) + lt_cv_deplibs_check_method=pass_all + ;; + pc) + lt_cv_deplibs_check_method=pass_all + ;; + esac + ;; + +tpf*) + lt_cv_deplibs_check_method=pass_all + ;; +esac + +fi +{ echo "$as_me:$LINENO: result: $lt_cv_deplibs_check_method" >&5 +echo "${ECHO_T}$lt_cv_deplibs_check_method" >&6; } + +file_magic_glob= +want_nocaseglob=no +if test "$build" = "$host"; then + case $host_os in + mingw* | pw32*) + if ( shopt | grep nocaseglob ) >/dev/null 2>&1; then + want_nocaseglob=yes + else + file_magic_glob=`echo aAbBcCdDeEfFgGhHiIjJkKlLmMnNoOpPqQrRsStTuUvVwWxXyYzZ | $SED -e "s/\(..\)/s\/[\1]\/[\1]\/g;/g"` + fi + ;; + esac +fi + +file_magic_cmd=$lt_cv_file_magic_cmd +deplibs_check_method=$lt_cv_deplibs_check_method +test -z "$deplibs_check_method" && deplibs_check_method=unknown + + + + + + + + + + + + + + + + + + + + + + +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}dlltool", so it can be a program name with args. +set dummy ${ac_tool_prefix}dlltool; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_DLLTOOL+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$DLLTOOL"; then + ac_cv_prog_DLLTOOL="$DLLTOOL" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_DLLTOOL="${ac_tool_prefix}dlltool" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +DLLTOOL=$ac_cv_prog_DLLTOOL +if test -n "$DLLTOOL"; then + { echo "$as_me:$LINENO: result: $DLLTOOL" >&5 +echo "${ECHO_T}$DLLTOOL" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_DLLTOOL"; then + ac_ct_DLLTOOL=$DLLTOOL + # Extract the first word of "dlltool", so it can be a program name with args. +set dummy dlltool; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_ac_ct_DLLTOOL+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_DLLTOOL"; then + ac_cv_prog_ac_ct_DLLTOOL="$ac_ct_DLLTOOL" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_ac_ct_DLLTOOL="dlltool" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +ac_ct_DLLTOOL=$ac_cv_prog_ac_ct_DLLTOOL +if test -n "$ac_ct_DLLTOOL"; then + { echo "$as_me:$LINENO: result: $ac_ct_DLLTOOL" >&5 +echo "${ECHO_T}$ac_ct_DLLTOOL" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + if test "x$ac_ct_DLLTOOL" = x; then + DLLTOOL="false" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ echo "$as_me:$LINENO: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&5 +echo "$as_me: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&2;} +ac_tool_warned=yes ;; +esac + DLLTOOL=$ac_ct_DLLTOOL + fi +else + DLLTOOL="$ac_cv_prog_DLLTOOL" +fi + +test -z "$DLLTOOL" && DLLTOOL=dlltool + + + + + + + + + + +{ echo "$as_me:$LINENO: checking how to associate runtime and link libraries" >&5 +echo $ECHO_N "checking how to associate runtime and link libraries... $ECHO_C" >&6; } +if test "${lt_cv_sharedlib_from_linklib_cmd+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_sharedlib_from_linklib_cmd='unknown' + +case $host_os in +cygwin* | mingw* | pw32* | cegcc*) + # two different shell functions defined in ltmain.sh + # decide which to use based on capabilities of $DLLTOOL + case `$DLLTOOL --help 2>&1` in + *--identify-strict*) + lt_cv_sharedlib_from_linklib_cmd=func_cygming_dll_for_implib + ;; + *) + lt_cv_sharedlib_from_linklib_cmd=func_cygming_dll_for_implib_fallback + ;; + esac + ;; +*) + # fallback: assume linklib IS sharedlib + lt_cv_sharedlib_from_linklib_cmd="$ECHO" + ;; +esac + +fi +{ echo "$as_me:$LINENO: result: $lt_cv_sharedlib_from_linklib_cmd" >&5 +echo "${ECHO_T}$lt_cv_sharedlib_from_linklib_cmd" >&6; } +sharedlib_from_linklib_cmd=$lt_cv_sharedlib_from_linklib_cmd +test -z "$sharedlib_from_linklib_cmd" && sharedlib_from_linklib_cmd=$ECHO + + + + + + + + +if test -n "$ac_tool_prefix"; then + for ac_prog in ar + do + # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args. +set dummy $ac_tool_prefix$ac_prog; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_AR+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$AR"; then + ac_cv_prog_AR="$AR" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_AR="$ac_tool_prefix$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +AR=$ac_cv_prog_AR +if test -n "$AR"; then + { echo "$as_me:$LINENO: result: $AR" >&5 +echo "${ECHO_T}$AR" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + + test -n "$AR" && break + done +fi +if test -z "$AR"; then + ac_ct_AR=$AR + for ac_prog in ar +do + # Extract the first word of "$ac_prog", so it can be a program name with args. +set dummy $ac_prog; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_ac_ct_AR+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_AR"; then + ac_cv_prog_ac_ct_AR="$ac_ct_AR" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_ac_ct_AR="$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +ac_ct_AR=$ac_cv_prog_ac_ct_AR +if test -n "$ac_ct_AR"; then + { echo "$as_me:$LINENO: result: $ac_ct_AR" >&5 +echo "${ECHO_T}$ac_ct_AR" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + + test -n "$ac_ct_AR" && break +done + + if test "x$ac_ct_AR" = x; then + AR="false" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ echo "$as_me:$LINENO: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&5 +echo "$as_me: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&2;} +ac_tool_warned=yes ;; +esac + AR=$ac_ct_AR + fi +fi + +: ${AR=ar} +: ${AR_FLAGS=cru} + + + + + + + + + + + +{ echo "$as_me:$LINENO: checking for archiver @FILE support" >&5 +echo $ECHO_N "checking for archiver @FILE support... $ECHO_C" >&6; } +if test "${lt_cv_ar_at_file+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_ar_at_file=no + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (ac_try="$ac_compile" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compile") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest.$ac_objext; then + echo conftest.$ac_objext > conftest.lst + lt_ar_try='$AR $AR_FLAGS libconftest.a @conftest.lst >&5' + { (eval echo "$as_me:$LINENO: \"$lt_ar_try\"") >&5 + (eval $lt_ar_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } + if test "$ac_status" -eq 0; then + # Ensure the archiver fails upon bogus file names. + rm -f conftest.$ac_objext libconftest.a + { (eval echo "$as_me:$LINENO: \"$lt_ar_try\"") >&5 + (eval $lt_ar_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } + if test "$ac_status" -ne 0; then + lt_cv_ar_at_file=@ + fi + fi + rm -f conftest.* libconftest.a + +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + +fi + +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext + +fi +{ echo "$as_me:$LINENO: result: $lt_cv_ar_at_file" >&5 +echo "${ECHO_T}$lt_cv_ar_at_file" >&6; } + +if test "x$lt_cv_ar_at_file" = xno; then + archiver_list_spec= +else + archiver_list_spec=$lt_cv_ar_at_file +fi + + + + + + + +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}strip", so it can be a program name with args. +set dummy ${ac_tool_prefix}strip; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_STRIP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$STRIP"; then + ac_cv_prog_STRIP="$STRIP" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_STRIP="${ac_tool_prefix}strip" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +STRIP=$ac_cv_prog_STRIP +if test -n "$STRIP"; then + { echo "$as_me:$LINENO: result: $STRIP" >&5 +echo "${ECHO_T}$STRIP" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_STRIP"; then + ac_ct_STRIP=$STRIP + # Extract the first word of "strip", so it can be a program name with args. +set dummy strip; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_ac_ct_STRIP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_STRIP"; then + ac_cv_prog_ac_ct_STRIP="$ac_ct_STRIP" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_ac_ct_STRIP="strip" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +ac_ct_STRIP=$ac_cv_prog_ac_ct_STRIP +if test -n "$ac_ct_STRIP"; then + { echo "$as_me:$LINENO: result: $ac_ct_STRIP" >&5 +echo "${ECHO_T}$ac_ct_STRIP" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + if test "x$ac_ct_STRIP" = x; then + STRIP=":" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ echo "$as_me:$LINENO: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&5 +echo "$as_me: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&2;} +ac_tool_warned=yes ;; +esac + STRIP=$ac_ct_STRIP + fi +else + STRIP="$ac_cv_prog_STRIP" +fi + +test -z "$STRIP" && STRIP=: + + + + + + +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}ranlib", so it can be a program name with args. +set dummy ${ac_tool_prefix}ranlib; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_RANLIB+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$RANLIB"; then + ac_cv_prog_RANLIB="$RANLIB" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_RANLIB="${ac_tool_prefix}ranlib" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +RANLIB=$ac_cv_prog_RANLIB +if test -n "$RANLIB"; then + { echo "$as_me:$LINENO: result: $RANLIB" >&5 +echo "${ECHO_T}$RANLIB" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_RANLIB"; then + ac_ct_RANLIB=$RANLIB + # Extract the first word of "ranlib", so it can be a program name with args. +set dummy ranlib; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_ac_ct_RANLIB+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_RANLIB"; then + ac_cv_prog_ac_ct_RANLIB="$ac_ct_RANLIB" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_ac_ct_RANLIB="ranlib" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +ac_ct_RANLIB=$ac_cv_prog_ac_ct_RANLIB +if test -n "$ac_ct_RANLIB"; then + { echo "$as_me:$LINENO: result: $ac_ct_RANLIB" >&5 +echo "${ECHO_T}$ac_ct_RANLIB" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + if test "x$ac_ct_RANLIB" = x; then + RANLIB=":" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ echo "$as_me:$LINENO: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&5 +echo "$as_me: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&2;} +ac_tool_warned=yes ;; +esac + RANLIB=$ac_ct_RANLIB + fi +else + RANLIB="$ac_cv_prog_RANLIB" +fi + +test -z "$RANLIB" && RANLIB=: + + + + + + +# Determine commands to create old-style static archives. +old_archive_cmds='$AR $AR_FLAGS $oldlib$oldobjs' +old_postinstall_cmds='chmod 644 $oldlib' +old_postuninstall_cmds= + +if test -n "$RANLIB"; then + case $host_os in + openbsd*) + old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB -t \$tool_oldlib" + ;; + *) + old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB \$tool_oldlib" + ;; + esac + old_archive_cmds="$old_archive_cmds~\$RANLIB \$tool_oldlib" +fi + +case $host_os in + darwin*) + lock_old_archive_extraction=yes ;; + *) + lock_old_archive_extraction=no ;; +esac + + + + + + + + + + + + + + + + + + + + + +for ac_prog in gawk mawk nawk awk +do + # Extract the first word of "$ac_prog", so it can be a program name with args. +set dummy $ac_prog; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_AWK+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$AWK"; then + ac_cv_prog_AWK="$AWK" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_AWK="$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +AWK=$ac_cv_prog_AWK +if test -n "$AWK"; then + { echo "$as_me:$LINENO: result: $AWK" >&5 +echo "${ECHO_T}$AWK" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + + test -n "$AWK" && break +done + + + + + + + + + + + + + + + + + + + +# If no C compiler was specified, use CC. +LTCC=${LTCC-"$CC"} + +# If no C compiler flags were specified, use CFLAGS. +LTCFLAGS=${LTCFLAGS-"$CFLAGS"} + +# Allow CC to be a program name with arguments. +compiler=$CC + + +# Check for command to grab the raw symbol name followed by C symbol from nm. +{ echo "$as_me:$LINENO: checking command to parse $NM output from $compiler object" >&5 +echo $ECHO_N "checking command to parse $NM output from $compiler object... $ECHO_C" >&6; } +if test "${lt_cv_sys_global_symbol_pipe+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + +# These are sane defaults that work on at least a few old systems. +# [They come from Ultrix. What could be older than Ultrix?!! ;)] + +# Character class describing NM global symbol codes. +symcode='[BCDEGRST]' + +# Regexp to match symbols that can be accessed directly from C. +sympat='\([_A-Za-z][_A-Za-z0-9]*\)' + +# Define system-specific variables. +case $host_os in +aix*) + symcode='[BCDT]' + ;; +cygwin* | mingw* | pw32* | cegcc*) + symcode='[ABCDGISTW]' + ;; +hpux*) + if test "$host_cpu" = ia64; then + symcode='[ABCDEGRST]' + fi + ;; +irix* | nonstopux*) + symcode='[BCDEGRST]' + ;; +osf*) + symcode='[BCDEGQRST]' + ;; +solaris*) + symcode='[BDRT]' + ;; +sco3.2v5*) + symcode='[DT]' + ;; +sysv4.2uw2*) + symcode='[DT]' + ;; +sysv5* | sco5v6* | unixware* | OpenUNIX*) + symcode='[ABDT]' + ;; +sysv4) + symcode='[DFNSTU]' + ;; +esac + +# If we're using GNU nm, then use its standard symbol codes. +case `$NM -V 2>&1` in +*GNU* | *'with BFD'*) + symcode='[ABCDGIRSTW]' ;; +esac + +# Transform an extracted symbol line into a proper C declaration. +# Some systems (esp. on ia64) link data and code symbols differently, +# so use this general approach. +lt_cv_sys_global_symbol_to_cdecl="sed -n -e 's/^T .* \(.*\)$/extern int \1();/p' -e 's/^$symcode* .* \(.*\)$/extern char \1;/p'" + +# Transform an extracted symbol line into symbol name and symbol address +lt_cv_sys_global_symbol_to_c_name_address="sed -n -e 's/^: \([^ ]*\)[ ]*$/ {\\\"\1\\\", (void *) 0},/p' -e 's/^$symcode* \([^ ]*\) \([^ ]*\)$/ {\"\2\", (void *) \&\2},/p'" +lt_cv_sys_global_symbol_to_c_name_address_lib_prefix="sed -n -e 's/^: \([^ ]*\)[ ]*$/ {\\\"\1\\\", (void *) 0},/p' -e 's/^$symcode* \([^ ]*\) \(lib[^ ]*\)$/ {\"\2\", (void *) \&\2},/p' -e 's/^$symcode* \([^ ]*\) \([^ ]*\)$/ {\"lib\2\", (void *) \&\2},/p'" + +# Handle CRLF in mingw tool chain +opt_cr= +case $build_os in +mingw*) + opt_cr=`$ECHO 'x\{0,1\}' | tr x '\015'` # option cr in regexp + ;; +esac + +# Try without a prefix underscore, then with it. +for ac_symprfx in "" "_"; do + + # Transform symcode, sympat, and symprfx into a raw symbol and a C symbol. + symxfrm="\\1 $ac_symprfx\\2 \\2" + + # Write the raw and C identifiers. + if test "$lt_cv_nm_interface" = "MS dumpbin"; then + # Fake it for dumpbin and say T for any non-static function + # and D for any global variable. + # Also find C++ and __fastcall symbols from MSVC++, + # which start with @ or ?. + lt_cv_sys_global_symbol_pipe="$AWK '"\ +" {last_section=section; section=\$ 3};"\ +" /^COFF SYMBOL TABLE/{for(i in hide) delete hide[i]};"\ +" /Section length .*#relocs.*(pick any)/{hide[last_section]=1};"\ +" \$ 0!~/External *\|/{next};"\ +" / 0+ UNDEF /{next}; / UNDEF \([^|]\)*()/{next};"\ +" {if(hide[section]) next};"\ +" {f=0}; \$ 0~/\(\).*\|/{f=1}; {printf f ? \"T \" : \"D \"};"\ +" {split(\$ 0, a, /\||\r/); split(a[2], s)};"\ +" s[1]~/^[@?]/{print s[1], s[1]; next};"\ +" s[1]~prfx {split(s[1],t,\"@\"); print t[1], substr(t[1],length(prfx))}"\ +" ' prfx=^$ac_symprfx" + else + lt_cv_sys_global_symbol_pipe="sed -n -e 's/^.*[ ]\($symcode$symcode*\)[ ][ ]*$ac_symprfx$sympat$opt_cr$/$symxfrm/p'" + fi + lt_cv_sys_global_symbol_pipe="$lt_cv_sys_global_symbol_pipe | sed '/ __gnu_lto/d'" + + # Check to see that the pipe works correctly. + pipe_works=no + + rm -f conftest* + cat > conftest.$ac_ext <<_LT_EOF +#ifdef __cplusplus +extern "C" { +#endif +char nm_test_var; +void nm_test_func(void); +void nm_test_func(void){} +#ifdef __cplusplus +} +#endif +int main(){nm_test_var='a';nm_test_func();return(0);} +_LT_EOF + + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + # Now try to grab the symbols. + nlist=conftest.nm + if { (eval echo "$as_me:$LINENO: \"$NM conftest.$ac_objext \| "$lt_cv_sys_global_symbol_pipe" \> $nlist\"") >&5 + (eval $NM conftest.$ac_objext \| "$lt_cv_sys_global_symbol_pipe" \> $nlist) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && test -s "$nlist"; then + # Try sorting and uniquifying the output. + if sort "$nlist" | uniq > "$nlist"T; then + mv -f "$nlist"T "$nlist" + else + rm -f "$nlist"T + fi + + # Make sure that we snagged all the symbols we need. + if $GREP ' nm_test_var$' "$nlist" >/dev/null; then + if $GREP ' nm_test_func$' "$nlist" >/dev/null; then + cat <<_LT_EOF > conftest.$ac_ext +/* Keep this code in sync between libtool.m4, ltmain, lt_system.h, and tests. */ +#if defined(_WIN32) || defined(__CYGWIN__) || defined(_WIN32_WCE) +/* DATA imports from DLLs on WIN32 con't be const, because runtime + relocations are performed -- see ld's documentation on pseudo-relocs. */ +# define LT_DLSYM_CONST +#elif defined(__osf__) +/* This system does not cope well with relocations in const data. */ +# define LT_DLSYM_CONST +#else +# define LT_DLSYM_CONST const +#endif + +#ifdef __cplusplus +extern "C" { +#endif + +_LT_EOF + # Now generate the symbol file. + eval "$lt_cv_sys_global_symbol_to_cdecl"' < "$nlist" | $GREP -v main >> conftest.$ac_ext' + + cat <<_LT_EOF >> conftest.$ac_ext + +/* The mapping between symbol names and symbols. */ +LT_DLSYM_CONST struct { + const char *name; + void *address; +} +lt__PROGRAM__LTX_preloaded_symbols[] = +{ + { "@PROGRAM@", (void *) 0 }, +_LT_EOF + $SED "s/^$symcode$symcode* \(.*\) \(.*\)$/ {\"\2\", (void *) \&\2},/" < "$nlist" | $GREP -v main >> conftest.$ac_ext + cat <<\_LT_EOF >> conftest.$ac_ext + {0, (void *) 0} +}; + +/* This works around a problem in FreeBSD linker */ +#ifdef FREEBSD_WORKAROUND +static const void *lt_preloaded_setup() { + return lt__PROGRAM__LTX_preloaded_symbols; +} +#endif + +#ifdef __cplusplus +} +#endif +_LT_EOF + # Now try linking the two files. + mv conftest.$ac_objext conftstm.$ac_objext + lt_globsym_save_LIBS=$LIBS + lt_globsym_save_CFLAGS=$CFLAGS + LIBS="conftstm.$ac_objext" + CFLAGS="$CFLAGS$lt_prog_compiler_no_builtin_flag" + if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && test -s conftest${ac_exeext}; then + pipe_works=yes + fi + LIBS=$lt_globsym_save_LIBS + CFLAGS=$lt_globsym_save_CFLAGS + else + echo "cannot find nm_test_func in $nlist" >&5 + fi + else + echo "cannot find nm_test_var in $nlist" >&5 + fi + else + echo "cannot run $lt_cv_sys_global_symbol_pipe" >&5 + fi + else + echo "$progname: failed program was:" >&5 + cat conftest.$ac_ext >&5 + fi + rm -rf conftest* conftst* + + # Do not use the global_symbol_pipe unless it works. + if test "$pipe_works" = yes; then + break + else + lt_cv_sys_global_symbol_pipe= + fi +done + +fi + +if test -z "$lt_cv_sys_global_symbol_pipe"; then + lt_cv_sys_global_symbol_to_cdecl= +fi +if test -z "$lt_cv_sys_global_symbol_pipe$lt_cv_sys_global_symbol_to_cdecl"; then + { echo "$as_me:$LINENO: result: failed" >&5 +echo "${ECHO_T}failed" >&6; } +else + { echo "$as_me:$LINENO: result: ok" >&5 +echo "${ECHO_T}ok" >&6; } +fi + +# Response file support. +if test "$lt_cv_nm_interface" = "MS dumpbin"; then + nm_file_list_spec='@' +elif $NM --help 2>/dev/null | grep '[@]FILE' >/dev/null; then + nm_file_list_spec='@' +fi + + + + + + + + + + + + + + + + + + + + + + + + + + + +{ echo "$as_me:$LINENO: checking for sysroot" >&5 +echo $ECHO_N "checking for sysroot... $ECHO_C" >&6; } + +# Check whether --with-sysroot was given. +if test "${with_sysroot+set}" = set; then + withval=$with_sysroot; +else + with_sysroot=no +fi + + +lt_sysroot= +case ${with_sysroot} in #( + yes) + if test "$GCC" = yes; then + lt_sysroot=`$CC --print-sysroot 2>/dev/null` + fi + ;; #( + /*) + lt_sysroot=`echo "$with_sysroot" | sed -e "$sed_quote_subst"` + ;; #( + no|'') + ;; #( + *) + { echo "$as_me:$LINENO: result: ${with_sysroot}" >&5 +echo "${ECHO_T}${with_sysroot}" >&6; } + { { echo "$as_me:$LINENO: error: The sysroot must be an absolute path." >&5 +echo "$as_me: error: The sysroot must be an absolute path." >&2;} + { (exit 1); exit 1; }; } + ;; +esac + + { echo "$as_me:$LINENO: result: ${lt_sysroot:-no}" >&5 +echo "${ECHO_T}${lt_sysroot:-no}" >&6; } + + + + + +# Check whether --enable-libtool-lock was given. +if test "${enable_libtool_lock+set}" = set; then + enableval=$enable_libtool_lock; +fi + +test "x$enable_libtool_lock" != xno && enable_libtool_lock=yes + +# Some flags need to be propagated to the compiler or linker for good +# libtool support. +case $host in +ia64-*-hpux*) + # Find out which ABI we are using. + echo 'int i;' > conftest.$ac_ext + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + case `/usr/bin/file conftest.$ac_objext` in + *ELF-32*) + HPUX_IA64_MODE="32" + ;; + *ELF-64*) + HPUX_IA64_MODE="64" + ;; + esac + fi + rm -rf conftest* + ;; +*-*-irix6*) + # Find out which ABI we are using. + echo '#line '$LINENO' "configure"' > conftest.$ac_ext + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + if test "$lt_cv_prog_gnu_ld" = yes; then + case `/usr/bin/file conftest.$ac_objext` in + *32-bit*) + LD="${LD-ld} -melf32bsmip" + ;; + *N32*) + LD="${LD-ld} -melf32bmipn32" + ;; + *64-bit*) + LD="${LD-ld} -melf64bmip" + ;; + esac + else + case `/usr/bin/file conftest.$ac_objext` in + *32-bit*) + LD="${LD-ld} -32" + ;; + *N32*) + LD="${LD-ld} -n32" + ;; + *64-bit*) + LD="${LD-ld} -64" + ;; + esac + fi + fi + rm -rf conftest* + ;; + +x86_64-*kfreebsd*-gnu|x86_64-*linux*|ppc*-*linux*|powerpc*-*linux*| \ +s390*-*linux*|s390*-*tpf*|sparc*-*linux*) + # Find out which ABI we are using. + echo 'int i;' > conftest.$ac_ext + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + case `/usr/bin/file conftest.o` in + *32-bit*) + case $host in + x86_64-*kfreebsd*-gnu) + LD="${LD-ld} -m elf_i386_fbsd" + ;; + x86_64-*linux*) + LD="${LD-ld} -m elf_i386" + ;; + ppc64-*linux*|powerpc64-*linux*) + LD="${LD-ld} -m elf32ppclinux" + ;; + s390x-*linux*) + LD="${LD-ld} -m elf_s390" + ;; + sparc64-*linux*) + LD="${LD-ld} -m elf32_sparc" + ;; + esac + ;; + *64-bit*) + case $host in + x86_64-*kfreebsd*-gnu) + LD="${LD-ld} -m elf_x86_64_fbsd" + ;; + x86_64-*linux*) + LD="${LD-ld} -m elf_x86_64" + ;; + ppc*-*linux*|powerpc*-*linux*) + LD="${LD-ld} -m elf64ppc" + ;; + s390*-*linux*|s390*-*tpf*) + LD="${LD-ld} -m elf64_s390" + ;; + sparc*-*linux*) + LD="${LD-ld} -m elf64_sparc" + ;; + esac + ;; + esac + fi + rm -rf conftest* + ;; + +*-*-sco3.2v5*) + # On SCO OpenServer 5, we need -belf to get full-featured binaries. + SAVE_CFLAGS="$CFLAGS" + CFLAGS="$CFLAGS -belf" + { echo "$as_me:$LINENO: checking whether the C compiler needs -belf" >&5 +echo $ECHO_N "checking whether the C compiler needs -belf... $ECHO_C" >&6; } +if test "${lt_cv_cc_needs_belf+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (ac_try="$ac_link" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_link") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest$ac_exeext && + $as_test_x conftest$ac_exeext; then + lt_cv_cc_needs_belf=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + lt_cv_cc_needs_belf=no +fi + +rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ + conftest$ac_exeext conftest.$ac_ext + ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + +fi +{ echo "$as_me:$LINENO: result: $lt_cv_cc_needs_belf" >&5 +echo "${ECHO_T}$lt_cv_cc_needs_belf" >&6; } + if test x"$lt_cv_cc_needs_belf" != x"yes"; then + # this is probably gcc 2.8.0, egcs 1.0 or newer; no need for -belf + CFLAGS="$SAVE_CFLAGS" + fi + ;; +*-*solaris*) + # Find out which ABI we are using. + echo 'int i;' > conftest.$ac_ext + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + case `/usr/bin/file conftest.o` in + *64-bit*) + case $lt_cv_prog_gnu_ld in + yes*) + case $host in + i?86-*-solaris*) + LD="${LD-ld} -m elf_x86_64" + ;; + sparc*-*-solaris*) + LD="${LD-ld} -m elf64_sparc" + ;; + esac + # GNU ld 2.21 introduced _sol2 emulations. Use them if available. + if ${LD-ld} -V | grep _sol2 >/dev/null 2>&1; then + LD="${LD-ld}_sol2" + fi + ;; + *) + if ${LD-ld} -64 -r -o conftest2.o conftest.o >/dev/null 2>&1; then + LD="${LD-ld} -64" + fi + ;; + esac + ;; + esac + fi + rm -rf conftest* + ;; +esac + +need_locks="$enable_libtool_lock" + +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}mt", so it can be a program name with args. +set dummy ${ac_tool_prefix}mt; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_MANIFEST_TOOL+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$MANIFEST_TOOL"; then + ac_cv_prog_MANIFEST_TOOL="$MANIFEST_TOOL" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_MANIFEST_TOOL="${ac_tool_prefix}mt" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +MANIFEST_TOOL=$ac_cv_prog_MANIFEST_TOOL +if test -n "$MANIFEST_TOOL"; then + { echo "$as_me:$LINENO: result: $MANIFEST_TOOL" >&5 +echo "${ECHO_T}$MANIFEST_TOOL" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_MANIFEST_TOOL"; then + ac_ct_MANIFEST_TOOL=$MANIFEST_TOOL + # Extract the first word of "mt", so it can be a program name with args. +set dummy mt; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_ac_ct_MANIFEST_TOOL+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_MANIFEST_TOOL"; then + ac_cv_prog_ac_ct_MANIFEST_TOOL="$ac_ct_MANIFEST_TOOL" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_ac_ct_MANIFEST_TOOL="mt" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +ac_ct_MANIFEST_TOOL=$ac_cv_prog_ac_ct_MANIFEST_TOOL +if test -n "$ac_ct_MANIFEST_TOOL"; then + { echo "$as_me:$LINENO: result: $ac_ct_MANIFEST_TOOL" >&5 +echo "${ECHO_T}$ac_ct_MANIFEST_TOOL" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + if test "x$ac_ct_MANIFEST_TOOL" = x; then + MANIFEST_TOOL=":" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ echo "$as_me:$LINENO: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&5 +echo "$as_me: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&2;} +ac_tool_warned=yes ;; +esac + MANIFEST_TOOL=$ac_ct_MANIFEST_TOOL + fi +else + MANIFEST_TOOL="$ac_cv_prog_MANIFEST_TOOL" +fi + +test -z "$MANIFEST_TOOL" && MANIFEST_TOOL=mt +{ echo "$as_me:$LINENO: checking if $MANIFEST_TOOL is a manifest tool" >&5 +echo $ECHO_N "checking if $MANIFEST_TOOL is a manifest tool... $ECHO_C" >&6; } +if test "${lt_cv_path_mainfest_tool+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_path_mainfest_tool=no + echo "$as_me:$LINENO: $MANIFEST_TOOL '-?'" >&5 + $MANIFEST_TOOL '-?' 2>conftest.err > conftest.out + cat conftest.err >&5 + if $GREP 'Manifest Tool' conftest.out > /dev/null; then + lt_cv_path_mainfest_tool=yes + fi + rm -f conftest* +fi +{ echo "$as_me:$LINENO: result: $lt_cv_path_mainfest_tool" >&5 +echo "${ECHO_T}$lt_cv_path_mainfest_tool" >&6; } +if test "x$lt_cv_path_mainfest_tool" != xyes; then + MANIFEST_TOOL=: +fi + + + + + + + case $host_os in + rhapsody* | darwin*) + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}dsymutil", so it can be a program name with args. +set dummy ${ac_tool_prefix}dsymutil; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_DSYMUTIL+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$DSYMUTIL"; then + ac_cv_prog_DSYMUTIL="$DSYMUTIL" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_DSYMUTIL="${ac_tool_prefix}dsymutil" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +DSYMUTIL=$ac_cv_prog_DSYMUTIL +if test -n "$DSYMUTIL"; then + { echo "$as_me:$LINENO: result: $DSYMUTIL" >&5 +echo "${ECHO_T}$DSYMUTIL" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_DSYMUTIL"; then + ac_ct_DSYMUTIL=$DSYMUTIL + # Extract the first word of "dsymutil", so it can be a program name with args. +set dummy dsymutil; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_ac_ct_DSYMUTIL+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_DSYMUTIL"; then + ac_cv_prog_ac_ct_DSYMUTIL="$ac_ct_DSYMUTIL" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_ac_ct_DSYMUTIL="dsymutil" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +ac_ct_DSYMUTIL=$ac_cv_prog_ac_ct_DSYMUTIL +if test -n "$ac_ct_DSYMUTIL"; then + { echo "$as_me:$LINENO: result: $ac_ct_DSYMUTIL" >&5 +echo "${ECHO_T}$ac_ct_DSYMUTIL" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + if test "x$ac_ct_DSYMUTIL" = x; then + DSYMUTIL=":" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ echo "$as_me:$LINENO: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&5 +echo "$as_me: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&2;} +ac_tool_warned=yes ;; +esac + DSYMUTIL=$ac_ct_DSYMUTIL + fi +else + DSYMUTIL="$ac_cv_prog_DSYMUTIL" +fi + + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}nmedit", so it can be a program name with args. +set dummy ${ac_tool_prefix}nmedit; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_NMEDIT+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$NMEDIT"; then + ac_cv_prog_NMEDIT="$NMEDIT" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_NMEDIT="${ac_tool_prefix}nmedit" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +NMEDIT=$ac_cv_prog_NMEDIT +if test -n "$NMEDIT"; then + { echo "$as_me:$LINENO: result: $NMEDIT" >&5 +echo "${ECHO_T}$NMEDIT" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_NMEDIT"; then + ac_ct_NMEDIT=$NMEDIT + # Extract the first word of "nmedit", so it can be a program name with args. +set dummy nmedit; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_ac_ct_NMEDIT+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_NMEDIT"; then + ac_cv_prog_ac_ct_NMEDIT="$ac_ct_NMEDIT" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_ac_ct_NMEDIT="nmedit" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +ac_ct_NMEDIT=$ac_cv_prog_ac_ct_NMEDIT +if test -n "$ac_ct_NMEDIT"; then + { echo "$as_me:$LINENO: result: $ac_ct_NMEDIT" >&5 +echo "${ECHO_T}$ac_ct_NMEDIT" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + if test "x$ac_ct_NMEDIT" = x; then + NMEDIT=":" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ echo "$as_me:$LINENO: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&5 +echo "$as_me: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&2;} +ac_tool_warned=yes ;; +esac + NMEDIT=$ac_ct_NMEDIT + fi +else + NMEDIT="$ac_cv_prog_NMEDIT" +fi + + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}lipo", so it can be a program name with args. +set dummy ${ac_tool_prefix}lipo; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_LIPO+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$LIPO"; then + ac_cv_prog_LIPO="$LIPO" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_LIPO="${ac_tool_prefix}lipo" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +LIPO=$ac_cv_prog_LIPO +if test -n "$LIPO"; then + { echo "$as_me:$LINENO: result: $LIPO" >&5 +echo "${ECHO_T}$LIPO" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_LIPO"; then + ac_ct_LIPO=$LIPO + # Extract the first word of "lipo", so it can be a program name with args. +set dummy lipo; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_ac_ct_LIPO+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_LIPO"; then + ac_cv_prog_ac_ct_LIPO="$ac_ct_LIPO" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_ac_ct_LIPO="lipo" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +ac_ct_LIPO=$ac_cv_prog_ac_ct_LIPO +if test -n "$ac_ct_LIPO"; then + { echo "$as_me:$LINENO: result: $ac_ct_LIPO" >&5 +echo "${ECHO_T}$ac_ct_LIPO" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + if test "x$ac_ct_LIPO" = x; then + LIPO=":" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ echo "$as_me:$LINENO: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&5 +echo "$as_me: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&2;} +ac_tool_warned=yes ;; +esac + LIPO=$ac_ct_LIPO + fi +else + LIPO="$ac_cv_prog_LIPO" +fi + + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}otool", so it can be a program name with args. +set dummy ${ac_tool_prefix}otool; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_OTOOL+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$OTOOL"; then + ac_cv_prog_OTOOL="$OTOOL" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_OTOOL="${ac_tool_prefix}otool" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +OTOOL=$ac_cv_prog_OTOOL +if test -n "$OTOOL"; then + { echo "$as_me:$LINENO: result: $OTOOL" >&5 +echo "${ECHO_T}$OTOOL" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_OTOOL"; then + ac_ct_OTOOL=$OTOOL + # Extract the first word of "otool", so it can be a program name with args. +set dummy otool; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_ac_ct_OTOOL+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_OTOOL"; then + ac_cv_prog_ac_ct_OTOOL="$ac_ct_OTOOL" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_ac_ct_OTOOL="otool" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +ac_ct_OTOOL=$ac_cv_prog_ac_ct_OTOOL +if test -n "$ac_ct_OTOOL"; then + { echo "$as_me:$LINENO: result: $ac_ct_OTOOL" >&5 +echo "${ECHO_T}$ac_ct_OTOOL" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + if test "x$ac_ct_OTOOL" = x; then + OTOOL=":" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ echo "$as_me:$LINENO: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&5 +echo "$as_me: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&2;} +ac_tool_warned=yes ;; +esac + OTOOL=$ac_ct_OTOOL + fi +else + OTOOL="$ac_cv_prog_OTOOL" +fi + + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}otool64", so it can be a program name with args. +set dummy ${ac_tool_prefix}otool64; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_OTOOL64+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$OTOOL64"; then + ac_cv_prog_OTOOL64="$OTOOL64" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_OTOOL64="${ac_tool_prefix}otool64" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +OTOOL64=$ac_cv_prog_OTOOL64 +if test -n "$OTOOL64"; then + { echo "$as_me:$LINENO: result: $OTOOL64" >&5 +echo "${ECHO_T}$OTOOL64" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + +fi +if test -z "$ac_cv_prog_OTOOL64"; then + ac_ct_OTOOL64=$OTOOL64 + # Extract the first word of "otool64", so it can be a program name with args. +set dummy otool64; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_ac_ct_OTOOL64+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_OTOOL64"; then + ac_cv_prog_ac_ct_OTOOL64="$ac_ct_OTOOL64" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_ac_ct_OTOOL64="otool64" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +ac_ct_OTOOL64=$ac_cv_prog_ac_ct_OTOOL64 +if test -n "$ac_ct_OTOOL64"; then + { echo "$as_me:$LINENO: result: $ac_ct_OTOOL64" >&5 +echo "${ECHO_T}$ac_ct_OTOOL64" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + if test "x$ac_ct_OTOOL64" = x; then + OTOOL64=":" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ echo "$as_me:$LINENO: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&5 +echo "$as_me: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&2;} +ac_tool_warned=yes ;; +esac + OTOOL64=$ac_ct_OTOOL64 + fi +else + OTOOL64="$ac_cv_prog_OTOOL64" +fi + + + + + + + + + + + + + + + + + + + + + + + + + + + + { echo "$as_me:$LINENO: checking for -single_module linker flag" >&5 +echo $ECHO_N "checking for -single_module linker flag... $ECHO_C" >&6; } +if test "${lt_cv_apple_cc_single_mod+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_apple_cc_single_mod=no + if test -z "${LT_MULTI_MODULE}"; then + # By default we will add the -single_module flag. You can override + # by either setting the environment variable LT_MULTI_MODULE + # non-empty at configure time, or by adding -multi_module to the + # link flags. + rm -rf libconftest.dylib* + echo "int foo(void){return 1;}" > conftest.c + echo "$LTCC $LTCFLAGS $LDFLAGS -o libconftest.dylib \ +-dynamiclib -Wl,-single_module conftest.c" >&5 + $LTCC $LTCFLAGS $LDFLAGS -o libconftest.dylib \ + -dynamiclib -Wl,-single_module conftest.c 2>conftest.err + _lt_result=$? + # If there is a non-empty error log, and "single_module" + # appears in it, assume the flag caused a linker warning + if test -s conftest.err && $GREP single_module conftest.err; then + cat conftest.err >&5 + # Otherwise, if the output was created with a 0 exit code from + # the compiler, it worked. + elif test -f libconftest.dylib && test $_lt_result -eq 0; then + lt_cv_apple_cc_single_mod=yes + else + cat conftest.err >&5 + fi + rm -rf libconftest.dylib* + rm -f conftest.* + fi +fi +{ echo "$as_me:$LINENO: result: $lt_cv_apple_cc_single_mod" >&5 +echo "${ECHO_T}$lt_cv_apple_cc_single_mod" >&6; } + + { echo "$as_me:$LINENO: checking for -exported_symbols_list linker flag" >&5 +echo $ECHO_N "checking for -exported_symbols_list linker flag... $ECHO_C" >&6; } +if test "${lt_cv_ld_exported_symbols_list+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_ld_exported_symbols_list=no + save_LDFLAGS=$LDFLAGS + echo "_main" > conftest.sym + LDFLAGS="$LDFLAGS -Wl,-exported_symbols_list,conftest.sym" + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (ac_try="$ac_link" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_link") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest$ac_exeext && + $as_test_x conftest$ac_exeext; then + lt_cv_ld_exported_symbols_list=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + lt_cv_ld_exported_symbols_list=no +fi + +rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ + conftest$ac_exeext conftest.$ac_ext + LDFLAGS="$save_LDFLAGS" + +fi +{ echo "$as_me:$LINENO: result: $lt_cv_ld_exported_symbols_list" >&5 +echo "${ECHO_T}$lt_cv_ld_exported_symbols_list" >&6; } + + { echo "$as_me:$LINENO: checking for -force_load linker flag" >&5 +echo $ECHO_N "checking for -force_load linker flag... $ECHO_C" >&6; } +if test "${lt_cv_ld_force_load+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_ld_force_load=no + cat > conftest.c << _LT_EOF +int forced_loaded() { return 2;} +_LT_EOF + echo "$LTCC $LTCFLAGS -c -o conftest.o conftest.c" >&5 + $LTCC $LTCFLAGS -c -o conftest.o conftest.c 2>&5 + echo "$AR cru libconftest.a conftest.o" >&5 + $AR cru libconftest.a conftest.o 2>&5 + echo "$RANLIB libconftest.a" >&5 + $RANLIB libconftest.a 2>&5 + cat > conftest.c << _LT_EOF +int main() { return 0;} +_LT_EOF + echo "$LTCC $LTCFLAGS $LDFLAGS -o conftest conftest.c -Wl,-force_load,./libconftest.a" >&5 + $LTCC $LTCFLAGS $LDFLAGS -o conftest conftest.c -Wl,-force_load,./libconftest.a 2>conftest.err + _lt_result=$? + if test -s conftest.err && $GREP force_load conftest.err; then + cat conftest.err >&5 + elif test -f conftest && test $_lt_result -eq 0 && $GREP forced_load conftest >/dev/null 2>&1 ; then + lt_cv_ld_force_load=yes + else + cat conftest.err >&5 + fi + rm -f conftest.err libconftest.a conftest conftest.c + rm -rf conftest.dSYM + +fi +{ echo "$as_me:$LINENO: result: $lt_cv_ld_force_load" >&5 +echo "${ECHO_T}$lt_cv_ld_force_load" >&6; } + case $host_os in + rhapsody* | darwin1.[012]) + _lt_dar_allow_undefined='${wl}-undefined ${wl}suppress' ;; + darwin1.*) + _lt_dar_allow_undefined='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' ;; + darwin*) # darwin 5.x on + # if running on 10.5 or later, the deployment target defaults + # to the OS version, if on x86, and 10.4, the deployment + # target defaults to 10.4. Don't you love it? + case ${MACOSX_DEPLOYMENT_TARGET-10.0},$host in + 10.0,*86*-darwin8*|10.0,*-darwin[91]*) + _lt_dar_allow_undefined='${wl}-undefined ${wl}dynamic_lookup' ;; + 10.[012]*) + _lt_dar_allow_undefined='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' ;; + 10.*) + _lt_dar_allow_undefined='${wl}-undefined ${wl}dynamic_lookup' ;; + esac + ;; + esac + if test "$lt_cv_apple_cc_single_mod" = "yes"; then + _lt_dar_single_mod='$single_module' + fi + if test "$lt_cv_ld_exported_symbols_list" = "yes"; then + _lt_dar_export_syms=' ${wl}-exported_symbols_list,$output_objdir/${libname}-symbols.expsym' + else + _lt_dar_export_syms='~$NMEDIT -s $output_objdir/${libname}-symbols.expsym ${lib}' + fi + if test "$DSYMUTIL" != ":" && test "$lt_cv_ld_force_load" = "no"; then + _lt_dsymutil='~$DSYMUTIL $lib || :' + else + _lt_dsymutil= + fi + ;; + esac + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu +{ echo "$as_me:$LINENO: checking how to run the C preprocessor" >&5 +echo $ECHO_N "checking how to run the C preprocessor... $ECHO_C" >&6; } +# On Suns, sometimes $CPP names a directory. +if test -n "$CPP" && test -d "$CPP"; then + CPP= +fi +if test -z "$CPP"; then + if test "${ac_cv_prog_CPP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + # Double quotes because CPP needs to be expanded + for CPP in "$CC -E" "$CC -E -traditional-cpp" "/lib/cpp" + do + ac_preproc_ok=false +for ac_c_preproc_warn_flag in '' yes +do + # Use a header file that comes with gcc, so configuring glibc + # with a fresh cross-compiler works. + # Prefer to if __STDC__ is defined, since + # exists even on freestanding compilers. + # On the NeXT, cc -E runs the code through the compiler's parser, + # not just through cpp. "Syntax error" is here to catch this case. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#ifdef __STDC__ +# include +#else +# include +#endif + Syntax error +_ACEOF +if { (ac_try="$ac_cpp conftest.$ac_ext" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_cpp conftest.$ac_ext") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null && { + test -z "$ac_c_preproc_warn_flag$ac_c_werror_flag" || + test ! -s conftest.err + }; then + : +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + # Broken: fails on valid input. +continue +fi + +rm -f conftest.err conftest.$ac_ext + + # OK, works on sane cases. Now check whether nonexistent headers + # can be detected and how. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +_ACEOF +if { (ac_try="$ac_cpp conftest.$ac_ext" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_cpp conftest.$ac_ext") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null && { + test -z "$ac_c_preproc_warn_flag$ac_c_werror_flag" || + test ! -s conftest.err + }; then + # Broken: success on invalid input. +continue +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + # Passes both tests. +ac_preproc_ok=: +break +fi + +rm -f conftest.err conftest.$ac_ext + +done +# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped. +rm -f conftest.err conftest.$ac_ext +if $ac_preproc_ok; then + break +fi + + done + ac_cv_prog_CPP=$CPP + +fi + CPP=$ac_cv_prog_CPP +else + ac_cv_prog_CPP=$CPP +fi +{ echo "$as_me:$LINENO: result: $CPP" >&5 +echo "${ECHO_T}$CPP" >&6; } +ac_preproc_ok=false +for ac_c_preproc_warn_flag in '' yes +do + # Use a header file that comes with gcc, so configuring glibc + # with a fresh cross-compiler works. + # Prefer to if __STDC__ is defined, since + # exists even on freestanding compilers. + # On the NeXT, cc -E runs the code through the compiler's parser, + # not just through cpp. "Syntax error" is here to catch this case. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#ifdef __STDC__ +# include +#else +# include +#endif + Syntax error +_ACEOF +if { (ac_try="$ac_cpp conftest.$ac_ext" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_cpp conftest.$ac_ext") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null && { + test -z "$ac_c_preproc_warn_flag$ac_c_werror_flag" || + test ! -s conftest.err + }; then + : +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + # Broken: fails on valid input. +continue +fi + +rm -f conftest.err conftest.$ac_ext + + # OK, works on sane cases. Now check whether nonexistent headers + # can be detected and how. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +_ACEOF +if { (ac_try="$ac_cpp conftest.$ac_ext" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_cpp conftest.$ac_ext") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null && { + test -z "$ac_c_preproc_warn_flag$ac_c_werror_flag" || + test ! -s conftest.err + }; then + # Broken: success on invalid input. +continue +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + # Passes both tests. +ac_preproc_ok=: +break +fi + +rm -f conftest.err conftest.$ac_ext + +done +# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped. +rm -f conftest.err conftest.$ac_ext +if $ac_preproc_ok; then + : +else + { { echo "$as_me:$LINENO: error: C preprocessor \"$CPP\" fails sanity check +See \`config.log' for more details." >&5 +echo "$as_me: error: C preprocessor \"$CPP\" fails sanity check +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } +fi + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + + +{ echo "$as_me:$LINENO: checking for ANSI C header files" >&5 +echo $ECHO_N "checking for ANSI C header files... $ECHO_C" >&6; } +if test "${ac_cv_header_stdc+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +#include +#include +#include + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (ac_try="$ac_compile" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compile") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest.$ac_objext; then + ac_cv_header_stdc=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + ac_cv_header_stdc=no +fi + +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext + +if test $ac_cv_header_stdc = yes; then + # SunOS 4.x string.h does not declare mem*, contrary to ANSI. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include + +_ACEOF +if (eval "$ac_cpp conftest.$ac_ext") 2>&5 | + $EGREP "memchr" >/dev/null 2>&1; then + : +else + ac_cv_header_stdc=no +fi +rm -f conftest* + +fi + +if test $ac_cv_header_stdc = yes; then + # ISC 2.0.2 stdlib.h does not declare free, contrary to ANSI. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include + +_ACEOF +if (eval "$ac_cpp conftest.$ac_ext") 2>&5 | + $EGREP "free" >/dev/null 2>&1; then + : +else + ac_cv_header_stdc=no +fi +rm -f conftest* + +fi + +if test $ac_cv_header_stdc = yes; then + # /bin/cc in Irix-4.0.5 gets non-ANSI ctype macros unless using -ansi. + if test "$cross_compiling" = yes; then + : +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +#include +#if ((' ' & 0x0FF) == 0x020) +# define ISLOWER(c) ('a' <= (c) && (c) <= 'z') +# define TOUPPER(c) (ISLOWER(c) ? 'A' + ((c) - 'a') : (c)) +#else +# define ISLOWER(c) \ + (('a' <= (c) && (c) <= 'i') \ + || ('j' <= (c) && (c) <= 'r') \ + || ('s' <= (c) && (c) <= 'z')) +# define TOUPPER(c) (ISLOWER(c) ? ((c) | 0x40) : (c)) +#endif + +#define XOR(e, f) (((e) && !(f)) || (!(e) && (f))) +int +main () +{ + int i; + for (i = 0; i < 256; i++) + if (XOR (islower (i), ISLOWER (i)) + || toupper (i) != TOUPPER (i)) + return 2; + return 0; +} +_ACEOF +rm -f conftest$ac_exeext +if { (ac_try="$ac_link" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_link") 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { ac_try='./conftest$ac_exeext' + { (case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_try") 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + : +else + echo "$as_me: program exited with status $ac_status" >&5 +echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +( exit $ac_status ) +ac_cv_header_stdc=no +fi +rm -f core *.core core.conftest.* gmon.out bb.out conftest$ac_exeext conftest.$ac_objext conftest.$ac_ext +fi + + +fi +fi +{ echo "$as_me:$LINENO: result: $ac_cv_header_stdc" >&5 +echo "${ECHO_T}$ac_cv_header_stdc" >&6; } +if test $ac_cv_header_stdc = yes; then + +cat >>confdefs.h <<\_ACEOF +#define STDC_HEADERS 1 +_ACEOF + +fi + +# On IRIX 5.3, sys/types and inttypes.h are conflicting. + + + + + + + + + +for ac_header in sys/types.h sys/stat.h stdlib.h string.h memory.h strings.h \ + inttypes.h stdint.h unistd.h +do +as_ac_Header=`echo "ac_cv_header_$ac_header" | $as_tr_sh` +{ echo "$as_me:$LINENO: checking for $ac_header" >&5 +echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6; } +if { as_var=$as_ac_Header; eval "test \"\${$as_var+set}\" = set"; }; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default + +#include <$ac_header> +_ACEOF +rm -f conftest.$ac_objext +if { (ac_try="$ac_compile" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compile") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest.$ac_objext; then + eval "$as_ac_Header=yes" +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + eval "$as_ac_Header=no" +fi + +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi +ac_res=`eval echo '${'$as_ac_Header'}'` + { echo "$as_me:$LINENO: result: $ac_res" >&5 +echo "${ECHO_T}$ac_res" >&6; } +if test `eval echo '${'$as_ac_Header'}'` = yes; then + cat >>confdefs.h <<_ACEOF +#define `echo "HAVE_$ac_header" | $as_tr_cpp` 1 +_ACEOF + +fi + +done + + + +for ac_header in dlfcn.h +do +as_ac_Header=`echo "ac_cv_header_$ac_header" | $as_tr_sh` +{ echo "$as_me:$LINENO: checking for $ac_header" >&5 +echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6; } +if { as_var=$as_ac_Header; eval "test \"\${$as_var+set}\" = set"; }; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default + +#include <$ac_header> +_ACEOF +rm -f conftest.$ac_objext +if { (ac_try="$ac_compile" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compile") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest.$ac_objext; then + eval "$as_ac_Header=yes" +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + eval "$as_ac_Header=no" +fi + +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi +ac_res=`eval echo '${'$as_ac_Header'}'` + { echo "$as_me:$LINENO: result: $ac_res" >&5 +echo "${ECHO_T}$ac_res" >&6; } +if test `eval echo '${'$as_ac_Header'}'` = yes; then + cat >>confdefs.h <<_ACEOF +#define `echo "HAVE_$ac_header" | $as_tr_cpp` 1 +_ACEOF + +fi + +done + + + + + +# Set options + + + + enable_dlopen=no + + + enable_win32_dll=no + + + # Check whether --enable-shared was given. +if test "${enable_shared+set}" = set; then + enableval=$enable_shared; p=${PACKAGE-default} + case $enableval in + yes) enable_shared=yes ;; + no) enable_shared=no ;; + *) + enable_shared=no + # Look at the argument we got. We use all the common list separators. + lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR," + for pkg in $enableval; do + IFS="$lt_save_ifs" + if test "X$pkg" = "X$p"; then + enable_shared=yes + fi + done + IFS="$lt_save_ifs" + ;; + esac +else + enable_shared=yes +fi + + + + + + + + + + # Check whether --enable-static was given. +if test "${enable_static+set}" = set; then + enableval=$enable_static; p=${PACKAGE-default} + case $enableval in + yes) enable_static=yes ;; + no) enable_static=no ;; + *) + enable_static=no + # Look at the argument we got. We use all the common list separators. + lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR," + for pkg in $enableval; do + IFS="$lt_save_ifs" + if test "X$pkg" = "X$p"; then + enable_static=yes + fi + done + IFS="$lt_save_ifs" + ;; + esac +else + enable_static=yes +fi + + + + + + + + + + +# Check whether --with-pic was given. +if test "${with_pic+set}" = set; then + withval=$with_pic; lt_p=${PACKAGE-default} + case $withval in + yes|no) pic_mode=$withval ;; + *) + pic_mode=default + # Look at the argument we got. We use all the common list separators. + lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR," + for lt_pkg in $withval; do + IFS="$lt_save_ifs" + if test "X$lt_pkg" = "X$lt_p"; then + pic_mode=yes + fi + done + IFS="$lt_save_ifs" + ;; + esac +else + pic_mode=default +fi + + +test -z "$pic_mode" && pic_mode=default + + + + + + + + # Check whether --enable-fast-install was given. +if test "${enable_fast_install+set}" = set; then + enableval=$enable_fast_install; p=${PACKAGE-default} + case $enableval in + yes) enable_fast_install=yes ;; + no) enable_fast_install=no ;; + *) + enable_fast_install=no + # Look at the argument we got. We use all the common list separators. + lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR," + for pkg in $enableval; do + IFS="$lt_save_ifs" + if test "X$pkg" = "X$p"; then + enable_fast_install=yes + fi + done + IFS="$lt_save_ifs" + ;; + esac +else + enable_fast_install=yes +fi + + + + + + + + + + + +# This can be used to rebuild libtool when needed +LIBTOOL_DEPS="$ltmain" + +# Always use our own libtool. +LIBTOOL='$(SHELL) $(top_builddir)/libtool' + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +test -z "$LN_S" && LN_S="ln -s" + + + + + + + + + + + + + + +if test -n "${ZSH_VERSION+set}" ; then + setopt NO_GLOB_SUBST +fi + +{ echo "$as_me:$LINENO: checking for objdir" >&5 +echo $ECHO_N "checking for objdir... $ECHO_C" >&6; } +if test "${lt_cv_objdir+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + rm -f .libs 2>/dev/null +mkdir .libs 2>/dev/null +if test -d .libs; then + lt_cv_objdir=.libs +else + # MS-DOS does not allow filenames that begin with a dot. + lt_cv_objdir=_libs +fi +rmdir .libs 2>/dev/null +fi +{ echo "$as_me:$LINENO: result: $lt_cv_objdir" >&5 +echo "${ECHO_T}$lt_cv_objdir" >&6; } +objdir=$lt_cv_objdir + + + + + +cat >>confdefs.h <<_ACEOF +#define LT_OBJDIR "$lt_cv_objdir/" +_ACEOF + + + + +case $host_os in +aix3*) + # AIX sometimes has problems with the GCC collect2 program. For some + # reason, if we set the COLLECT_NAMES environment variable, the problems + # vanish in a puff of smoke. + if test "X${COLLECT_NAMES+set}" != Xset; then + COLLECT_NAMES= + export COLLECT_NAMES + fi + ;; +esac + +# Global variables: +ofile=libtool +can_build_shared=yes + +# All known linkers require a `.a' archive for static linking (except MSVC, +# which needs '.lib'). +libext=a + +with_gnu_ld="$lt_cv_prog_gnu_ld" + +old_CC="$CC" +old_CFLAGS="$CFLAGS" + +# Set sane defaults for various variables +test -z "$CC" && CC=cc +test -z "$LTCC" && LTCC=$CC +test -z "$LTCFLAGS" && LTCFLAGS=$CFLAGS +test -z "$LD" && LD=ld +test -z "$ac_objext" && ac_objext=o + +for cc_temp in $compiler""; do + case $cc_temp in + compile | *[\\/]compile | ccache | *[\\/]ccache ) ;; + distcc | *[\\/]distcc | purify | *[\\/]purify ) ;; + \-*) ;; + *) break;; + esac +done +cc_basename=`$ECHO "$cc_temp" | $SED "s%.*/%%; s%^$host_alias-%%"` + + +# Only perform the check for file, if the check method requires it +test -z "$MAGIC_CMD" && MAGIC_CMD=file +case $deplibs_check_method in +file_magic*) + if test "$file_magic_cmd" = '$MAGIC_CMD'; then + { echo "$as_me:$LINENO: checking for ${ac_tool_prefix}file" >&5 +echo $ECHO_N "checking for ${ac_tool_prefix}file... $ECHO_C" >&6; } +if test "${lt_cv_path_MAGIC_CMD+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + case $MAGIC_CMD in +[\\/*] | ?:[\\/]*) + lt_cv_path_MAGIC_CMD="$MAGIC_CMD" # Let the user override the test with a path. + ;; +*) + lt_save_MAGIC_CMD="$MAGIC_CMD" + lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR + ac_dummy="/usr/bin$PATH_SEPARATOR$PATH" + for ac_dir in $ac_dummy; do + IFS="$lt_save_ifs" + test -z "$ac_dir" && ac_dir=. + if test -f $ac_dir/${ac_tool_prefix}file; then + lt_cv_path_MAGIC_CMD="$ac_dir/${ac_tool_prefix}file" + if test -n "$file_magic_test_file"; then + case $deplibs_check_method in + "file_magic "*) + file_magic_regex=`expr "$deplibs_check_method" : "file_magic \(.*\)"` + MAGIC_CMD="$lt_cv_path_MAGIC_CMD" + if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null | + $EGREP "$file_magic_regex" > /dev/null; then + : + else + cat <<_LT_EOF 1>&2 + +*** Warning: the command libtool uses to detect shared libraries, +*** $file_magic_cmd, produces output that libtool cannot recognize. +*** The result is that libtool may fail to recognize shared libraries +*** as such. This will affect the creation of libtool libraries that +*** depend on shared libraries, but programs linked with such libtool +*** libraries will work regardless of this problem. Nevertheless, you +*** may want to report the problem to your system manager and/or to +*** bug-libtool@gnu.org + +_LT_EOF + fi ;; + esac + fi + break + fi + done + IFS="$lt_save_ifs" + MAGIC_CMD="$lt_save_MAGIC_CMD" + ;; +esac +fi + +MAGIC_CMD="$lt_cv_path_MAGIC_CMD" +if test -n "$MAGIC_CMD"; then + { echo "$as_me:$LINENO: result: $MAGIC_CMD" >&5 +echo "${ECHO_T}$MAGIC_CMD" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + + + + +if test -z "$lt_cv_path_MAGIC_CMD"; then + if test -n "$ac_tool_prefix"; then + { echo "$as_me:$LINENO: checking for file" >&5 +echo $ECHO_N "checking for file... $ECHO_C" >&6; } +if test "${lt_cv_path_MAGIC_CMD+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + case $MAGIC_CMD in +[\\/*] | ?:[\\/]*) + lt_cv_path_MAGIC_CMD="$MAGIC_CMD" # Let the user override the test with a path. + ;; +*) + lt_save_MAGIC_CMD="$MAGIC_CMD" + lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR + ac_dummy="/usr/bin$PATH_SEPARATOR$PATH" + for ac_dir in $ac_dummy; do + IFS="$lt_save_ifs" + test -z "$ac_dir" && ac_dir=. + if test -f $ac_dir/file; then + lt_cv_path_MAGIC_CMD="$ac_dir/file" + if test -n "$file_magic_test_file"; then + case $deplibs_check_method in + "file_magic "*) + file_magic_regex=`expr "$deplibs_check_method" : "file_magic \(.*\)"` + MAGIC_CMD="$lt_cv_path_MAGIC_CMD" + if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null | + $EGREP "$file_magic_regex" > /dev/null; then + : + else + cat <<_LT_EOF 1>&2 + +*** Warning: the command libtool uses to detect shared libraries, +*** $file_magic_cmd, produces output that libtool cannot recognize. +*** The result is that libtool may fail to recognize shared libraries +*** as such. This will affect the creation of libtool libraries that +*** depend on shared libraries, but programs linked with such libtool +*** libraries will work regardless of this problem. Nevertheless, you +*** may want to report the problem to your system manager and/or to +*** bug-libtool@gnu.org + +_LT_EOF + fi ;; + esac + fi + break + fi + done + IFS="$lt_save_ifs" + MAGIC_CMD="$lt_save_MAGIC_CMD" + ;; +esac +fi + +MAGIC_CMD="$lt_cv_path_MAGIC_CMD" +if test -n "$MAGIC_CMD"; then + { echo "$as_me:$LINENO: result: $MAGIC_CMD" >&5 +echo "${ECHO_T}$MAGIC_CMD" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + + else + MAGIC_CMD=: + fi +fi + + fi + ;; +esac + +# Use C for the default configuration in the libtool script + +lt_save_CC="$CC" +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + + +# Source file extension for C test sources. +ac_ext=c + +# Object file extension for compiled C test sources. +objext=o +objext=$objext + +# Code to be used in simple compile tests +lt_simple_compile_test_code="int some_variable = 0;" + +# Code to be used in simple link tests +lt_simple_link_test_code='int main(){return(0);}' + + + + + + + +# If no C compiler was specified, use CC. +LTCC=${LTCC-"$CC"} + +# If no C compiler flags were specified, use CFLAGS. +LTCFLAGS=${LTCFLAGS-"$CFLAGS"} + +# Allow CC to be a program name with arguments. +compiler=$CC + +# Save the default compiler, since it gets overwritten when the other +# tags are being tested, and _LT_TAGVAR(compiler, []) is a NOP. +compiler_DEFAULT=$CC + +# save warnings/boilerplate of simple test code +ac_outfile=conftest.$ac_objext +echo "$lt_simple_compile_test_code" >conftest.$ac_ext +eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err +_lt_compiler_boilerplate=`cat conftest.err` +$RM conftest* + +ac_outfile=conftest.$ac_objext +echo "$lt_simple_link_test_code" >conftest.$ac_ext +eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err +_lt_linker_boilerplate=`cat conftest.err` +$RM -r conftest* + + +## CAVEAT EMPTOR: +## There is no encapsulation within the following macros, do not change +## the running order or otherwise move them around unless you know exactly +## what you are doing... +if test -n "$compiler"; then + +lt_prog_compiler_no_builtin_flag= + +if test "$GCC" = yes; then + case $cc_basename in + nvcc*) + lt_prog_compiler_no_builtin_flag=' -Xcompiler -fno-builtin' ;; + *) + lt_prog_compiler_no_builtin_flag=' -fno-builtin' ;; + esac + + { echo "$as_me:$LINENO: checking if $compiler supports -fno-rtti -fno-exceptions" >&5 +echo $ECHO_N "checking if $compiler supports -fno-rtti -fno-exceptions... $ECHO_C" >&6; } +if test "${lt_cv_prog_compiler_rtti_exceptions+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_prog_compiler_rtti_exceptions=no + ac_outfile=conftest.$ac_objext + echo "$lt_simple_compile_test_code" > conftest.$ac_ext + lt_compiler_flag="-fno-rtti -fno-exceptions" + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + # The option is referenced via a variable to avoid confusing sed. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5) + (eval "$lt_compile" 2>conftest.err) + ac_status=$? + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + if (exit $ac_status) && test -s "$ac_outfile"; then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings other than the usual output. + $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' >conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then + lt_cv_prog_compiler_rtti_exceptions=yes + fi + fi + $RM conftest* + +fi +{ echo "$as_me:$LINENO: result: $lt_cv_prog_compiler_rtti_exceptions" >&5 +echo "${ECHO_T}$lt_cv_prog_compiler_rtti_exceptions" >&6; } + +if test x"$lt_cv_prog_compiler_rtti_exceptions" = xyes; then + lt_prog_compiler_no_builtin_flag="$lt_prog_compiler_no_builtin_flag -fno-rtti -fno-exceptions" +else + : +fi + +fi + + + + + + + lt_prog_compiler_wl= +lt_prog_compiler_pic= +lt_prog_compiler_static= + + + if test "$GCC" = yes; then + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_static='-static' + + case $host_os in + aix*) + # All AIX code is PIC. + if test "$host_cpu" = ia64; then + # AIX 5 now supports IA64 processor + lt_prog_compiler_static='-Bstatic' + fi + ;; + + amigaos*) + case $host_cpu in + powerpc) + # see comment about AmigaOS4 .so support + lt_prog_compiler_pic='-fPIC' + ;; + m68k) + # FIXME: we need at least 68020 code to build shared libraries, but + # adding the `-m68020' flag to GCC prevents building anything better, + # like `-m68040'. + lt_prog_compiler_pic='-m68020 -resident32 -malways-restore-a4' + ;; + esac + ;; + + beos* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*) + # PIC is the default for these OSes. + ;; + + mingw* | cygwin* | pw32* | os2* | cegcc*) + # This hack is so that the source file can tell whether it is being + # built for inclusion in a dll (and should export symbols for example). + # Although the cygwin gcc ignores -fPIC, still need this for old-style + # (--disable-auto-import) libraries + lt_prog_compiler_pic='-DDLL_EXPORT' + ;; + + darwin* | rhapsody*) + # PIC is the default on this platform + # Common symbols not allowed in MH_DYLIB files + lt_prog_compiler_pic='-fno-common' + ;; + + haiku*) + # PIC is the default for Haiku. + # The "-static" flag exists, but is broken. + lt_prog_compiler_static= + ;; + + hpux*) + # PIC is the default for 64-bit PA HP-UX, but not for 32-bit + # PA HP-UX. On IA64 HP-UX, PIC is the default but the pic flag + # sets the default TLS model and affects inlining. + case $host_cpu in + hppa*64*) + # +Z the default + ;; + *) + lt_prog_compiler_pic='-fPIC' + ;; + esac + ;; + + interix[3-9]*) + # Interix 3.x gcc -fpic/-fPIC options generate broken code. + # Instead, we relocate shared libraries at runtime. + ;; + + msdosdjgpp*) + # Just because we use GCC doesn't mean we suddenly get shared libraries + # on systems that don't support them. + lt_prog_compiler_can_build_shared=no + enable_shared=no + ;; + + *nto* | *qnx*) + # QNX uses GNU C++, but need to define -shared option too, otherwise + # it will coredump. + lt_prog_compiler_pic='-fPIC -shared' + ;; + + sysv4*MP*) + if test -d /usr/nec; then + lt_prog_compiler_pic=-Kconform_pic + fi + ;; + + *) + lt_prog_compiler_pic='-fPIC' + ;; + esac + + case $cc_basename in + nvcc*) # Cuda Compiler Driver 2.2 + lt_prog_compiler_wl='-Xlinker ' + if test -n "$lt_prog_compiler_pic"; then + lt_prog_compiler_pic="-Xcompiler $lt_prog_compiler_pic" + fi + ;; + esac + else + # PORTME Check for flag to pass linker flags through the system compiler. + case $host_os in + aix*) + lt_prog_compiler_wl='-Wl,' + if test "$host_cpu" = ia64; then + # AIX 5 now supports IA64 processor + lt_prog_compiler_static='-Bstatic' + else + lt_prog_compiler_static='-bnso -bI:/lib/syscalls.exp' + fi + ;; + + mingw* | cygwin* | pw32* | os2* | cegcc*) + # This hack is so that the source file can tell whether it is being + # built for inclusion in a dll (and should export symbols for example). + lt_prog_compiler_pic='-DDLL_EXPORT' + ;; + + hpux9* | hpux10* | hpux11*) + lt_prog_compiler_wl='-Wl,' + # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but + # not for PA HP-UX. + case $host_cpu in + hppa*64*|ia64*) + # +Z the default + ;; + *) + lt_prog_compiler_pic='+Z' + ;; + esac + # Is there a better lt_prog_compiler_static that works with the bundled CC? + lt_prog_compiler_static='${wl}-a ${wl}archive' + ;; + + irix5* | irix6* | nonstopux*) + lt_prog_compiler_wl='-Wl,' + # PIC (with -KPIC) is the default. + lt_prog_compiler_static='-non_shared' + ;; + + linux* | k*bsd*-gnu | kopensolaris*-gnu) + case $cc_basename in + # old Intel for x86_64 which still supported -KPIC. + ecc*) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-static' + ;; + # icc used to be incompatible with GCC. + # ICC 10 doesn't accept -KPIC any more. + icc* | ifort*) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-fPIC' + lt_prog_compiler_static='-static' + ;; + # Lahey Fortran 8.1. + lf95*) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='--shared' + lt_prog_compiler_static='--static' + ;; + nagfor*) + # NAG Fortran compiler + lt_prog_compiler_wl='-Wl,-Wl,,' + lt_prog_compiler_pic='-PIC' + lt_prog_compiler_static='-Bstatic' + ;; + pgcc* | pgf77* | pgf90* | pgf95* | pgfortran*) + # Portland Group compilers (*not* the Pentium gcc compiler, + # which looks to be a dead project) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-fpic' + lt_prog_compiler_static='-Bstatic' + ;; + ccc*) + lt_prog_compiler_wl='-Wl,' + # All Alpha code is PIC. + lt_prog_compiler_static='-non_shared' + ;; + xl* | bgxl* | bgf* | mpixl*) + # IBM XL C 8.0/Fortran 10.1, 11.1 on PPC and BlueGene + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-qpic' + lt_prog_compiler_static='-qstaticlink' + ;; + *) + case `$CC -V 2>&1 | sed 5q` in + *Sun\ Ceres\ Fortran* | *Sun*Fortran*\ [1-7].* | *Sun*Fortran*\ 8.[0-3]*) + # Sun Fortran 8.3 passes all unrecognized flags to the linker + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-Bstatic' + lt_prog_compiler_wl='' + ;; + *Sun\ F* | *Sun*Fortran*) + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-Bstatic' + lt_prog_compiler_wl='-Qoption ld ' + ;; + *Sun\ C*) + # Sun C 5.9 + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-Bstatic' + lt_prog_compiler_wl='-Wl,' + ;; + *Intel*\ [CF]*Compiler*) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-fPIC' + lt_prog_compiler_static='-static' + ;; + *Portland\ Group*) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-fpic' + lt_prog_compiler_static='-Bstatic' + ;; + esac + ;; + esac + ;; + + newsos6) + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-Bstatic' + ;; + + *nto* | *qnx*) + # QNX uses GNU C++, but need to define -shared option too, otherwise + # it will coredump. + lt_prog_compiler_pic='-fPIC -shared' + ;; + + osf3* | osf4* | osf5*) + lt_prog_compiler_wl='-Wl,' + # All OSF/1 code is PIC. + lt_prog_compiler_static='-non_shared' + ;; + + rdos*) + lt_prog_compiler_static='-non_shared' + ;; + + solaris*) + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-Bstatic' + case $cc_basename in + f77* | f90* | f95* | sunf77* | sunf90* | sunf95*) + lt_prog_compiler_wl='-Qoption ld ';; + *) + lt_prog_compiler_wl='-Wl,';; + esac + ;; + + sunos4*) + lt_prog_compiler_wl='-Qoption ld ' + lt_prog_compiler_pic='-PIC' + lt_prog_compiler_static='-Bstatic' + ;; + + sysv4 | sysv4.2uw2* | sysv4.3*) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-Bstatic' + ;; + + sysv4*MP*) + if test -d /usr/nec ;then + lt_prog_compiler_pic='-Kconform_pic' + lt_prog_compiler_static='-Bstatic' + fi + ;; + + sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-Bstatic' + ;; + + unicos*) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_can_build_shared=no + ;; + + uts4*) + lt_prog_compiler_pic='-pic' + lt_prog_compiler_static='-Bstatic' + ;; + + *) + lt_prog_compiler_can_build_shared=no + ;; + esac + fi + +case $host_os in + # For platforms which do not support PIC, -DPIC is meaningless: + *djgpp*) + lt_prog_compiler_pic= + ;; + *) + lt_prog_compiler_pic="$lt_prog_compiler_pic -DPIC" + ;; +esac + +{ echo "$as_me:$LINENO: checking for $compiler option to produce PIC" >&5 +echo $ECHO_N "checking for $compiler option to produce PIC... $ECHO_C" >&6; } +if test "${lt_cv_prog_compiler_pic+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_prog_compiler_pic=$lt_prog_compiler_pic +fi +{ echo "$as_me:$LINENO: result: $lt_cv_prog_compiler_pic" >&5 +echo "${ECHO_T}$lt_cv_prog_compiler_pic" >&6; } +lt_prog_compiler_pic=$lt_cv_prog_compiler_pic + +# +# Check to make sure the PIC flag actually works. +# +if test -n "$lt_prog_compiler_pic"; then + { echo "$as_me:$LINENO: checking if $compiler PIC flag $lt_prog_compiler_pic works" >&5 +echo $ECHO_N "checking if $compiler PIC flag $lt_prog_compiler_pic works... $ECHO_C" >&6; } +if test "${lt_cv_prog_compiler_pic_works+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_prog_compiler_pic_works=no + ac_outfile=conftest.$ac_objext + echo "$lt_simple_compile_test_code" > conftest.$ac_ext + lt_compiler_flag="$lt_prog_compiler_pic -DPIC" + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + # The option is referenced via a variable to avoid confusing sed. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5) + (eval "$lt_compile" 2>conftest.err) + ac_status=$? + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + if (exit $ac_status) && test -s "$ac_outfile"; then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings other than the usual output. + $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' >conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then + lt_cv_prog_compiler_pic_works=yes + fi + fi + $RM conftest* + +fi +{ echo "$as_me:$LINENO: result: $lt_cv_prog_compiler_pic_works" >&5 +echo "${ECHO_T}$lt_cv_prog_compiler_pic_works" >&6; } + +if test x"$lt_cv_prog_compiler_pic_works" = xyes; then + case $lt_prog_compiler_pic in + "" | " "*) ;; + *) lt_prog_compiler_pic=" $lt_prog_compiler_pic" ;; + esac +else + lt_prog_compiler_pic= + lt_prog_compiler_can_build_shared=no +fi + +fi + + + + + + + + + + + +# +# Check to make sure the static flag actually works. +# +wl=$lt_prog_compiler_wl eval lt_tmp_static_flag=\"$lt_prog_compiler_static\" +{ echo "$as_me:$LINENO: checking if $compiler static flag $lt_tmp_static_flag works" >&5 +echo $ECHO_N "checking if $compiler static flag $lt_tmp_static_flag works... $ECHO_C" >&6; } +if test "${lt_cv_prog_compiler_static_works+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_prog_compiler_static_works=no + save_LDFLAGS="$LDFLAGS" + LDFLAGS="$LDFLAGS $lt_tmp_static_flag" + echo "$lt_simple_link_test_code" > conftest.$ac_ext + if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then + # The linker can only warn and ignore the option if not recognized + # So say no if there are warnings + if test -s conftest.err; then + # Append any errors to the config.log. + cat conftest.err 1>&5 + $ECHO "$_lt_linker_boilerplate" | $SED '/^$/d' > conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if diff conftest.exp conftest.er2 >/dev/null; then + lt_cv_prog_compiler_static_works=yes + fi + else + lt_cv_prog_compiler_static_works=yes + fi + fi + $RM -r conftest* + LDFLAGS="$save_LDFLAGS" + +fi +{ echo "$as_me:$LINENO: result: $lt_cv_prog_compiler_static_works" >&5 +echo "${ECHO_T}$lt_cv_prog_compiler_static_works" >&6; } + +if test x"$lt_cv_prog_compiler_static_works" = xyes; then + : +else + lt_prog_compiler_static= +fi + + + + + + + + { echo "$as_me:$LINENO: checking if $compiler supports -c -o file.$ac_objext" >&5 +echo $ECHO_N "checking if $compiler supports -c -o file.$ac_objext... $ECHO_C" >&6; } +if test "${lt_cv_prog_compiler_c_o+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_prog_compiler_c_o=no + $RM -r conftest 2>/dev/null + mkdir conftest + cd conftest + mkdir out + echo "$lt_simple_compile_test_code" > conftest.$ac_ext + + lt_compiler_flag="-o out/conftest2.$ac_objext" + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5) + (eval "$lt_compile" 2>out/conftest.err) + ac_status=$? + cat out/conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + if (exit $ac_status) && test -s out/conftest2.$ac_objext + then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings + $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' > out/conftest.exp + $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2 + if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then + lt_cv_prog_compiler_c_o=yes + fi + fi + chmod u+w . 2>&5 + $RM conftest* + # SGI C++ compiler will create directory out/ii_files/ for + # template instantiation + test -d out/ii_files && $RM out/ii_files/* && rmdir out/ii_files + $RM out/* && rmdir out + cd .. + $RM -r conftest + $RM conftest* + +fi +{ echo "$as_me:$LINENO: result: $lt_cv_prog_compiler_c_o" >&5 +echo "${ECHO_T}$lt_cv_prog_compiler_c_o" >&6; } + + + + + + + { echo "$as_me:$LINENO: checking if $compiler supports -c -o file.$ac_objext" >&5 +echo $ECHO_N "checking if $compiler supports -c -o file.$ac_objext... $ECHO_C" >&6; } +if test "${lt_cv_prog_compiler_c_o+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_prog_compiler_c_o=no + $RM -r conftest 2>/dev/null + mkdir conftest + cd conftest + mkdir out + echo "$lt_simple_compile_test_code" > conftest.$ac_ext + + lt_compiler_flag="-o out/conftest2.$ac_objext" + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5) + (eval "$lt_compile" 2>out/conftest.err) + ac_status=$? + cat out/conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + if (exit $ac_status) && test -s out/conftest2.$ac_objext + then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings + $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' > out/conftest.exp + $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2 + if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then + lt_cv_prog_compiler_c_o=yes + fi + fi + chmod u+w . 2>&5 + $RM conftest* + # SGI C++ compiler will create directory out/ii_files/ for + # template instantiation + test -d out/ii_files && $RM out/ii_files/* && rmdir out/ii_files + $RM out/* && rmdir out + cd .. + $RM -r conftest + $RM conftest* + +fi +{ echo "$as_me:$LINENO: result: $lt_cv_prog_compiler_c_o" >&5 +echo "${ECHO_T}$lt_cv_prog_compiler_c_o" >&6; } + + + + +hard_links="nottested" +if test "$lt_cv_prog_compiler_c_o" = no && test "$need_locks" != no; then + # do not overwrite the value of need_locks provided by the user + { echo "$as_me:$LINENO: checking if we can lock with hard links" >&5 +echo $ECHO_N "checking if we can lock with hard links... $ECHO_C" >&6; } + hard_links=yes + $RM conftest* + ln conftest.a conftest.b 2>/dev/null && hard_links=no + touch conftest.a + ln conftest.a conftest.b 2>&5 || hard_links=no + ln conftest.a conftest.b 2>/dev/null && hard_links=no + { echo "$as_me:$LINENO: result: $hard_links" >&5 +echo "${ECHO_T}$hard_links" >&6; } + if test "$hard_links" = no; then + { echo "$as_me:$LINENO: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&5 +echo "$as_me: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&2;} + need_locks=warn + fi +else + need_locks=no +fi + + + + + + + { echo "$as_me:$LINENO: checking whether the $compiler linker ($LD) supports shared libraries" >&5 +echo $ECHO_N "checking whether the $compiler linker ($LD) supports shared libraries... $ECHO_C" >&6; } + + runpath_var= + allow_undefined_flag= + always_export_symbols=no + archive_cmds= + archive_expsym_cmds= + compiler_needs_object=no + enable_shared_with_static_runtimes=no + export_dynamic_flag_spec= + export_symbols_cmds='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols' + hardcode_automatic=no + hardcode_direct=no + hardcode_direct_absolute=no + hardcode_libdir_flag_spec= + hardcode_libdir_separator= + hardcode_minus_L=no + hardcode_shlibpath_var=unsupported + inherit_rpath=no + link_all_deplibs=unknown + module_cmds= + module_expsym_cmds= + old_archive_from_new_cmds= + old_archive_from_expsyms_cmds= + thread_safe_flag_spec= + whole_archive_flag_spec= + # include_expsyms should be a list of space-separated symbols to be *always* + # included in the symbol list + include_expsyms= + # exclude_expsyms can be an extended regexp of symbols to exclude + # it will be wrapped by ` (' and `)$', so one must not match beginning or + # end of line. Example: `a|bc|.*d.*' will exclude the symbols `a' and `bc', + # as well as any symbol that contains `d'. + exclude_expsyms='_GLOBAL_OFFSET_TABLE_|_GLOBAL__F[ID]_.*' + # Although _GLOBAL_OFFSET_TABLE_ is a valid symbol C name, most a.out + # platforms (ab)use it in PIC code, but their linkers get confused if + # the symbol is explicitly referenced. Since portable code cannot + # rely on this symbol name, it's probably fine to never include it in + # preloaded symbol tables. + # Exclude shared library initialization/finalization symbols. + extract_expsyms_cmds= + + case $host_os in + cygwin* | mingw* | pw32* | cegcc*) + # FIXME: the MSVC++ port hasn't been tested in a loooong time + # When not using gcc, we currently assume that we are using + # Microsoft Visual C++. + if test "$GCC" != yes; then + with_gnu_ld=no + fi + ;; + interix*) + # we just hope/assume this is gcc and not c89 (= MSVC++) + with_gnu_ld=yes + ;; + openbsd*) + with_gnu_ld=no + ;; + esac + + ld_shlibs=yes + + # On some targets, GNU ld is compatible enough with the native linker + # that we're better off using the native interface for both. + lt_use_gnu_ld_interface=no + if test "$with_gnu_ld" = yes; then + case $host_os in + aix*) + # The AIX port of GNU ld has always aspired to compatibility + # with the native linker. However, as the warning in the GNU ld + # block says, versions before 2.19.5* couldn't really create working + # shared libraries, regardless of the interface used. + case `$LD -v 2>&1` in + *\ \(GNU\ Binutils\)\ 2.19.5*) ;; + *\ \(GNU\ Binutils\)\ 2.[2-9]*) ;; + *\ \(GNU\ Binutils\)\ [3-9]*) ;; + *) + lt_use_gnu_ld_interface=yes + ;; + esac + ;; + *) + lt_use_gnu_ld_interface=yes + ;; + esac + fi + + if test "$lt_use_gnu_ld_interface" = yes; then + # If archive_cmds runs LD, not CC, wlarc should be empty + wlarc='${wl}' + + # Set some defaults for GNU ld with shared library support. These + # are reset later if shared libraries are not supported. Putting them + # here allows them to be overridden if necessary. + runpath_var=LD_RUN_PATH + hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir' + export_dynamic_flag_spec='${wl}--export-dynamic' + # ancient GNU ld didn't support --whole-archive et. al. + if $LD --help 2>&1 | $GREP 'no-whole-archive' > /dev/null; then + whole_archive_flag_spec="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive' + else + whole_archive_flag_spec= + fi + supports_anon_versioning=no + case `$LD -v 2>&1` in + *GNU\ gold*) supports_anon_versioning=yes ;; + *\ [01].* | *\ 2.[0-9].* | *\ 2.10.*) ;; # catch versions < 2.11 + *\ 2.11.93.0.2\ *) supports_anon_versioning=yes ;; # RH7.3 ... + *\ 2.11.92.0.12\ *) supports_anon_versioning=yes ;; # Mandrake 8.2 ... + *\ 2.11.*) ;; # other 2.11 versions + *) supports_anon_versioning=yes ;; + esac + + # See if GNU ld supports shared libraries. + case $host_os in + aix[3-9]*) + # On AIX/PPC, the GNU linker is very broken + if test "$host_cpu" != ia64; then + ld_shlibs=no + cat <<_LT_EOF 1>&2 + +*** Warning: the GNU linker, at least up to release 2.19, is reported +*** to be unable to reliably create shared libraries on AIX. +*** Therefore, libtool is disabling shared libraries support. If you +*** really care for shared libraries, you may want to install binutils +*** 2.20 or above, or modify your PATH so that a non-GNU linker is found. +*** You will then need to restart the configuration process. + +_LT_EOF + fi + ;; + + amigaos*) + case $host_cpu in + powerpc) + # see comment about AmigaOS4 .so support + archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + archive_expsym_cmds='' + ;; + m68k) + archive_cmds='$RM $output_objdir/a2ixlibrary.data~$ECHO "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$ECHO "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$ECHO "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$ECHO "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)' + hardcode_libdir_flag_spec='-L$libdir' + hardcode_minus_L=yes + ;; + esac + ;; + + beos*) + if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then + allow_undefined_flag=unsupported + # Joseph Beckenbach says some releases of gcc + # support --undefined. This deserves some investigation. FIXME + archive_cmds='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + else + ld_shlibs=no + fi + ;; + + cygwin* | mingw* | pw32* | cegcc*) + # _LT_TAGVAR(hardcode_libdir_flag_spec, ) is actually meaningless, + # as there is no search path for DLLs. + hardcode_libdir_flag_spec='-L$libdir' + export_dynamic_flag_spec='${wl}--export-all-symbols' + allow_undefined_flag=unsupported + always_export_symbols=no + enable_shared_with_static_runtimes=yes + export_symbols_cmds='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[BCDGRS][ ]/s/.*[ ]\([^ ]*\)/\1 DATA/;s/^.*[ ]__nm__\([^ ]*\)[ ][^ ]*/\1 DATA/;/^I[ ]/d;/^[AITW][ ]/s/.* //'\'' | sort | uniq > $export_symbols' + exclude_expsyms='[_]+GLOBAL_OFFSET_TABLE_|[_]+GLOBAL__[FID]_.*|[_]+head_[A-Za-z0-9_]+_dll|[A-Za-z0-9_]+_dll_iname' + + if $LD --help 2>&1 | $GREP 'auto-import' > /dev/null; then + archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib' + # If the export-symbols file already is a .def file (1st line + # is EXPORTS), use it as is; otherwise, prepend... + archive_expsym_cmds='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then + cp $export_symbols $output_objdir/$soname.def; + else + echo EXPORTS > $output_objdir/$soname.def; + cat $export_symbols >> $output_objdir/$soname.def; + fi~ + $CC -shared $output_objdir/$soname.def $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib' + else + ld_shlibs=no + fi + ;; + + haiku*) + archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + link_all_deplibs=yes + ;; + + interix[3-9]*) + hardcode_direct=no + hardcode_shlibpath_var=no + hardcode_libdir_flag_spec='${wl}-rpath,$libdir' + export_dynamic_flag_spec='${wl}-E' + # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc. + # Instead, shared libraries are loaded at an image base (0x10000000 by + # default) and relocated if they conflict, which is a slow very memory + # consuming and fragmenting process. To avoid this, we pick a random, + # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link + # time. Moving up from 0x10000000 also allows more sbrk(2) space. + archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib' + archive_expsym_cmds='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib' + ;; + + gnu* | linux* | tpf* | k*bsd*-gnu | kopensolaris*-gnu) + tmp_diet=no + if test "$host_os" = linux-dietlibc; then + case $cc_basename in + diet\ *) tmp_diet=yes;; # linux-dietlibc with static linking (!diet-dyn) + esac + fi + if $LD --help 2>&1 | $EGREP ': supported targets:.* elf' > /dev/null \ + && test "$tmp_diet" = no + then + tmp_addflag=' $pic_flag' + tmp_sharedflag='-shared' + case $cc_basename,$host_cpu in + pgcc*) # Portland Group C compiler + whole_archive_flag_spec='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive' + tmp_addflag=' $pic_flag' + ;; + pgf77* | pgf90* | pgf95* | pgfortran*) + # Portland Group f77 and f90 compilers + whole_archive_flag_spec='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive' + tmp_addflag=' $pic_flag -Mnomain' ;; + ecc*,ia64* | icc*,ia64*) # Intel C compiler on ia64 + tmp_addflag=' -i_dynamic' ;; + efc*,ia64* | ifort*,ia64*) # Intel Fortran compiler on ia64 + tmp_addflag=' -i_dynamic -nofor_main' ;; + ifc* | ifort*) # Intel Fortran compiler + tmp_addflag=' -nofor_main' ;; + lf95*) # Lahey Fortran 8.1 + whole_archive_flag_spec= + tmp_sharedflag='--shared' ;; + xl[cC]* | bgxl[cC]* | mpixl[cC]*) # IBM XL C 8.0 on PPC (deal with xlf below) + tmp_sharedflag='-qmkshrobj' + tmp_addflag= ;; + nvcc*) # Cuda Compiler Driver 2.2 + whole_archive_flag_spec='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive' + compiler_needs_object=yes + ;; + esac + case `$CC -V 2>&1 | sed 5q` in + *Sun\ C*) # Sun C 5.9 + whole_archive_flag_spec='${wl}--whole-archive`new_convenience=; for conv in $convenience\"\"; do test -z \"$conv\" || new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive' + compiler_needs_object=yes + tmp_sharedflag='-G' ;; + *Sun\ F*) # Sun Fortran 8.3 + tmp_sharedflag='-G' ;; + esac + archive_cmds='$CC '"$tmp_sharedflag""$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + + if test "x$supports_anon_versioning" = xyes; then + archive_expsym_cmds='echo "{ global:" > $output_objdir/$libname.ver~ + cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~ + echo "local: *; };" >> $output_objdir/$libname.ver~ + $CC '"$tmp_sharedflag""$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-version-script ${wl}$output_objdir/$libname.ver -o $lib' + fi + + case $cc_basename in + xlf* | bgf* | bgxlf* | mpixlf*) + # IBM XL Fortran 10.1 on PPC cannot create shared libs itself + whole_archive_flag_spec='--whole-archive$convenience --no-whole-archive' + hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir' + archive_cmds='$LD -shared $libobjs $deplibs $linker_flags -soname $soname -o $lib' + if test "x$supports_anon_versioning" = xyes; then + archive_expsym_cmds='echo "{ global:" > $output_objdir/$libname.ver~ + cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~ + echo "local: *; };" >> $output_objdir/$libname.ver~ + $LD -shared $libobjs $deplibs $linker_flags -soname $soname -version-script $output_objdir/$libname.ver -o $lib' + fi + ;; + esac + else + ld_shlibs=no + fi + ;; + + netbsd*) + if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then + archive_cmds='$LD -Bshareable $libobjs $deplibs $linker_flags -o $lib' + wlarc= + else + archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + archive_expsym_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + fi + ;; + + solaris*) + if $LD -v 2>&1 | $GREP 'BFD 2\.8' > /dev/null; then + ld_shlibs=no + cat <<_LT_EOF 1>&2 + +*** Warning: The releases 2.8.* of the GNU linker cannot reliably +*** create shared libraries on Solaris systems. Therefore, libtool +*** is disabling shared libraries support. We urge you to upgrade GNU +*** binutils to release 2.9.1 or newer. Another option is to modify +*** your PATH or compiler configuration so that the native linker is +*** used, and then restart. + +_LT_EOF + elif $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then + archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + archive_expsym_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + else + ld_shlibs=no + fi + ;; + + sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX*) + case `$LD -v 2>&1` in + *\ [01].* | *\ 2.[0-9].* | *\ 2.1[0-5].*) + ld_shlibs=no + cat <<_LT_EOF 1>&2 + +*** Warning: Releases of the GNU linker prior to 2.16.91.0.3 can not +*** reliably create shared libraries on SCO systems. Therefore, libtool +*** is disabling shared libraries support. We urge you to upgrade GNU +*** binutils to release 2.16.91.0.3 or newer. Another option is to modify +*** your PATH or compiler configuration so that the native linker is +*** used, and then restart. + +_LT_EOF + ;; + *) + # For security reasons, it is highly recommended that you always + # use absolute paths for naming shared libraries, and exclude the + # DT_RUNPATH tag from executables and libraries. But doing so + # requires that you compile everything twice, which is a pain. + if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then + hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir' + archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + archive_expsym_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + else + ld_shlibs=no + fi + ;; + esac + ;; + + sunos4*) + archive_cmds='$LD -assert pure-text -Bshareable -o $lib $libobjs $deplibs $linker_flags' + wlarc= + hardcode_direct=yes + hardcode_shlibpath_var=no + ;; + + *) + if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then + archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + archive_expsym_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + else + ld_shlibs=no + fi + ;; + esac + + if test "$ld_shlibs" = no; then + runpath_var= + hardcode_libdir_flag_spec= + export_dynamic_flag_spec= + whole_archive_flag_spec= + fi + else + # PORTME fill in a description of your system's linker (not GNU ld) + case $host_os in + aix3*) + allow_undefined_flag=unsupported + always_export_symbols=yes + archive_expsym_cmds='$LD -o $output_objdir/$soname $libobjs $deplibs $linker_flags -bE:$export_symbols -T512 -H512 -bM:SRE~$AR $AR_FLAGS $lib $output_objdir/$soname' + # Note: this linker hardcodes the directories in LIBPATH if there + # are no directories specified by -L. + hardcode_minus_L=yes + if test "$GCC" = yes && test -z "$lt_prog_compiler_static"; then + # Neither direct hardcoding nor static linking is supported with a + # broken collect2. + hardcode_direct=unsupported + fi + ;; + + aix[4-9]*) + if test "$host_cpu" = ia64; then + # On IA64, the linker does run time linking by default, so we don't + # have to do anything special. + aix_use_runtimelinking=no + exp_sym_flag='-Bexport' + no_entry_flag="" + else + # If we're using GNU nm, then we don't want the "-C" option. + # -C means demangle to AIX nm, but means don't demangle with GNU nm + # Also, AIX nm treats weak defined symbols like other global + # defined symbols, whereas GNU nm marks them as "W". + if $NM -V 2>&1 | $GREP 'GNU' > /dev/null; then + export_symbols_cmds='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B") || (\$ 2 == "W")) && (substr(\$ 3,1,1) != ".")) { print \$ 3 } }'\'' | sort -u > $export_symbols' + else + export_symbols_cmds='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B")) && (substr(\$ 3,1,1) != ".")) { print \$ 3 } }'\'' | sort -u > $export_symbols' + fi + aix_use_runtimelinking=no + + # Test if we are trying to use run time linking or normal + # AIX style linking. If -brtl is somewhere in LDFLAGS, we + # need to do runtime linking. + case $host_os in aix4.[23]|aix4.[23].*|aix[5-9]*) + for ld_flag in $LDFLAGS; do + if (test $ld_flag = "-brtl" || test $ld_flag = "-Wl,-brtl"); then + aix_use_runtimelinking=yes + break + fi + done + ;; + esac + + exp_sym_flag='-bexport' + no_entry_flag='-bnoentry' + fi + + # When large executables or shared objects are built, AIX ld can + # have problems creating the table of contents. If linking a library + # or program results in "error TOC overflow" add -mminimal-toc to + # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not + # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS. + + archive_cmds='' + hardcode_direct=yes + hardcode_direct_absolute=yes + hardcode_libdir_separator=':' + link_all_deplibs=yes + file_list_spec='${wl}-f,' + + if test "$GCC" = yes; then + case $host_os in aix4.[012]|aix4.[012].*) + # We only want to do this on AIX 4.2 and lower, the check + # below for broken collect2 doesn't work under 4.3+ + collect2name=`${CC} -print-prog-name=collect2` + if test -f "$collect2name" && + strings "$collect2name" | $GREP resolve_lib_name >/dev/null + then + # We have reworked collect2 + : + else + # We have old collect2 + hardcode_direct=unsupported + # It fails to find uninstalled libraries when the uninstalled + # path is not listed in the libpath. Setting hardcode_minus_L + # to unsupported forces relinking + hardcode_minus_L=yes + hardcode_libdir_flag_spec='-L$libdir' + hardcode_libdir_separator= + fi + ;; + esac + shared_flag='-shared' + if test "$aix_use_runtimelinking" = yes; then + shared_flag="$shared_flag "'${wl}-G' + fi + else + # not using gcc + if test "$host_cpu" = ia64; then + # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release + # chokes on -Wl,-G. The following line is correct: + shared_flag='-G' + else + if test "$aix_use_runtimelinking" = yes; then + shared_flag='${wl}-G' + else + shared_flag='${wl}-bM:SRE' + fi + fi + fi + + export_dynamic_flag_spec='${wl}-bexpall' + # It seems that -bexpall does not export symbols beginning with + # underscore (_), so it is better to generate a list of symbols to export. + always_export_symbols=yes + if test "$aix_use_runtimelinking" = yes; then + # Warning - without using the other runtime loading flags (-brtl), + # -berok will link without error, but may produce a broken library. + allow_undefined_flag='-berok' + # Determine the default libpath from the value encoded in an + # empty executable. + if test "${lt_cv_aix_libpath+set}" = set; then + aix_libpath=$lt_cv_aix_libpath +else + if test "${lt_cv_aix_libpath_+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (ac_try="$ac_link" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_link") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest$ac_exeext && + $as_test_x conftest$ac_exeext; then + + lt_aix_libpath_sed=' + /Import File Strings/,/^$/ { + /^0/ { + s/^0 *\([^ ]*\) *$/\1/ + p + } + }' + lt_cv_aix_libpath_=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"` + # Check for a 64-bit object if we didn't find anything. + if test -z "$lt_cv_aix_libpath_"; then + lt_cv_aix_libpath_=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"` + fi +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + +fi + +rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ + conftest$ac_exeext conftest.$ac_ext + if test -z "$lt_cv_aix_libpath_"; then + lt_cv_aix_libpath_="/usr/lib:/lib" + fi + +fi + + aix_libpath=$lt_cv_aix_libpath_ +fi + + hardcode_libdir_flag_spec='${wl}-blibpath:$libdir:'"$aix_libpath" + archive_expsym_cmds='$CC -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then func_echo_all "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag" + else + if test "$host_cpu" = ia64; then + hardcode_libdir_flag_spec='${wl}-R $libdir:/usr/lib:/lib' + allow_undefined_flag="-z nodefs" + archive_expsym_cmds="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols" + else + # Determine the default libpath from the value encoded in an + # empty executable. + if test "${lt_cv_aix_libpath+set}" = set; then + aix_libpath=$lt_cv_aix_libpath +else + if test "${lt_cv_aix_libpath_+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (ac_try="$ac_link" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_link") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest$ac_exeext && + $as_test_x conftest$ac_exeext; then + + lt_aix_libpath_sed=' + /Import File Strings/,/^$/ { + /^0/ { + s/^0 *\([^ ]*\) *$/\1/ + p + } + }' + lt_cv_aix_libpath_=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"` + # Check for a 64-bit object if we didn't find anything. + if test -z "$lt_cv_aix_libpath_"; then + lt_cv_aix_libpath_=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"` + fi +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + +fi + +rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ + conftest$ac_exeext conftest.$ac_ext + if test -z "$lt_cv_aix_libpath_"; then + lt_cv_aix_libpath_="/usr/lib:/lib" + fi + +fi + + aix_libpath=$lt_cv_aix_libpath_ +fi + + hardcode_libdir_flag_spec='${wl}-blibpath:$libdir:'"$aix_libpath" + # Warning - without using the other run time loading flags, + # -berok will link without error, but may produce a broken library. + no_undefined_flag=' ${wl}-bernotok' + allow_undefined_flag=' ${wl}-berok' + if test "$with_gnu_ld" = yes; then + # We only use this code for GNU lds that support --whole-archive. + whole_archive_flag_spec='${wl}--whole-archive$convenience ${wl}--no-whole-archive' + else + # Exported symbols can be pulled into shared objects from archives + whole_archive_flag_spec='$convenience' + fi + archive_cmds_need_lc=yes + # This is similar to how AIX traditionally builds its shared libraries. + archive_expsym_cmds="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname' + fi + fi + ;; + + amigaos*) + case $host_cpu in + powerpc) + # see comment about AmigaOS4 .so support + archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + archive_expsym_cmds='' + ;; + m68k) + archive_cmds='$RM $output_objdir/a2ixlibrary.data~$ECHO "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$ECHO "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$ECHO "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$ECHO "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)' + hardcode_libdir_flag_spec='-L$libdir' + hardcode_minus_L=yes + ;; + esac + ;; + + bsdi[45]*) + export_dynamic_flag_spec=-rdynamic + ;; + + cygwin* | mingw* | pw32* | cegcc*) + # When not using gcc, we currently assume that we are using + # Microsoft Visual C++. + # hardcode_libdir_flag_spec is actually meaningless, as there is + # no search path for DLLs. + case $cc_basename in + cl*) + # Native MSVC + hardcode_libdir_flag_spec=' ' + allow_undefined_flag=unsupported + always_export_symbols=yes + file_list_spec='@' + # Tell ltmain to make .lib files, not .a files. + libext=lib + # Tell ltmain to make .dll files, not .so files. + shrext_cmds=".dll" + # FIXME: Setting linknames here is a bad hack. + archive_cmds='$CC -o $output_objdir/$soname $libobjs $compiler_flags $deplibs -Wl,-dll~linknames=' + archive_expsym_cmds='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then + sed -n -e 's/\\\\\\\(.*\\\\\\\)/-link\\\ -EXPORT:\\\\\\\1/' -e '1\\\!p' < $export_symbols > $output_objdir/$soname.exp; + else + sed -e 's/\\\\\\\(.*\\\\\\\)/-link\\\ -EXPORT:\\\\\\\1/' < $export_symbols > $output_objdir/$soname.exp; + fi~ + $CC -o $tool_output_objdir$soname $libobjs $compiler_flags $deplibs "@$tool_output_objdir$soname.exp" -Wl,-DLL,-IMPLIB:"$tool_output_objdir$libname.dll.lib"~ + linknames=' + # The linker will not automatically build a static lib if we build a DLL. + # _LT_TAGVAR(old_archive_from_new_cmds, )='true' + enable_shared_with_static_runtimes=yes + exclude_expsyms='_NULL_IMPORT_DESCRIPTOR|_IMPORT_DESCRIPTOR_.*' + export_symbols_cmds='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[BCDGRS][ ]/s/.*[ ]\([^ ]*\)/\1,DATA/'\'' | $SED -e '\''/^[AITW][ ]/s/.*[ ]//'\'' | sort | uniq > $export_symbols' + # Don't use ranlib + old_postinstall_cmds='chmod 644 $oldlib' + postlink_cmds='lt_outputfile="@OUTPUT@"~ + lt_tool_outputfile="@TOOL_OUTPUT@"~ + case $lt_outputfile in + *.exe|*.EXE) ;; + *) + lt_outputfile="$lt_outputfile.exe" + lt_tool_outputfile="$lt_tool_outputfile.exe" + ;; + esac~ + if test "$MANIFEST_TOOL" != ":" && test -f "$lt_outputfile.manifest"; then + $MANIFEST_TOOL -manifest "$lt_tool_outputfile.manifest" -outputresource:"$lt_tool_outputfile" || exit 1; + $RM "$lt_outputfile.manifest"; + fi' + ;; + *) + # Assume MSVC wrapper + hardcode_libdir_flag_spec=' ' + allow_undefined_flag=unsupported + # Tell ltmain to make .lib files, not .a files. + libext=lib + # Tell ltmain to make .dll files, not .so files. + shrext_cmds=".dll" + # FIXME: Setting linknames here is a bad hack. + archive_cmds='$CC -o $lib $libobjs $compiler_flags `func_echo_all "$deplibs" | $SED '\''s/ -lc$//'\''` -link -dll~linknames=' + # The linker will automatically build a .lib file if we build a DLL. + old_archive_from_new_cmds='true' + # FIXME: Should let the user specify the lib program. + old_archive_cmds='lib -OUT:$oldlib$oldobjs$old_deplibs' + enable_shared_with_static_runtimes=yes + ;; + esac + ;; + + darwin* | rhapsody*) + + + archive_cmds_need_lc=no + hardcode_direct=no + hardcode_automatic=yes + hardcode_shlibpath_var=unsupported + if test "$lt_cv_ld_force_load" = "yes"; then + whole_archive_flag_spec='`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience ${wl}-force_load,$conv\"; done; func_echo_all \"$new_convenience\"`' + + else + whole_archive_flag_spec='' + fi + link_all_deplibs=yes + allow_undefined_flag="$_lt_dar_allow_undefined" + case $cc_basename in + ifort*) _lt_dar_can_shared=yes ;; + *) _lt_dar_can_shared=$GCC ;; + esac + if test "$_lt_dar_can_shared" = "yes"; then + output_verbose_link_cmd=func_echo_all + archive_cmds="\$CC -dynamiclib \$allow_undefined_flag -o \$lib \$libobjs \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring $_lt_dar_single_mod${_lt_dsymutil}" + module_cmds="\$CC \$allow_undefined_flag -o \$lib -bundle \$libobjs \$deplibs \$compiler_flags${_lt_dsymutil}" + archive_expsym_cmds="sed 's,^,_,' < \$export_symbols > \$output_objdir/\${libname}-symbols.expsym~\$CC -dynamiclib \$allow_undefined_flag -o \$lib \$libobjs \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring ${_lt_dar_single_mod}${_lt_dar_export_syms}${_lt_dsymutil}" + module_expsym_cmds="sed -e 's,^,_,' < \$export_symbols > \$output_objdir/\${libname}-symbols.expsym~\$CC \$allow_undefined_flag -o \$lib -bundle \$libobjs \$deplibs \$compiler_flags${_lt_dar_export_syms}${_lt_dsymutil}" + + else + ld_shlibs=no + fi + + ;; + + dgux*) + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_libdir_flag_spec='-L$libdir' + hardcode_shlibpath_var=no + ;; + + # FreeBSD 2.2.[012] allows us to include c++rt0.o to get C++ constructor + # support. Future versions do this automatically, but an explicit c++rt0.o + # does not break anything, and helps significantly (at the cost of a little + # extra space). + freebsd2.2*) + archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags /usr/lib/c++rt0.o' + hardcode_libdir_flag_spec='-R$libdir' + hardcode_direct=yes + hardcode_shlibpath_var=no + ;; + + # Unfortunately, older versions of FreeBSD 2 do not have this feature. + freebsd2.*) + archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' + hardcode_direct=yes + hardcode_minus_L=yes + hardcode_shlibpath_var=no + ;; + + # FreeBSD 3 and greater uses gcc -shared to do shared libraries. + freebsd* | dragonfly*) + archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags' + hardcode_libdir_flag_spec='-R$libdir' + hardcode_direct=yes + hardcode_shlibpath_var=no + ;; + + hpux9*) + if test "$GCC" = yes; then + archive_cmds='$RM $output_objdir/$soname~$CC -shared $pic_flag ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $libobjs $deplibs $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib' + else + archive_cmds='$RM $output_objdir/$soname~$LD -b +b $install_libdir -o $output_objdir/$soname $libobjs $deplibs $linker_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib' + fi + hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir' + hardcode_libdir_separator=: + hardcode_direct=yes + + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + hardcode_minus_L=yes + export_dynamic_flag_spec='${wl}-E' + ;; + + hpux10*) + if test "$GCC" = yes && test "$with_gnu_ld" = no; then + archive_cmds='$CC -shared $pic_flag ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags' + else + archive_cmds='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags' + fi + if test "$with_gnu_ld" = no; then + hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir' + hardcode_libdir_separator=: + hardcode_direct=yes + hardcode_direct_absolute=yes + export_dynamic_flag_spec='${wl}-E' + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + hardcode_minus_L=yes + fi + ;; + + hpux11*) + if test "$GCC" = yes && test "$with_gnu_ld" = no; then + case $host_cpu in + hppa*64*) + archive_cmds='$CC -shared ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + ia64*) + archive_cmds='$CC -shared $pic_flag ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags' + ;; + *) + archive_cmds='$CC -shared $pic_flag ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags' + ;; + esac + else + case $host_cpu in + hppa*64*) + archive_cmds='$CC -b ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + ia64*) + archive_cmds='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags' + ;; + *) + + # Older versions of the 11.00 compiler do not understand -b yet + # (HP92453-01 A.11.01.20 doesn't, HP92453-01 B.11.X.35175-35176.GP does) + { echo "$as_me:$LINENO: checking if $CC understands -b" >&5 +echo $ECHO_N "checking if $CC understands -b... $ECHO_C" >&6; } +if test "${lt_cv_prog_compiler__b+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_prog_compiler__b=no + save_LDFLAGS="$LDFLAGS" + LDFLAGS="$LDFLAGS -b" + echo "$lt_simple_link_test_code" > conftest.$ac_ext + if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then + # The linker can only warn and ignore the option if not recognized + # So say no if there are warnings + if test -s conftest.err; then + # Append any errors to the config.log. + cat conftest.err 1>&5 + $ECHO "$_lt_linker_boilerplate" | $SED '/^$/d' > conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if diff conftest.exp conftest.er2 >/dev/null; then + lt_cv_prog_compiler__b=yes + fi + else + lt_cv_prog_compiler__b=yes + fi + fi + $RM -r conftest* + LDFLAGS="$save_LDFLAGS" + +fi +{ echo "$as_me:$LINENO: result: $lt_cv_prog_compiler__b" >&5 +echo "${ECHO_T}$lt_cv_prog_compiler__b" >&6; } + +if test x"$lt_cv_prog_compiler__b" = xyes; then + archive_cmds='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags' +else + archive_cmds='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags' +fi + + ;; + esac + fi + if test "$with_gnu_ld" = no; then + hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir' + hardcode_libdir_separator=: + + case $host_cpu in + hppa*64*|ia64*) + hardcode_direct=no + hardcode_shlibpath_var=no + ;; + *) + hardcode_direct=yes + hardcode_direct_absolute=yes + export_dynamic_flag_spec='${wl}-E' + + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + hardcode_minus_L=yes + ;; + esac + fi + ;; + + irix5* | irix6* | nonstopux*) + if test "$GCC" = yes; then + archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + # Try to use the -exported_symbol ld option, if it does not + # work, assume that -exports_file does not work either and + # implicitly export all symbols. + # This should be the same for all languages, so no per-tag cache variable. + { echo "$as_me:$LINENO: checking whether the $host_os linker accepts -exported_symbol" >&5 +echo $ECHO_N "checking whether the $host_os linker accepts -exported_symbol... $ECHO_C" >&6; } +if test "${lt_cv_irix_exported_symbol+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + save_LDFLAGS="$LDFLAGS" + LDFLAGS="$LDFLAGS -shared ${wl}-exported_symbol ${wl}foo ${wl}-update_registry ${wl}/dev/null" + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +int foo (void) { return 0; } +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (ac_try="$ac_link" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_link") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest$ac_exeext && + $as_test_x conftest$ac_exeext; then + lt_cv_irix_exported_symbol=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + lt_cv_irix_exported_symbol=no +fi + +rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ + conftest$ac_exeext conftest.$ac_ext + LDFLAGS="$save_LDFLAGS" +fi +{ echo "$as_me:$LINENO: result: $lt_cv_irix_exported_symbol" >&5 +echo "${ECHO_T}$lt_cv_irix_exported_symbol" >&6; } + if test "$lt_cv_irix_exported_symbol" = yes; then + archive_expsym_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations ${wl}-exports_file ${wl}$export_symbols -o $lib' + fi + else + archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib' + archive_expsym_cmds='$CC -shared $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -exports_file $export_symbols -o $lib' + fi + archive_cmds_need_lc='no' + hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir' + hardcode_libdir_separator=: + inherit_rpath=yes + link_all_deplibs=yes + ;; + + netbsd*) + if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then + archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' # a.out + else + archive_cmds='$LD -shared -o $lib $libobjs $deplibs $linker_flags' # ELF + fi + hardcode_libdir_flag_spec='-R$libdir' + hardcode_direct=yes + hardcode_shlibpath_var=no + ;; + + newsos6) + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_direct=yes + hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir' + hardcode_libdir_separator=: + hardcode_shlibpath_var=no + ;; + + *nto* | *qnx*) + ;; + + openbsd*) + if test -f /usr/libexec/ld.so; then + hardcode_direct=yes + hardcode_shlibpath_var=no + hardcode_direct_absolute=yes + if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then + archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-retain-symbols-file,$export_symbols' + hardcode_libdir_flag_spec='${wl}-rpath,$libdir' + export_dynamic_flag_spec='${wl}-E' + else + case $host_os in + openbsd[01].* | openbsd2.[0-7] | openbsd2.[0-7].*) + archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' + hardcode_libdir_flag_spec='-R$libdir' + ;; + *) + archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags' + hardcode_libdir_flag_spec='${wl}-rpath,$libdir' + ;; + esac + fi + else + ld_shlibs=no + fi + ;; + + os2*) + hardcode_libdir_flag_spec='-L$libdir' + hardcode_minus_L=yes + allow_undefined_flag=unsupported + archive_cmds='$ECHO "LIBRARY $libname INITINSTANCE" > $output_objdir/$libname.def~$ECHO "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~echo DATA >> $output_objdir/$libname.def~echo " SINGLE NONSHARED" >> $output_objdir/$libname.def~echo EXPORTS >> $output_objdir/$libname.def~emxexp $libobjs >> $output_objdir/$libname.def~$CC -Zdll -Zcrtdll -o $lib $libobjs $deplibs $compiler_flags $output_objdir/$libname.def' + old_archive_from_new_cmds='emximp -o $output_objdir/$libname.a $output_objdir/$libname.def' + ;; + + osf3*) + if test "$GCC" = yes; then + allow_undefined_flag=' ${wl}-expect_unresolved ${wl}\*' + archive_cmds='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + else + allow_undefined_flag=' -expect_unresolved \*' + archive_cmds='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib' + fi + archive_cmds_need_lc='no' + hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir' + hardcode_libdir_separator=: + ;; + + osf4* | osf5*) # as osf3* with the addition of -msym flag + if test "$GCC" = yes; then + allow_undefined_flag=' ${wl}-expect_unresolved ${wl}\*' + archive_cmds='$CC -shared${allow_undefined_flag} $pic_flag $libobjs $deplibs $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir' + else + allow_undefined_flag=' -expect_unresolved \*' + archive_cmds='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags -msym -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib' + archive_expsym_cmds='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done; printf "%s\\n" "-hidden">> $lib.exp~ + $CC -shared${allow_undefined_flag} ${wl}-input ${wl}$lib.exp $compiler_flags $libobjs $deplibs -soname $soname `test -n "$verstring" && $ECHO "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib~$RM $lib.exp' + + # Both c and cxx compiler support -rpath directly + hardcode_libdir_flag_spec='-rpath $libdir' + fi + archive_cmds_need_lc='no' + hardcode_libdir_separator=: + ;; + + solaris*) + no_undefined_flag=' -z defs' + if test "$GCC" = yes; then + wlarc='${wl}' + archive_cmds='$CC -shared $pic_flag ${wl}-z ${wl}text ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~ + $CC -shared $pic_flag ${wl}-z ${wl}text ${wl}-M ${wl}$lib.exp ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags~$RM $lib.exp' + else + case `$CC -V 2>&1` in + *"Compilers 5.0"*) + wlarc='' + archive_cmds='$LD -G${allow_undefined_flag} -h $soname -o $lib $libobjs $deplibs $linker_flags' + archive_expsym_cmds='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~ + $LD -G${allow_undefined_flag} -M $lib.exp -h $soname -o $lib $libobjs $deplibs $linker_flags~$RM $lib.exp' + ;; + *) + wlarc='${wl}' + archive_cmds='$CC -G${allow_undefined_flag} -h $soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~ + $CC -G${allow_undefined_flag} -M $lib.exp -h $soname -o $lib $libobjs $deplibs $compiler_flags~$RM $lib.exp' + ;; + esac + fi + hardcode_libdir_flag_spec='-R$libdir' + hardcode_shlibpath_var=no + case $host_os in + solaris2.[0-5] | solaris2.[0-5].*) ;; + *) + # The compiler driver will combine and reorder linker options, + # but understands `-z linker_flag'. GCC discards it without `$wl', + # but is careful enough not to reorder. + # Supported since Solaris 2.6 (maybe 2.5.1?) + if test "$GCC" = yes; then + whole_archive_flag_spec='${wl}-z ${wl}allextract$convenience ${wl}-z ${wl}defaultextract' + else + whole_archive_flag_spec='-z allextract$convenience -z defaultextract' + fi + ;; + esac + link_all_deplibs=yes + ;; + + sunos4*) + if test "x$host_vendor" = xsequent; then + # Use $CC to link under sequent, because it throws in some extra .o + # files that make .init and .fini sections work. + archive_cmds='$CC -G ${wl}-h $soname -o $lib $libobjs $deplibs $compiler_flags' + else + archive_cmds='$LD -assert pure-text -Bstatic -o $lib $libobjs $deplibs $linker_flags' + fi + hardcode_libdir_flag_spec='-L$libdir' + hardcode_direct=yes + hardcode_minus_L=yes + hardcode_shlibpath_var=no + ;; + + sysv4) + case $host_vendor in + sni) + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_direct=yes # is this really true??? + ;; + siemens) + ## LD is ld it makes a PLAMLIB + ## CC just makes a GrossModule. + archive_cmds='$LD -G -o $lib $libobjs $deplibs $linker_flags' + reload_cmds='$CC -r -o $output$reload_objs' + hardcode_direct=no + ;; + motorola) + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_direct=no #Motorola manual says yes, but my tests say they lie + ;; + esac + runpath_var='LD_RUN_PATH' + hardcode_shlibpath_var=no + ;; + + sysv4.3*) + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_shlibpath_var=no + export_dynamic_flag_spec='-Bexport' + ;; + + sysv4*MP*) + if test -d /usr/nec; then + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_shlibpath_var=no + runpath_var=LD_RUN_PATH + hardcode_runpath_var=yes + ld_shlibs=yes + fi + ;; + + sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[01].[10]* | unixware7* | sco3.2v5.0.[024]*) + no_undefined_flag='${wl}-z,text' + archive_cmds_need_lc=no + hardcode_shlibpath_var=no + runpath_var='LD_RUN_PATH' + + if test "$GCC" = yes; then + archive_cmds='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + else + archive_cmds='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + fi + ;; + + sysv5* | sco3.2v5* | sco5v6*) + # Note: We can NOT use -z defs as we might desire, because we do not + # link with -lc, and that would cause any symbols used from libc to + # always be unresolved, which means just about no library would + # ever link correctly. If we're not using GNU ld we use -z text + # though, which does catch some bad symbols but isn't as heavy-handed + # as -z defs. + no_undefined_flag='${wl}-z,text' + allow_undefined_flag='${wl}-z,nodefs' + archive_cmds_need_lc=no + hardcode_shlibpath_var=no + hardcode_libdir_flag_spec='${wl}-R,$libdir' + hardcode_libdir_separator=':' + link_all_deplibs=yes + export_dynamic_flag_spec='${wl}-Bexport' + runpath_var='LD_RUN_PATH' + + if test "$GCC" = yes; then + archive_cmds='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + else + archive_cmds='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + fi + ;; + + uts4*) + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_libdir_flag_spec='-L$libdir' + hardcode_shlibpath_var=no + ;; + + *) + ld_shlibs=no + ;; + esac + + if test x$host_vendor = xsni; then + case $host in + sysv4 | sysv4.2uw2* | sysv4.3* | sysv5*) + export_dynamic_flag_spec='${wl}-Blargedynsym' + ;; + esac + fi + fi + +{ echo "$as_me:$LINENO: result: $ld_shlibs" >&5 +echo "${ECHO_T}$ld_shlibs" >&6; } +test "$ld_shlibs" = no && can_build_shared=no + +with_gnu_ld=$with_gnu_ld + + + + + + + + + + + + + + + +# +# Do we need to explicitly link libc? +# +case "x$archive_cmds_need_lc" in +x|xyes) + # Assume -lc should be added + archive_cmds_need_lc=yes + + if test "$enable_shared" = yes && test "$GCC" = yes; then + case $archive_cmds in + *'~'*) + # FIXME: we may have to deal with multi-command sequences. + ;; + '$CC '*) + # Test whether the compiler implicitly links with -lc since on some + # systems, -lgcc has to come before -lc. If gcc already passes -lc + # to ld, don't add -lc before -lgcc. + { echo "$as_me:$LINENO: checking whether -lc should be explicitly linked in" >&5 +echo $ECHO_N "checking whether -lc should be explicitly linked in... $ECHO_C" >&6; } +if test "${lt_cv_archive_cmds_need_lc+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + $RM conftest* + echo "$lt_simple_compile_test_code" > conftest.$ac_ext + + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } 2>conftest.err; then + soname=conftest + lib=conftest + libobjs=conftest.$ac_objext + deplibs= + wl=$lt_prog_compiler_wl + pic_flag=$lt_prog_compiler_pic + compiler_flags=-v + linker_flags=-v + verstring= + output_objdir=. + libname=conftest + lt_save_allow_undefined_flag=$allow_undefined_flag + allow_undefined_flag= + if { (eval echo "$as_me:$LINENO: \"$archive_cmds 2\>\&1 \| $GREP \" -lc \" \>/dev/null 2\>\&1\"") >&5 + (eval $archive_cmds 2\>\&1 \| $GREP \" -lc \" \>/dev/null 2\>\&1) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } + then + lt_cv_archive_cmds_need_lc=no + else + lt_cv_archive_cmds_need_lc=yes + fi + allow_undefined_flag=$lt_save_allow_undefined_flag + else + cat conftest.err 1>&5 + fi + $RM conftest* + +fi +{ echo "$as_me:$LINENO: result: $lt_cv_archive_cmds_need_lc" >&5 +echo "${ECHO_T}$lt_cv_archive_cmds_need_lc" >&6; } + archive_cmds_need_lc=$lt_cv_archive_cmds_need_lc + ;; + esac + fi + ;; +esac + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + { echo "$as_me:$LINENO: checking dynamic linker characteristics" >&5 +echo $ECHO_N "checking dynamic linker characteristics... $ECHO_C" >&6; } + +if test "$GCC" = yes; then + case $host_os in + darwin*) lt_awk_arg="/^libraries:/,/LR/" ;; + *) lt_awk_arg="/^libraries:/" ;; + esac + case $host_os in + mingw* | cegcc*) lt_sed_strip_eq="s,=\([A-Za-z]:\),\1,g" ;; + *) lt_sed_strip_eq="s,=/,/,g" ;; + esac + lt_search_path_spec=`$CC -print-search-dirs | awk $lt_awk_arg | $SED -e "s/^libraries://" -e $lt_sed_strip_eq` + case $lt_search_path_spec in + *\;*) + # if the path contains ";" then we assume it to be the separator + # otherwise default to the standard path separator (i.e. ":") - it is + # assumed that no part of a normal pathname contains ";" but that should + # okay in the real world where ";" in dirpaths is itself problematic. + lt_search_path_spec=`$ECHO "$lt_search_path_spec" | $SED 's/;/ /g'` + ;; + *) + lt_search_path_spec=`$ECHO "$lt_search_path_spec" | $SED "s/$PATH_SEPARATOR/ /g"` + ;; + esac + # Ok, now we have the path, separated by spaces, we can step through it + # and add multilib dir if necessary. + lt_tmp_lt_search_path_spec= + lt_multi_os_dir=`$CC $CPPFLAGS $CFLAGS $LDFLAGS -print-multi-os-directory 2>/dev/null` + for lt_sys_path in $lt_search_path_spec; do + if test -d "$lt_sys_path/$lt_multi_os_dir"; then + lt_tmp_lt_search_path_spec="$lt_tmp_lt_search_path_spec $lt_sys_path/$lt_multi_os_dir" + else + test -d "$lt_sys_path" && \ + lt_tmp_lt_search_path_spec="$lt_tmp_lt_search_path_spec $lt_sys_path" + fi + done + lt_search_path_spec=`$ECHO "$lt_tmp_lt_search_path_spec" | awk ' +BEGIN {RS=" "; FS="/|\n";} { + lt_foo=""; + lt_count=0; + for (lt_i = NF; lt_i > 0; lt_i--) { + if ($lt_i != "" && $lt_i != ".") { + if ($lt_i == "..") { + lt_count++; + } else { + if (lt_count == 0) { + lt_foo="/" $lt_i lt_foo; + } else { + lt_count--; + } + } + } + } + if (lt_foo != "") { lt_freq[lt_foo]++; } + if (lt_freq[lt_foo] == 1) { print lt_foo; } +}'` + # AWK program above erroneously prepends '/' to C:/dos/paths + # for these hosts. + case $host_os in + mingw* | cegcc*) lt_search_path_spec=`$ECHO "$lt_search_path_spec" |\ + $SED 's,/\([A-Za-z]:\),\1,g'` ;; + esac + sys_lib_search_path_spec=`$ECHO "$lt_search_path_spec" | $lt_NL2SP` +else + sys_lib_search_path_spec="/lib /usr/lib /usr/local/lib" +fi +library_names_spec= +libname_spec='lib$name' +soname_spec= +shrext_cmds=".so" +postinstall_cmds= +postuninstall_cmds= +finish_cmds= +finish_eval= +shlibpath_var= +shlibpath_overrides_runpath=unknown +version_type=none +dynamic_linker="$host_os ld.so" +sys_lib_dlsearch_path_spec="/lib /usr/lib" +need_lib_prefix=unknown +hardcode_into_libs=no + +# when you set need_version to no, make sure it does not cause -set_version +# flags to be left without arguments +need_version=unknown + +case $host_os in +aix3*) + version_type=linux # correct to gnu/linux during the next big refactor + library_names_spec='${libname}${release}${shared_ext}$versuffix $libname.a' + shlibpath_var=LIBPATH + + # AIX 3 has no versioning support, so we append a major version to the name. + soname_spec='${libname}${release}${shared_ext}$major' + ;; + +aix[4-9]*) + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + hardcode_into_libs=yes + if test "$host_cpu" = ia64; then + # AIX 5 supports IA64 + library_names_spec='${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext}$versuffix $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + else + # With GCC up to 2.95.x, collect2 would create an import file + # for dependence libraries. The import file would start with + # the line `#! .'. This would cause the generated library to + # depend on `.', always an invalid library. This was fixed in + # development snapshots of GCC prior to 3.0. + case $host_os in + aix4 | aix4.[01] | aix4.[01].*) + if { echo '#if __GNUC__ > 2 || (__GNUC__ == 2 && __GNUC_MINOR__ >= 97)' + echo ' yes ' + echo '#endif'; } | ${CC} -E - | $GREP yes > /dev/null; then + : + else + can_build_shared=no + fi + ;; + esac + # AIX (on Power*) has no versioning support, so currently we can not hardcode correct + # soname into executable. Probably we can add versioning support to + # collect2, so additional links can be useful in future. + if test "$aix_use_runtimelinking" = yes; then + # If using run time linking (on AIX 4.2 or later) use lib.so + # instead of lib.a to let people know that these are not + # typical AIX shared libraries. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + else + # We preserve .a as extension for shared libraries through AIX4.2 + # and later when we are not doing run time linking. + library_names_spec='${libname}${release}.a $libname.a' + soname_spec='${libname}${release}${shared_ext}$major' + fi + shlibpath_var=LIBPATH + fi + ;; + +amigaos*) + case $host_cpu in + powerpc) + # Since July 2007 AmigaOS4 officially supports .so libraries. + # When compiling the executable, add -use-dynld -Lsobjs: to the compileline. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + ;; + m68k) + library_names_spec='$libname.ixlibrary $libname.a' + # Create ${libname}_ixlibrary.a entries in /sys/libs. + finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`func_echo_all "$lib" | $SED '\''s%^.*/\([^/]*\)\.ixlibrary$%\1%'\''`; test $RM /sys/libs/${libname}_ixlibrary.a; $show "cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a"; cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a || exit 1; done' + ;; + esac + ;; + +beos*) + library_names_spec='${libname}${shared_ext}' + dynamic_linker="$host_os ld.so" + shlibpath_var=LIBRARY_PATH + ;; + +bsdi[45]*) + version_type=linux # correct to gnu/linux during the next big refactor + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + finish_cmds='PATH="\$PATH:/sbin" ldconfig $libdir' + shlibpath_var=LD_LIBRARY_PATH + sys_lib_search_path_spec="/shlib /usr/lib /usr/X11/lib /usr/contrib/lib /lib /usr/local/lib" + sys_lib_dlsearch_path_spec="/shlib /usr/lib /usr/local/lib" + # the default ld.so.conf also contains /usr/contrib/lib and + # /usr/X11R6/lib (/usr/X11 is a link to /usr/X11R6), but let us allow + # libtool to hard-code these into programs + ;; + +cygwin* | mingw* | pw32* | cegcc*) + version_type=windows + shrext_cmds=".dll" + need_version=no + need_lib_prefix=no + + case $GCC,$cc_basename in + yes,*) + # gcc + library_names_spec='$libname.dll.a' + # DLL is installed to $(libdir)/../bin by postinstall_cmds + postinstall_cmds='base_file=`basename \${file}`~ + dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i; echo \$dlname'\''`~ + dldir=$destdir/`dirname \$dlpath`~ + test -d \$dldir || mkdir -p \$dldir~ + $install_prog $dir/$dlname \$dldir/$dlname~ + chmod a+x \$dldir/$dlname~ + if test -n '\''$stripme'\'' && test -n '\''$striplib'\''; then + eval '\''$striplib \$dldir/$dlname'\'' || exit \$?; + fi' + postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~ + dlpath=$dir/\$dldll~ + $RM \$dlpath' + shlibpath_overrides_runpath=yes + + case $host_os in + cygwin*) + # Cygwin DLLs use 'cyg' prefix rather than 'lib' + soname_spec='`echo ${libname} | sed -e 's/^lib/cyg/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}' + + sys_lib_search_path_spec="$sys_lib_search_path_spec /usr/lib/w32api" + ;; + mingw* | cegcc*) + # MinGW DLLs use traditional 'lib' prefix + soname_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}' + ;; + pw32*) + # pw32 DLLs use 'pw' prefix rather than 'lib' + library_names_spec='`echo ${libname} | sed -e 's/^lib/pw/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}' + ;; + esac + dynamic_linker='Win32 ld.exe' + ;; + + *,cl*) + # Native MSVC + libname_spec='$name' + soname_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}' + library_names_spec='${libname}.dll.lib' + + case $build_os in + mingw*) + sys_lib_search_path_spec= + lt_save_ifs=$IFS + IFS=';' + for lt_path in $LIB + do + IFS=$lt_save_ifs + # Let DOS variable expansion print the short 8.3 style file name. + lt_path=`cd "$lt_path" 2>/dev/null && cmd //C "for %i in (".") do @echo %~si"` + sys_lib_search_path_spec="$sys_lib_search_path_spec $lt_path" + done + IFS=$lt_save_ifs + # Convert to MSYS style. + sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | sed -e 's|\\\\|/|g' -e 's| \\([a-zA-Z]\\):| /\\1|g' -e 's|^ ||'` + ;; + cygwin*) + # Convert to unix form, then to dos form, then back to unix form + # but this time dos style (no spaces!) so that the unix form looks + # like /cygdrive/c/PROGRA~1:/cygdr... + sys_lib_search_path_spec=`cygpath --path --unix "$LIB"` + sys_lib_search_path_spec=`cygpath --path --dos "$sys_lib_search_path_spec" 2>/dev/null` + sys_lib_search_path_spec=`cygpath --path --unix "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"` + ;; + *) + sys_lib_search_path_spec="$LIB" + if $ECHO "$sys_lib_search_path_spec" | $GREP ';[c-zC-Z]:/' >/dev/null; then + # It is most probably a Windows format PATH. + sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'` + else + sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"` + fi + # FIXME: find the short name or the path components, as spaces are + # common. (e.g. "Program Files" -> "PROGRA~1") + ;; + esac + + # DLL is installed to $(libdir)/../bin by postinstall_cmds + postinstall_cmds='base_file=`basename \${file}`~ + dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i; echo \$dlname'\''`~ + dldir=$destdir/`dirname \$dlpath`~ + test -d \$dldir || mkdir -p \$dldir~ + $install_prog $dir/$dlname \$dldir/$dlname' + postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~ + dlpath=$dir/\$dldll~ + $RM \$dlpath' + shlibpath_overrides_runpath=yes + dynamic_linker='Win32 link.exe' + ;; + + *) + # Assume MSVC wrapper + library_names_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext} $libname.lib' + dynamic_linker='Win32 ld.exe' + ;; + esac + # FIXME: first we should search . and the directory the executable is in + shlibpath_var=PATH + ;; + +darwin* | rhapsody*) + dynamic_linker="$host_os dyld" + version_type=darwin + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${major}$shared_ext ${libname}$shared_ext' + soname_spec='${libname}${release}${major}$shared_ext' + shlibpath_overrides_runpath=yes + shlibpath_var=DYLD_LIBRARY_PATH + shrext_cmds='`test .$module = .yes && echo .so || echo .dylib`' + + sys_lib_search_path_spec="$sys_lib_search_path_spec /usr/local/lib" + sys_lib_dlsearch_path_spec='/usr/local/lib /lib /usr/lib' + ;; + +dgux*) + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname$shared_ext' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + ;; + +freebsd* | dragonfly*) + # DragonFly does not have aout. When/if they implement a new + # versioning mechanism, adjust this. + if test -x /usr/bin/objformat; then + objformat=`/usr/bin/objformat` + else + case $host_os in + freebsd[23].*) objformat=aout ;; + *) objformat=elf ;; + esac + fi + version_type=freebsd-$objformat + case $version_type in + freebsd-elf*) + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}' + need_version=no + need_lib_prefix=no + ;; + freebsd-*) + library_names_spec='${libname}${release}${shared_ext}$versuffix $libname${shared_ext}$versuffix' + need_version=yes + ;; + esac + shlibpath_var=LD_LIBRARY_PATH + case $host_os in + freebsd2.*) + shlibpath_overrides_runpath=yes + ;; + freebsd3.[01]* | freebsdelf3.[01]*) + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + freebsd3.[2-9]* | freebsdelf3.[2-9]* | \ + freebsd4.[0-5] | freebsdelf4.[0-5] | freebsd4.1.1 | freebsdelf4.1.1) + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + *) # from 4.6 on, and DragonFly + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + esac + ;; + +gnu*) + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + +haiku*) + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + dynamic_linker="$host_os runtime_loader" + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LIBRARY_PATH + shlibpath_overrides_runpath=yes + sys_lib_dlsearch_path_spec='/boot/home/config/lib /boot/common/lib /boot/system/lib' + hardcode_into_libs=yes + ;; + +hpux9* | hpux10* | hpux11*) + # Give a soname corresponding to the major version so that dld.sl refuses to + # link against other versions. + version_type=sunos + need_lib_prefix=no + need_version=no + case $host_cpu in + ia64*) + shrext_cmds='.so' + hardcode_into_libs=yes + dynamic_linker="$host_os dld.so" + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes # Unless +noenvvar is specified. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + if test "X$HPUX_IA64_MODE" = X32; then + sys_lib_search_path_spec="/usr/lib/hpux32 /usr/local/lib/hpux32 /usr/local/lib" + else + sys_lib_search_path_spec="/usr/lib/hpux64 /usr/local/lib/hpux64" + fi + sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec + ;; + hppa*64*) + shrext_cmds='.sl' + hardcode_into_libs=yes + dynamic_linker="$host_os dld.sl" + shlibpath_var=LD_LIBRARY_PATH # How should we handle SHLIB_PATH + shlibpath_overrides_runpath=yes # Unless +noenvvar is specified. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + sys_lib_search_path_spec="/usr/lib/pa20_64 /usr/ccs/lib/pa20_64" + sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec + ;; + *) + shrext_cmds='.sl' + dynamic_linker="$host_os dld.sl" + shlibpath_var=SHLIB_PATH + shlibpath_overrides_runpath=no # +s is required to enable SHLIB_PATH + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + ;; + esac + # HP-UX runs *really* slowly unless shared libraries are mode 555, ... + postinstall_cmds='chmod 555 $lib' + # or fails outright, so override atomically: + install_override_mode=555 + ;; + +interix[3-9]*) + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + dynamic_linker='Interix 3.x ld.so.1 (PE, like ELF)' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + +irix5* | irix6* | nonstopux*) + case $host_os in + nonstopux*) version_type=nonstopux ;; + *) + if test "$lt_cv_prog_gnu_ld" = yes; then + version_type=linux # correct to gnu/linux during the next big refactor + else + version_type=irix + fi ;; + esac + need_lib_prefix=no + need_version=no + soname_spec='${libname}${release}${shared_ext}$major' + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext} $libname${shared_ext}' + case $host_os in + irix5* | nonstopux*) + libsuff= shlibsuff= + ;; + *) + case $LD in # libtool.m4 will add one of these switches to LD + *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ") + libsuff= shlibsuff= libmagic=32-bit;; + *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ") + libsuff=32 shlibsuff=N32 libmagic=N32;; + *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ") + libsuff=64 shlibsuff=64 libmagic=64-bit;; + *) libsuff= shlibsuff= libmagic=never-match;; + esac + ;; + esac + shlibpath_var=LD_LIBRARY${shlibsuff}_PATH + shlibpath_overrides_runpath=no + sys_lib_search_path_spec="/usr/lib${libsuff} /lib${libsuff} /usr/local/lib${libsuff}" + sys_lib_dlsearch_path_spec="/usr/lib${libsuff} /lib${libsuff}" + hardcode_into_libs=yes + ;; + +# No shared lib support for Linux oldld, aout, or coff. +linux*oldld* | linux*aout* | linux*coff*) + dynamic_linker=no + ;; + +# This must be glibc/ELF. +linux* | k*bsd*-gnu | kopensolaris*-gnu) + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + + # Some binutils ld are patched to set DT_RUNPATH + if test "${lt_cv_shlibpath_overrides_runpath+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_shlibpath_overrides_runpath=no + save_LDFLAGS=$LDFLAGS + save_libdir=$libdir + eval "libdir=/foo; wl=\"$lt_prog_compiler_wl\"; \ + LDFLAGS=\"\$LDFLAGS $hardcode_libdir_flag_spec\"" + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (ac_try="$ac_link" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_link") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest$ac_exeext && + $as_test_x conftest$ac_exeext; then + if ($OBJDUMP -p conftest$ac_exeext) 2>/dev/null | grep "RUNPATH.*$libdir" >/dev/null; then + lt_cv_shlibpath_overrides_runpath=yes +fi + +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + +fi + +rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ + conftest$ac_exeext conftest.$ac_ext + LDFLAGS=$save_LDFLAGS + libdir=$save_libdir + +fi + + shlibpath_overrides_runpath=$lt_cv_shlibpath_overrides_runpath + + # This implies no fast_install, which is unacceptable. + # Some rework will be needed to allow for fast_install + # before this can be enabled. + hardcode_into_libs=yes + + # Append ld.so.conf contents to the search path + if test -f /etc/ld.so.conf; then + lt_ld_extra=`awk '/^include / { system(sprintf("cd /etc; cat %s 2>/dev/null", \$2)); skip = 1; } { if (!skip) print \$0; skip = 0; }' < /etc/ld.so.conf | $SED -e 's/#.*//;/^[ ]*hwcap[ ]/d;s/[:, ]/ /g;s/=[^=]*$//;s/=[^= ]* / /g;s/"//g;/^$/d' | tr '\n' ' '` + sys_lib_dlsearch_path_spec="/lib /usr/lib $lt_ld_extra" + fi + + # We used to test for /lib/ld.so.1 and disable shared libraries on + # powerpc, because MkLinux only supported shared libraries with the + # GNU dynamic linker. Since this was broken with cross compilers, + # most powerpc-linux boxes support dynamic linking these days and + # people can always --disable-shared, the test was removed, and we + # assume the GNU/Linux dynamic linker is in use. + dynamic_linker='GNU/Linux ld.so' + ;; + +netbsd*) + version_type=sunos + need_lib_prefix=no + need_version=no + if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir' + dynamic_linker='NetBSD (a.out) ld.so' + else + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + dynamic_linker='NetBSD ld.elf_so' + fi + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + +newsos6) + version_type=linux # correct to gnu/linux during the next big refactor + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + ;; + +*nto* | *qnx*) + version_type=qnx + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + dynamic_linker='ldqnx.so' + ;; + +openbsd*) + version_type=sunos + sys_lib_dlsearch_path_spec="/usr/lib" + need_lib_prefix=no + # Some older versions of OpenBSD (3.3 at least) *do* need versioned libs. + case $host_os in + openbsd3.3 | openbsd3.3.*) need_version=yes ;; + *) need_version=no ;; + esac + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir' + shlibpath_var=LD_LIBRARY_PATH + if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then + case $host_os in + openbsd2.[89] | openbsd2.[89].*) + shlibpath_overrides_runpath=no + ;; + *) + shlibpath_overrides_runpath=yes + ;; + esac + else + shlibpath_overrides_runpath=yes + fi + ;; + +os2*) + libname_spec='$name' + shrext_cmds=".dll" + need_lib_prefix=no + library_names_spec='$libname${shared_ext} $libname.a' + dynamic_linker='OS/2 ld.exe' + shlibpath_var=LIBPATH + ;; + +osf3* | osf4* | osf5*) + version_type=osf + need_lib_prefix=no + need_version=no + soname_spec='${libname}${release}${shared_ext}$major' + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + sys_lib_search_path_spec="/usr/shlib /usr/ccs/lib /usr/lib/cmplrs/cc /usr/lib /usr/local/lib /var/shlib" + sys_lib_dlsearch_path_spec="$sys_lib_search_path_spec" + ;; + +rdos*) + dynamic_linker=no + ;; + +solaris*) + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + # ldd complains unless libraries are executable + postinstall_cmds='chmod +x $lib' + ;; + +sunos4*) + version_type=sunos + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + if test "$with_gnu_ld" = yes; then + need_lib_prefix=no + fi + need_version=yes + ;; + +sysv4 | sysv4.3*) + version_type=linux # correct to gnu/linux during the next big refactor + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + case $host_vendor in + sni) + shlibpath_overrides_runpath=no + need_lib_prefix=no + runpath_var=LD_RUN_PATH + ;; + siemens) + need_lib_prefix=no + ;; + motorola) + need_lib_prefix=no + need_version=no + shlibpath_overrides_runpath=no + sys_lib_search_path_spec='/lib /usr/lib /usr/ccs/lib' + ;; + esac + ;; + +sysv4*MP*) + if test -d /usr/nec ;then + version_type=linux # correct to gnu/linux during the next big refactor + library_names_spec='$libname${shared_ext}.$versuffix $libname${shared_ext}.$major $libname${shared_ext}' + soname_spec='$libname${shared_ext}.$major' + shlibpath_var=LD_LIBRARY_PATH + fi + ;; + +sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*) + version_type=freebsd-elf + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + if test "$with_gnu_ld" = yes; then + sys_lib_search_path_spec='/usr/local/lib /usr/gnu/lib /usr/ccs/lib /usr/lib /lib' + else + sys_lib_search_path_spec='/usr/ccs/lib /usr/lib' + case $host_os in + sco3.2v5*) + sys_lib_search_path_spec="$sys_lib_search_path_spec /lib" + ;; + esac + fi + sys_lib_dlsearch_path_spec='/usr/lib' + ;; + +tpf*) + # TPF is a cross-target only. Preferred cross-host = GNU/Linux. + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + +uts4*) + version_type=linux # correct to gnu/linux during the next big refactor + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + ;; + +*) + dynamic_linker=no + ;; +esac +{ echo "$as_me:$LINENO: result: $dynamic_linker" >&5 +echo "${ECHO_T}$dynamic_linker" >&6; } +test "$dynamic_linker" = no && can_build_shared=no + +variables_saved_for_relink="PATH $shlibpath_var $runpath_var" +if test "$GCC" = yes; then + variables_saved_for_relink="$variables_saved_for_relink GCC_EXEC_PREFIX COMPILER_PATH LIBRARY_PATH" +fi + +if test "${lt_cv_sys_lib_search_path_spec+set}" = set; then + sys_lib_search_path_spec="$lt_cv_sys_lib_search_path_spec" +fi +if test "${lt_cv_sys_lib_dlsearch_path_spec+set}" = set; then + sys_lib_dlsearch_path_spec="$lt_cv_sys_lib_dlsearch_path_spec" +fi + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + { echo "$as_me:$LINENO: checking how to hardcode library paths into programs" >&5 +echo $ECHO_N "checking how to hardcode library paths into programs... $ECHO_C" >&6; } +hardcode_action= +if test -n "$hardcode_libdir_flag_spec" || + test -n "$runpath_var" || + test "X$hardcode_automatic" = "Xyes" ; then + + # We can hardcode non-existent directories. + if test "$hardcode_direct" != no && + # If the only mechanism to avoid hardcoding is shlibpath_var, we + # have to relink, otherwise we might link with an installed library + # when we should be linking with a yet-to-be-installed one + ## test "$_LT_TAGVAR(hardcode_shlibpath_var, )" != no && + test "$hardcode_minus_L" != no; then + # Linking always hardcodes the temporary library directory. + hardcode_action=relink + else + # We can link without hardcoding, and we can hardcode nonexisting dirs. + hardcode_action=immediate + fi +else + # We cannot hardcode anything, or else we can only hardcode existing + # directories. + hardcode_action=unsupported +fi +{ echo "$as_me:$LINENO: result: $hardcode_action" >&5 +echo "${ECHO_T}$hardcode_action" >&6; } + +if test "$hardcode_action" = relink || + test "$inherit_rpath" = yes; then + # Fast installation is not supported + enable_fast_install=no +elif test "$shlibpath_overrides_runpath" = yes || + test "$enable_shared" = no; then + # Fast installation is not necessary + enable_fast_install=needless +fi + + + + + + + if test "x$enable_dlopen" != xyes; then + enable_dlopen=unknown + enable_dlopen_self=unknown + enable_dlopen_self_static=unknown +else + lt_cv_dlopen=no + lt_cv_dlopen_libs= + + case $host_os in + beos*) + lt_cv_dlopen="load_add_on" + lt_cv_dlopen_libs= + lt_cv_dlopen_self=yes + ;; + + mingw* | pw32* | cegcc*) + lt_cv_dlopen="LoadLibrary" + lt_cv_dlopen_libs= + ;; + + cygwin*) + lt_cv_dlopen="dlopen" + lt_cv_dlopen_libs= + ;; + + darwin*) + # if libdl is installed we need to link against it + { echo "$as_me:$LINENO: checking for dlopen in -ldl" >&5 +echo $ECHO_N "checking for dlopen in -ldl... $ECHO_C" >&6; } +if test "${ac_cv_lib_dl_dlopen+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_check_lib_save_LIBS=$LIBS +LIBS="-ldl $LIBS" +cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char dlopen (); +int +main () +{ +return dlopen (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (ac_try="$ac_link" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_link") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest$ac_exeext && + $as_test_x conftest$ac_exeext; then + ac_cv_lib_dl_dlopen=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + ac_cv_lib_dl_dlopen=no +fi + +rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ + conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +{ echo "$as_me:$LINENO: result: $ac_cv_lib_dl_dlopen" >&5 +echo "${ECHO_T}$ac_cv_lib_dl_dlopen" >&6; } +if test $ac_cv_lib_dl_dlopen = yes; then + lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-ldl" +else + + lt_cv_dlopen="dyld" + lt_cv_dlopen_libs= + lt_cv_dlopen_self=yes + +fi + + ;; + + *) + { echo "$as_me:$LINENO: checking for shl_load" >&5 +echo $ECHO_N "checking for shl_load... $ECHO_C" >&6; } +if test "${ac_cv_func_shl_load+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +/* Define shl_load to an innocuous variant, in case declares shl_load. + For example, HP-UX 11i declares gettimeofday. */ +#define shl_load innocuous_shl_load + +/* System header to define __stub macros and hopefully few prototypes, + which can conflict with char shl_load (); below. + Prefer to if __STDC__ is defined, since + exists even on freestanding compilers. */ + +#ifdef __STDC__ +# include +#else +# include +#endif + +#undef shl_load + +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char shl_load (); +/* The GNU C library defines this for functions which it implements + to always fail with ENOSYS. Some functions are actually named + something starting with __ and the normal name is an alias. */ +#if defined __stub_shl_load || defined __stub___shl_load +choke me +#endif + +int +main () +{ +return shl_load (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (ac_try="$ac_link" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_link") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest$ac_exeext && + $as_test_x conftest$ac_exeext; then + ac_cv_func_shl_load=yes else - { { echo "$as_me:$LINENO: error: cannot compute suffix of executables: cannot compile and link -See \`config.log' for more details." >&5 -echo "$as_me: error: cannot compute suffix of executables: cannot compile and link -See \`config.log' for more details." >&2;} - { (exit 1); exit 1; }; } -fi + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 -rm -f conftest$ac_cv_exeext -{ echo "$as_me:$LINENO: result: $ac_cv_exeext" >&5 -echo "${ECHO_T}$ac_cv_exeext" >&6; } + ac_cv_func_shl_load=no +fi -rm -f conftest.$ac_ext -EXEEXT=$ac_cv_exeext -ac_exeext=$EXEEXT -{ echo "$as_me:$LINENO: checking for suffix of object files" >&5 -echo $ECHO_N "checking for suffix of object files... $ECHO_C" >&6; } -if test "${ac_cv_objext+set}" = set; then +rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ + conftest$ac_exeext conftest.$ac_ext +fi +{ echo "$as_me:$LINENO: result: $ac_cv_func_shl_load" >&5 +echo "${ECHO_T}$ac_cv_func_shl_load" >&6; } +if test $ac_cv_func_shl_load = yes; then + lt_cv_dlopen="shl_load" +else + { echo "$as_me:$LINENO: checking for shl_load in -ldld" >&5 +echo $ECHO_N "checking for shl_load in -ldld... $ECHO_C" >&6; } +if test "${ac_cv_lib_dld_shl_load+set}" = set; then echo $ECHO_N "(cached) $ECHO_C" >&6 else - cat >conftest.$ac_ext <<_ACEOF + ac_check_lib_save_LIBS=$LIBS +LIBS="-ldld $LIBS" +cat >conftest.$ac_ext <<_ACEOF /* confdefs.h. */ _ACEOF cat confdefs.h >>conftest.$ac_ext cat >>conftest.$ac_ext <<_ACEOF /* end confdefs.h. */ +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char shl_load (); int main () { - +return shl_load (); ; return 0; } _ACEOF -rm -f conftest.o conftest.obj -if { (ac_try="$ac_compile" +rm -f conftest.$ac_objext conftest$ac_exeext +if { (ac_try="$ac_link" case "(($ac_try" in *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; *) ac_try_echo=$ac_try;; esac eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_compile") 2>&5 + (eval "$ac_link") 2>conftest.er1 ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 echo "$as_me:$LINENO: \$? = $ac_status" >&5 - (exit $ac_status); }; then - for ac_file in conftest.o conftest.obj conftest.*; do - test -f "$ac_file" || continue; - case $ac_file in - *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf ) ;; - *) ac_cv_objext=`expr "$ac_file" : '.*\.\(.*\)'` - break;; - esac -done + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest$ac_exeext && + $as_test_x conftest$ac_exeext; then + ac_cv_lib_dld_shl_load=yes else echo "$as_me: failed program was:" >&5 sed 's/^/| /' conftest.$ac_ext >&5 -{ { echo "$as_me:$LINENO: error: cannot compute suffix of object files: cannot compile -See \`config.log' for more details." >&5 -echo "$as_me: error: cannot compute suffix of object files: cannot compile -See \`config.log' for more details." >&2;} - { (exit 1); exit 1; }; } + ac_cv_lib_dld_shl_load=no fi -rm -f conftest.$ac_cv_objext conftest.$ac_ext +rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ + conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS fi -{ echo "$as_me:$LINENO: result: $ac_cv_objext" >&5 -echo "${ECHO_T}$ac_cv_objext" >&6; } -OBJEXT=$ac_cv_objext -ac_objext=$OBJEXT -{ echo "$as_me:$LINENO: checking whether we are using the GNU C compiler" >&5 -echo $ECHO_N "checking whether we are using the GNU C compiler... $ECHO_C" >&6; } -if test "${ac_cv_c_compiler_gnu+set}" = set; then +{ echo "$as_me:$LINENO: result: $ac_cv_lib_dld_shl_load" >&5 +echo "${ECHO_T}$ac_cv_lib_dld_shl_load" >&6; } +if test $ac_cv_lib_dld_shl_load = yes; then + lt_cv_dlopen="shl_load" lt_cv_dlopen_libs="-ldld" +else + { echo "$as_me:$LINENO: checking for dlopen" >&5 +echo $ECHO_N "checking for dlopen... $ECHO_C" >&6; } +if test "${ac_cv_func_dlopen+set}" = set; then echo $ECHO_N "(cached) $ECHO_C" >&6 else cat >conftest.$ac_ext <<_ACEOF @@ -2415,26 +12448,53 @@ cat confdefs.h >>conftest.$ac_ext cat >>conftest.$ac_ext <<_ACEOF /* end confdefs.h. */ +/* Define dlopen to an innocuous variant, in case declares dlopen. + For example, HP-UX 11i declares gettimeofday. */ +#define dlopen innocuous_dlopen + +/* System header to define __stub macros and hopefully few prototypes, + which can conflict with char dlopen (); below. + Prefer to if __STDC__ is defined, since + exists even on freestanding compilers. */ + +#ifdef __STDC__ +# include +#else +# include +#endif + +#undef dlopen + +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char dlopen (); +/* The GNU C library defines this for functions which it implements + to always fail with ENOSYS. Some functions are actually named + something starting with __ and the normal name is an alias. */ +#if defined __stub_dlopen || defined __stub___dlopen +choke me +#endif int main () { -#ifndef __GNUC__ - choke me -#endif - +return dlopen (); ; return 0; } _ACEOF -rm -f conftest.$ac_objext -if { (ac_try="$ac_compile" +rm -f conftest.$ac_objext conftest$ac_exeext +if { (ac_try="$ac_link" case "(($ac_try" in *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; *) ac_try_echo=$ac_try;; esac eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_compile") 2>conftest.er1 + (eval "$ac_link") 2>conftest.er1 ac_status=$? grep -v '^ *+' conftest.er1 >conftest.err rm -f conftest.er1 @@ -2443,56 +12503,61 @@ (exit $ac_status); } && { test -z "$ac_c_werror_flag" || test ! -s conftest.err - } && test -s conftest.$ac_objext; then - ac_compiler_gnu=yes + } && test -s conftest$ac_exeext && + $as_test_x conftest$ac_exeext; then + ac_cv_func_dlopen=yes else echo "$as_me: failed program was:" >&5 sed 's/^/| /' conftest.$ac_ext >&5 - ac_compiler_gnu=no + ac_cv_func_dlopen=no fi -rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext -ac_cv_c_compiler_gnu=$ac_compiler_gnu - +rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ + conftest$ac_exeext conftest.$ac_ext fi -{ echo "$as_me:$LINENO: result: $ac_cv_c_compiler_gnu" >&5 -echo "${ECHO_T}$ac_cv_c_compiler_gnu" >&6; } -GCC=`test $ac_compiler_gnu = yes && echo yes` -ac_test_CFLAGS=${CFLAGS+set} -ac_save_CFLAGS=$CFLAGS -{ echo "$as_me:$LINENO: checking whether $CC accepts -g" >&5 -echo $ECHO_N "checking whether $CC accepts -g... $ECHO_C" >&6; } -if test "${ac_cv_prog_cc_g+set}" = set; then +{ echo "$as_me:$LINENO: result: $ac_cv_func_dlopen" >&5 +echo "${ECHO_T}$ac_cv_func_dlopen" >&6; } +if test $ac_cv_func_dlopen = yes; then + lt_cv_dlopen="dlopen" +else + { echo "$as_me:$LINENO: checking for dlopen in -ldl" >&5 +echo $ECHO_N "checking for dlopen in -ldl... $ECHO_C" >&6; } +if test "${ac_cv_lib_dl_dlopen+set}" = set; then echo $ECHO_N "(cached) $ECHO_C" >&6 else - ac_save_c_werror_flag=$ac_c_werror_flag - ac_c_werror_flag=yes - ac_cv_prog_cc_g=no - CFLAGS="-g" - cat >conftest.$ac_ext <<_ACEOF + ac_check_lib_save_LIBS=$LIBS +LIBS="-ldl $LIBS" +cat >conftest.$ac_ext <<_ACEOF /* confdefs.h. */ _ACEOF cat confdefs.h >>conftest.$ac_ext cat >>conftest.$ac_ext <<_ACEOF /* end confdefs.h. */ +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char dlopen (); int main () { - +return dlopen (); ; return 0; } _ACEOF -rm -f conftest.$ac_objext -if { (ac_try="$ac_compile" +rm -f conftest.$ac_objext conftest$ac_exeext +if { (ac_try="$ac_link" case "(($ac_try" in *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; *) ac_try_echo=$ac_try;; esac eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_compile") 2>conftest.er1 + (eval "$ac_link") 2>conftest.er1 ac_status=$? grep -v '^ *+' conftest.er1 >conftest.err rm -f conftest.er1 @@ -2501,36 +12566,62 @@ (exit $ac_status); } && { test -z "$ac_c_werror_flag" || test ! -s conftest.err - } && test -s conftest.$ac_objext; then - ac_cv_prog_cc_g=yes + } && test -s conftest$ac_exeext && + $as_test_x conftest$ac_exeext; then + ac_cv_lib_dl_dlopen=yes else echo "$as_me: failed program was:" >&5 sed 's/^/| /' conftest.$ac_ext >&5 - CFLAGS="" - cat >conftest.$ac_ext <<_ACEOF + ac_cv_lib_dl_dlopen=no +fi + +rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ + conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +{ echo "$as_me:$LINENO: result: $ac_cv_lib_dl_dlopen" >&5 +echo "${ECHO_T}$ac_cv_lib_dl_dlopen" >&6; } +if test $ac_cv_lib_dl_dlopen = yes; then + lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-ldl" +else + { echo "$as_me:$LINENO: checking for dlopen in -lsvld" >&5 +echo $ECHO_N "checking for dlopen in -lsvld... $ECHO_C" >&6; } +if test "${ac_cv_lib_svld_dlopen+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_check_lib_save_LIBS=$LIBS +LIBS="-lsvld $LIBS" +cat >conftest.$ac_ext <<_ACEOF /* confdefs.h. */ _ACEOF cat confdefs.h >>conftest.$ac_ext cat >>conftest.$ac_ext <<_ACEOF /* end confdefs.h. */ +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char dlopen (); int main () { - +return dlopen (); ; return 0; } _ACEOF -rm -f conftest.$ac_objext -if { (ac_try="$ac_compile" +rm -f conftest.$ac_objext conftest$ac_exeext +if { (ac_try="$ac_link" case "(($ac_try" in *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; *) ac_try_echo=$ac_try;; esac eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_compile") 2>conftest.er1 + (eval "$ac_link") 2>conftest.er1 ac_status=$? grep -v '^ *+' conftest.er1 >conftest.err rm -f conftest.er1 @@ -2539,37 +12630,62 @@ (exit $ac_status); } && { test -z "$ac_c_werror_flag" || test ! -s conftest.err - } && test -s conftest.$ac_objext; then - : + } && test -s conftest$ac_exeext && + $as_test_x conftest$ac_exeext; then + ac_cv_lib_svld_dlopen=yes else echo "$as_me: failed program was:" >&5 sed 's/^/| /' conftest.$ac_ext >&5 - ac_c_werror_flag=$ac_save_c_werror_flag - CFLAGS="-g" - cat >conftest.$ac_ext <<_ACEOF + ac_cv_lib_svld_dlopen=no +fi + +rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ + conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +{ echo "$as_me:$LINENO: result: $ac_cv_lib_svld_dlopen" >&5 +echo "${ECHO_T}$ac_cv_lib_svld_dlopen" >&6; } +if test $ac_cv_lib_svld_dlopen = yes; then + lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-lsvld" +else + { echo "$as_me:$LINENO: checking for dld_link in -ldld" >&5 +echo $ECHO_N "checking for dld_link in -ldld... $ECHO_C" >&6; } +if test "${ac_cv_lib_dld_dld_link+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_check_lib_save_LIBS=$LIBS +LIBS="-ldld $LIBS" +cat >conftest.$ac_ext <<_ACEOF /* confdefs.h. */ _ACEOF cat confdefs.h >>conftest.$ac_ext cat >>conftest.$ac_ext <<_ACEOF /* end confdefs.h. */ +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char dld_link (); int main () { - +return dld_link (); ; return 0; } _ACEOF -rm -f conftest.$ac_objext -if { (ac_try="$ac_compile" +rm -f conftest.$ac_objext conftest$ac_exeext +if { (ac_try="$ac_link" case "(($ac_try" in *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; *) ac_try_echo=$ac_try;; esac eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_compile") 2>conftest.er1 + (eval "$ac_link") 2>conftest.er1 ac_status=$? grep -v '^ *+' conftest.er1 >conftest.err rm -f conftest.er1 @@ -2578,673 +12694,1021 @@ (exit $ac_status); } && { test -z "$ac_c_werror_flag" || test ! -s conftest.err - } && test -s conftest.$ac_objext; then - ac_cv_prog_cc_g=yes + } && test -s conftest$ac_exeext && + $as_test_x conftest$ac_exeext; then + ac_cv_lib_dld_dld_link=yes else echo "$as_me: failed program was:" >&5 sed 's/^/| /' conftest.$ac_ext >&5 + ac_cv_lib_dld_dld_link=no +fi + +rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ + conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +{ echo "$as_me:$LINENO: result: $ac_cv_lib_dld_dld_link" >&5 +echo "${ECHO_T}$ac_cv_lib_dld_dld_link" >&6; } +if test $ac_cv_lib_dld_dld_link = yes; then + lt_cv_dlopen="dld_link" lt_cv_dlopen_libs="-ldld" +fi + fi -rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext + fi -rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext + fi -rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext - ac_c_werror_flag=$ac_save_c_werror_flag + fi -{ echo "$as_me:$LINENO: result: $ac_cv_prog_cc_g" >&5 -echo "${ECHO_T}$ac_cv_prog_cc_g" >&6; } -if test "$ac_test_CFLAGS" = set; then - CFLAGS=$ac_save_CFLAGS -elif test $ac_cv_prog_cc_g = yes; then - if test "$GCC" = yes; then - CFLAGS="-g -O2" + + +fi + + ;; + esac + + if test "x$lt_cv_dlopen" != xno; then + enable_dlopen=yes else - CFLAGS="-g" + enable_dlopen=no fi + + case $lt_cv_dlopen in + dlopen) + save_CPPFLAGS="$CPPFLAGS" + test "x$ac_cv_header_dlfcn_h" = xyes && CPPFLAGS="$CPPFLAGS -DHAVE_DLFCN_H" + + save_LDFLAGS="$LDFLAGS" + wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $export_dynamic_flag_spec\" + + save_LIBS="$LIBS" + LIBS="$lt_cv_dlopen_libs $LIBS" + + { echo "$as_me:$LINENO: checking whether a program can dlopen itself" >&5 +echo $ECHO_N "checking whether a program can dlopen itself... $ECHO_C" >&6; } +if test "${lt_cv_dlopen_self+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - if test "$GCC" = yes; then - CFLAGS="-O2" + if test "$cross_compiling" = yes; then : + lt_cv_dlopen_self=cross +else + lt_dlunknown=0; lt_dlno_uscore=1; lt_dlneed_uscore=2 + lt_status=$lt_dlunknown + cat > conftest.$ac_ext <<_LT_EOF +#line $LINENO "configure" +#include "confdefs.h" + +#if HAVE_DLFCN_H +#include +#endif + +#include + +#ifdef RTLD_GLOBAL +# define LT_DLGLOBAL RTLD_GLOBAL +#else +# ifdef DL_GLOBAL +# define LT_DLGLOBAL DL_GLOBAL +# else +# define LT_DLGLOBAL 0 +# endif +#endif + +/* We may have to define LT_DLLAZY_OR_NOW in the command line if we + find out it does not work in some platform. */ +#ifndef LT_DLLAZY_OR_NOW +# ifdef RTLD_LAZY +# define LT_DLLAZY_OR_NOW RTLD_LAZY +# else +# ifdef DL_LAZY +# define LT_DLLAZY_OR_NOW DL_LAZY +# else +# ifdef RTLD_NOW +# define LT_DLLAZY_OR_NOW RTLD_NOW +# else +# ifdef DL_NOW +# define LT_DLLAZY_OR_NOW DL_NOW +# else +# define LT_DLLAZY_OR_NOW 0 +# endif +# endif +# endif +# endif +#endif + +/* When -fvisbility=hidden is used, assume the code has been annotated + correspondingly for the symbols needed. */ +#if defined(__GNUC__) && (((__GNUC__ == 3) && (__GNUC_MINOR__ >= 3)) || (__GNUC__ > 3)) +int fnord () __attribute__((visibility("default"))); +#endif + +int fnord () { return 42; } +int main () +{ + void *self = dlopen (0, LT_DLGLOBAL|LT_DLLAZY_OR_NOW); + int status = $lt_dlunknown; + + if (self) + { + if (dlsym (self,"fnord")) status = $lt_dlno_uscore; + else + { + if (dlsym( self,"_fnord")) status = $lt_dlneed_uscore; + else puts (dlerror ()); + } + /* dlclose (self); */ + } else - CFLAGS= + puts (dlerror ()); + + return status; +} +_LT_EOF + if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && test -s conftest${ac_exeext} 2>/dev/null; then + (./conftest; exit; ) >&5 2>/dev/null + lt_status=$? + case x$lt_status in + x$lt_dlno_uscore) lt_cv_dlopen_self=yes ;; + x$lt_dlneed_uscore) lt_cv_dlopen_self=yes ;; + x$lt_dlunknown|x*) lt_cv_dlopen_self=no ;; + esac + else : + # compilation failed + lt_cv_dlopen_self=no fi fi -{ echo "$as_me:$LINENO: checking for $CC option to accept ISO C89" >&5 -echo $ECHO_N "checking for $CC option to accept ISO C89... $ECHO_C" >&6; } -if test "${ac_cv_prog_cc_c89+set}" = set; then +rm -fr conftest* + + +fi +{ echo "$as_me:$LINENO: result: $lt_cv_dlopen_self" >&5 +echo "${ECHO_T}$lt_cv_dlopen_self" >&6; } + + if test "x$lt_cv_dlopen_self" = xyes; then + wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $lt_prog_compiler_static\" + { echo "$as_me:$LINENO: checking whether a statically linked program can dlopen itself" >&5 +echo $ECHO_N "checking whether a statically linked program can dlopen itself... $ECHO_C" >&6; } +if test "${lt_cv_dlopen_self_static+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test "$cross_compiling" = yes; then : + lt_cv_dlopen_self_static=cross +else + lt_dlunknown=0; lt_dlno_uscore=1; lt_dlneed_uscore=2 + lt_status=$lt_dlunknown + cat > conftest.$ac_ext <<_LT_EOF +#line $LINENO "configure" +#include "confdefs.h" + +#if HAVE_DLFCN_H +#include +#endif + +#include + +#ifdef RTLD_GLOBAL +# define LT_DLGLOBAL RTLD_GLOBAL +#else +# ifdef DL_GLOBAL +# define LT_DLGLOBAL DL_GLOBAL +# else +# define LT_DLGLOBAL 0 +# endif +#endif + +/* We may have to define LT_DLLAZY_OR_NOW in the command line if we + find out it does not work in some platform. */ +#ifndef LT_DLLAZY_OR_NOW +# ifdef RTLD_LAZY +# define LT_DLLAZY_OR_NOW RTLD_LAZY +# else +# ifdef DL_LAZY +# define LT_DLLAZY_OR_NOW DL_LAZY +# else +# ifdef RTLD_NOW +# define LT_DLLAZY_OR_NOW RTLD_NOW +# else +# ifdef DL_NOW +# define LT_DLLAZY_OR_NOW DL_NOW +# else +# define LT_DLLAZY_OR_NOW 0 +# endif +# endif +# endif +# endif +#endif + +/* When -fvisbility=hidden is used, assume the code has been annotated + correspondingly for the symbols needed. */ +#if defined(__GNUC__) && (((__GNUC__ == 3) && (__GNUC_MINOR__ >= 3)) || (__GNUC__ > 3)) +int fnord () __attribute__((visibility("default"))); +#endif + +int fnord () { return 42; } +int main () +{ + void *self = dlopen (0, LT_DLGLOBAL|LT_DLLAZY_OR_NOW); + int status = $lt_dlunknown; + + if (self) + { + if (dlsym (self,"fnord")) status = $lt_dlno_uscore; + else + { + if (dlsym( self,"_fnord")) status = $lt_dlneed_uscore; + else puts (dlerror ()); + } + /* dlclose (self); */ + } + else + puts (dlerror ()); + + return status; +} +_LT_EOF + if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && test -s conftest${ac_exeext} 2>/dev/null; then + (./conftest; exit; ) >&5 2>/dev/null + lt_status=$? + case x$lt_status in + x$lt_dlno_uscore) lt_cv_dlopen_self_static=yes ;; + x$lt_dlneed_uscore) lt_cv_dlopen_self_static=yes ;; + x$lt_dlunknown|x*) lt_cv_dlopen_self_static=no ;; + esac + else : + # compilation failed + lt_cv_dlopen_self_static=no + fi +fi +rm -fr conftest* + + +fi +{ echo "$as_me:$LINENO: result: $lt_cv_dlopen_self_static" >&5 +echo "${ECHO_T}$lt_cv_dlopen_self_static" >&6; } + fi + + CPPFLAGS="$save_CPPFLAGS" + LDFLAGS="$save_LDFLAGS" + LIBS="$save_LIBS" + ;; + esac + + case $lt_cv_dlopen_self in + yes|no) enable_dlopen_self=$lt_cv_dlopen_self ;; + *) enable_dlopen_self=unknown ;; + esac + + case $lt_cv_dlopen_self_static in + yes|no) enable_dlopen_self_static=$lt_cv_dlopen_self_static ;; + *) enable_dlopen_self_static=unknown ;; + esac +fi + + + + + + + + + + + + + + + + + +striplib= +old_striplib= +{ echo "$as_me:$LINENO: checking whether stripping libraries is possible" >&5 +echo $ECHO_N "checking whether stripping libraries is possible... $ECHO_C" >&6; } +if test -n "$STRIP" && $STRIP -V 2>&1 | $GREP "GNU strip" >/dev/null; then + test -z "$old_striplib" && old_striplib="$STRIP --strip-debug" + test -z "$striplib" && striplib="$STRIP --strip-unneeded" + { echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6; } +else +# FIXME - insert some real tests, host_os isn't really good enough + case $host_os in + darwin*) + if test -n "$STRIP" ; then + striplib="$STRIP -x" + old_striplib="$STRIP -S" + { echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6; } + else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } + fi + ;; + *) + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } + ;; + esac +fi + + + + + + + + + + + + + # Report which library types will actually be built + { echo "$as_me:$LINENO: checking if libtool supports shared libraries" >&5 +echo $ECHO_N "checking if libtool supports shared libraries... $ECHO_C" >&6; } + { echo "$as_me:$LINENO: result: $can_build_shared" >&5 +echo "${ECHO_T}$can_build_shared" >&6; } + + { echo "$as_me:$LINENO: checking whether to build shared libraries" >&5 +echo $ECHO_N "checking whether to build shared libraries... $ECHO_C" >&6; } + test "$can_build_shared" = "no" && enable_shared=no + + # On AIX, shared libraries and static libraries use the same namespace, and + # are all built from PIC. + case $host_os in + aix3*) + test "$enable_shared" = yes && enable_static=no + if test -n "$RANLIB"; then + archive_cmds="$archive_cmds~\$RANLIB \$lib" + postinstall_cmds='$RANLIB $lib' + fi + ;; + + aix[4-9]*) + if test "$host_cpu" != ia64 && test "$aix_use_runtimelinking" = no ; then + test "$enable_shared" = yes && enable_static=no + fi + ;; + esac + { echo "$as_me:$LINENO: result: $enable_shared" >&5 +echo "${ECHO_T}$enable_shared" >&6; } + + { echo "$as_me:$LINENO: checking whether to build static libraries" >&5 +echo $ECHO_N "checking whether to build static libraries... $ECHO_C" >&6; } + # Make sure either enable_shared or enable_static is yes. + test "$enable_shared" = yes || enable_static=yes + { echo "$as_me:$LINENO: result: $enable_static" >&5 +echo "${ECHO_T}$enable_static" >&6; } + + + + +fi +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + +CC="$lt_save_CC" + + + + + + + + + + + + + + + + ac_config_commands="$ac_config_commands libtool" + + + + +# Only expand once: + + + + + + + + + +if test "x$ac_cv_env_PKG_CONFIG_set" != "xset"; then + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}pkg-config", so it can be a program name with args. +set dummy ${ac_tool_prefix}pkg-config; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_path_PKG_CONFIG+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + case $PKG_CONFIG in + [\\/]* | ?:[\\/]*) + ac_cv_path_PKG_CONFIG="$PKG_CONFIG" # Let the user override the test with a path. + ;; + *) + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_path_PKG_CONFIG="$as_dir/$ac_word$ac_exec_ext" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + + ;; +esac +fi +PKG_CONFIG=$ac_cv_path_PKG_CONFIG +if test -n "$PKG_CONFIG"; then + { echo "$as_me:$LINENO: result: $PKG_CONFIG" >&5 +echo "${ECHO_T}$PKG_CONFIG" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + +fi +if test -z "$ac_cv_path_PKG_CONFIG"; then + ac_pt_PKG_CONFIG=$PKG_CONFIG + # Extract the first word of "pkg-config", so it can be a program name with args. +set dummy pkg-config; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_path_ac_pt_PKG_CONFIG+set}" = set; then echo $ECHO_N "(cached) $ECHO_C" >&6 else - ac_cv_prog_cc_c89=no -ac_save_CC=$CC -cat >conftest.$ac_ext <<_ACEOF -/* confdefs.h. */ -_ACEOF -cat confdefs.h >>conftest.$ac_ext -cat >>conftest.$ac_ext <<_ACEOF -/* end confdefs.h. */ -#include -#include -#include -#include -/* Most of the following tests are stolen from RCS 5.7's src/conf.sh. */ -struct buf { int x; }; -FILE * (*rcsopen) (struct buf *, struct stat *, int); -static char *e (p, i) - char **p; - int i; -{ - return p[i]; -} -static char *f (char * (*g) (char **, int), char **p, ...) -{ - char *s; - va_list v; - va_start (v,p); - s = g (p, va_arg (v,int)); - va_end (v); - return s; -} + case $ac_pt_PKG_CONFIG in + [\\/]* | ?:[\\/]*) + ac_cv_path_ac_pt_PKG_CONFIG="$ac_pt_PKG_CONFIG" # Let the user override the test with a path. + ;; + *) + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_path_ac_pt_PKG_CONFIG="$as_dir/$ac_word$ac_exec_ext" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + + ;; +esac +fi +ac_pt_PKG_CONFIG=$ac_cv_path_ac_pt_PKG_CONFIG +if test -n "$ac_pt_PKG_CONFIG"; then + { echo "$as_me:$LINENO: result: $ac_pt_PKG_CONFIG" >&5 +echo "${ECHO_T}$ac_pt_PKG_CONFIG" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + + if test "x$ac_pt_PKG_CONFIG" = x; then + PKG_CONFIG="" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ echo "$as_me:$LINENO: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&5 +echo "$as_me: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&2;} +ac_tool_warned=yes ;; +esac + PKG_CONFIG=$ac_pt_PKG_CONFIG + fi +else + PKG_CONFIG="$ac_cv_path_PKG_CONFIG" +fi -/* OSF 4.0 Compaq cc is some sort of almost-ANSI by default. It has - function prototypes and stuff, but not '\xHH' hex character constants. - These don't provoke an error unfortunately, instead are silently treated - as 'x'. The following induces an error, until -std is added to get - proper ANSI mode. Curiously '\x00'!='x' always comes out true, for an - array size at least. It's necessary to write '\x00'==0 to get something - that's true only with -std. */ -int osf4_cc_array ['\x00' == 0 ? 1 : -1]; +fi +if test -n "$PKG_CONFIG"; then + _pkg_min_version=0.28 + { echo "$as_me:$LINENO: checking pkg-config is at least version $_pkg_min_version" >&5 +echo $ECHO_N "checking pkg-config is at least version $_pkg_min_version... $ECHO_C" >&6; } + if $PKG_CONFIG --atleast-pkgconfig-version $_pkg_min_version; then + { echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6; } + else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } + PKG_CONFIG="" + fi +fi -/* IBM C 6 for AIX is almost-ANSI by default, but it replaces macro parameters - inside strings and character constants. */ -#define FOO(x) 'x' -int xlc6_cc_array[FOO(a) == 'x' ? 1 : -1]; + # include explicit openssl dependency to get consistent LIBS -int test (int i, double x); -struct s1 {int (*f) (int a);}; -struct s2 {int (*f) (double a);}; -int pairnames (int, char **, FILE *(*)(struct buf *, struct stat *, int), int, int); -int argc; -char **argv; -int -main () -{ -return f (e, argv, 0) != argv[0] || f (e, argv, 1) != argv[1]; - ; - return 0; -} -_ACEOF -for ac_arg in '' -qlanglvl=extc89 -qlanglvl=ansi -std \ - -Ae "-Aa -D_HPUX_SOURCE" "-Xc -D__EXTENSIONS__" -do - CC="$ac_save_CC $ac_arg" - rm -f conftest.$ac_objext -if { (ac_try="$ac_compile" -case "(($ac_try" in - *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; - *) ac_try_echo=$ac_try;; -esac -eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_compile") 2>conftest.er1 +pkg_failed=no +{ echo "$as_me:$LINENO: checking for GLOBUS_PKG" >&5 +echo $ECHO_N "checking for GLOBUS_PKG... $ECHO_C" >&6; } + +if test -n "$GLOBUS_PKG_CFLAGS"; then + pkg_cv_GLOBUS_PKG_CFLAGS="$GLOBUS_PKG_CFLAGS" + elif test -n "$PKG_CONFIG"; then + if test -n "$PKG_CONFIG" && \ + { (echo "$as_me:$LINENO: \$PKG_CONFIG --exists --print-errors \"globus-gss-assist >= 2, globus-gssapi-gsi, globus-usage >= 1, globus-common, openssl\"") >&5 + ($PKG_CONFIG --exists --print-errors "globus-gss-assist >= 2, globus-gssapi-gsi, globus-usage >= 1, globus-common, openssl") 2>&5 ac_status=$? - grep -v '^ *+' conftest.er1 >conftest.err - rm -f conftest.er1 - cat conftest.err >&5 echo "$as_me:$LINENO: \$? = $ac_status" >&5 - (exit $ac_status); } && { - test -z "$ac_c_werror_flag" || - test ! -s conftest.err - } && test -s conftest.$ac_objext; then - ac_cv_prog_cc_c89=$ac_arg + (exit $ac_status); }; then + pkg_cv_GLOBUS_PKG_CFLAGS=`$PKG_CONFIG --cflags "globus-gss-assist >= 2, globus-gssapi-gsi, globus-usage >= 1, globus-common, openssl" 2>/dev/null` + test "x$?" != "x0" && pkg_failed=yes else - echo "$as_me: failed program was:" >&5 -sed 's/^/| /' conftest.$ac_ext >&5 + pkg_failed=yes +fi + else + pkg_failed=untried +fi +if test -n "$GLOBUS_PKG_LIBS"; then + pkg_cv_GLOBUS_PKG_LIBS="$GLOBUS_PKG_LIBS" + elif test -n "$PKG_CONFIG"; then + if test -n "$PKG_CONFIG" && \ + { (echo "$as_me:$LINENO: \$PKG_CONFIG --exists --print-errors \"globus-gss-assist >= 2, globus-gssapi-gsi, globus-usage >= 1, globus-common, openssl\"") >&5 + ($PKG_CONFIG --exists --print-errors "globus-gss-assist >= 2, globus-gssapi-gsi, globus-usage >= 1, globus-common, openssl") 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + pkg_cv_GLOBUS_PKG_LIBS=`$PKG_CONFIG --libs "globus-gss-assist >= 2, globus-gssapi-gsi, globus-usage >= 1, globus-common, openssl" 2>/dev/null` + test "x$?" != "x0" && pkg_failed=yes +else + pkg_failed=yes +fi + else + pkg_failed=untried +fi -fi -rm -f core conftest.err conftest.$ac_objext - test "x$ac_cv_prog_cc_c89" != "xno" && break -done -rm -f conftest.$ac_ext -CC=$ac_save_CC +if test $pkg_failed = yes; then + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +if $PKG_CONFIG --atleast-pkgconfig-version 0.20; then + _pkg_short_errors_supported=yes +else + _pkg_short_errors_supported=no fi -# AC_CACHE_VAL -case "x$ac_cv_prog_cc_c89" in - x) - { echo "$as_me:$LINENO: result: none needed" >&5 -echo "${ECHO_T}none needed" >&6; } ;; - xno) - { echo "$as_me:$LINENO: result: unsupported" >&5 -echo "${ECHO_T}unsupported" >&6; } ;; - *) - CC="$CC $ac_cv_prog_cc_c89" - { echo "$as_me:$LINENO: result: $ac_cv_prog_cc_c89" >&5 -echo "${ECHO_T}$ac_cv_prog_cc_c89" >&6; } ;; -esac + if test $_pkg_short_errors_supported = yes; then + GLOBUS_PKG_PKG_ERRORS=`$PKG_CONFIG --short-errors --print-errors --cflags --libs "globus-gss-assist >= 2, globus-gssapi-gsi, globus-usage >= 1, globus-common, openssl" 2>&1` + else + GLOBUS_PKG_PKG_ERRORS=`$PKG_CONFIG --print-errors --cflags --libs "globus-gss-assist >= 2, globus-gssapi-gsi, globus-usage >= 1, globus-common, openssl" 2>&1` + fi + # Put the nasty error message in config.log where it belongs + echo "$GLOBUS_PKG_PKG_ERRORS" >&5 + { { echo "$as_me:$LINENO: error: Package requirements (globus-gss-assist >= 2, globus-gssapi-gsi, globus-usage >= 1, globus-common, openssl) were not met: -ac_ext=c -ac_cpp='$CPP $CPPFLAGS' -ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' -ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' -ac_compiler_gnu=$ac_cv_c_compiler_gnu +$GLOBUS_PKG_PKG_ERRORS -ac_aux_dir= -for ac_dir in "$srcdir" "$srcdir/.." "$srcdir/../.."; do - if test -f "$ac_dir/install-sh"; then - ac_aux_dir=$ac_dir - ac_install_sh="$ac_aux_dir/install-sh -c" - break - elif test -f "$ac_dir/install.sh"; then - ac_aux_dir=$ac_dir - ac_install_sh="$ac_aux_dir/install.sh -c" - break - elif test -f "$ac_dir/shtool"; then - ac_aux_dir=$ac_dir - ac_install_sh="$ac_aux_dir/shtool install -c" - break - fi -done -if test -z "$ac_aux_dir"; then - { { echo "$as_me:$LINENO: error: cannot find install-sh or install.sh in \"$srcdir\" \"$srcdir/..\" \"$srcdir/../..\"" >&5 -echo "$as_me: error: cannot find install-sh or install.sh in \"$srcdir\" \"$srcdir/..\" \"$srcdir/../..\"" >&2;} - { (exit 1); exit 1; }; } -fi +Consider adjusting the PKG_CONFIG_PATH environment variable if you +installed software in a non-standard prefix. -# These three variables are undocumented and unsupported, -# and are intended to be withdrawn in a future Autoconf release. -# They can cause serious problems if a builder's source tree is in a directory -# whose full name contains unusual characters. -ac_config_guess="$SHELL $ac_aux_dir/config.guess" # Please don't use this var. -ac_config_sub="$SHELL $ac_aux_dir/config.sub" # Please don't use this var. -ac_configure="$SHELL $ac_aux_dir/configure" # Please don't use this var. +Alternatively, you may set the environment variables GLOBUS_PKG_CFLAGS +and GLOBUS_PKG_LIBS to avoid the need to call pkg-config. +See the pkg-config man page for more details." >&5 +echo "$as_me: error: Package requirements (globus-gss-assist >= 2, globus-gssapi-gsi, globus-usage >= 1, globus-common, openssl) were not met: +$GLOBUS_PKG_PKG_ERRORS -# Make sure we can run config.sub. -$SHELL "$ac_aux_dir/config.sub" sun4 >/dev/null 2>&1 || - { { echo "$as_me:$LINENO: error: cannot run $SHELL $ac_aux_dir/config.sub" >&5 -echo "$as_me: error: cannot run $SHELL $ac_aux_dir/config.sub" >&2;} - { (exit 1); exit 1; }; } +Consider adjusting the PKG_CONFIG_PATH environment variable if you +installed software in a non-standard prefix. -{ echo "$as_me:$LINENO: checking build system type" >&5 -echo $ECHO_N "checking build system type... $ECHO_C" >&6; } -if test "${ac_cv_build+set}" = set; then - echo $ECHO_N "(cached) $ECHO_C" >&6 -else - ac_build_alias=$build_alias -test "x$ac_build_alias" = x && - ac_build_alias=`$SHELL "$ac_aux_dir/config.guess"` -test "x$ac_build_alias" = x && - { { echo "$as_me:$LINENO: error: cannot guess build type; you must specify one" >&5 -echo "$as_me: error: cannot guess build type; you must specify one" >&2;} - { (exit 1); exit 1; }; } -ac_cv_build=`$SHELL "$ac_aux_dir/config.sub" $ac_build_alias` || - { { echo "$as_me:$LINENO: error: $SHELL $ac_aux_dir/config.sub $ac_build_alias failed" >&5 -echo "$as_me: error: $SHELL $ac_aux_dir/config.sub $ac_build_alias failed" >&2;} +Alternatively, you may set the environment variables GLOBUS_PKG_CFLAGS +and GLOBUS_PKG_LIBS to avoid the need to call pkg-config. +See the pkg-config man page for more details." >&2;} { (exit 1); exit 1; }; } +elif test $pkg_failed = untried; then + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } + { { echo "$as_me:$LINENO: error: The pkg-config script could not be found or is too old. Make sure it +is in your PATH or set the PKG_CONFIG environment variable to the full +path to pkg-config. -fi -{ echo "$as_me:$LINENO: result: $ac_cv_build" >&5 -echo "${ECHO_T}$ac_cv_build" >&6; } -case $ac_cv_build in -*-*-*) ;; -*) { { echo "$as_me:$LINENO: error: invalid value of canonical build" >&5 -echo "$as_me: error: invalid value of canonical build" >&2;} - { (exit 1); exit 1; }; };; -esac -build=$ac_cv_build -ac_save_IFS=$IFS; IFS='-' -set x $ac_cv_build -shift -build_cpu=$1 -build_vendor=$2 -shift; shift -# Remember, the first character of IFS is used to create $*, -# except with old shells: -build_os=$* -IFS=$ac_save_IFS -case $build_os in *\ *) build_os=`echo "$build_os" | sed 's/ /-/g'`;; esac +Alternatively, you may set the environment variables GLOBUS_PKG_CFLAGS +and GLOBUS_PKG_LIBS to avoid the need to call pkg-config. +See the pkg-config man page for more details. +To get pkg-config, see . +See \`config.log' for more details." >&5 +echo "$as_me: error: The pkg-config script could not be found or is too old. Make sure it +is in your PATH or set the PKG_CONFIG environment variable to the full +path to pkg-config. + +Alternatively, you may set the environment variables GLOBUS_PKG_CFLAGS +and GLOBUS_PKG_LIBS to avoid the need to call pkg-config. +See the pkg-config man page for more details. -{ echo "$as_me:$LINENO: checking host system type" >&5 -echo $ECHO_N "checking host system type... $ECHO_C" >&6; } -if test "${ac_cv_host+set}" = set; then - echo $ECHO_N "(cached) $ECHO_C" >&6 -else - if test "x$host_alias" = x; then - ac_cv_host=$ac_cv_build -else - ac_cv_host=`$SHELL "$ac_aux_dir/config.sub" $host_alias` || - { { echo "$as_me:$LINENO: error: $SHELL $ac_aux_dir/config.sub $host_alias failed" >&5 -echo "$as_me: error: $SHELL $ac_aux_dir/config.sub $host_alias failed" >&2;} +To get pkg-config, see . +See \`config.log' for more details." >&2;} { (exit 1); exit 1; }; } -fi +else + GLOBUS_PKG_CFLAGS=$pkg_cv_GLOBUS_PKG_CFLAGS + GLOBUS_PKG_LIBS=$pkg_cv_GLOBUS_PKG_LIBS + { echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6; } fi -{ echo "$as_me:$LINENO: result: $ac_cv_host" >&5 -echo "${ECHO_T}$ac_cv_host" >&6; } -case $ac_cv_host in -*-*-*) ;; -*) { { echo "$as_me:$LINENO: error: invalid value of canonical host" >&5 -echo "$as_me: error: invalid value of canonical host" >&2;} - { (exit 1); exit 1; }; };; -esac -host=$ac_cv_host -ac_save_IFS=$IFS; IFS='-' -set x $ac_cv_host -shift -host_cpu=$1 -host_vendor=$2 -shift; shift -# Remember, the first character of IFS is used to create $*, -# except with old shells: -host_os=$* -IFS=$ac_save_IFS -case $host_os in *\ *) host_os=`echo "$host_os" | sed 's/ /-/g'`;; esac + CFLAGS="$CFLAGS $GLOBUS_PKG_CFLAGS" + LIBS="$LIBS $GLOBUS_PKG_LIBS" + LD="\$(LIBTOOL) --mode=link $CC" + + cat >>confdefs.h <<\_ACEOF +#define HAVE_GSSAPI_H 1 +_ACEOF + + + INSTALL_GSISSH="yes" +else + INSTALL_GSISSH="" +fi +# End Globus/GSI section +ac_config_headers="$ac_config_headers config.h" ac_ext=c ac_cpp='$CPP $CPPFLAGS' ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' ac_compiler_gnu=$ac_cv_c_compiler_gnu -{ echo "$as_me:$LINENO: checking how to run the C preprocessor" >&5 -echo $ECHO_N "checking how to run the C preprocessor... $ECHO_C" >&6; } -# On Suns, sometimes $CPP names a directory. -if test -n "$CPP" && test -d "$CPP"; then - CPP= -fi -if test -z "$CPP"; then - if test "${ac_cv_prog_CPP+set}" = set; then +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}gcc", so it can be a program name with args. +set dummy ${ac_tool_prefix}gcc; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_CC+set}" = set; then echo $ECHO_N "(cached) $ECHO_C" >&6 else - # Double quotes because CPP needs to be expanded - for CPP in "$CC -E" "$CC -E -traditional-cpp" "/lib/cpp" - do - ac_preproc_ok=false -for ac_c_preproc_warn_flag in '' yes -do - # Use a header file that comes with gcc, so configuring glibc - # with a fresh cross-compiler works. - # Prefer to if __STDC__ is defined, since - # exists even on freestanding compilers. - # On the NeXT, cc -E runs the code through the compiler's parser, - # not just through cpp. "Syntax error" is here to catch this case. - cat >conftest.$ac_ext <<_ACEOF -/* confdefs.h. */ -_ACEOF -cat confdefs.h >>conftest.$ac_ext -cat >>conftest.$ac_ext <<_ACEOF -/* end confdefs.h. */ -#ifdef __STDC__ -# include -#else -# include -#endif - Syntax error -_ACEOF -if { (ac_try="$ac_cpp conftest.$ac_ext" -case "(($ac_try" in - *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; - *) ac_try_echo=$ac_try;; -esac -eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_cpp conftest.$ac_ext") 2>conftest.er1 - ac_status=$? - grep -v '^ *+' conftest.er1 >conftest.err - rm -f conftest.er1 - cat conftest.err >&5 - echo "$as_me:$LINENO: \$? = $ac_status" >&5 - (exit $ac_status); } >/dev/null && { - test -z "$ac_c_preproc_warn_flag$ac_c_werror_flag" || - test ! -s conftest.err - }; then - : + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. else - echo "$as_me: failed program was:" >&5 -sed 's/^/| /' conftest.$ac_ext >&5 +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_CC="${ac_tool_prefix}gcc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS - # Broken: fails on valid input. -continue fi - -rm -f conftest.err conftest.$ac_ext - - # OK, works on sane cases. Now check whether nonexistent headers - # can be detected and how. - cat >conftest.$ac_ext <<_ACEOF -/* confdefs.h. */ -_ACEOF -cat confdefs.h >>conftest.$ac_ext -cat >>conftest.$ac_ext <<_ACEOF -/* end confdefs.h. */ -#include -_ACEOF -if { (ac_try="$ac_cpp conftest.$ac_ext" -case "(($ac_try" in - *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; - *) ac_try_echo=$ac_try;; -esac -eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_cpp conftest.$ac_ext") 2>conftest.er1 - ac_status=$? - grep -v '^ *+' conftest.er1 >conftest.err - rm -f conftest.er1 - cat conftest.err >&5 - echo "$as_me:$LINENO: \$? = $ac_status" >&5 - (exit $ac_status); } >/dev/null && { - test -z "$ac_c_preproc_warn_flag$ac_c_werror_flag" || - test ! -s conftest.err - }; then - # Broken: success on invalid input. -continue +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + { echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6; } else - echo "$as_me: failed program was:" >&5 -sed 's/^/| /' conftest.$ac_ext >&5 - - # Passes both tests. -ac_preproc_ok=: -break + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } fi -rm -f conftest.err conftest.$ac_ext -done -# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped. -rm -f conftest.err conftest.$ac_ext -if $ac_preproc_ok; then - break fi - - done - ac_cv_prog_CPP=$CPP +if test -z "$ac_cv_prog_CC"; then + ac_ct_CC=$CC + # Extract the first word of "gcc", so it can be a program name with args. +set dummy gcc; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_ac_ct_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_CC"; then + ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_ac_ct_CC="gcc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS fi - CPP=$ac_cv_prog_CPP +fi +ac_ct_CC=$ac_cv_prog_ac_ct_CC +if test -n "$ac_ct_CC"; then + { echo "$as_me:$LINENO: result: $ac_ct_CC" >&5 +echo "${ECHO_T}$ac_ct_CC" >&6; } else - ac_cv_prog_CPP=$CPP + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } fi -{ echo "$as_me:$LINENO: result: $CPP" >&5 -echo "${ECHO_T}$CPP" >&6; } -ac_preproc_ok=false -for ac_c_preproc_warn_flag in '' yes -do - # Use a header file that comes with gcc, so configuring glibc - # with a fresh cross-compiler works. - # Prefer to if __STDC__ is defined, since - # exists even on freestanding compilers. - # On the NeXT, cc -E runs the code through the compiler's parser, - # not just through cpp. "Syntax error" is here to catch this case. - cat >conftest.$ac_ext <<_ACEOF -/* confdefs.h. */ -_ACEOF -cat confdefs.h >>conftest.$ac_ext -cat >>conftest.$ac_ext <<_ACEOF -/* end confdefs.h. */ -#ifdef __STDC__ -# include -#else -# include -#endif - Syntax error -_ACEOF -if { (ac_try="$ac_cpp conftest.$ac_ext" -case "(($ac_try" in - *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; - *) ac_try_echo=$ac_try;; + + if test "x$ac_ct_CC" = x; then + CC="" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ echo "$as_me:$LINENO: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&5 +echo "$as_me: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&2;} +ac_tool_warned=yes ;; esac -eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_cpp conftest.$ac_ext") 2>conftest.er1 - ac_status=$? - grep -v '^ *+' conftest.er1 >conftest.err - rm -f conftest.er1 - cat conftest.err >&5 - echo "$as_me:$LINENO: \$? = $ac_status" >&5 - (exit $ac_status); } >/dev/null && { - test -z "$ac_c_preproc_warn_flag$ac_c_werror_flag" || - test ! -s conftest.err - }; then - : + CC=$ac_ct_CC + fi else - echo "$as_me: failed program was:" >&5 -sed 's/^/| /' conftest.$ac_ext >&5 - - # Broken: fails on valid input. -continue + CC="$ac_cv_prog_CC" fi -rm -f conftest.err conftest.$ac_ext - - # OK, works on sane cases. Now check whether nonexistent headers - # can be detected and how. - cat >conftest.$ac_ext <<_ACEOF -/* confdefs.h. */ -_ACEOF -cat confdefs.h >>conftest.$ac_ext -cat >>conftest.$ac_ext <<_ACEOF -/* end confdefs.h. */ -#include -_ACEOF -if { (ac_try="$ac_cpp conftest.$ac_ext" -case "(($ac_try" in - *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; - *) ac_try_echo=$ac_try;; -esac -eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_cpp conftest.$ac_ext") 2>conftest.er1 - ac_status=$? - grep -v '^ *+' conftest.er1 >conftest.err - rm -f conftest.er1 - cat conftest.err >&5 - echo "$as_me:$LINENO: \$? = $ac_status" >&5 - (exit $ac_status); } >/dev/null && { - test -z "$ac_c_preproc_warn_flag$ac_c_werror_flag" || - test ! -s conftest.err - }; then - # Broken: success on invalid input. -continue +if test -z "$CC"; then + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}cc", so it can be a program name with args. +set dummy ${ac_tool_prefix}cc; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - echo "$as_me: failed program was:" >&5 -sed 's/^/| /' conftest.$ac_ext >&5 + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_CC="${ac_tool_prefix}cc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS - # Passes both tests. -ac_preproc_ok=: -break fi - -rm -f conftest.err conftest.$ac_ext - -done -# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped. -rm -f conftest.err conftest.$ac_ext -if $ac_preproc_ok; then - : +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + { echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6; } else - { { echo "$as_me:$LINENO: error: C preprocessor \"$CPP\" fails sanity check -See \`config.log' for more details." >&5 -echo "$as_me: error: C preprocessor \"$CPP\" fails sanity check -See \`config.log' for more details." >&2;} - { (exit 1); exit 1; }; } + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } fi -ac_ext=c -ac_cpp='$CPP $CPPFLAGS' -ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' -ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' -ac_compiler_gnu=$ac_cv_c_compiler_gnu - -{ echo "$as_me:$LINENO: checking for grep that handles long lines and -e" >&5 -echo $ECHO_N "checking for grep that handles long lines and -e... $ECHO_C" >&6; } -if test "${ac_cv_path_GREP+set}" = set; then + fi +fi +if test -z "$CC"; then + # Extract the first word of "cc", so it can be a program name with args. +set dummy cc; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_CC+set}" = set; then echo $ECHO_N "(cached) $ECHO_C" >&6 else - # Extract the first word of "grep ggrep" to use in msg output -if test -z "$GREP"; then -set dummy grep ggrep; ac_prog_name=$2 -if test "${ac_cv_path_GREP+set}" = set; then - echo $ECHO_N "(cached) $ECHO_C" >&6 + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. else - ac_path_GREP_found=false -# Loop through the user's path and test for each of PROGNAME-LIST + ac_prog_rejected=no as_save_IFS=$IFS; IFS=$PATH_SEPARATOR -for as_dir in $PATH$PATH_SEPARATOR/usr/xpg4/bin +for as_dir in $PATH do IFS=$as_save_IFS test -z "$as_dir" && as_dir=. - for ac_prog in grep ggrep; do for ac_exec_ext in '' $ac_executable_extensions; do - ac_path_GREP="$as_dir/$ac_prog$ac_exec_ext" - { test -f "$ac_path_GREP" && $as_test_x "$ac_path_GREP"; } || continue - # Check for GNU ac_path_GREP and select it if it is found. - # Check for GNU $ac_path_GREP -case `"$ac_path_GREP" --version 2>&1` in -*GNU*) - ac_cv_path_GREP="$ac_path_GREP" ac_path_GREP_found=:;; -*) - ac_count=0 - echo $ECHO_N "0123456789$ECHO_C" >"conftest.in" - while : - do - cat "conftest.in" "conftest.in" >"conftest.tmp" - mv "conftest.tmp" "conftest.in" - cp "conftest.in" "conftest.nl" - echo 'GREP' >> "conftest.nl" - "$ac_path_GREP" -e 'GREP$' -e '-(cannot match)-' < "conftest.nl" >"conftest.out" 2>/dev/null || break - diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break - ac_count=`expr $ac_count + 1` - if test $ac_count -gt ${ac_path_GREP_max-0}; then - # Best one so far, save it but keep looking for a better one - ac_cv_path_GREP="$ac_path_GREP" - ac_path_GREP_max=$ac_count - fi - # 10*(2^10) chars as input seems more than enough - test $ac_count -gt 10 && break - done - rm -f conftest.in conftest.tmp conftest.nl conftest.out;; -esac - - - $ac_path_GREP_found && break 3 - done + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + if test "$as_dir/$ac_word$ac_exec_ext" = "/usr/ucb/cc"; then + ac_prog_rejected=yes + continue + fi + ac_cv_prog_CC="cc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi done - done IFS=$as_save_IFS - +if test $ac_prog_rejected = yes; then + # We found a bogon in the path, so make sure we never use it. + set dummy $ac_cv_prog_CC + shift + if test $# != 0; then + # We chose a different compiler from the bogus one. + # However, it has the same basename, so the bogon will be chosen + # first if we set CC to just the basename; use the full file name. + shift + ac_cv_prog_CC="$as_dir/$ac_word${1+' '}$@" + fi fi - -GREP="$ac_cv_path_GREP" -if test -z "$GREP"; then - { { echo "$as_me:$LINENO: error: no acceptable $ac_prog_name could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" >&5 -echo "$as_me: error: no acceptable $ac_prog_name could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" >&2;} - { (exit 1); exit 1; }; } fi - +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + { echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6; } else - ac_cv_path_GREP=$GREP + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } fi fi -{ echo "$as_me:$LINENO: result: $ac_cv_path_GREP" >&5 -echo "${ECHO_T}$ac_cv_path_GREP" >&6; } - GREP="$ac_cv_path_GREP" - - -{ echo "$as_me:$LINENO: checking for egrep" >&5 -echo $ECHO_N "checking for egrep... $ECHO_C" >&6; } -if test "${ac_cv_path_EGREP+set}" = set; then +if test -z "$CC"; then + if test -n "$ac_tool_prefix"; then + for ac_prog in cl.exe + do + # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args. +set dummy $ac_tool_prefix$ac_prog; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_CC+set}" = set; then echo $ECHO_N "(cached) $ECHO_C" >&6 else - if echo a | $GREP -E '(a|b)' >/dev/null 2>&1 - then ac_cv_path_EGREP="$GREP -E" - else - # Extract the first word of "egrep" to use in msg output -if test -z "$EGREP"; then -set dummy egrep; ac_prog_name=$2 -if test "${ac_cv_path_EGREP+set}" = set; then - echo $ECHO_N "(cached) $ECHO_C" >&6 + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. else - ac_path_EGREP_found=false -# Loop through the user's path and test for each of PROGNAME-LIST as_save_IFS=$IFS; IFS=$PATH_SEPARATOR -for as_dir in $PATH$PATH_SEPARATOR/usr/xpg4/bin +for as_dir in $PATH do IFS=$as_save_IFS test -z "$as_dir" && as_dir=. - for ac_prog in egrep; do for ac_exec_ext in '' $ac_executable_extensions; do - ac_path_EGREP="$as_dir/$ac_prog$ac_exec_ext" - { test -f "$ac_path_EGREP" && $as_test_x "$ac_path_EGREP"; } || continue - # Check for GNU ac_path_EGREP and select it if it is found. - # Check for GNU $ac_path_EGREP -case `"$ac_path_EGREP" --version 2>&1` in -*GNU*) - ac_cv_path_EGREP="$ac_path_EGREP" ac_path_EGREP_found=:;; -*) - ac_count=0 - echo $ECHO_N "0123456789$ECHO_C" >"conftest.in" - while : - do - cat "conftest.in" "conftest.in" >"conftest.tmp" - mv "conftest.tmp" "conftest.in" - cp "conftest.in" "conftest.nl" - echo 'EGREP' >> "conftest.nl" - "$ac_path_EGREP" 'EGREP$' < "conftest.nl" >"conftest.out" 2>/dev/null || break - diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break - ac_count=`expr $ac_count + 1` - if test $ac_count -gt ${ac_path_EGREP_max-0}; then - # Best one so far, save it but keep looking for a better one - ac_cv_path_EGREP="$ac_path_EGREP" - ac_path_EGREP_max=$ac_count - fi - # 10*(2^10) chars as input seems more than enough - test $ac_count -gt 10 && break - done - rm -f conftest.in conftest.tmp conftest.nl conftest.out;; -esac + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_CC="$ac_tool_prefix$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done +IFS=$as_save_IFS + +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + { echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6; } +else + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi - $ac_path_EGREP_found && break 3 + test -n "$CC" && break done +fi +if test -z "$CC"; then + ac_ct_CC=$CC + for ac_prog in cl.exe +do + # Extract the first word of "$ac_prog", so it can be a program name with args. +set dummy $ac_prog; ac_word=$2 +{ echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6; } +if test "${ac_cv_prog_ac_ct_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_CC"; then + ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if { test -f "$as_dir/$ac_word$ac_exec_ext" && $as_test_x "$as_dir/$ac_word$ac_exec_ext"; }; then + ac_cv_prog_ac_ct_CC="$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi done - done IFS=$as_save_IFS - fi - -EGREP="$ac_cv_path_EGREP" -if test -z "$EGREP"; then - { { echo "$as_me:$LINENO: error: no acceptable $ac_prog_name could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" >&5 -echo "$as_me: error: no acceptable $ac_prog_name could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" >&2;} - { (exit 1); exit 1; }; } fi - +ac_ct_CC=$ac_cv_prog_ac_ct_CC +if test -n "$ac_ct_CC"; then + { echo "$as_me:$LINENO: result: $ac_ct_CC" >&5 +echo "${ECHO_T}$ac_ct_CC" >&6; } else - ac_cv_path_EGREP=$EGREP + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } fi - fi + test -n "$ac_ct_CC" && break +done + + if test "x$ac_ct_CC" = x; then + CC="" + else + case $cross_compiling:$ac_tool_warned in +yes:) +{ echo "$as_me:$LINENO: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&5 +echo "$as_me: WARNING: In the future, Autoconf will not detect cross-tools +whose name does not start with the host triplet. If you think this +configuration is useful to you, please write to autoconf@gnu.org." >&2;} +ac_tool_warned=yes ;; +esac + CC=$ac_ct_CC + fi fi -{ echo "$as_me:$LINENO: result: $ac_cv_path_EGREP" >&5 -echo "${ECHO_T}$ac_cv_path_EGREP" >&6; } - EGREP="$ac_cv_path_EGREP" +fi -{ echo "$as_me:$LINENO: checking for ANSI C header files" >&5 -echo $ECHO_N "checking for ANSI C header files... $ECHO_C" >&6; } -if test "${ac_cv_header_stdc+set}" = set; then + +test -z "$CC" && { { echo "$as_me:$LINENO: error: no acceptable C compiler found in \$PATH +See \`config.log' for more details." >&5 +echo "$as_me: error: no acceptable C compiler found in \$PATH +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } + +# Provide some information about the compiler. +echo "$as_me:$LINENO: checking for C compiler version" >&5 +ac_compiler=`set X $ac_compile; echo $2` +{ (ac_try="$ac_compiler --version >&5" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compiler --version >&5") 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } +{ (ac_try="$ac_compiler -v >&5" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compiler -v >&5") 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } +{ (ac_try="$ac_compiler -V >&5" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compiler -V >&5") 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } + +{ echo "$as_me:$LINENO: checking whether we are using the GNU C compiler" >&5 +echo $ECHO_N "checking whether we are using the GNU C compiler... $ECHO_C" >&6; } +if test "${ac_cv_c_compiler_gnu+set}" = set; then echo $ECHO_N "(cached) $ECHO_C" >&6 else cat >conftest.$ac_ext <<_ACEOF @@ -3253,14 +13717,13 @@ cat confdefs.h >>conftest.$ac_ext cat >>conftest.$ac_ext <<_ACEOF /* end confdefs.h. */ -#include -#include -#include -#include int main () { +#ifndef __GNUC__ + choke me +#endif ; return 0; @@ -3283,169 +13746,244 @@ test -z "$ac_c_werror_flag" || test ! -s conftest.err } && test -s conftest.$ac_objext; then - ac_cv_header_stdc=yes + ac_compiler_gnu=yes else echo "$as_me: failed program was:" >&5 sed 's/^/| /' conftest.$ac_ext >&5 - ac_cv_header_stdc=no + ac_compiler_gnu=no fi rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +ac_cv_c_compiler_gnu=$ac_compiler_gnu -if test $ac_cv_header_stdc = yes; then - # SunOS 4.x string.h does not declare mem*, contrary to ANSI. - cat >conftest.$ac_ext <<_ACEOF +fi +{ echo "$as_me:$LINENO: result: $ac_cv_c_compiler_gnu" >&5 +echo "${ECHO_T}$ac_cv_c_compiler_gnu" >&6; } +GCC=`test $ac_compiler_gnu = yes && echo yes` +ac_test_CFLAGS=${CFLAGS+set} +ac_save_CFLAGS=$CFLAGS +{ echo "$as_me:$LINENO: checking whether $CC accepts -g" >&5 +echo $ECHO_N "checking whether $CC accepts -g... $ECHO_C" >&6; } +if test "${ac_cv_prog_cc_g+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_save_c_werror_flag=$ac_c_werror_flag + ac_c_werror_flag=yes + ac_cv_prog_cc_g=no + CFLAGS="-g" + cat >conftest.$ac_ext <<_ACEOF /* confdefs.h. */ _ACEOF cat confdefs.h >>conftest.$ac_ext cat >>conftest.$ac_ext <<_ACEOF /* end confdefs.h. */ -#include +int +main () +{ + + ; + return 0; +} _ACEOF -if (eval "$ac_cpp conftest.$ac_ext") 2>&5 | - $EGREP "memchr" >/dev/null 2>&1; then - : +rm -f conftest.$ac_objext +if { (ac_try="$ac_compile" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compile") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest.$ac_objext; then + ac_cv_prog_cc_g=yes else - ac_cv_header_stdc=no -fi -rm -f conftest* - -fi + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 -if test $ac_cv_header_stdc = yes; then - # ISC 2.0.2 stdlib.h does not declare free, contrary to ANSI. - cat >conftest.$ac_ext <<_ACEOF + CFLAGS="" + cat >conftest.$ac_ext <<_ACEOF /* confdefs.h. */ _ACEOF cat confdefs.h >>conftest.$ac_ext cat >>conftest.$ac_ext <<_ACEOF /* end confdefs.h. */ -#include +int +main () +{ + + ; + return 0; +} _ACEOF -if (eval "$ac_cpp conftest.$ac_ext") 2>&5 | - $EGREP "free" >/dev/null 2>&1; then +rm -f conftest.$ac_objext +if { (ac_try="$ac_compile" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compile") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest.$ac_objext; then : else - ac_cv_header_stdc=no -fi -rm -f conftest* - -fi + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 -if test $ac_cv_header_stdc = yes; then - # /bin/cc in Irix-4.0.5 gets non-ANSI ctype macros unless using -ansi. - if test "$cross_compiling" = yes; then - : -else - cat >conftest.$ac_ext <<_ACEOF + ac_c_werror_flag=$ac_save_c_werror_flag + CFLAGS="-g" + cat >conftest.$ac_ext <<_ACEOF /* confdefs.h. */ _ACEOF cat confdefs.h >>conftest.$ac_ext cat >>conftest.$ac_ext <<_ACEOF /* end confdefs.h. */ -#include -#include -#if ((' ' & 0x0FF) == 0x020) -# define ISLOWER(c) ('a' <= (c) && (c) <= 'z') -# define TOUPPER(c) (ISLOWER(c) ? 'A' + ((c) - 'a') : (c)) -#else -# define ISLOWER(c) \ - (('a' <= (c) && (c) <= 'i') \ - || ('j' <= (c) && (c) <= 'r') \ - || ('s' <= (c) && (c) <= 'z')) -# define TOUPPER(c) (ISLOWER(c) ? ((c) | 0x40) : (c)) -#endif -#define XOR(e, f) (((e) && !(f)) || (!(e) && (f))) int main () { - int i; - for (i = 0; i < 256; i++) - if (XOR (islower (i), ISLOWER (i)) - || toupper (i) != TOUPPER (i)) - return 2; + + ; return 0; } _ACEOF -rm -f conftest$ac_exeext -if { (ac_try="$ac_link" +rm -f conftest.$ac_objext +if { (ac_try="$ac_compile" case "(($ac_try" in *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; *) ac_try_echo=$ac_try;; esac eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_link") 2>&5 - ac_status=$? - echo "$as_me:$LINENO: \$? = $ac_status" >&5 - (exit $ac_status); } && { ac_try='./conftest$ac_exeext' - { (case "(($ac_try" in - *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; - *) ac_try_echo=$ac_try;; -esac -eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_try") 2>&5 + (eval "$ac_compile") 2>conftest.er1 ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 echo "$as_me:$LINENO: \$? = $ac_status" >&5 - (exit $ac_status); }; }; then - : + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest.$ac_objext; then + ac_cv_prog_cc_g=yes else - echo "$as_me: program exited with status $ac_status" >&5 -echo "$as_me: failed program was:" >&5 + echo "$as_me: failed program was:" >&5 sed 's/^/| /' conftest.$ac_ext >&5 -( exit $ac_status ) -ac_cv_header_stdc=no -fi -rm -f core *.core core.conftest.* gmon.out bb.out conftest$ac_exeext conftest.$ac_objext conftest.$ac_ext -fi - fi -fi -{ echo "$as_me:$LINENO: result: $ac_cv_header_stdc" >&5 -echo "${ECHO_T}$ac_cv_header_stdc" >&6; } -if test $ac_cv_header_stdc = yes; then - -cat >>confdefs.h <<\_ACEOF -#define STDC_HEADERS 1 -_ACEOF +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext fi -# On IRIX 5.3, sys/types and inttypes.h are conflicting. - - - - - - - - +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +fi -for ac_header in sys/types.h sys/stat.h stdlib.h string.h memory.h strings.h \ - inttypes.h stdint.h unistd.h -do -as_ac_Header=`echo "ac_cv_header_$ac_header" | $as_tr_sh` -{ echo "$as_me:$LINENO: checking for $ac_header" >&5 -echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6; } -if { as_var=$as_ac_Header; eval "test \"\${$as_var+set}\" = set"; }; then +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext + ac_c_werror_flag=$ac_save_c_werror_flag +fi +{ echo "$as_me:$LINENO: result: $ac_cv_prog_cc_g" >&5 +echo "${ECHO_T}$ac_cv_prog_cc_g" >&6; } +if test "$ac_test_CFLAGS" = set; then + CFLAGS=$ac_save_CFLAGS +elif test $ac_cv_prog_cc_g = yes; then + if test "$GCC" = yes; then + CFLAGS="-g -O2" + else + CFLAGS="-g" + fi +else + if test "$GCC" = yes; then + CFLAGS="-O2" + else + CFLAGS= + fi +fi +{ echo "$as_me:$LINENO: checking for $CC option to accept ISO C89" >&5 +echo $ECHO_N "checking for $CC option to accept ISO C89... $ECHO_C" >&6; } +if test "${ac_cv_prog_cc_c89+set}" = set; then echo $ECHO_N "(cached) $ECHO_C" >&6 else - cat >conftest.$ac_ext <<_ACEOF + ac_cv_prog_cc_c89=no +ac_save_CC=$CC +cat >conftest.$ac_ext <<_ACEOF /* confdefs.h. */ _ACEOF cat confdefs.h >>conftest.$ac_ext cat >>conftest.$ac_ext <<_ACEOF /* end confdefs.h. */ -$ac_includes_default +#include +#include +#include +#include +/* Most of the following tests are stolen from RCS 5.7's src/conf.sh. */ +struct buf { int x; }; +FILE * (*rcsopen) (struct buf *, struct stat *, int); +static char *e (p, i) + char **p; + int i; +{ + return p[i]; +} +static char *f (char * (*g) (char **, int), char **p, ...) +{ + char *s; + va_list v; + va_start (v,p); + s = g (p, va_arg (v,int)); + va_end (v); + return s; +} -#include <$ac_header> +/* OSF 4.0 Compaq cc is some sort of almost-ANSI by default. It has + function prototypes and stuff, but not '\xHH' hex character constants. + These don't provoke an error unfortunately, instead are silently treated + as 'x'. The following induces an error, until -std is added to get + proper ANSI mode. Curiously '\x00'!='x' always comes out true, for an + array size at least. It's necessary to write '\x00'==0 to get something + that's true only with -std. */ +int osf4_cc_array ['\x00' == 0 ? 1 : -1]; + +/* IBM C 6 for AIX is almost-ANSI by default, but it replaces macro parameters + inside strings and character constants. */ +#define FOO(x) 'x' +int xlc6_cc_array[FOO(a) == 'x' ? 1 : -1]; + +int test (int i, double x); +struct s1 {int (*f) (int a);}; +struct s2 {int (*f) (double a);}; +int pairnames (int, char **, FILE *(*)(struct buf *, struct stat *, int), int, int); +int argc; +char **argv; +int +main () +{ +return f (e, argv, 0) != argv[0] || f (e, argv, 1) != argv[1]; + ; + return 0; +} _ACEOF -rm -f conftest.$ac_objext +for ac_arg in '' -qlanglvl=extc89 -qlanglvl=ansi -std \ + -Ae "-Aa -D_HPUX_SOURCE" "-Xc -D__EXTENSIONS__" +do + CC="$ac_save_CC $ac_arg" + rm -f conftest.$ac_objext if { (ac_try="$ac_compile" case "(($ac_try" in *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; @@ -3462,27 +14000,77 @@ test -z "$ac_c_werror_flag" || test ! -s conftest.err } && test -s conftest.$ac_objext; then - eval "$as_ac_Header=yes" + ac_cv_prog_cc_c89=$ac_arg else echo "$as_me: failed program was:" >&5 sed 's/^/| /' conftest.$ac_ext >&5 - eval "$as_ac_Header=no" + fi -rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +rm -f core conftest.err conftest.$ac_objext + test "x$ac_cv_prog_cc_c89" != "xno" && break +done +rm -f conftest.$ac_ext +CC=$ac_save_CC + fi -ac_res=`eval echo '${'$as_ac_Header'}'` - { echo "$as_me:$LINENO: result: $ac_res" >&5 -echo "${ECHO_T}$ac_res" >&6; } -if test `eval echo '${'$as_ac_Header'}'` = yes; then - cat >>confdefs.h <<_ACEOF -#define `echo "HAVE_$ac_header" | $as_tr_cpp` 1 -_ACEOF +# AC_CACHE_VAL +case "x$ac_cv_prog_cc_c89" in + x) + { echo "$as_me:$LINENO: result: none needed" >&5 +echo "${ECHO_T}none needed" >&6; } ;; + xno) + { echo "$as_me:$LINENO: result: unsupported" >&5 +echo "${ECHO_T}unsupported" >&6; } ;; + *) + CC="$CC $ac_cv_prog_cc_c89" + { echo "$as_me:$LINENO: result: $ac_cv_prog_cc_c89" >&5 +echo "${ECHO_T}$ac_cv_prog_cc_c89" >&6; } ;; +esac + + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu +{ echo "$as_me:$LINENO: checking host system type" >&5 +echo $ECHO_N "checking host system type... $ECHO_C" >&6; } +if test "${ac_cv_host+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test "x$host_alias" = x; then + ac_cv_host=$ac_cv_build +else + ac_cv_host=`$SHELL "$ac_aux_dir/config.sub" $host_alias` || + { { echo "$as_me:$LINENO: error: $SHELL $ac_aux_dir/config.sub $host_alias failed" >&5 +echo "$as_me: error: $SHELL $ac_aux_dir/config.sub $host_alias failed" >&2;} + { (exit 1); exit 1; }; } fi -done +fi +{ echo "$as_me:$LINENO: result: $ac_cv_host" >&5 +echo "${ECHO_T}$ac_cv_host" >&6; } +case $ac_cv_host in +*-*-*) ;; +*) { { echo "$as_me:$LINENO: error: invalid value of canonical host" >&5 +echo "$as_me: error: invalid value of canonical host" >&2;} + { (exit 1); exit 1; }; };; +esac +host=$ac_cv_host +ac_save_IFS=$IFS; IFS='-' +set x $ac_cv_host +shift +host_cpu=$1 +host_vendor=$2 +shift; shift +# Remember, the first character of IFS is used to create $*, +# except with old shells: +host_os=$* +IFS=$ac_save_IFS +case $host_os in *\ *) host_os=`echo "$host_os" | sed 's/ /-/g'`;; esac { echo "$as_me:$LINENO: checking whether byte ordering is bigendian" >&5 @@ -6172,73 +16760,8 @@ rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext } - { - { echo "$as_me:$LINENO: checking if $CC supports compile flag -Wuninitialized" >&5 -echo $ECHO_N "checking if $CC supports compile flag -Wuninitialized... $ECHO_C" >&6; } - saved_CFLAGS="$CFLAGS" - CFLAGS="$CFLAGS $WERROR -Wuninitialized" - _define_flag="" - test "x$_define_flag" = "x" && _define_flag="-Wuninitialized" - cat >conftest.$ac_ext <<_ACEOF -/* confdefs.h. */ -_ACEOF -cat confdefs.h >>conftest.$ac_ext -cat >>conftest.$ac_ext <<_ACEOF -/* end confdefs.h. */ - -#include -#include -int main(int argc, char **argv) { - /* Some math to catch -ftrapv problems in the toolchain */ - int i = 123 * argc, j = 456 + argc, k = 789 - argc; - float l = i * 2.1; - double m = l / 0.5; - long long int n = argc * 12345LL, o = 12345LL * (long long int)argc; - printf("%d %d %d %f %f %lld %lld\n", i, j, k, l, m, n, o); - exit(0); -} - -_ACEOF -rm -f conftest.$ac_objext -if { (ac_try="$ac_compile" -case "(($ac_try" in - *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; - *) ac_try_echo=$ac_try;; -esac -eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_compile") 2>conftest.er1 - ac_status=$? - grep -v '^ *+' conftest.er1 >conftest.err - rm -f conftest.er1 - cat conftest.err >&5 - echo "$as_me:$LINENO: \$? = $ac_status" >&5 - (exit $ac_status); } && { - test -z "$ac_c_werror_flag" || - test ! -s conftest.err - } && test -s conftest.$ac_objext; then - -if `grep -i "unrecognized option" conftest.err >/dev/null` -then - { echo "$as_me:$LINENO: result: no" >&5 -echo "${ECHO_T}no" >&6; } - CFLAGS="$saved_CFLAGS" -else - { echo "$as_me:$LINENO: result: yes" >&5 -echo "${ECHO_T}yes" >&6; } - CFLAGS="$saved_CFLAGS $_define_flag" -fi -else - echo "$as_me: failed program was:" >&5 -sed 's/^/| /' conftest.$ac_ext >&5 - - { echo "$as_me:$LINENO: result: no" >&5 -echo "${ECHO_T}no" >&6; } - CFLAGS="$saved_CFLAGS" - -fi - -rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext -} +# cc1: warning: -Wuninitialized is not supported without -O +# OSSH_CHECK_CFLAG_COMPILE([-Wuninitialized]) { { echo "$as_me:$LINENO: checking if $CC supports compile flag -Wsign-compare" >&5 echo $ECHO_N "checking if $CC supports compile flag -Wsign-compare... $ECHO_C" >&6; } @@ -9078,68 +19601,12 @@ ;; *-*-darwin*) - use_pie=auto - { echo "$as_me:$LINENO: checking if we have working getaddrinfo" >&5 -echo $ECHO_N "checking if we have working getaddrinfo... $ECHO_C" >&6; } - if test "$cross_compiling" = yes; then - { echo "$as_me:$LINENO: result: assume it is working" >&5 -echo "${ECHO_T}assume it is working" >&6; } -else - cat >conftest.$ac_ext <<_ACEOF -/* confdefs.h. */ -_ACEOF -cat confdefs.h >>conftest.$ac_ext -cat >>conftest.$ac_ext <<_ACEOF -/* end confdefs.h. */ - #include -main() { if (NSVersionOfRunTimeLibrary("System") >= (60 << 16)) - exit(0); - else - exit(1); -} - -_ACEOF -rm -f conftest$ac_exeext -if { (ac_try="$ac_link" -case "(($ac_try" in - *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; - *) ac_try_echo=$ac_try;; -esac -eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_link") 2>&5 - ac_status=$? - echo "$as_me:$LINENO: \$? = $ac_status" >&5 - (exit $ac_status); } && { ac_try='./conftest$ac_exeext' - { (case "(($ac_try" in - *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; - *) ac_try_echo=$ac_try;; -esac -eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_try") 2>&5 - ac_status=$? - echo "$as_me:$LINENO: \$? = $ac_status" >&5 - (exit $ac_status); }; }; then - { echo "$as_me:$LINENO: result: working" >&5 -echo "${ECHO_T}working" >&6; } -else - echo "$as_me: program exited with status $ac_status" >&5 -echo "$as_me: failed program was:" >&5 -sed 's/^/| /' conftest.$ac_ext >&5 - -( exit $ac_status ) -{ echo "$as_me:$LINENO: result: buggy" >&5 -echo "${ECHO_T}buggy" >&6; } + CFLAGS="$CFLAGS -Wno-deprecated-declarations" # suppress openssl warns cat >>confdefs.h <<\_ACEOF #define BROKEN_GETADDRINFO 1 _ACEOF - -fi -rm -f core *.core core.conftest.* gmon.out bb.out conftest$ac_exeext conftest.$ac_objext conftest.$ac_ext -fi - - cat >>confdefs.h <<\_ACEOF #define SETEUID_BREAKS_SETUID 1 _ACEOF @@ -9177,6 +19644,117 @@ #define SSH_TUN_PREPEND_AF 1 _ACEOF + { echo "$as_me:$LINENO: checking if we have the Security Authorization Session API" >&5 +echo $ECHO_N "checking if we have the Security Authorization Session API... $ECHO_C" >&6; } + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +int +main () +{ +SessionCreate(0, 0); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (ac_try="$ac_compile" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compile") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest.$ac_objext; then + ac_cv_use_security_session_api="yes" + +cat >>confdefs.h <<\_ACEOF +#define USE_SECURITY_SESSION_API 1 +_ACEOF + + LIBS="$LIBS -framework Security" + { echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6; } +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + ac_cv_use_security_session_api="no" + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } +fi + +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext + { echo "$as_me:$LINENO: checking if we have an in-memory credentials cache" >&5 +echo $ECHO_N "checking if we have an in-memory credentials cache... $ECHO_C" >&6; } + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +int +main () +{ +cc_context_t c; + (void) cc_initialize (&c, 0, NULL, NULL); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (ac_try="$ac_compile" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compile") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest.$ac_objext; then + +cat >>confdefs.h <<\_ACEOF +#define USE_CCAPI 1 +_ACEOF + + LIBS="$LIBS -framework Security" + { echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6; } + if test "x$ac_cv_use_security_session_api" = "xno"; then + { { echo "$as_me:$LINENO: error: *** Need a security framework to use the credentials cache API ***" >&5 +echo "$as_me: error: *** Need a security framework to use the credentials cache API ***" >&2;} + { (exit 1); exit 1; }; } + fi +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + { echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6; } + +fi + +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext { echo "$as_me:$LINENO: checking whether AU_IPv4 is declared" >&5 echo $ECHO_N "checking whether AU_IPv4 is declared... $ECHO_C" >&6; } @@ -9329,168 +19907,25 @@ echo "$as_me: failed program was:" >&5 sed 's/^/| /' conftest.$ac_ext >&5 - eval "$as_ac_var=no" -fi - -rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ - conftest$ac_exeext conftest.$ac_ext -fi -ac_res=`eval echo '${'$as_ac_var'}'` - { echo "$as_me:$LINENO: result: $ac_res" >&5 -echo "${ECHO_T}$ac_res" >&6; } -if test `eval echo '${'$as_ac_var'}'` = yes; then - cat >>confdefs.h <<_ACEOF -#define `echo "HAVE_$ac_func" | $as_tr_cpp` 1 -_ACEOF - -fi -done - - -for ac_header in sandbox.h -do -as_ac_Header=`echo "ac_cv_header_$ac_header" | $as_tr_sh` -if { as_var=$as_ac_Header; eval "test \"\${$as_var+set}\" = set"; }; then - { echo "$as_me:$LINENO: checking for $ac_header" >&5 -echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6; } -if { as_var=$as_ac_Header; eval "test \"\${$as_var+set}\" = set"; }; then - echo $ECHO_N "(cached) $ECHO_C" >&6 -fi -ac_res=`eval echo '${'$as_ac_Header'}'` - { echo "$as_me:$LINENO: result: $ac_res" >&5 -echo "${ECHO_T}$ac_res" >&6; } -else - # Is the header compilable? -{ echo "$as_me:$LINENO: checking $ac_header usability" >&5 -echo $ECHO_N "checking $ac_header usability... $ECHO_C" >&6; } -cat >conftest.$ac_ext <<_ACEOF -/* confdefs.h. */ -_ACEOF -cat confdefs.h >>conftest.$ac_ext -cat >>conftest.$ac_ext <<_ACEOF -/* end confdefs.h. */ -$ac_includes_default -#include <$ac_header> -_ACEOF -rm -f conftest.$ac_objext -if { (ac_try="$ac_compile" -case "(($ac_try" in - *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; - *) ac_try_echo=$ac_try;; -esac -eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_compile") 2>conftest.er1 - ac_status=$? - grep -v '^ *+' conftest.er1 >conftest.err - rm -f conftest.er1 - cat conftest.err >&5 - echo "$as_me:$LINENO: \$? = $ac_status" >&5 - (exit $ac_status); } && { - test -z "$ac_c_werror_flag" || - test ! -s conftest.err - } && test -s conftest.$ac_objext; then - ac_header_compiler=yes -else - echo "$as_me: failed program was:" >&5 -sed 's/^/| /' conftest.$ac_ext >&5 - - ac_header_compiler=no -fi - -rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext -{ echo "$as_me:$LINENO: result: $ac_header_compiler" >&5 -echo "${ECHO_T}$ac_header_compiler" >&6; } - -# Is the header present? -{ echo "$as_me:$LINENO: checking $ac_header presence" >&5 -echo $ECHO_N "checking $ac_header presence... $ECHO_C" >&6; } -cat >conftest.$ac_ext <<_ACEOF -/* confdefs.h. */ -_ACEOF -cat confdefs.h >>conftest.$ac_ext -cat >>conftest.$ac_ext <<_ACEOF -/* end confdefs.h. */ -#include <$ac_header> -_ACEOF -if { (ac_try="$ac_cpp conftest.$ac_ext" -case "(($ac_try" in - *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; - *) ac_try_echo=$ac_try;; -esac -eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_cpp conftest.$ac_ext") 2>conftest.er1 - ac_status=$? - grep -v '^ *+' conftest.er1 >conftest.err - rm -f conftest.er1 - cat conftest.err >&5 - echo "$as_me:$LINENO: \$? = $ac_status" >&5 - (exit $ac_status); } >/dev/null && { - test -z "$ac_c_preproc_warn_flag$ac_c_werror_flag" || - test ! -s conftest.err - }; then - ac_header_preproc=yes -else - echo "$as_me: failed program was:" >&5 -sed 's/^/| /' conftest.$ac_ext >&5 - - ac_header_preproc=no -fi - -rm -f conftest.err conftest.$ac_ext -{ echo "$as_me:$LINENO: result: $ac_header_preproc" >&5 -echo "${ECHO_T}$ac_header_preproc" >&6; } - -# So? What about this header? -case $ac_header_compiler:$ac_header_preproc:$ac_c_preproc_warn_flag in - yes:no: ) - { echo "$as_me:$LINENO: WARNING: $ac_header: accepted by the compiler, rejected by the preprocessor!" >&5 -echo "$as_me: WARNING: $ac_header: accepted by the compiler, rejected by the preprocessor!" >&2;} - { echo "$as_me:$LINENO: WARNING: $ac_header: proceeding with the compiler's result" >&5 -echo "$as_me: WARNING: $ac_header: proceeding with the compiler's result" >&2;} - ac_header_preproc=yes - ;; - no:yes:* ) - { echo "$as_me:$LINENO: WARNING: $ac_header: present but cannot be compiled" >&5 -echo "$as_me: WARNING: $ac_header: present but cannot be compiled" >&2;} - { echo "$as_me:$LINENO: WARNING: $ac_header: check for missing prerequisite headers?" >&5 -echo "$as_me: WARNING: $ac_header: check for missing prerequisite headers?" >&2;} - { echo "$as_me:$LINENO: WARNING: $ac_header: see the Autoconf documentation" >&5 -echo "$as_me: WARNING: $ac_header: see the Autoconf documentation" >&2;} - { echo "$as_me:$LINENO: WARNING: $ac_header: section \"Present But Cannot Be Compiled\"" >&5 -echo "$as_me: WARNING: $ac_header: section \"Present But Cannot Be Compiled\"" >&2;} - { echo "$as_me:$LINENO: WARNING: $ac_header: proceeding with the preprocessor's result" >&5 -echo "$as_me: WARNING: $ac_header: proceeding with the preprocessor's result" >&2;} - { echo "$as_me:$LINENO: WARNING: $ac_header: in the future, the compiler will take precedence" >&5 -echo "$as_me: WARNING: $ac_header: in the future, the compiler will take precedence" >&2;} - ( cat <<\_ASBOX -## ------------------------------------------- ## -## Report this to openssh-unix-dev@mindrot.org ## -## ------------------------------------------- ## -_ASBOX - ) | sed "s/^/$as_me: WARNING: /" >&2 - ;; -esac -{ echo "$as_me:$LINENO: checking for $ac_header" >&5 -echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6; } -if { as_var=$as_ac_Header; eval "test \"\${$as_var+set}\" = set"; }; then - echo $ECHO_N "(cached) $ECHO_C" >&6 -else - eval "$as_ac_Header=\$ac_header_preproc" + eval "$as_ac_var=no" fi -ac_res=`eval echo '${'$as_ac_Header'}'` - { echo "$as_me:$LINENO: result: $ac_res" >&5 -echo "${ECHO_T}$ac_res" >&6; } +rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ + conftest$ac_exeext conftest.$ac_ext fi -if test `eval echo '${'$as_ac_Header'}'` = yes; then +ac_res=`eval echo '${'$as_ac_var'}'` + { echo "$as_me:$LINENO: result: $ac_res" >&5 +echo "${ECHO_T}$ac_res" >&6; } +if test `eval echo '${'$as_ac_var'}'` = yes; then cat >>confdefs.h <<_ACEOF -#define `echo "HAVE_$ac_header" | $as_tr_cpp` 1 +#define `echo "HAVE_$ac_func" | $as_tr_cpp` 1 _ACEOF fi - done + # unreliable with autoconf pre-2.64 (such as used by GPT) + # AC_CHECK_HEADERS([sandbox.h]) ;; *-*-dragonfly*) SSHDLIBS="$SSHDLIBS -lcrypt" @@ -32007,86 +42442,632 @@ For example, HP-UX 11i declares gettimeofday. */ #define $ac_func innocuous_$ac_func -/* System header to define __stub macros and hopefully few prototypes, - which can conflict with char $ac_func (); below. - Prefer to if __STDC__ is defined, since - exists even on freestanding compilers. */ +/* System header to define __stub macros and hopefully few prototypes, + which can conflict with char $ac_func (); below. + Prefer to if __STDC__ is defined, since + exists even on freestanding compilers. */ + +#ifdef __STDC__ +# include +#else +# include +#endif + +#undef $ac_func + +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char $ac_func (); +/* The GNU C library defines this for functions which it implements + to always fail with ENOSYS. Some functions are actually named + something starting with __ and the normal name is an alias. */ +#if defined __stub_$ac_func || defined __stub___$ac_func +choke me +#endif + +int +main () +{ +return $ac_func (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (ac_try="$ac_link" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_link") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest$ac_exeext && + $as_test_x conftest$ac_exeext; then + eval "$as_ac_var=yes" +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + eval "$as_ac_var=no" +fi + +rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ + conftest$ac_exeext conftest.$ac_ext +fi +ac_res=`eval echo '${'$as_ac_var'}'` + { echo "$as_me:$LINENO: result: $ac_res" >&5 +echo "${ECHO_T}$ac_res" >&6; } +if test `eval echo '${'$as_ac_var'}'` = yes; then + cat >>confdefs.h <<_ACEOF +#define `echo "HAVE_$ac_func" | $as_tr_cpp` 1 +_ACEOF + +fi +done + + LIBS="$save_LIBS" + fi + +fi + + + + +# Finish configuring Globus GSSAPI +if test "x$gsi_path" != "xno" && test -d "$gsi_path/lib"; then + if test ! -z "$need_dash_r" ; then + LDFLAGS="$LDFLAGS -R${gsi_path}/lib" + fi + if test ! -z "$blibpath" ; then + blibpath="$blibpath:${gsi_path}/lib" + fi + # test that we got the libraries OK + { echo "$as_me:$LINENO: checking Globus linkline" >&5 +echo $ECHO_N "checking Globus linkline... $ECHO_C" >&6; } + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (ac_try="$ac_link" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_link") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest$ac_exeext && + $as_test_x conftest$ac_exeext; then + + { echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6; } + +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + + { { echo "$as_me:$LINENO: error: link with Globus libraries failed" >&5 +echo "$as_me: error: link with Globus libraries failed" >&2;} + { (exit 1); exit 1; }; } + + +fi + +rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ + conftest$ac_exeext conftest.$ac_ext + +for ac_func in globus_gss_assist_map_and_authorize +do +as_ac_var=`echo "ac_cv_func_$ac_func" | $as_tr_sh` +{ echo "$as_me:$LINENO: checking for $ac_func" >&5 +echo $ECHO_N "checking for $ac_func... $ECHO_C" >&6; } +if { as_var=$as_ac_var; eval "test \"\${$as_var+set}\" = set"; }; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +/* Define $ac_func to an innocuous variant, in case declares $ac_func. + For example, HP-UX 11i declares gettimeofday. */ +#define $ac_func innocuous_$ac_func + +/* System header to define __stub macros and hopefully few prototypes, + which can conflict with char $ac_func (); below. + Prefer to if __STDC__ is defined, since + exists even on freestanding compilers. */ + +#ifdef __STDC__ +# include +#else +# include +#endif + +#undef $ac_func + +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char $ac_func (); +/* The GNU C library defines this for functions which it implements + to always fail with ENOSYS. Some functions are actually named + something starting with __ and the normal name is an alias. */ +#if defined __stub_$ac_func || defined __stub___$ac_func +choke me +#endif + +int +main () +{ +return $ac_func (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (ac_try="$ac_link" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_link") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest$ac_exeext && + $as_test_x conftest$ac_exeext; then + eval "$as_ac_var=yes" +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + eval "$as_ac_var=no" +fi + +rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ + conftest$ac_exeext conftest.$ac_ext +fi +ac_res=`eval echo '${'$as_ac_var'}'` + { echo "$as_me:$LINENO: result: $ac_res" >&5 +echo "${ECHO_T}$ac_res" >&6; } +if test `eval echo '${'$as_ac_var'}'` = yes; then + cat >>confdefs.h <<_ACEOF +#define `echo "HAVE_$ac_func" | $as_tr_cpp` 1 +_ACEOF + +fi +done + +fi + + +{ echo "$as_me:$LINENO: checking for globus_usage_stats_send" >&5 +echo $ECHO_N "checking for globus_usage_stats_send... $ECHO_C" >&6; } +if test "${ac_cv_func_globus_usage_stats_send+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +/* Define globus_usage_stats_send to an innocuous variant, in case declares globus_usage_stats_send. + For example, HP-UX 11i declares gettimeofday. */ +#define globus_usage_stats_send innocuous_globus_usage_stats_send + +/* System header to define __stub macros and hopefully few prototypes, + which can conflict with char globus_usage_stats_send (); below. + Prefer to if __STDC__ is defined, since + exists even on freestanding compilers. */ + +#ifdef __STDC__ +# include +#else +# include +#endif + +#undef globus_usage_stats_send + +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char globus_usage_stats_send (); +/* The GNU C library defines this for functions which it implements + to always fail with ENOSYS. Some functions are actually named + something starting with __ and the normal name is an alias. */ +#if defined __stub_globus_usage_stats_send || defined __stub___globus_usage_stats_send +choke me +#endif + +int +main () +{ +return globus_usage_stats_send (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (ac_try="$ac_link" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_link") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest$ac_exeext && + $as_test_x conftest$ac_exeext; then + ac_cv_func_globus_usage_stats_send=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + ac_cv_func_globus_usage_stats_send=no +fi + +rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ + conftest$ac_exeext conftest.$ac_ext +fi +{ echo "$as_me:$LINENO: result: $ac_cv_func_globus_usage_stats_send" >&5 +echo "${ECHO_T}$ac_cv_func_globus_usage_stats_send" >&6; } +if test $ac_cv_func_globus_usage_stats_send = yes; then + +cat >>confdefs.h <<\_ACEOF +#define HAVE_GLOBUS_USAGE 1 +_ACEOF + +fi + + +{ echo "$as_me:$LINENO: checking for globus_usage_stats_send_array" >&5 +echo $ECHO_N "checking for globus_usage_stats_send_array... $ECHO_C" >&6; } +if test "${ac_cv_func_globus_usage_stats_send_array+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +/* Define globus_usage_stats_send_array to an innocuous variant, in case declares globus_usage_stats_send_array. + For example, HP-UX 11i declares gettimeofday. */ +#define globus_usage_stats_send_array innocuous_globus_usage_stats_send_array + +/* System header to define __stub macros and hopefully few prototypes, + which can conflict with char globus_usage_stats_send_array (); below. + Prefer to if __STDC__ is defined, since + exists even on freestanding compilers. */ + +#ifdef __STDC__ +# include +#else +# include +#endif + +#undef globus_usage_stats_send_array + +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char globus_usage_stats_send_array (); +/* The GNU C library defines this for functions which it implements + to always fail with ENOSYS. Some functions are actually named + something starting with __ and the normal name is an alias. */ +#if defined __stub_globus_usage_stats_send_array || defined __stub___globus_usage_stats_send_array +choke me +#endif + +int +main () +{ +return globus_usage_stats_send_array (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (ac_try="$ac_link" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_link") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest$ac_exeext && + $as_test_x conftest$ac_exeext; then + ac_cv_func_globus_usage_stats_send_array=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + ac_cv_func_globus_usage_stats_send_array=no +fi + +rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ + conftest$ac_exeext conftest.$ac_ext +fi +{ echo "$as_me:$LINENO: result: $ac_cv_func_globus_usage_stats_send_array" >&5 +echo "${ECHO_T}$ac_cv_func_globus_usage_stats_send_array" >&6; } +if test $ac_cv_func_globus_usage_stats_send_array = yes; then + +cat >>confdefs.h <<\_ACEOF +#define HAVE_GLOBUS_USAGE_SEND_ARRAY 1 +_ACEOF + +fi + + +# Check whether the user wants GSSAPI mechglue support + +# Check whether --with-mechglue was given. +if test "${with_mechglue+set}" = set; then + withval=$with_mechglue; + { echo "$as_me:$LINENO: checking for mechglue library" >&5 +echo $ECHO_N "checking for mechglue library... $ECHO_C" >&6; } + + if test -e ${withval}/libgssapi.a ; then + mechglue_lib=${withval}/libgssapi.a + elif test -e ${withval}/lib/libgssapi.a ; then + mechglue_lib=${withval}/lib/libgssapi.a + else + { { echo "$as_me:$LINENO: error: \"Can't find libgssapi in ${withval}\"" >&5 +echo "$as_me: error: \"Can't find libgssapi in ${withval}\"" >&2;} + { (exit 1); exit 1; }; }; + fi + LIBS="${mechglue_lib} $LIBS" + { echo "$as_me:$LINENO: result: ${mechglue_lib}" >&5 +echo "${ECHO_T}${mechglue_lib}" >&6; } + + +{ echo "$as_me:$LINENO: checking for dlopen in -ldl" >&5 +echo $ECHO_N "checking for dlopen in -ldl... $ECHO_C" >&6; } +if test "${ac_cv_lib_dl_dlopen+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_check_lib_save_LIBS=$LIBS +LIBS="-ldl $LIBS" +cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +/* Override any GCC internal prototype to avoid an error. + Use char because int might match the return type of a GCC + builtin and then its argument prototype would still apply. */ +#ifdef __cplusplus +extern "C" +#endif +char dlopen (); +int +main () +{ +return dlopen (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (ac_try="$ac_link" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_link") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest$ac_exeext && + $as_test_x conftest$ac_exeext; then + ac_cv_lib_dl_dlopen=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + ac_cv_lib_dl_dlopen=no +fi + +rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ + conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +{ echo "$as_me:$LINENO: result: $ac_cv_lib_dl_dlopen" >&5 +echo "${ECHO_T}$ac_cv_lib_dl_dlopen" >&6; } +if test $ac_cv_lib_dl_dlopen = yes; then + cat >>confdefs.h <<_ACEOF +#define HAVE_LIBDL 1 +_ACEOF + + LIBS="-ldl $LIBS" + +fi + + if test $ac_cv_lib_dl_dlopen = yes; then + LDFLAGS="$LDFLAGS -ldl -Wl,-Bsymbolic" + fi + + cat >>confdefs.h <<\_ACEOF +#define GSSAPI 1 +_ACEOF + + +cat >>confdefs.h <<\_ACEOF +#define MECHGLUE 1 +_ACEOF + + GSSAPI="mechglue" + + +fi + + + +NERSC_MOD='no' + +# Check whether --with-nerscmod was given. +if test "${with_nerscmod+set}" = set; then + withval=$with_nerscmod; + if test "x$withval" != "xno" ; then + NERSC_MOD='yes' + +cat >>confdefs.h <<\_ACEOF +#define NERSC_MOD 1 +_ACEOF + + { echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6; } + + fi + + +fi + + +STUNNEL_PORT='799' + +# Check whether --with-stunnelport was given. +if test "${with_stunnelport+set}" = set; then + withval=$with_stunnelport; + + case "$withval" in + [0-9]*) + STUNNEL_PORT="$withval" + ;; + *) + { { echo "$as_me:$LINENO: error: You must specify a numeric port number for --with-stunnelport" >&5 +echo "$as_me: error: You must specify a numeric port number for --with-stunnelport" >&2;} + { (exit 1); exit 1; }; } + ;; + esac + + if test ! -z "$withval" ; then + #STUNNEL_PORT="$withval" + +cat >>confdefs.h <<_ACEOF +#define STUNNEL_PORT $STUNNEL_PORT +_ACEOF + + fi -#ifdef __STDC__ -# include -#else -# include -#endif -#undef $ac_func +fi -/* Override any GCC internal prototype to avoid an error. - Use char because int might match the return type of a GCC - builtin and then its argument prototype would still apply. */ -#ifdef __cplusplus -extern "C" -#endif -char $ac_func (); -/* The GNU C library defines this for functions which it implements - to always fail with ENOSYS. Some functions are actually named - something starting with __ and the normal name is an alias. */ -#if defined __stub_$ac_func || defined __stub___$ac_func -choke me -#endif -int -main () -{ -return $ac_func (); - ; - return 0; -} +STUNNEL_HOST='localhost' + +# Check whether --with-stunnelhost was given. +if test "${with_stunnelhost+set}" = set; then + withval=$with_stunnelhost; + + STUNNEL_HOST="localhost" + + if test "x$withval" != "xno" ; then + STUNNEL_HOST="\"$withval\"" + +cat >>confdefs.h <<_ACEOF +#define STUNNEL_HOST $STUNNEL_HOST _ACEOF -rm -f conftest.$ac_objext conftest$ac_exeext -if { (ac_try="$ac_link" -case "(($ac_try" in - *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; - *) ac_try_echo=$ac_try;; -esac -eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 - (eval "$ac_link") 2>conftest.er1 - ac_status=$? - grep -v '^ *+' conftest.er1 >conftest.err - rm -f conftest.er1 - cat conftest.err >&5 - echo "$as_me:$LINENO: \$? = $ac_status" >&5 - (exit $ac_status); } && { - test -z "$ac_c_werror_flag" || - test ! -s conftest.err - } && test -s conftest$ac_exeext && - $as_test_x conftest$ac_exeext; then - eval "$as_ac_var=yes" -else - echo "$as_me: failed program was:" >&5 -sed 's/^/| /' conftest.$ac_ext >&5 - eval "$as_ac_var=no" -fi + fi + -rm -f core conftest.err conftest.$ac_objext conftest_ipa8_conftest.oo \ - conftest$ac_exeext conftest.$ac_ext fi -ac_res=`eval echo '${'$as_ac_var'}'` - { echo "$as_me:$LINENO: result: $ac_res" >&5 -echo "${ECHO_T}$ac_res" >&6; } -if test `eval echo '${'$as_ac_var'}'` = yes; then - cat >>confdefs.h <<_ACEOF -#define `echo "HAVE_$ac_func" | $as_tr_cpp` 1 + + + +PASSWD_REC='no' + +# Check whether --with-passwdrec was given. +if test "${with_passwdrec+set}" = set; then + withval=$with_passwdrec; + if test "x$withval" != "xno" ; then + PASSWD_REC='yes' + +cat >>confdefs.h <<\_ACEOF +#define PASSWD_REC 1 _ACEOF -fi -done + { echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6; } - LIBS="$save_LIBS" - fi + fi -fi +fi @@ -33143,7 +44124,158 @@ - fi + # If we're using some other GSSAPI + if test "$GSSAPI" -a "$GSSAPI" != "mechglue"; then + { { echo "$as_me:$LINENO: error: $GSSAPI GSSAPI library conflicts with Kerberos support. Use mechglue instead." >&5 +echo "$as_me: error: $GSSAPI GSSAPI library conflicts with Kerberos support. Use mechglue instead." >&2;} + { (exit 1); exit 1; }; } + fi + + if test -z "$GSSAPI"; then + GSSAPI="KRB5"; + fi + + oldCPP="$CPPFLAGS" + CPPFLAGS="$CPPFLAGS -I${KRB5ROOT}/include/gssapi" + if test "${ac_cv_header_gssapi_krb5_h+set}" = set; then + { echo "$as_me:$LINENO: checking for gssapi_krb5.h" >&5 +echo $ECHO_N "checking for gssapi_krb5.h... $ECHO_C" >&6; } +if test "${ac_cv_header_gssapi_krb5_h+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +fi +{ echo "$as_me:$LINENO: result: $ac_cv_header_gssapi_krb5_h" >&5 +echo "${ECHO_T}$ac_cv_header_gssapi_krb5_h" >&6; } +else + # Is the header compilable? +{ echo "$as_me:$LINENO: checking gssapi_krb5.h usability" >&5 +echo $ECHO_N "checking gssapi_krb5.h usability... $ECHO_C" >&6; } +cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default +#include +_ACEOF +rm -f conftest.$ac_objext +if { (ac_try="$ac_compile" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_compile") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { + test -z "$ac_c_werror_flag" || + test ! -s conftest.err + } && test -s conftest.$ac_objext; then + ac_header_compiler=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + ac_header_compiler=no +fi + +rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext +{ echo "$as_me:$LINENO: result: $ac_header_compiler" >&5 +echo "${ECHO_T}$ac_header_compiler" >&6; } + +# Is the header present? +{ echo "$as_me:$LINENO: checking gssapi_krb5.h presence" >&5 +echo $ECHO_N "checking gssapi_krb5.h presence... $ECHO_C" >&6; } +cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +_ACEOF +if { (ac_try="$ac_cpp conftest.$ac_ext" +case "(($ac_try" in + *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;; + *) ac_try_echo=$ac_try;; +esac +eval "echo \"\$as_me:$LINENO: $ac_try_echo\"") >&5 + (eval "$ac_cpp conftest.$ac_ext") 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null && { + test -z "$ac_c_preproc_warn_flag$ac_c_werror_flag" || + test ! -s conftest.err + }; then + ac_header_preproc=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + ac_header_preproc=no +fi + +rm -f conftest.err conftest.$ac_ext +{ echo "$as_me:$LINENO: result: $ac_header_preproc" >&5 +echo "${ECHO_T}$ac_header_preproc" >&6; } + +# So? What about this header? +case $ac_header_compiler:$ac_header_preproc:$ac_c_preproc_warn_flag in + yes:no: ) + { echo "$as_me:$LINENO: WARNING: gssapi_krb5.h: accepted by the compiler, rejected by the preprocessor!" >&5 +echo "$as_me: WARNING: gssapi_krb5.h: accepted by the compiler, rejected by the preprocessor!" >&2;} + { echo "$as_me:$LINENO: WARNING: gssapi_krb5.h: proceeding with the compiler's result" >&5 +echo "$as_me: WARNING: gssapi_krb5.h: proceeding with the compiler's result" >&2;} + ac_header_preproc=yes + ;; + no:yes:* ) + { echo "$as_me:$LINENO: WARNING: gssapi_krb5.h: present but cannot be compiled" >&5 +echo "$as_me: WARNING: gssapi_krb5.h: present but cannot be compiled" >&2;} + { echo "$as_me:$LINENO: WARNING: gssapi_krb5.h: check for missing prerequisite headers?" >&5 +echo "$as_me: WARNING: gssapi_krb5.h: check for missing prerequisite headers?" >&2;} + { echo "$as_me:$LINENO: WARNING: gssapi_krb5.h: see the Autoconf documentation" >&5 +echo "$as_me: WARNING: gssapi_krb5.h: see the Autoconf documentation" >&2;} + { echo "$as_me:$LINENO: WARNING: gssapi_krb5.h: section \"Present But Cannot Be Compiled\"" >&5 +echo "$as_me: WARNING: gssapi_krb5.h: section \"Present But Cannot Be Compiled\"" >&2;} + { echo "$as_me:$LINENO: WARNING: gssapi_krb5.h: proceeding with the preprocessor's result" >&5 +echo "$as_me: WARNING: gssapi_krb5.h: proceeding with the preprocessor's result" >&2;} + { echo "$as_me:$LINENO: WARNING: gssapi_krb5.h: in the future, the compiler will take precedence" >&5 +echo "$as_me: WARNING: gssapi_krb5.h: in the future, the compiler will take precedence" >&2;} + ( cat <<\_ASBOX +## ------------------------------------------- ## +## Report this to openssh-unix-dev@mindrot.org ## +## ------------------------------------------- ## +_ASBOX + ) | sed "s/^/$as_me: WARNING: /" >&2 + ;; +esac +{ echo "$as_me:$LINENO: checking for gssapi_krb5.h" >&5 +echo $ECHO_N "checking for gssapi_krb5.h... $ECHO_C" >&6; } +if test "${ac_cv_header_gssapi_krb5_h+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_cv_header_gssapi_krb5_h=$ac_header_preproc +fi +{ echo "$as_me:$LINENO: result: $ac_cv_header_gssapi_krb5_h" >&5 +echo "${ECHO_T}$ac_cv_header_gssapi_krb5_h" >&6; } + +fi +if test $ac_cv_header_gssapi_krb5_h = yes; then + : +else + CPPFLAGS="$oldCPP" +fi + + + + fi if test ! -z "$need_dash_r" ; then LDFLAGS="$LDFLAGS -R${KRB5ROOT}/lib" fi @@ -33867,6 +44999,61 @@ +# Check whether user wants AFS_KRB5 support +AFS_KRB5_MSG="no" + +# Check whether --with-afs-krb5 was given. +if test "${with_afs_krb5+set}" = set; then + withval=$with_afs_krb5; + if test "x$withval" != "xno" ; then + + if test "x$withval" != "xyes" ; then + +cat >>confdefs.h <<_ACEOF +#define AKLOG_PATH "$withval" +_ACEOF + + else + +cat >>confdefs.h <<_ACEOF +#define AKLOG_PATH "/usr/bin/aklog" +_ACEOF + + fi + + if test -z "$KRB5ROOT" ; then + { echo "$as_me:$LINENO: WARNING: AFS_KRB5 requires Kerberos 5 support, build may fail" >&5 +echo "$as_me: WARNING: AFS_KRB5 requires Kerberos 5 support, build may fail" >&2;} + fi + + LIBS="-lkrbafs -lkrb4 $LIBS" + if test ! -z "$AFS_LIBS" ; then + LIBS="$LIBS $AFS_LIBS" + fi + +cat >>confdefs.h <<\_ACEOF +#define AFS_KRB5 1 +_ACEOF + + AFS_KRB5_MSG="yes" + fi + + +fi + + + +# Check whether --with-session-hooks was given. +if test "${with_session_hooks+set}" = set; then + withval=$with_session_hooks; +cat >>confdefs.h <<\_ACEOF +#define SESSION_HOOKS 1 +_ACEOF + + +fi + + # Looking for programs, paths and files PRIVSEP_PATH=/var/empty @@ -33948,7 +45135,10 @@ fi +# strip causes problems with GSI libraries... +if test -z "$GLOBUS_LDFLAGS" ; then STRIP_OPT=-s +fi # Check whether --enable-strip was given. if test "${enable_strip+set}" = set; then enableval=$enable_strip; @@ -35979,6 +47169,7 @@ # Files that config.status was made for. config_files="$ac_config_files" config_headers="$ac_config_headers" +config_commands="$ac_config_commands" _ACEOF @@ -36005,6 +47196,9 @@ Configuration headers: $config_headers +Configuration commands: +$config_commands + Report bugs to ." _ACEOF @@ -36110,6 +47304,287 @@ _ACEOF cat >>$CONFIG_STATUS <<_ACEOF +# +# INIT-COMMANDS +# + + +# The HP-UX ksh and POSIX shell print the target directory to stdout +# if CDPATH is set. +(unset CDPATH) >/dev/null 2>&1 && unset CDPATH + +sed_quote_subst='$sed_quote_subst' +double_quote_subst='$double_quote_subst' +delay_variable_subst='$delay_variable_subst' +macro_version='`$ECHO "$macro_version" | $SED "$delay_single_quote_subst"`' +macro_revision='`$ECHO "$macro_revision" | $SED "$delay_single_quote_subst"`' +enable_shared='`$ECHO "$enable_shared" | $SED "$delay_single_quote_subst"`' +enable_static='`$ECHO "$enable_static" | $SED "$delay_single_quote_subst"`' +pic_mode='`$ECHO "$pic_mode" | $SED "$delay_single_quote_subst"`' +enable_fast_install='`$ECHO "$enable_fast_install" | $SED "$delay_single_quote_subst"`' +SHELL='`$ECHO "$SHELL" | $SED "$delay_single_quote_subst"`' +ECHO='`$ECHO "$ECHO" | $SED "$delay_single_quote_subst"`' +PATH_SEPARATOR='`$ECHO "$PATH_SEPARATOR" | $SED "$delay_single_quote_subst"`' +host_alias='`$ECHO "$host_alias" | $SED "$delay_single_quote_subst"`' +host='`$ECHO "$host" | $SED "$delay_single_quote_subst"`' +host_os='`$ECHO "$host_os" | $SED "$delay_single_quote_subst"`' +build_alias='`$ECHO "$build_alias" | $SED "$delay_single_quote_subst"`' +build='`$ECHO "$build" | $SED "$delay_single_quote_subst"`' +build_os='`$ECHO "$build_os" | $SED "$delay_single_quote_subst"`' +SED='`$ECHO "$SED" | $SED "$delay_single_quote_subst"`' +Xsed='`$ECHO "$Xsed" | $SED "$delay_single_quote_subst"`' +GREP='`$ECHO "$GREP" | $SED "$delay_single_quote_subst"`' +EGREP='`$ECHO "$EGREP" | $SED "$delay_single_quote_subst"`' +FGREP='`$ECHO "$FGREP" | $SED "$delay_single_quote_subst"`' +LD='`$ECHO "$LD" | $SED "$delay_single_quote_subst"`' +NM='`$ECHO "$NM" | $SED "$delay_single_quote_subst"`' +LN_S='`$ECHO "$LN_S" | $SED "$delay_single_quote_subst"`' +max_cmd_len='`$ECHO "$max_cmd_len" | $SED "$delay_single_quote_subst"`' +ac_objext='`$ECHO "$ac_objext" | $SED "$delay_single_quote_subst"`' +exeext='`$ECHO "$exeext" | $SED "$delay_single_quote_subst"`' +lt_unset='`$ECHO "$lt_unset" | $SED "$delay_single_quote_subst"`' +lt_SP2NL='`$ECHO "$lt_SP2NL" | $SED "$delay_single_quote_subst"`' +lt_NL2SP='`$ECHO "$lt_NL2SP" | $SED "$delay_single_quote_subst"`' +lt_cv_to_host_file_cmd='`$ECHO "$lt_cv_to_host_file_cmd" | $SED "$delay_single_quote_subst"`' +lt_cv_to_tool_file_cmd='`$ECHO "$lt_cv_to_tool_file_cmd" | $SED "$delay_single_quote_subst"`' +reload_flag='`$ECHO "$reload_flag" | $SED "$delay_single_quote_subst"`' +reload_cmds='`$ECHO "$reload_cmds" | $SED "$delay_single_quote_subst"`' +OBJDUMP='`$ECHO "$OBJDUMP" | $SED "$delay_single_quote_subst"`' +deplibs_check_method='`$ECHO "$deplibs_check_method" | $SED "$delay_single_quote_subst"`' +file_magic_cmd='`$ECHO "$file_magic_cmd" | $SED "$delay_single_quote_subst"`' +file_magic_glob='`$ECHO "$file_magic_glob" | $SED "$delay_single_quote_subst"`' +want_nocaseglob='`$ECHO "$want_nocaseglob" | $SED "$delay_single_quote_subst"`' +DLLTOOL='`$ECHO "$DLLTOOL" | $SED "$delay_single_quote_subst"`' +sharedlib_from_linklib_cmd='`$ECHO "$sharedlib_from_linklib_cmd" | $SED "$delay_single_quote_subst"`' +AR='`$ECHO "$AR" | $SED "$delay_single_quote_subst"`' +AR_FLAGS='`$ECHO "$AR_FLAGS" | $SED "$delay_single_quote_subst"`' +archiver_list_spec='`$ECHO "$archiver_list_spec" | $SED "$delay_single_quote_subst"`' +STRIP='`$ECHO "$STRIP" | $SED "$delay_single_quote_subst"`' +RANLIB='`$ECHO "$RANLIB" | $SED "$delay_single_quote_subst"`' +old_postinstall_cmds='`$ECHO "$old_postinstall_cmds" | $SED "$delay_single_quote_subst"`' +old_postuninstall_cmds='`$ECHO "$old_postuninstall_cmds" | $SED "$delay_single_quote_subst"`' +old_archive_cmds='`$ECHO "$old_archive_cmds" | $SED "$delay_single_quote_subst"`' +lock_old_archive_extraction='`$ECHO "$lock_old_archive_extraction" | $SED "$delay_single_quote_subst"`' +CC='`$ECHO "$CC" | $SED "$delay_single_quote_subst"`' +CFLAGS='`$ECHO "$CFLAGS" | $SED "$delay_single_quote_subst"`' +compiler='`$ECHO "$compiler" | $SED "$delay_single_quote_subst"`' +GCC='`$ECHO "$GCC" | $SED "$delay_single_quote_subst"`' +lt_cv_sys_global_symbol_pipe='`$ECHO "$lt_cv_sys_global_symbol_pipe" | $SED "$delay_single_quote_subst"`' +lt_cv_sys_global_symbol_to_cdecl='`$ECHO "$lt_cv_sys_global_symbol_to_cdecl" | $SED "$delay_single_quote_subst"`' +lt_cv_sys_global_symbol_to_c_name_address='`$ECHO "$lt_cv_sys_global_symbol_to_c_name_address" | $SED "$delay_single_quote_subst"`' +lt_cv_sys_global_symbol_to_c_name_address_lib_prefix='`$ECHO "$lt_cv_sys_global_symbol_to_c_name_address_lib_prefix" | $SED "$delay_single_quote_subst"`' +nm_file_list_spec='`$ECHO "$nm_file_list_spec" | $SED "$delay_single_quote_subst"`' +lt_sysroot='`$ECHO "$lt_sysroot" | $SED "$delay_single_quote_subst"`' +objdir='`$ECHO "$objdir" | $SED "$delay_single_quote_subst"`' +MAGIC_CMD='`$ECHO "$MAGIC_CMD" | $SED "$delay_single_quote_subst"`' +lt_prog_compiler_no_builtin_flag='`$ECHO "$lt_prog_compiler_no_builtin_flag" | $SED "$delay_single_quote_subst"`' +lt_prog_compiler_pic='`$ECHO "$lt_prog_compiler_pic" | $SED "$delay_single_quote_subst"`' +lt_prog_compiler_wl='`$ECHO "$lt_prog_compiler_wl" | $SED "$delay_single_quote_subst"`' +lt_prog_compiler_static='`$ECHO "$lt_prog_compiler_static" | $SED "$delay_single_quote_subst"`' +lt_cv_prog_compiler_c_o='`$ECHO "$lt_cv_prog_compiler_c_o" | $SED "$delay_single_quote_subst"`' +need_locks='`$ECHO "$need_locks" | $SED "$delay_single_quote_subst"`' +MANIFEST_TOOL='`$ECHO "$MANIFEST_TOOL" | $SED "$delay_single_quote_subst"`' +DSYMUTIL='`$ECHO "$DSYMUTIL" | $SED "$delay_single_quote_subst"`' +NMEDIT='`$ECHO "$NMEDIT" | $SED "$delay_single_quote_subst"`' +LIPO='`$ECHO "$LIPO" | $SED "$delay_single_quote_subst"`' +OTOOL='`$ECHO "$OTOOL" | $SED "$delay_single_quote_subst"`' +OTOOL64='`$ECHO "$OTOOL64" | $SED "$delay_single_quote_subst"`' +libext='`$ECHO "$libext" | $SED "$delay_single_quote_subst"`' +shrext_cmds='`$ECHO "$shrext_cmds" | $SED "$delay_single_quote_subst"`' +extract_expsyms_cmds='`$ECHO "$extract_expsyms_cmds" | $SED "$delay_single_quote_subst"`' +archive_cmds_need_lc='`$ECHO "$archive_cmds_need_lc" | $SED "$delay_single_quote_subst"`' +enable_shared_with_static_runtimes='`$ECHO "$enable_shared_with_static_runtimes" | $SED "$delay_single_quote_subst"`' +export_dynamic_flag_spec='`$ECHO "$export_dynamic_flag_spec" | $SED "$delay_single_quote_subst"`' +whole_archive_flag_spec='`$ECHO "$whole_archive_flag_spec" | $SED "$delay_single_quote_subst"`' +compiler_needs_object='`$ECHO "$compiler_needs_object" | $SED "$delay_single_quote_subst"`' +old_archive_from_new_cmds='`$ECHO "$old_archive_from_new_cmds" | $SED "$delay_single_quote_subst"`' +old_archive_from_expsyms_cmds='`$ECHO "$old_archive_from_expsyms_cmds" | $SED "$delay_single_quote_subst"`' +archive_cmds='`$ECHO "$archive_cmds" | $SED "$delay_single_quote_subst"`' +archive_expsym_cmds='`$ECHO "$archive_expsym_cmds" | $SED "$delay_single_quote_subst"`' +module_cmds='`$ECHO "$module_cmds" | $SED "$delay_single_quote_subst"`' +module_expsym_cmds='`$ECHO "$module_expsym_cmds" | $SED "$delay_single_quote_subst"`' +with_gnu_ld='`$ECHO "$with_gnu_ld" | $SED "$delay_single_quote_subst"`' +allow_undefined_flag='`$ECHO "$allow_undefined_flag" | $SED "$delay_single_quote_subst"`' +no_undefined_flag='`$ECHO "$no_undefined_flag" | $SED "$delay_single_quote_subst"`' +hardcode_libdir_flag_spec='`$ECHO "$hardcode_libdir_flag_spec" | $SED "$delay_single_quote_subst"`' +hardcode_libdir_separator='`$ECHO "$hardcode_libdir_separator" | $SED "$delay_single_quote_subst"`' +hardcode_direct='`$ECHO "$hardcode_direct" | $SED "$delay_single_quote_subst"`' +hardcode_direct_absolute='`$ECHO "$hardcode_direct_absolute" | $SED "$delay_single_quote_subst"`' +hardcode_minus_L='`$ECHO "$hardcode_minus_L" | $SED "$delay_single_quote_subst"`' +hardcode_shlibpath_var='`$ECHO "$hardcode_shlibpath_var" | $SED "$delay_single_quote_subst"`' +hardcode_automatic='`$ECHO "$hardcode_automatic" | $SED "$delay_single_quote_subst"`' +inherit_rpath='`$ECHO "$inherit_rpath" | $SED "$delay_single_quote_subst"`' +link_all_deplibs='`$ECHO "$link_all_deplibs" | $SED "$delay_single_quote_subst"`' +always_export_symbols='`$ECHO "$always_export_symbols" | $SED "$delay_single_quote_subst"`' +export_symbols_cmds='`$ECHO "$export_symbols_cmds" | $SED "$delay_single_quote_subst"`' +exclude_expsyms='`$ECHO "$exclude_expsyms" | $SED "$delay_single_quote_subst"`' +include_expsyms='`$ECHO "$include_expsyms" | $SED "$delay_single_quote_subst"`' +prelink_cmds='`$ECHO "$prelink_cmds" | $SED "$delay_single_quote_subst"`' +postlink_cmds='`$ECHO "$postlink_cmds" | $SED "$delay_single_quote_subst"`' +file_list_spec='`$ECHO "$file_list_spec" | $SED "$delay_single_quote_subst"`' +variables_saved_for_relink='`$ECHO "$variables_saved_for_relink" | $SED "$delay_single_quote_subst"`' +need_lib_prefix='`$ECHO "$need_lib_prefix" | $SED "$delay_single_quote_subst"`' +need_version='`$ECHO "$need_version" | $SED "$delay_single_quote_subst"`' +version_type='`$ECHO "$version_type" | $SED "$delay_single_quote_subst"`' +runpath_var='`$ECHO "$runpath_var" | $SED "$delay_single_quote_subst"`' +shlibpath_var='`$ECHO "$shlibpath_var" | $SED "$delay_single_quote_subst"`' +shlibpath_overrides_runpath='`$ECHO "$shlibpath_overrides_runpath" | $SED "$delay_single_quote_subst"`' +libname_spec='`$ECHO "$libname_spec" | $SED "$delay_single_quote_subst"`' +library_names_spec='`$ECHO "$library_names_spec" | $SED "$delay_single_quote_subst"`' +soname_spec='`$ECHO "$soname_spec" | $SED "$delay_single_quote_subst"`' +install_override_mode='`$ECHO "$install_override_mode" | $SED "$delay_single_quote_subst"`' +postinstall_cmds='`$ECHO "$postinstall_cmds" | $SED "$delay_single_quote_subst"`' +postuninstall_cmds='`$ECHO "$postuninstall_cmds" | $SED "$delay_single_quote_subst"`' +finish_cmds='`$ECHO "$finish_cmds" | $SED "$delay_single_quote_subst"`' +finish_eval='`$ECHO "$finish_eval" | $SED "$delay_single_quote_subst"`' +hardcode_into_libs='`$ECHO "$hardcode_into_libs" | $SED "$delay_single_quote_subst"`' +sys_lib_search_path_spec='`$ECHO "$sys_lib_search_path_spec" | $SED "$delay_single_quote_subst"`' +sys_lib_dlsearch_path_spec='`$ECHO "$sys_lib_dlsearch_path_spec" | $SED "$delay_single_quote_subst"`' +hardcode_action='`$ECHO "$hardcode_action" | $SED "$delay_single_quote_subst"`' +enable_dlopen='`$ECHO "$enable_dlopen" | $SED "$delay_single_quote_subst"`' +enable_dlopen_self='`$ECHO "$enable_dlopen_self" | $SED "$delay_single_quote_subst"`' +enable_dlopen_self_static='`$ECHO "$enable_dlopen_self_static" | $SED "$delay_single_quote_subst"`' +old_striplib='`$ECHO "$old_striplib" | $SED "$delay_single_quote_subst"`' +striplib='`$ECHO "$striplib" | $SED "$delay_single_quote_subst"`' + +LTCC='$LTCC' +LTCFLAGS='$LTCFLAGS' +compiler='$compiler_DEFAULT' + +# A function that is used when there is no print builtin or printf. +func_fallback_echo () +{ + eval 'cat <<_LTECHO_EOF +\$1 +_LTECHO_EOF' +} + +# Quote evaled strings. +for var in SHELL \ +ECHO \ +PATH_SEPARATOR \ +SED \ +GREP \ +EGREP \ +FGREP \ +LD \ +NM \ +LN_S \ +lt_SP2NL \ +lt_NL2SP \ +reload_flag \ +OBJDUMP \ +deplibs_check_method \ +file_magic_cmd \ +file_magic_glob \ +want_nocaseglob \ +DLLTOOL \ +sharedlib_from_linklib_cmd \ +AR \ +AR_FLAGS \ +archiver_list_spec \ +STRIP \ +RANLIB \ +CC \ +CFLAGS \ +compiler \ +lt_cv_sys_global_symbol_pipe \ +lt_cv_sys_global_symbol_to_cdecl \ +lt_cv_sys_global_symbol_to_c_name_address \ +lt_cv_sys_global_symbol_to_c_name_address_lib_prefix \ +nm_file_list_spec \ +lt_prog_compiler_no_builtin_flag \ +lt_prog_compiler_pic \ +lt_prog_compiler_wl \ +lt_prog_compiler_static \ +lt_cv_prog_compiler_c_o \ +need_locks \ +MANIFEST_TOOL \ +DSYMUTIL \ +NMEDIT \ +LIPO \ +OTOOL \ +OTOOL64 \ +shrext_cmds \ +export_dynamic_flag_spec \ +whole_archive_flag_spec \ +compiler_needs_object \ +with_gnu_ld \ +allow_undefined_flag \ +no_undefined_flag \ +hardcode_libdir_flag_spec \ +hardcode_libdir_separator \ +exclude_expsyms \ +include_expsyms \ +file_list_spec \ +variables_saved_for_relink \ +libname_spec \ +library_names_spec \ +soname_spec \ +install_override_mode \ +finish_eval \ +old_striplib \ +striplib; do + case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in + *[\\\\\\\`\\"\\\$]*) + eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED \\"\\\$sed_quote_subst\\"\\\`\\\\\\"" + ;; + *) + eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\"" + ;; + esac +done + +# Double-quote double-evaled strings. +for var in reload_cmds \ +old_postinstall_cmds \ +old_postuninstall_cmds \ +old_archive_cmds \ +extract_expsyms_cmds \ +old_archive_from_new_cmds \ +old_archive_from_expsyms_cmds \ +archive_cmds \ +archive_expsym_cmds \ +module_cmds \ +module_expsym_cmds \ +export_symbols_cmds \ +prelink_cmds \ +postlink_cmds \ +postinstall_cmds \ +postuninstall_cmds \ +finish_cmds \ +sys_lib_search_path_spec \ +sys_lib_dlsearch_path_spec; do + case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in + *[\\\\\\\`\\"\\\$]*) + eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED -e \\"\\\$double_quote_subst\\" -e \\"\\\$sed_quote_subst\\" -e \\"\\\$delay_variable_subst\\"\\\`\\\\\\"" + ;; + *) + eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\"" + ;; + esac +done + +ac_aux_dir='$ac_aux_dir' +xsi_shell='$xsi_shell' +lt_shell_append='$lt_shell_append' + +# See if we are running on zsh, and set the options which allow our +# commands through without removal of \ escapes INIT. +if test -n "\${ZSH_VERSION+set}" ; then + setopt NO_GLOB_SUBST +fi + + + PACKAGE='$PACKAGE' + VERSION='$VERSION' + TIMESTAMP='$TIMESTAMP' + RM='$RM' + ofile='$ofile' + + + + _ACEOF cat >>$CONFIG_STATUS <<\_ACEOF @@ -36118,6 +47593,7 @@ for ac_config_target in $ac_config_targets do case $ac_config_target in + "libtool") CONFIG_COMMANDS="$CONFIG_COMMANDS libtool" ;; "config.h") CONFIG_HEADERS="$CONFIG_HEADERS config.h" ;; "Makefile") CONFIG_FILES="$CONFIG_FILES Makefile" ;; "buildpkg.sh") CONFIG_FILES="$CONFIG_FILES buildpkg.sh" ;; @@ -36141,6 +47617,7 @@ if $ac_need_defaults; then test "${CONFIG_FILES+set}" = set || CONFIG_FILES=$config_files test "${CONFIG_HEADERS+set}" = set || CONFIG_HEADERS=$config_headers + test "${CONFIG_COMMANDS+set}" = set || CONFIG_COMMANDS=$config_commands fi # Have a temporary directory for convenience. Make it in the build tree @@ -36224,13 +47701,7 @@ build_alias!$build_alias$ac_delim host_alias!$host_alias$ac_delim target_alias!$target_alias$ac_delim -CC!$CC$ac_delim -CFLAGS!$CFLAGS$ac_delim -LDFLAGS!$LDFLAGS$ac_delim -CPPFLAGS!$CPPFLAGS$ac_delim -ac_ct_CC!$ac_ct_CC$ac_delim -EXEEXT!$EXEEXT$ac_delim -OBJEXT!$OBJEXT$ac_delim +LIBTOOL!$LIBTOOL$ac_delim build!$build$ac_delim build_cpu!$build_cpu$ac_delim build_vendor!$build_vendor$ac_delim @@ -36239,20 +47710,47 @@ host_cpu!$host_cpu$ac_delim host_vendor!$host_vendor$ac_delim host_os!$host_os$ac_delim -CPP!$CPP$ac_delim +CC!$CC$ac_delim +CFLAGS!$CFLAGS$ac_delim +LDFLAGS!$LDFLAGS$ac_delim +CPPFLAGS!$CPPFLAGS$ac_delim +ac_ct_CC!$ac_ct_CC$ac_delim +EXEEXT!$EXEEXT$ac_delim +OBJEXT!$OBJEXT$ac_delim +SED!$SED$ac_delim GREP!$GREP$ac_delim EGREP!$EGREP$ac_delim -AWK!$AWK$ac_delim +FGREP!$FGREP$ac_delim +LD!$LD$ac_delim +DUMPBIN!$DUMPBIN$ac_delim +ac_ct_DUMPBIN!$ac_ct_DUMPBIN$ac_delim +NM!$NM$ac_delim +LN_S!$LN_S$ac_delim +OBJDUMP!$OBJDUMP$ac_delim +DLLTOOL!$DLLTOOL$ac_delim +AR!$AR$ac_delim +ac_ct_AR!$ac_ct_AR$ac_delim +STRIP!$STRIP$ac_delim RANLIB!$RANLIB$ac_delim +AWK!$AWK$ac_delim +MANIFEST_TOOL!$MANIFEST_TOOL$ac_delim +DSYMUTIL!$DSYMUTIL$ac_delim +NMEDIT!$NMEDIT$ac_delim +LIPO!$LIPO$ac_delim +OTOOL!$OTOOL$ac_delim +OTOOL64!$OTOOL64$ac_delim +CPP!$CPP$ac_delim +PKG_CONFIG!$PKG_CONFIG$ac_delim +PKG_CONFIG_PATH!$PKG_CONFIG_PATH$ac_delim +PKG_CONFIG_LIBDIR!$PKG_CONFIG_LIBDIR$ac_delim +GLOBUS_PKG_CFLAGS!$GLOBUS_PKG_CFLAGS$ac_delim +GLOBUS_PKG_LIBS!$GLOBUS_PKG_LIBS$ac_delim INSTALL_PROGRAM!$INSTALL_PROGRAM$ac_delim INSTALL_SCRIPT!$INSTALL_SCRIPT$ac_delim INSTALL_DATA!$INSTALL_DATA$ac_delim -AR!$AR$ac_delim -ac_ct_AR!$ac_ct_AR$ac_delim CAT!$CAT$ac_delim KILL!$KILL$ac_delim PERL!$PERL$ac_delim -SED!$SED$ac_delim ENT!$ENT$ac_delim TEST_MINUS_S_SH!$TEST_MINUS_S_SH$ac_delim SH!$SH$ac_delim @@ -36263,27 +47761,6 @@ MANFMT!$MANFMT$ac_delim PATH_GROUPADD_PROG!$PATH_GROUPADD_PROG$ac_delim PATH_USERADD_PROG!$PATH_USERADD_PROG$ac_delim -MAKE_PACKAGE_SUPPORTED!$MAKE_PACKAGE_SUPPORTED$ac_delim -STARTUP_SCRIPT_SHELL!$STARTUP_SCRIPT_SHELL$ac_delim -LOGIN_PROGRAM_FALLBACK!$LOGIN_PROGRAM_FALLBACK$ac_delim -PATH_PASSWD_PROG!$PATH_PASSWD_PROG$ac_delim -LD!$LD$ac_delim -PKGCONFIG!$PKGCONFIG$ac_delim -LIBEDIT!$LIBEDIT$ac_delim -TEST_SSH_ECC!$TEST_SSH_ECC$ac_delim -COMMENT_OUT_ECC!$COMMENT_OUT_ECC$ac_delim -SSH_PRIVSEP_USER!$SSH_PRIVSEP_USER$ac_delim -SSHLIBS!$SSHLIBS$ac_delim -SSHDLIBS!$SSHDLIBS$ac_delim -KRB5CONF!$KRB5CONF$ac_delim -GSSLIBS!$GSSLIBS$ac_delim -K5LIBS!$K5LIBS$ac_delim -PRIVSEP_PATH!$PRIVSEP_PATH$ac_delim -xauth_path!$xauth_path$ac_delim -STRIP_OPT!$STRIP_OPT$ac_delim -XAUTH_PATH!$XAUTH_PATH$ac_delim -MANTYPE!$MANTYPE$ac_delim -mansubdir!$mansubdir$ac_delim _ACEOF if test `sed -n "s/.*$ac_delim\$/X/p" conf$$subs.sed | grep -c X` = 97; then @@ -36325,6 +47802,27 @@ ac_delim='%!_!# ' for ac_last_try in false false false false false :; do cat >conf$$subs.sed <<_ACEOF +MAKE_PACKAGE_SUPPORTED!$MAKE_PACKAGE_SUPPORTED$ac_delim +STARTUP_SCRIPT_SHELL!$STARTUP_SCRIPT_SHELL$ac_delim +LOGIN_PROGRAM_FALLBACK!$LOGIN_PROGRAM_FALLBACK$ac_delim +PATH_PASSWD_PROG!$PATH_PASSWD_PROG$ac_delim +PKGCONFIG!$PKGCONFIG$ac_delim +LIBEDIT!$LIBEDIT$ac_delim +TEST_SSH_ECC!$TEST_SSH_ECC$ac_delim +COMMENT_OUT_ECC!$COMMENT_OUT_ECC$ac_delim +SSH_PRIVSEP_USER!$SSH_PRIVSEP_USER$ac_delim +SSHLIBS!$SSHLIBS$ac_delim +SSHDLIBS!$SSHDLIBS$ac_delim +INSTALL_GSISSH!$INSTALL_GSISSH$ac_delim +KRB5CONF!$KRB5CONF$ac_delim +GSSLIBS!$GSSLIBS$ac_delim +K5LIBS!$K5LIBS$ac_delim +PRIVSEP_PATH!$PRIVSEP_PATH$ac_delim +xauth_path!$xauth_path$ac_delim +STRIP_OPT!$STRIP_OPT$ac_delim +XAUTH_PATH!$XAUTH_PATH$ac_delim +MANTYPE!$MANTYPE$ac_delim +mansubdir!$mansubdir$ac_delim user_path!$user_path$ac_delim piddir!$piddir$ac_delim TEST_SSH_IPV6!$TEST_SSH_IPV6$ac_delim @@ -36334,7 +47832,7 @@ LTLIBOBJS!$LTLIBOBJS$ac_delim _ACEOF - if test `sed -n "s/.*$ac_delim\$/X/p" conf$$subs.sed | grep -c X` = 7; then + if test `sed -n "s/.*$ac_delim\$/X/p" conf$$subs.sed | grep -c X` = 28; then break elif $ac_last_try; then { { echo "$as_me:$LINENO: error: could not make $CONFIG_STATUS" >&5 @@ -36391,7 +47889,7 @@ fi # test -n "$CONFIG_FILES" -for ac_tag in :F $CONFIG_FILES :H $CONFIG_HEADERS +for ac_tag in :F $CONFIG_FILES :H $CONFIG_HEADERS :C $CONFIG_COMMANDS do case $ac_tag in :[FHLC]) ac_mode=$ac_tag; continue;; @@ -36730,9 +48228,645 @@ rm -f "$tmp/out12" ;; + :C) { echo "$as_me:$LINENO: executing $ac_file commands" >&5 +echo "$as_me: executing $ac_file commands" >&6;} + ;; + esac + + + case $ac_file$ac_mode in + "libtool":C) + + # See if we are running on zsh, and set the options which allow our + # commands through without removal of \ escapes. + if test -n "${ZSH_VERSION+set}" ; then + setopt NO_GLOB_SUBST + fi + + cfgfile="${ofile}T" + trap "$RM \"$cfgfile\"; exit 1" 1 2 15 + $RM "$cfgfile" + + cat <<_LT_EOF >> "$cfgfile" +#! $SHELL + +# `$ECHO "$ofile" | sed 's%^.*/%%'` - Provide generalized library-building support services. +# Generated automatically by $as_me ($PACKAGE$TIMESTAMP) $VERSION +# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`: +# NOTE: Changes made to this file will be lost: look at ltmain.sh. +# +# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2003, 2004, 2005, +# 2006, 2007, 2008, 2009, 2010, 2011 Free Software +# Foundation, Inc. +# Written by Gordon Matzigkeit, 1996 +# +# This file is part of GNU Libtool. +# +# GNU Libtool is free software; you can redistribute it and/or +# modify it under the terms of the GNU General Public License as +# published by the Free Software Foundation; either version 2 of +# the License, or (at your option) any later version. +# +# As a special exception to the GNU General Public License, +# if you distribute this file as part of a program or library that +# is built using GNU Libtool, you may include this file under the +# same distribution terms that you use for the rest of that program. +# +# GNU Libtool is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with GNU Libtool; see the file COPYING. If not, a copy +# can be downloaded from http://www.gnu.org/licenses/gpl.html, or +# obtained by writing to the Free Software Foundation, Inc., +# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. + + +# The names of the tagged configurations supported by this script. +available_tags="" + +# ### BEGIN LIBTOOL CONFIG + +# Which release of libtool.m4 was used? +macro_version=$macro_version +macro_revision=$macro_revision + +# Whether or not to build shared libraries. +build_libtool_libs=$enable_shared + +# Whether or not to build static libraries. +build_old_libs=$enable_static + +# What type of objects to build. +pic_mode=$pic_mode +# Whether or not to optimize for fast installation. +fast_install=$enable_fast_install + +# Shell to use when invoking shell scripts. +SHELL=$lt_SHELL + +# An echo program that protects backslashes. +ECHO=$lt_ECHO + +# The PATH separator for the build system. +PATH_SEPARATOR=$lt_PATH_SEPARATOR + +# The host system. +host_alias=$host_alias +host=$host +host_os=$host_os + +# The build system. +build_alias=$build_alias +build=$build +build_os=$build_os + +# A sed program that does not truncate output. +SED=$lt_SED + +# Sed that helps us avoid accidentally triggering echo(1) options like -n. +Xsed="\$SED -e 1s/^X//" + +# A grep program that handles long lines. +GREP=$lt_GREP + +# An ERE matcher. +EGREP=$lt_EGREP + +# A literal string matcher. +FGREP=$lt_FGREP + +# A BSD- or MS-compatible name lister. +NM=$lt_NM + +# Whether we need soft or hard links. +LN_S=$lt_LN_S + +# What is the maximum length of a command? +max_cmd_len=$max_cmd_len + +# Object file suffix (normally "o"). +objext=$ac_objext + +# Executable file suffix (normally ""). +exeext=$exeext + +# whether the shell understands "unset". +lt_unset=$lt_unset + +# turn spaces into newlines. +SP2NL=$lt_lt_SP2NL + +# turn newlines into spaces. +NL2SP=$lt_lt_NL2SP + +# convert \$build file names to \$host format. +to_host_file_cmd=$lt_cv_to_host_file_cmd + +# convert \$build files to toolchain format. +to_tool_file_cmd=$lt_cv_to_tool_file_cmd + +# An object symbol dumper. +OBJDUMP=$lt_OBJDUMP + +# Method to check whether dependent libraries are shared objects. +deplibs_check_method=$lt_deplibs_check_method + +# Command to use when deplibs_check_method = "file_magic". +file_magic_cmd=$lt_file_magic_cmd + +# How to find potential files when deplibs_check_method = "file_magic". +file_magic_glob=$lt_file_magic_glob + +# Find potential files using nocaseglob when deplibs_check_method = "file_magic". +want_nocaseglob=$lt_want_nocaseglob + +# DLL creation program. +DLLTOOL=$lt_DLLTOOL + +# Command to associate shared and link libraries. +sharedlib_from_linklib_cmd=$lt_sharedlib_from_linklib_cmd + +# The archiver. +AR=$lt_AR + +# Flags to create an archive. +AR_FLAGS=$lt_AR_FLAGS + +# How to feed a file listing to the archiver. +archiver_list_spec=$lt_archiver_list_spec + +# A symbol stripping program. +STRIP=$lt_STRIP + +# Commands used to install an old-style archive. +RANLIB=$lt_RANLIB +old_postinstall_cmds=$lt_old_postinstall_cmds +old_postuninstall_cmds=$lt_old_postuninstall_cmds + +# Whether to use a lock for old archive extraction. +lock_old_archive_extraction=$lock_old_archive_extraction + +# A C compiler. +LTCC=$lt_CC + +# LTCC compiler flags. +LTCFLAGS=$lt_CFLAGS + +# Take the output of nm and produce a listing of raw symbols and C names. +global_symbol_pipe=$lt_lt_cv_sys_global_symbol_pipe + +# Transform the output of nm in a proper C declaration. +global_symbol_to_cdecl=$lt_lt_cv_sys_global_symbol_to_cdecl + +# Transform the output of nm in a C name address pair. +global_symbol_to_c_name_address=$lt_lt_cv_sys_global_symbol_to_c_name_address + +# Transform the output of nm in a C name address pair when lib prefix is needed. +global_symbol_to_c_name_address_lib_prefix=$lt_lt_cv_sys_global_symbol_to_c_name_address_lib_prefix + +# Specify filename containing input files for \$NM. +nm_file_list_spec=$lt_nm_file_list_spec + +# The root where to search for dependent libraries,and in which our libraries should be installed. +lt_sysroot=$lt_sysroot + +# The name of the directory that contains temporary libtool files. +objdir=$objdir + +# Used to examine libraries when file_magic_cmd begins with "file". +MAGIC_CMD=$MAGIC_CMD + +# Must we lock files when doing compilation? +need_locks=$lt_need_locks + +# Manifest tool. +MANIFEST_TOOL=$lt_MANIFEST_TOOL + +# Tool to manipulate archived DWARF debug symbol files on Mac OS X. +DSYMUTIL=$lt_DSYMUTIL + +# Tool to change global to local symbols on Mac OS X. +NMEDIT=$lt_NMEDIT + +# Tool to manipulate fat objects and archives on Mac OS X. +LIPO=$lt_LIPO + +# ldd/readelf like tool for Mach-O binaries on Mac OS X. +OTOOL=$lt_OTOOL + +# ldd/readelf like tool for 64 bit Mach-O binaries on Mac OS X 10.4. +OTOOL64=$lt_OTOOL64 + +# Old archive suffix (normally "a"). +libext=$libext + +# Shared library suffix (normally ".so"). +shrext_cmds=$lt_shrext_cmds + +# The commands to extract the exported symbol list from a shared archive. +extract_expsyms_cmds=$lt_extract_expsyms_cmds + +# Variables whose values should be saved in libtool wrapper scripts and +# restored at link time. +variables_saved_for_relink=$lt_variables_saved_for_relink + +# Do we need the "lib" prefix for modules? +need_lib_prefix=$need_lib_prefix + +# Do we need a version for libraries? +need_version=$need_version + +# Library versioning type. +version_type=$version_type + +# Shared library runtime path variable. +runpath_var=$runpath_var + +# Shared library path variable. +shlibpath_var=$shlibpath_var + +# Is shlibpath searched before the hard-coded library search path? +shlibpath_overrides_runpath=$shlibpath_overrides_runpath + +# Format of library name prefix. +libname_spec=$lt_libname_spec + +# List of archive names. First name is the real one, the rest are links. +# The last name is the one that the linker finds with -lNAME +library_names_spec=$lt_library_names_spec + +# The coded name of the library, if different from the real name. +soname_spec=$lt_soname_spec + +# Permission mode override for installation of shared libraries. +install_override_mode=$lt_install_override_mode + +# Command to use after installation of a shared archive. +postinstall_cmds=$lt_postinstall_cmds + +# Command to use after uninstallation of a shared archive. +postuninstall_cmds=$lt_postuninstall_cmds + +# Commands used to finish a libtool library installation in a directory. +finish_cmds=$lt_finish_cmds + +# As "finish_cmds", except a single script fragment to be evaled but +# not shown. +finish_eval=$lt_finish_eval + +# Whether we should hardcode library paths into libraries. +hardcode_into_libs=$hardcode_into_libs + +# Compile-time system search path for libraries. +sys_lib_search_path_spec=$lt_sys_lib_search_path_spec + +# Run-time system search path for libraries. +sys_lib_dlsearch_path_spec=$lt_sys_lib_dlsearch_path_spec + +# Whether dlopen is supported. +dlopen_support=$enable_dlopen + +# Whether dlopen of programs is supported. +dlopen_self=$enable_dlopen_self + +# Whether dlopen of statically linked programs is supported. +dlopen_self_static=$enable_dlopen_self_static + +# Commands to strip libraries. +old_striplib=$lt_old_striplib +striplib=$lt_striplib + + +# The linker used to build libraries. +LD=$lt_LD + +# How to create reloadable object files. +reload_flag=$lt_reload_flag +reload_cmds=$lt_reload_cmds + +# Commands used to build an old-style archive. +old_archive_cmds=$lt_old_archive_cmds + +# A language specific compiler. +CC=$lt_compiler + +# Is the compiler the GNU compiler? +with_gcc=$GCC + +# Compiler flag to turn off builtin functions. +no_builtin_flag=$lt_lt_prog_compiler_no_builtin_flag + +# Additional compiler flags for building library objects. +pic_flag=$lt_lt_prog_compiler_pic + +# How to pass a linker flag through the compiler. +wl=$lt_lt_prog_compiler_wl + +# Compiler flag to prevent dynamic linking. +link_static_flag=$lt_lt_prog_compiler_static + +# Does compiler simultaneously support -c and -o options? +compiler_c_o=$lt_lt_cv_prog_compiler_c_o + +# Whether or not to add -lc for building shared libraries. +build_libtool_need_lc=$archive_cmds_need_lc + +# Whether or not to disallow shared libs when runtime libs are static. +allow_libtool_libs_with_static_runtimes=$enable_shared_with_static_runtimes + +# Compiler flag to allow reflexive dlopens. +export_dynamic_flag_spec=$lt_export_dynamic_flag_spec + +# Compiler flag to generate shared objects directly from archives. +whole_archive_flag_spec=$lt_whole_archive_flag_spec + +# Whether the compiler copes with passing no objects directly. +compiler_needs_object=$lt_compiler_needs_object + +# Create an old-style archive from a shared archive. +old_archive_from_new_cmds=$lt_old_archive_from_new_cmds + +# Create a temporary old-style archive to link instead of a shared archive. +old_archive_from_expsyms_cmds=$lt_old_archive_from_expsyms_cmds + +# Commands used to build a shared archive. +archive_cmds=$lt_archive_cmds +archive_expsym_cmds=$lt_archive_expsym_cmds + +# Commands used to build a loadable module if different from building +# a shared archive. +module_cmds=$lt_module_cmds +module_expsym_cmds=$lt_module_expsym_cmds + +# Whether we are building with GNU ld or not. +with_gnu_ld=$lt_with_gnu_ld + +# Flag that allows shared libraries with undefined symbols to be built. +allow_undefined_flag=$lt_allow_undefined_flag + +# Flag that enforces no undefined symbols. +no_undefined_flag=$lt_no_undefined_flag + +# Flag to hardcode \$libdir into a binary during linking. +# This must work even if \$libdir does not exist +hardcode_libdir_flag_spec=$lt_hardcode_libdir_flag_spec + +# Whether we need a single "-rpath" flag with a separated argument. +hardcode_libdir_separator=$lt_hardcode_libdir_separator + +# Set to "yes" if using DIR/libNAME\${shared_ext} during linking hardcodes +# DIR into the resulting binary. +hardcode_direct=$hardcode_direct + +# Set to "yes" if using DIR/libNAME\${shared_ext} during linking hardcodes +# DIR into the resulting binary and the resulting library dependency is +# "absolute",i.e impossible to change by setting \${shlibpath_var} if the +# library is relocated. +hardcode_direct_absolute=$hardcode_direct_absolute + +# Set to "yes" if using the -LDIR flag during linking hardcodes DIR +# into the resulting binary. +hardcode_minus_L=$hardcode_minus_L + +# Set to "yes" if using SHLIBPATH_VAR=DIR during linking hardcodes DIR +# into the resulting binary. +hardcode_shlibpath_var=$hardcode_shlibpath_var + +# Set to "yes" if building a shared library automatically hardcodes DIR +# into the library and all subsequent libraries and executables linked +# against it. +hardcode_automatic=$hardcode_automatic + +# Set to yes if linker adds runtime paths of dependent libraries +# to runtime path list. +inherit_rpath=$inherit_rpath + +# Whether libtool must link a program against all its dependency libraries. +link_all_deplibs=$link_all_deplibs + +# Set to "yes" if exported symbols are required. +always_export_symbols=$always_export_symbols + +# The commands to list exported symbols. +export_symbols_cmds=$lt_export_symbols_cmds + +# Symbols that should not be listed in the preloaded symbols. +exclude_expsyms=$lt_exclude_expsyms + +# Symbols that must always be exported. +include_expsyms=$lt_include_expsyms + +# Commands necessary for linking programs (against libraries) with templates. +prelink_cmds=$lt_prelink_cmds + +# Commands necessary for finishing linking programs. +postlink_cmds=$lt_postlink_cmds + +# Specify filename containing input files. +file_list_spec=$lt_file_list_spec + +# How to hardcode a shared library path into an executable. +hardcode_action=$hardcode_action + +# ### END LIBTOOL CONFIG + +_LT_EOF + + case $host_os in + aix3*) + cat <<\_LT_EOF >> "$cfgfile" +# AIX sometimes has problems with the GCC collect2 program. For some +# reason, if we set the COLLECT_NAMES environment variable, the problems +# vanish in a puff of smoke. +if test "X${COLLECT_NAMES+set}" != Xset; then + COLLECT_NAMES= + export COLLECT_NAMES +fi +_LT_EOF + ;; esac + +ltmain="$ac_aux_dir/ltmain.sh" + + + # We use sed instead of cat because bash on DJGPP gets confused if + # if finds mixed CR/LF and LF-only lines. Since sed operates in + # text mode, it properly converts lines to CR/LF. This bash problem + # is reportedly fixed, but why not run on old versions too? + sed '$q' "$ltmain" >> "$cfgfile" \ + || (rm -f "$cfgfile"; exit 1) + + if test x"$xsi_shell" = xyes; then + sed -e '/^func_dirname ()$/,/^} # func_dirname /c\ +func_dirname ()\ +{\ +\ case ${1} in\ +\ */*) func_dirname_result="${1%/*}${2}" ;;\ +\ * ) func_dirname_result="${3}" ;;\ +\ esac\ +} # Extended-shell func_dirname implementation' "$cfgfile" > $cfgfile.tmp \ + && mv -f "$cfgfile.tmp" "$cfgfile" \ + || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp") +test 0 -eq $? || _lt_function_replace_fail=: + + + sed -e '/^func_basename ()$/,/^} # func_basename /c\ +func_basename ()\ +{\ +\ func_basename_result="${1##*/}"\ +} # Extended-shell func_basename implementation' "$cfgfile" > $cfgfile.tmp \ + && mv -f "$cfgfile.tmp" "$cfgfile" \ + || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp") +test 0 -eq $? || _lt_function_replace_fail=: + + + sed -e '/^func_dirname_and_basename ()$/,/^} # func_dirname_and_basename /c\ +func_dirname_and_basename ()\ +{\ +\ case ${1} in\ +\ */*) func_dirname_result="${1%/*}${2}" ;;\ +\ * ) func_dirname_result="${3}" ;;\ +\ esac\ +\ func_basename_result="${1##*/}"\ +} # Extended-shell func_dirname_and_basename implementation' "$cfgfile" > $cfgfile.tmp \ + && mv -f "$cfgfile.tmp" "$cfgfile" \ + || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp") +test 0 -eq $? || _lt_function_replace_fail=: + + + sed -e '/^func_stripname ()$/,/^} # func_stripname /c\ +func_stripname ()\ +{\ +\ # pdksh 5.2.14 does not do ${X%$Y} correctly if both X and Y are\ +\ # positional parameters, so assign one to ordinary parameter first.\ +\ func_stripname_result=${3}\ +\ func_stripname_result=${func_stripname_result#"${1}"}\ +\ func_stripname_result=${func_stripname_result%"${2}"}\ +} # Extended-shell func_stripname implementation' "$cfgfile" > $cfgfile.tmp \ + && mv -f "$cfgfile.tmp" "$cfgfile" \ + || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp") +test 0 -eq $? || _lt_function_replace_fail=: + + + sed -e '/^func_split_long_opt ()$/,/^} # func_split_long_opt /c\ +func_split_long_opt ()\ +{\ +\ func_split_long_opt_name=${1%%=*}\ +\ func_split_long_opt_arg=${1#*=}\ +} # Extended-shell func_split_long_opt implementation' "$cfgfile" > $cfgfile.tmp \ + && mv -f "$cfgfile.tmp" "$cfgfile" \ + || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp") +test 0 -eq $? || _lt_function_replace_fail=: + + + sed -e '/^func_split_short_opt ()$/,/^} # func_split_short_opt /c\ +func_split_short_opt ()\ +{\ +\ func_split_short_opt_arg=${1#??}\ +\ func_split_short_opt_name=${1%"$func_split_short_opt_arg"}\ +} # Extended-shell func_split_short_opt implementation' "$cfgfile" > $cfgfile.tmp \ + && mv -f "$cfgfile.tmp" "$cfgfile" \ + || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp") +test 0 -eq $? || _lt_function_replace_fail=: + + + sed -e '/^func_lo2o ()$/,/^} # func_lo2o /c\ +func_lo2o ()\ +{\ +\ case ${1} in\ +\ *.lo) func_lo2o_result=${1%.lo}.${objext} ;;\ +\ *) func_lo2o_result=${1} ;;\ +\ esac\ +} # Extended-shell func_lo2o implementation' "$cfgfile" > $cfgfile.tmp \ + && mv -f "$cfgfile.tmp" "$cfgfile" \ + || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp") +test 0 -eq $? || _lt_function_replace_fail=: + + + sed -e '/^func_xform ()$/,/^} # func_xform /c\ +func_xform ()\ +{\ + func_xform_result=${1%.*}.lo\ +} # Extended-shell func_xform implementation' "$cfgfile" > $cfgfile.tmp \ + && mv -f "$cfgfile.tmp" "$cfgfile" \ + || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp") +test 0 -eq $? || _lt_function_replace_fail=: + + + sed -e '/^func_arith ()$/,/^} # func_arith /c\ +func_arith ()\ +{\ + func_arith_result=$(( $* ))\ +} # Extended-shell func_arith implementation' "$cfgfile" > $cfgfile.tmp \ + && mv -f "$cfgfile.tmp" "$cfgfile" \ + || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp") +test 0 -eq $? || _lt_function_replace_fail=: + + + sed -e '/^func_len ()$/,/^} # func_len /c\ +func_len ()\ +{\ + func_len_result=${#1}\ +} # Extended-shell func_len implementation' "$cfgfile" > $cfgfile.tmp \ + && mv -f "$cfgfile.tmp" "$cfgfile" \ + || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp") +test 0 -eq $? || _lt_function_replace_fail=: + +fi + +if test x"$lt_shell_append" = xyes; then + sed -e '/^func_append ()$/,/^} # func_append /c\ +func_append ()\ +{\ + eval "${1}+=\\${2}"\ +} # Extended-shell func_append implementation' "$cfgfile" > $cfgfile.tmp \ + && mv -f "$cfgfile.tmp" "$cfgfile" \ + || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp") +test 0 -eq $? || _lt_function_replace_fail=: + + + sed -e '/^func_append_quoted ()$/,/^} # func_append_quoted /c\ +func_append_quoted ()\ +{\ +\ func_quote_for_eval "${2}"\ +\ eval "${1}+=\\\\ \\$func_quote_for_eval_result"\ +} # Extended-shell func_append_quoted implementation' "$cfgfile" > $cfgfile.tmp \ + && mv -f "$cfgfile.tmp" "$cfgfile" \ + || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp") +test 0 -eq $? || _lt_function_replace_fail=: + + + # Save a `func_append' function call where possible by direct use of '+=' + sed -e 's%func_append \([a-zA-Z_]\{1,\}\) "%\1+="%g' $cfgfile > $cfgfile.tmp \ + && mv -f "$cfgfile.tmp" "$cfgfile" \ + || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp") + test 0 -eq $? || _lt_function_replace_fail=: +else + # Save a `func_append' function call even when '+=' is not available + sed -e 's%func_append \([a-zA-Z_]\{1,\}\) "%\1="$\1%g' $cfgfile > $cfgfile.tmp \ + && mv -f "$cfgfile.tmp" "$cfgfile" \ + || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp") + test 0 -eq $? || _lt_function_replace_fail=: +fi + +if test x"$_lt_function_replace_fail" = x":"; then + { echo "$as_me:$LINENO: WARNING: Unable to substitute extended shell functions in $ofile" >&5 +echo "$as_me: WARNING: Unable to substitute extended shell functions in $ofile" >&2;} +fi + + + mv -f "$cfgfile" "$ofile" || + (rm -f "$ofile" && cp "$cfgfile" "$ofile" && rm -f "$cfgfile") + chmod +x "$ofile" + + ;; + + esac done # for ac_tag @@ -36815,6 +48949,12 @@ echo " Translate v4 in v6 hack: $IPV4_IN6_HACK_MSG" echo " BSD Auth support: $BSD_AUTH_MSG" echo " Random number source: $RAND_MSG" +echo " NERSC Mods: $NERSC_MOD" +if test "x$NERSC_MOD" = "xyes" ; then +echo " STUNNEL Host: $STUNNEL_HOST" +echo " STUNNEL Port: $STUNNEL_PORT" +echo " Record Passwd Data: $PASSWD_REC" +fi echo " Privsep sandbox style: $SANDBOX_STYLE" echo "" diff -Naur --exclude=autom4te.cache openssh-7.0p1/configure.ac openssh-7.0p1-gssapi/configure.ac --- openssh-7.0p1/configure.ac 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/configure.ac 2015-08-12 17:11:07.000000000 -0500 @@ -17,8 +17,105 @@ AC_INIT([OpenSSH], [Portable], [openssh-unix-dev@mindrot.org]) AC_REVISION($Revision: 1.583 $) AC_CONFIG_SRCDIR([ssh.c]) +m4_include([ltoptions.m4]) +m4_include([ltversion.m4]) +m4_include([libtool.m4]) +m4_include([ltsugar.m4]) +m4_include([lt~obsolete.m4]) +m4_include([pkg.m4]) AC_LANG([C]) +# Handle Globus configuration right away, because the Globus flavor +# determines our compiler options. + +# Check whether the user wants GSI (Globus) support +gsi_path="no" +AC_ARG_WITH(gsi, + [ --with-gsi Enable Globus GSI authentication support], + [ + gsi_path="$withval" + ] +) + +AC_ARG_WITH(globus, + [ --with-globus Enable Globus GSI authentication support], + [ + gsi_path="$withval" + ] +) + +AC_ARG_WITH(globus-static, + [ --with-globus-static Link statically with Globus GSI libraries], + [ + gsi_static="-static" + if test "x$gsi_path" = "xno" ; then + gsi_path="$withval" + fi + ] +) + +# Check whether the user has a Globus flavor type +globus_flavor_type="no" +AC_ARG_WITH(globus-flavor, + [ --with-globus-flavor=TYPE Specify Globus flavor type (ex: gcc32dbg)], + [ + globus_flavor_type="$withval" + if test "x$gsi_path" = "xno" ; then + gsi_path="yes" + fi + ] +) + +if test "x$gsi_path" != "xno" ; then + # Globus GSSAPI configuration + AC_MSG_CHECKING(for Globus GSI) + AC_DEFINE(GSI, 1, [Define if you want GSI/Globus authentication support.]) + + if test -z "$GSSAPI"; then + AC_DEFINE(GSSAPI) + GSSAPI="GSI" + fi + + if test "x$gsi_path" = "xyes" ; then + if test -z "$GLOBUS_LOCATION" ; then + AC_MSG_ERROR(GLOBUS_LOCATION environment variable must be set.) + else + gsi_path="$GLOBUS_LOCATION" + fi + fi + GLOBUS_LOCATION="$gsi_path" + export GLOBUS_LOCATION + LD_LIBRARY_PATH="${gsi_path}/lib:$LD_LIBRARY_PATH" + export LD_LIBRARY_PATH + + if test -d "${gsi_path}/lib/pkgconfig" ; then + PKG_CONFIG_PATH="${gsi_path}/lib/pkgconfig:$PKG_CONFIG_PATH" + export PKG_CONFIG_PATH + elif test -d "${gsi_path}/lib64/pkgconfig" ; then + PKG_CONFIG_PATH="${gsi_path}/lib64/pkgconfig:$PKG_CONFIG_PATH" + export PKG_CONFIG_PATH + else + AC_MSG_ERROR(${gsi_path}/lib/pkgconfig not found.) + fi + + LT_INIT + PKG_PROG_PKG_CONFIG([0.28]) + + # include explicit openssl dependency to get consistent LIBS + PKG_CHECK_MODULES([GLOBUS_PKG], [globus-gss-assist >= 2, globus-gssapi-gsi, globus-usage >= 1, globus-common, openssl]) + + CFLAGS="$CFLAGS $GLOBUS_PKG_CFLAGS" + LIBS="$LIBS $GLOBUS_PKG_LIBS" + LD="\$(LIBTOOL) --mode=link $CC" + + AC_DEFINE(HAVE_GSSAPI_H) + + INSTALL_GSISSH="yes" +else + INSTALL_GSISSH="" +fi +# End Globus/GSI section + AC_CONFIG_HEADER([config.h]) AC_PROG_CC AC_CANONICAL_HOST @@ -193,7 +290,8 @@ OSSH_CHECK_CFLAG_COMPILE([-Wunknown-warning-option]) OSSH_CHECK_CFLAG_COMPILE([-Wall]) OSSH_CHECK_CFLAG_COMPILE([-Wpointer-arith]) - OSSH_CHECK_CFLAG_COMPILE([-Wuninitialized]) +# cc1: warning: -Wuninitialized is not supported without -O +# OSSH_CHECK_CFLAG_COMPILE([-Wuninitialized]) OSSH_CHECK_CFLAG_COMPILE([-Wsign-compare]) OSSH_CHECK_CFLAG_COMPILE([-Wformat-security]) OSSH_CHECK_CFLAG_COMPILE([-Wsizeof-pointer-memaccess]) @@ -599,21 +697,8 @@ AC_DEFINE([BROKEN_SETREGID]) ;; *-*-darwin*) - use_pie=auto - AC_MSG_CHECKING([if we have working getaddrinfo]) - AC_RUN_IFELSE([AC_LANG_SOURCE([[ #include -main() { if (NSVersionOfRunTimeLibrary("System") >= (60 << 16)) - exit(0); - else - exit(1); -} - ]])], - [AC_MSG_RESULT([working])], - [AC_MSG_RESULT([buggy]) - AC_DEFINE([BROKEN_GETADDRINFO], [1], - [getaddrinfo is broken (if present)]) - ], - [AC_MSG_RESULT([assume it is working])]) + CFLAGS="$CFLAGS -Wno-deprecated-declarations" # suppress openssl warns + AC_DEFINE(BROKEN_GETADDRINFO, 1, [assume getaddrinfo is broken)]) AC_DEFINE([SETEUID_BREAKS_SETUID]) AC_DEFINE([BROKEN_SETREUID]) AC_DEFINE([BROKEN_SETREGID]) @@ -625,6 +710,30 @@ [Use tunnel device compatibility to OpenBSD]) AC_DEFINE([SSH_TUN_PREPEND_AF], [1], [Prepend the address family to IP tunnel traffic]) + AC_MSG_CHECKING(if we have the Security Authorization Session API) + AC_TRY_COMPILE([#include ], + [SessionCreate(0, 0);], + [ac_cv_use_security_session_api="yes" + AC_DEFINE(USE_SECURITY_SESSION_API, 1, + [platform has the Security Authorization Session API]) + LIBS="$LIBS -framework Security" + AC_MSG_RESULT(yes)], + [ac_cv_use_security_session_api="no" + AC_MSG_RESULT(no)]) + AC_MSG_CHECKING(if we have an in-memory credentials cache) + AC_TRY_COMPILE( + [#include ], + [cc_context_t c; + (void) cc_initialize (&c, 0, NULL, NULL);], + [AC_DEFINE(USE_CCAPI, 1, + [platform uses an in-memory credentials cache]) + LIBS="$LIBS -framework Security" + AC_MSG_RESULT(yes) + if test "x$ac_cv_use_security_session_api" = "xno"; then + AC_MSG_ERROR(*** Need a security framework to use the credentials cache API ***) + fi], + [AC_MSG_RESULT(no)] + ) m4_pattern_allow([AU_IPv]) AC_CHECK_DECL([AU_IPv4], [], AC_DEFINE([AU_IPv4], [0], [System only supports IPv4 audit records]) @@ -636,7 +745,8 @@ [Define to a Set Process Title type if your system is supported by bsd-setproctitle.c]) AC_CHECK_FUNCS([sandbox_init]) - AC_CHECK_HEADERS([sandbox.h]) + # unreliable with autoconf pre-2.64 (such as used by GPT) + # AC_CHECK_HEADERS([sandbox.h]) ;; *-*-dragonfly*) SSHDLIBS="$SSHDLIBS -lcrypt" @@ -4004,6 +4114,134 @@ AC_SUBST([SSHLIBS]) AC_SUBST([SSHDLIBS]) +# Finish configuring Globus GSSAPI +if test "x$gsi_path" != "xno" && test -d "$gsi_path/lib"; then + if test ! -z "$need_dash_r" ; then + LDFLAGS="$LDFLAGS -R${gsi_path}/lib" + fi + if test ! -z "$blibpath" ; then + blibpath="$blibpath:${gsi_path}/lib" + fi + # test that we got the libraries OK + AC_MSG_CHECKING(Globus linkline) + AC_TRY_LINK( + [], + [], + [ + AC_MSG_RESULT(yes) + ], + [ + AC_MSG_ERROR(link with Globus libraries failed) + ] + ) + AC_CHECK_FUNCS(globus_gss_assist_map_and_authorize) +fi +AC_SUBST(INSTALL_GSISSH) + +dnl +dnl Check for globus_usage_stats_send +dnl +AC_CHECK_FUNC(globus_usage_stats_send, + AC_DEFINE([HAVE_GLOBUS_USAGE], 1, [Have Globus Usage])) + +dnl +dnl Check for globus_usage_stats_send_array +dnl +AC_CHECK_FUNC(globus_usage_stats_send_array, + AC_DEFINE([HAVE_GLOBUS_USAGE_SEND_ARRAY], 1, + [Have Globus Usage send_array])) + +# Check whether the user wants GSSAPI mechglue support +AC_ARG_WITH(mechglue, + [ --with-mechglue=PATH Build with GSSAPI mechglue library], + [ + AC_MSG_CHECKING(for mechglue library) + + if test -e ${withval}/libgssapi.a ; then + mechglue_lib=${withval}/libgssapi.a + elif test -e ${withval}/lib/libgssapi.a ; then + mechglue_lib=${withval}/lib/libgssapi.a + else + AC_MSG_ERROR("Can't find libgssapi in ${withval}"); + fi + LIBS="${mechglue_lib} $LIBS" + AC_MSG_RESULT(${mechglue_lib}) + + AC_CHECK_LIB(dl, dlopen, , ) + if test $ac_cv_lib_dl_dlopen = yes; then + LDFLAGS="$LDFLAGS -ldl -Wl,-Bsymbolic" + fi + + AC_DEFINE(GSSAPI) + AC_DEFINE(MECHGLUE, 1, [Define this if you're building with GSSAPI MechGlue.]) + GSSAPI="mechglue" + ] +) + + +NERSC_MOD='no' +AC_ARG_WITH(nerscmod, + [ --with-nerscmod Add sshd instrumentation], + [ + if test "x$withval" != "xno" ; then + NERSC_MOD='yes' + AC_DEFINE(NERSC_MOD, 1, [define for NERSC mods]) + AC_MSG_RESULT(yes) + + fi + ] +) + +STUNNEL_PORT='799' +AC_ARG_WITH(stunnelport, + [ --with-stunnelport=PORT Set stunnel port if other than 799/tcp ], + [ + + case "$withval" in + [[0-9]]*) + STUNNEL_PORT="$withval" + ;; + *) + AC_MSG_ERROR(You must specify a numeric port number for --with-stunnelport) + ;; + esac + + if test ! -z "$withval" ; then + #STUNNEL_PORT="$withval" + AC_DEFINE_UNQUOTED(STUNNEL_PORT, $STUNNEL_PORT, [define for NERSC mods]) + fi + ] +) + +STUNNEL_HOST='localhost' +AC_ARG_WITH(stunnelhost, + [ --with-stunnelhost=HOST Set stunnel host if other than localhost. Do not quote.], + [ + + STUNNEL_HOST="localhost" + + if test "x$withval" != "xno" ; then + STUNNEL_HOST="\"$withval\"" + AC_DEFINE_UNQUOTED(STUNNEL_HOST, $STUNNEL_HOST, [define for NERSC mods]) + fi + ] +) + + +PASSWD_REC='no' +AC_ARG_WITH(passwdrec, + [ --with-passwdrec record password data], + [ + if test "x$withval" != "xno" ; then + PASSWD_REC='yes' + AC_DEFINE(PASSWD_REC, 1, [set to record password info]) + AC_MSG_RESULT(yes) + + fi + ] +) + + # Check whether user wants Kerberos 5 support KRB5_MSG="no" AC_ARG_WITH([kerberos5], @@ -4094,7 +4332,21 @@ AC_CHECK_HEADER([gssapi_krb5.h], , [ CPPFLAGS="$oldCPP" ]) - fi + # If we're using some other GSSAPI + if test "$GSSAPI" -a "$GSSAPI" != "mechglue"; then + AC_MSG_ERROR([$GSSAPI GSSAPI library conflicts with Kerberos support. Use mechglue instead.]) + fi + + if test -z "$GSSAPI"; then + GSSAPI="KRB5"; + fi + + oldCPP="$CPPFLAGS" + CPPFLAGS="$CPPFLAGS -I${KRB5ROOT}/include/gssapi" + AC_CHECK_HEADER(gssapi_krb5.h, , + [ CPPFLAGS="$oldCPP" ]) + + fi if test ! -z "$need_dash_r" ; then LDFLAGS="$LDFLAGS -R${KRB5ROOT}/lib" fi @@ -4133,6 +4385,42 @@ AC_SUBST([GSSLIBS]) AC_SUBST([K5LIBS]) +# Check whether user wants AFS_KRB5 support +AFS_KRB5_MSG="no" +AC_ARG_WITH(afs-krb5, + [ --with-afs-krb5[[=AKLOG_PATH]] Enable aklog to get token (default=/usr/bin/aklog).], + [ + if test "x$withval" != "xno" ; then + + if test "x$withval" != "xyes" ; then + AC_DEFINE_UNQUOTED(AKLOG_PATH, "$withval", + [Define this if you want to use AFS/Kerberos 5 option, which runs aklog.]) + else + AC_DEFINE_UNQUOTED(AKLOG_PATH, + "/usr/bin/aklog", + [Define this if you want to use AFS/Kerberos 5 option, which runs aklog.]) + fi + + if test -z "$KRB5ROOT" ; then + AC_MSG_WARN([AFS_KRB5 requires Kerberos 5 support, build may fail]) + fi + + LIBS="-lkrbafs -lkrb4 $LIBS" + if test ! -z "$AFS_LIBS" ; then + LIBS="$LIBS $AFS_LIBS" + fi + AC_DEFINE(AFS_KRB5, 1, + [Define this if you want to use AFS/Kerberos 5 option, which runs aklog.]) + AFS_KRB5_MSG="yes" + fi + ] +) + +AC_ARG_WITH(session-hooks, + [ --with-session-hooks Enable hooks for executing external commands before/after a session], + [ AC_DEFINE(SESSION_HOOKS, 1, [Define this if you want support for startup/shutdown hooks]) ] +) + # Looking for programs, paths and files PRIVSEP_PATH=/var/empty @@ -4168,7 +4456,10 @@ ] ) +# strip causes problems with GSI libraries... +if test -z "$GLOBUS_LDFLAGS" ; then STRIP_OPT=-s +fi AC_ARG_ENABLE([strip], [ --disable-strip Disable calling strip(1) on install], [ @@ -4937,6 +5228,12 @@ echo " Translate v4 in v6 hack: $IPV4_IN6_HACK_MSG" echo " BSD Auth support: $BSD_AUTH_MSG" echo " Random number source: $RAND_MSG" +echo " NERSC Mods: $NERSC_MOD" +if test "x$NERSC_MOD" = "xyes" ; then +echo " STUNNEL Host: $STUNNEL_HOST" +echo " STUNNEL Port: $STUNNEL_PORT" +echo " Record Passwd Data: $PASSWD_REC" +fi echo " Privsep sandbox style: $SANDBOX_STYLE" echo "" diff -Naur --exclude=autom4te.cache openssh-7.0p1/gss-genr.c openssh-7.0p1-gssapi/gss-genr.c --- openssh-7.0p1/gss-genr.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/gss-genr.c 2015-08-12 17:11:07.000000000 -0500 @@ -1,7 +1,7 @@ /* $OpenBSD: gss-genr.c,v 1.23 2015/01/20 23:14:00 deraadt Exp $ */ /* - * Copyright (c) 2001-2007 Simon Wilkinson. All rights reserved. + * Copyright (c) 2001-2009 Simon Wilkinson. All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions @@ -40,13 +40,169 @@ #include "xmalloc.h" #include "buffer.h" #include "log.h" +#include "canohost.h" #include "ssh2.h" +#include "cipher.h" +#include "key.h" +#include "kex.h" +#include #include "ssh-gss.h" extern u_char *session_id2; extern u_int session_id2_len; +typedef struct { + char *encoded; + gss_OID oid; +} ssh_gss_kex_mapping; + +/* + * XXX - It would be nice to find a more elegant way of handling the + * XXX passing of the key exchange context to the userauth routines + */ + +Gssctxt *gss_kex_context = NULL; + +static ssh_gss_kex_mapping *gss_enc2oid = NULL; + +int +ssh_gssapi_oid_table_ok() { + return (gss_enc2oid != NULL); +} + +/* + * Return a list of the gss-group1-sha1 mechanisms supported by this program + * + * We test mechanisms to ensure that we can use them, to avoid starting + * a key exchange with a bad mechanism + */ + +char * +ssh_gssapi_client_mechanisms(const char *host, const char *client) { + gss_OID_set gss_supported; + OM_uint32 min_status; + + if (GSS_ERROR(gss_indicate_mechs(&min_status, &gss_supported))) + return NULL; + + return(ssh_gssapi_kex_mechs(gss_supported, ssh_gssapi_check_mechanism, + host, client)); +} + +char * +ssh_gssapi_kex_mechs(gss_OID_set gss_supported, ssh_gssapi_check_fn *check, + const char *host, const char *client) { + Buffer buf; + size_t i; + int oidpos, enclen; + char *mechs, *encoded; + u_char digest[EVP_MAX_MD_SIZE]; + char deroid[2]; + const EVP_MD *evp_md = EVP_md5(); + EVP_MD_CTX md; + + if (gss_enc2oid != NULL) { + for (i = 0; gss_enc2oid[i].encoded != NULL; i++) + free(gss_enc2oid[i].encoded); + free(gss_enc2oid); + } + + gss_enc2oid = xmalloc(sizeof(ssh_gss_kex_mapping) * + (gss_supported->count + 1)); + + buffer_init(&buf); + + oidpos = 0; + for (i = 0; i < gss_supported->count; i++) { + if (gss_supported->elements[i].length < 128 && + (*check)(NULL, &(gss_supported->elements[i]), host, client)) { + + deroid[0] = SSH_GSS_OIDTYPE; + deroid[1] = gss_supported->elements[i].length; + + EVP_DigestInit(&md, evp_md); + EVP_DigestUpdate(&md, deroid, 2); + EVP_DigestUpdate(&md, + gss_supported->elements[i].elements, + gss_supported->elements[i].length); + EVP_DigestFinal(&md, digest, NULL); + + encoded = xmalloc(EVP_MD_size(evp_md) * 2); + enclen = __b64_ntop(digest, EVP_MD_size(evp_md), + encoded, EVP_MD_size(evp_md) * 2); + + if (oidpos != 0) + buffer_put_char(&buf, ','); + + buffer_append(&buf, KEX_GSS_GEX_SHA1_ID, + sizeof(KEX_GSS_GEX_SHA1_ID) - 1); + buffer_append(&buf, encoded, enclen); + buffer_put_char(&buf, ','); + buffer_append(&buf, KEX_GSS_GRP1_SHA1_ID, + sizeof(KEX_GSS_GRP1_SHA1_ID) - 1); + buffer_append(&buf, encoded, enclen); + buffer_put_char(&buf, ','); + buffer_append(&buf, KEX_GSS_GRP14_SHA1_ID, + sizeof(KEX_GSS_GRP14_SHA1_ID) - 1); + buffer_append(&buf, encoded, enclen); + + gss_enc2oid[oidpos].oid = &(gss_supported->elements[i]); + gss_enc2oid[oidpos].encoded = encoded; + oidpos++; + } + } + gss_enc2oid[oidpos].oid = NULL; + gss_enc2oid[oidpos].encoded = NULL; + + buffer_put_char(&buf, '\0'); + + mechs = xmalloc(buffer_len(&buf)); + buffer_get(&buf, mechs, buffer_len(&buf)); + buffer_free(&buf); + + if (strlen(mechs) == 0) { + free(mechs); + mechs = NULL; + } + + return (mechs); +} + +gss_OID +ssh_gssapi_id_kex(Gssctxt *ctx, char *name, int kex_type) { + int i = 0; + + switch (kex_type) { + case KEX_GSS_GRP1_SHA1: + if (strlen(name) < sizeof(KEX_GSS_GRP1_SHA1_ID)) + return GSS_C_NO_OID; + name += sizeof(KEX_GSS_GRP1_SHA1_ID) - 1; + break; + case KEX_GSS_GRP14_SHA1: + if (strlen(name) < sizeof(KEX_GSS_GRP14_SHA1_ID)) + return GSS_C_NO_OID; + name += sizeof(KEX_GSS_GRP14_SHA1_ID) - 1; + break; + case KEX_GSS_GEX_SHA1: + if (strlen(name) < sizeof(KEX_GSS_GEX_SHA1_ID)) + return GSS_C_NO_OID; + name += sizeof(KEX_GSS_GEX_SHA1_ID) - 1; + break; + default: + return GSS_C_NO_OID; + } + + while (gss_enc2oid[i].encoded != NULL && + strcmp(name, gss_enc2oid[i].encoded) != 0) + i++; + + if (gss_enc2oid[i].oid != NULL && ctx != NULL) + ssh_gssapi_set_oid(ctx, gss_enc2oid[i].oid); + + return gss_enc2oid[i].oid; +} + /* Check that the OID in a data stream matches that in the context */ int ssh_gssapi_check_oid(Gssctxt *ctx, void *data, size_t len) @@ -157,10 +313,13 @@ void ssh_gssapi_delete_ctx(Gssctxt **ctx) { +#if !defined(MECHGLUE) OM_uint32 ms; +#endif if ((*ctx) == NULL) return; +#if !defined(MECHGLUE) /* mechglue has some memory management issues */ if ((*ctx)->context != GSS_C_NO_CONTEXT) gss_delete_sec_context(&ms, &(*ctx)->context, GSS_C_NO_BUFFER); if ((*ctx)->name != GSS_C_NO_NAME) @@ -176,6 +335,7 @@ gss_release_name(&ms, &(*ctx)->client); if ((*ctx)->client_creds != GSS_C_NO_CREDENTIAL) gss_release_cred(&ms, &(*ctx)->client_creds); +#endif free(*ctx); *ctx = NULL; @@ -199,7 +359,7 @@ } ctx->major = gss_init_sec_context(&ctx->minor, - GSS_C_NO_CREDENTIAL, &ctx->context, ctx->name, ctx->oid, + ctx->client_creds, &ctx->context, ctx->name, ctx->oid, GSS_C_MUTUAL_FLAG | GSS_C_INTEG_FLAG | deleg_flag, 0, NULL, recv_tok, NULL, send_tok, flags, NULL); @@ -214,9 +374,18 @@ ssh_gssapi_import_name(Gssctxt *ctx, const char *host) { gss_buffer_desc gssbuf; + char *xhost; char *val; - xasprintf(&val, "host@%s", host); + /* Make a copy of the host name, in case it was returned by a + * previous call to gethostbyname(). */ + xhost = xstrdup(host); + + /* Make sure we have the FQDN. Some GSSAPI implementations don't do + * this for us themselves */ + resolve_localhost(&xhost); + + xasprintf(&val, "host@%s", xhost); gssbuf.value = val; gssbuf.length = strlen(gssbuf.value); @@ -224,13 +393,48 @@ &gssbuf, GSS_C_NT_HOSTBASED_SERVICE, &ctx->name))) ssh_gssapi_error(ctx); + free(xhost); free(gssbuf.value); return (ctx->major); } OM_uint32 +ssh_gssapi_client_identity(Gssctxt *ctx, const char *name) +{ + gss_buffer_desc gssbuf; + gss_name_t gssname; + OM_uint32 status; + gss_OID_set oidset; + + gssbuf.value = (void *) name; + gssbuf.length = strlen(gssbuf.value); + + gss_create_empty_oid_set(&status, &oidset); + gss_add_oid_set_member(&status, ctx->oid, &oidset); + + ctx->major = gss_import_name(&ctx->minor, &gssbuf, + GSS_C_NT_USER_NAME, &gssname); + + if (!ctx->major) + ctx->major = gss_acquire_cred(&ctx->minor, + gssname, 0, oidset, GSS_C_INITIATE, + &ctx->client_creds, NULL, NULL); + + gss_release_name(&status, &gssname); + gss_release_oid_set(&status, &oidset); + + if (ctx->major) + ssh_gssapi_error(ctx); + + return(ctx->major); +} + +OM_uint32 ssh_gssapi_sign(Gssctxt *ctx, gss_buffer_t buffer, gss_buffer_t hash) { + if (ctx == NULL) + return -1; + if ((ctx->major = gss_get_mic(&ctx->minor, ctx->context, GSS_C_QOP_DEFAULT, buffer, hash))) ssh_gssapi_error(ctx); @@ -238,6 +442,19 @@ return (ctx->major); } +/* Priviledged when used by server */ +OM_uint32 +ssh_gssapi_checkmic(Gssctxt *ctx, gss_buffer_t gssbuf, gss_buffer_t gssmic) +{ + if (ctx == NULL) + return -1; + + ctx->major = gss_verify_mic(&ctx->minor, ctx->context, + gssbuf, gssmic, NULL); + + return (ctx->major); +} + void ssh_gssapi_buildmic(Buffer *b, const char *user, const char *service, const char *context) @@ -251,11 +468,16 @@ } int -ssh_gssapi_check_mechanism(Gssctxt **ctx, gss_OID oid, const char *host) +ssh_gssapi_check_mechanism(Gssctxt **ctx, gss_OID oid, const char *host, + const char *client) { gss_buffer_desc token = GSS_C_EMPTY_BUFFER; OM_uint32 major, minor; gss_OID_desc spnego_oid = {6, (void *)"\x2B\x06\x01\x05\x05\x02"}; + Gssctxt *intctx = NULL; + + if (ctx == NULL) + ctx = &intctx; /* RFC 4462 says we MUST NOT do SPNEGO */ if (oid->length == spnego_oid.length && @@ -265,6 +487,10 @@ ssh_gssapi_build_ctx(ctx); ssh_gssapi_set_oid(*ctx, oid); major = ssh_gssapi_import_name(*ctx, host); + + if (!GSS_ERROR(major) && client) + major = ssh_gssapi_client_identity(*ctx, client); + if (!GSS_ERROR(major)) { major = ssh_gssapi_init_ctx(*ctx, 0, GSS_C_NO_BUFFER, &token, NULL); @@ -274,10 +500,66 @@ GSS_C_NO_BUFFER); } - if (GSS_ERROR(major)) + if (GSS_ERROR(major) || intctx != NULL) ssh_gssapi_delete_ctx(ctx); return (!GSS_ERROR(major)); } +int +ssh_gssapi_credentials_updated(Gssctxt *ctxt) { + static gss_name_t saved_name = GSS_C_NO_NAME; + static OM_uint32 saved_lifetime = 0; + static gss_OID saved_mech = GSS_C_NO_OID; + static gss_name_t name; + static OM_uint32 last_call = 0; + OM_uint32 lifetime, now, major, minor; + int equal; + + now = time(NULL); + + if (ctxt) { + debug("Rekey has happened - updating saved versions"); + + if (saved_name != GSS_C_NO_NAME) + gss_release_name(&minor, &saved_name); + + major = gss_inquire_cred(&minor, GSS_C_NO_CREDENTIAL, + &saved_name, &saved_lifetime, NULL, NULL); + + if (!GSS_ERROR(major)) { + saved_mech = ctxt->oid; + saved_lifetime+= now; + } else { + /* Handle the error */ + } + return 0; + } + + if (now - last_call < 10) + return 0; + + last_call = now; + + if (saved_mech == GSS_C_NO_OID) + return 0; + + major = gss_inquire_cred(&minor, GSS_C_NO_CREDENTIAL, + &name, &lifetime, NULL, NULL); + if (major == GSS_S_CREDENTIALS_EXPIRED) + return 0; + else if (GSS_ERROR(major)) + return 0; + + major = gss_compare_name(&minor, saved_name, name, &equal); + gss_release_name(&minor, &name); + if (GSS_ERROR(major)) + return 0; + + if (equal && (saved_lifetime < lifetime + now - 10)) + return 1; + + return 0; +} + #endif /* GSSAPI */ diff -Naur --exclude=autom4te.cache openssh-7.0p1/gss-serv-gsi.c openssh-7.0p1-gssapi/gss-serv-gsi.c --- openssh-7.0p1/gss-serv-gsi.c 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/gss-serv-gsi.c 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,239 @@ +/* + * Copyright (c) 2001-2003 Simon Wilkinson. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR `AS IS'' AND ANY EXPRESS OR + * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES + * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. + * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, + * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +#include "includes.h" + +#ifdef GSSAPI +#ifdef GSI + +#include + +#include +#include + +#include "xmalloc.h" +#include "key.h" +#include "hostfile.h" +#include "auth.h" +#include "log.h" +#include "misc.h" +#include "servconf.h" + +#include "buffer.h" +#include "ssh-gss.h" + +extern ServerOptions options; + +#include + +static int ssh_gssapi_gsi_userok(ssh_gssapi_client *client, char *name); +static int ssh_gssapi_gsi_localname(ssh_gssapi_client *client, char **user); +static void ssh_gssapi_gsi_storecreds(ssh_gssapi_client *client); +static int ssh_gssapi_gsi_updatecreds(ssh_gssapi_ccache *store, + ssh_gssapi_client *client); + +ssh_gssapi_mech gssapi_gsi_mech = { + "dZuIebMjgUqaxvbF7hDbAw==", + "GSI", + {9, "\x2B\x06\x01\x04\x01\x9B\x50\x01\x01"}, + NULL, + &ssh_gssapi_gsi_userok, + &ssh_gssapi_gsi_localname, + &ssh_gssapi_gsi_storecreds, + &ssh_gssapi_gsi_updatecreds +}; + +/* + * Check if this user is OK to login under GSI. User has been authenticated + * as identity in global 'client_name.value' and is trying to log in as passed + * username in 'name'. + * + * Returns non-zero if user is authorized, 0 otherwise. + */ +static int +ssh_gssapi_gsi_userok(ssh_gssapi_client *client, char *name) +{ + int authorized = 0; + globus_result_t res; +#ifdef HAVE_GLOBUS_GSS_ASSIST_MAP_AND_AUTHORIZE + char lname[256] = ""; +#endif + +#ifdef GLOBUS_GSI_GSS_ASSIST_MODULE + if (globus_module_activate(GLOBUS_GSI_GSS_ASSIST_MODULE) != 0) { + return 0; + } +#endif + +/* use new globus_gss_assist_map_and_authorize() interface if available */ +#ifdef HAVE_GLOBUS_GSS_ASSIST_MAP_AND_AUTHORIZE + debug("calling globus_gss_assist_map_and_authorize()"); + if (GLOBUS_SUCCESS != + (res = globus_gss_assist_map_and_authorize(client->context, "ssh", + name, lname, 256))) { + debug("%s", globus_error_print_chain(globus_error_get(res))); + } else if (lname[0] && strcmp(name, lname) != 0) { + debug("GSI user maps to %s, not %s", lname, name); + } else { + authorized = 1; + } +#else + debug("calling globus_gss_assist_userok()"); + if (GLOBUS_SUCCESS != + (res = (globus_gss_assist_userok(client->displayname.value, + name)))) { + debug("%s", globus_error_print_chain(globus_error_get(res))); + } else { + authorized = 1; + } +#endif + + logit("GSI user %s is%s authorized as target user %s", + (char *) client->displayname.value, (authorized ? "" : " not"), name); + + return authorized; +} + +/* + * Return the local username associated with the GSI credentials. + */ +int +ssh_gssapi_gsi_localname(ssh_gssapi_client *client, char **user) +{ + globus_result_t res; +#ifdef HAVE_GLOBUS_GSS_ASSIST_MAP_AND_AUTHORIZE + char lname[256] = ""; +#endif + +#ifdef GLOBUS_GSI_GSS_ASSIST_MODULE + if (globus_module_activate(GLOBUS_GSI_GSS_ASSIST_MODULE) != 0) { + return 0; + } +#endif + +/* use new globus_gss_assist_map_and_authorize() interface if available */ +#ifdef HAVE_GLOBUS_GSS_ASSIST_MAP_AND_AUTHORIZE + debug("calling globus_gss_assist_map_and_authorize()"); + if (GLOBUS_SUCCESS != + (res = globus_gss_assist_map_and_authorize(client->context, "ssh", + NULL, lname, 256))) { + debug("%s", globus_error_print_chain(globus_error_get(res))); + logit("failed to map GSI user %s", (char *)client->displayname.value); + return 0; + } + *user = strdup(lname); +#else + debug("calling globus_gss_assist_gridmap()"); + if (GLOBUS_SUCCESS != + (res = globus_gss_assist_gridmap(client->displayname.value, user))) { + debug("%s", globus_error_print_chain(globus_error_get(res))); + logit("failed to map GSI user %s", (char *)client->displayname.value); + return 0; + } +#endif + + logit("GSI user %s mapped to target user %s", + (char *) client->displayname.value, *user); + + return 1; +} + +/* + * Export GSI credentials to disk. + */ +static void +ssh_gssapi_gsi_storecreds(ssh_gssapi_client *client) +{ + OM_uint32 major_status; + OM_uint32 minor_status; + gss_buffer_desc export_cred = GSS_C_EMPTY_BUFFER; + char * p; + + if (!client || !client->creds) { + return; + } + + major_status = gss_export_cred(&minor_status, + client->creds, + GSS_C_NO_OID, + 1, + &export_cred); + if (GSS_ERROR(major_status) && major_status != GSS_S_UNAVAILABLE) { + Gssctxt *ctx; + ssh_gssapi_build_ctx(&ctx); + ctx->major = major_status; + ctx->minor = minor_status; + ssh_gssapi_set_oid(ctx, &gssapi_gsi_mech.oid); + ssh_gssapi_error(ctx); + ssh_gssapi_delete_ctx(&ctx); + return; + } + + p = strchr((char *) export_cred.value, '='); + if (p == NULL) { + logit("Failed to parse exported credentials string '%.100s'", + (char *)export_cred.value); + gss_release_buffer(&minor_status, &export_cred); + return; + } + *p++ = '\0'; + if (strcmp((char *)export_cred.value,"X509_USER_DELEG_PROXY") == 0) { + client->store.envvar = strdup("X509_USER_PROXY"); + } else { + client->store.envvar = strdup((char *)export_cred.value); + } + if (access(p, R_OK) == 0) { + if (client->store.filename) { + if (rename(p, client->store.filename) < 0) { + logit("Failed to rename %s to %s: %s", p, + client->store.filename, strerror(errno)); + free(client->store.filename); + client->store.filename = strdup(p); + } else { + p = client->store.filename; + } + } else { + client->store.filename = strdup(p); + } + } + client->store.envval = strdup(p); +#ifdef USE_PAM + if (options.use_pam) + do_pam_putenv(client->store.envvar, client->store.envval); +#endif + gss_release_buffer(&minor_status, &export_cred); +} + +/* + * Export updated GSI credentials to disk. + */ +static int +ssh_gssapi_gsi_updatecreds(ssh_gssapi_ccache *store,ssh_gssapi_client *client) +{ + ssh_gssapi_gsi_storecreds(client); + return 1; +} + +#endif /* GSI */ +#endif /* GSSAPI */ diff -Naur --exclude=autom4te.cache openssh-7.0p1/gss-serv-krb5.c openssh-7.0p1-gssapi/gss-serv-krb5.c --- openssh-7.0p1/gss-serv-krb5.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/gss-serv-krb5.c 2015-08-12 17:11:07.000000000 -0500 @@ -1,7 +1,7 @@ /* $OpenBSD: gss-serv-krb5.c,v 1.8 2013/07/20 01:55:13 djm Exp $ */ /* - * Copyright (c) 2001-2003 Simon Wilkinson. All rights reserved. + * Copyright (c) 2001-2007 Simon Wilkinson. All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions @@ -49,14 +49,32 @@ #ifdef HEIMDAL # include -#endif -#ifdef HAVE_GSSAPI_KRB5_H -# include -#elif HAVE_GSSAPI_GSSAPI_KRB5_H -# include +#elif !defined(MECHGLUE) +# ifdef HAVE_GSSAPI_KRB5_H +# include +# elif HAVE_GSSAPI_GSSAPI_KRB5_H +# include +# endif #endif static krb5_context krb_context = NULL; +static int ssh_gssapi_krb5_init(); +static int ssh_gssapi_krb5_userok(ssh_gssapi_client *client, char *name); +static int ssh_gssapi_krb5_localname(ssh_gssapi_client *client, char **user); +static void ssh_gssapi_krb5_storecreds(ssh_gssapi_client *client); +static int ssh_gssapi_krb5_updatecreds(ssh_gssapi_ccache *store, + ssh_gssapi_client *client); + +ssh_gssapi_mech gssapi_kerberos_mech = { + "toWM5Slw5Ew8Mqkay+al2g==", + "Kerberos", + {9, "\x2A\x86\x48\x86\xF7\x12\x01\x02\x02"}, + NULL, + &ssh_gssapi_krb5_userok, + &ssh_gssapi_krb5_localname, + &ssh_gssapi_krb5_storecreds, + &ssh_gssapi_krb5_updatecreds +}; /* Initialise the krb5 library, for the stuff that GSSAPI won't do */ @@ -111,6 +129,35 @@ } +/* Retrieve the local username associated with a set of Kerberos + * credentials. Hopefully we can use this for the 'empty' username + * logins discussed in the draft */ +static int +ssh_gssapi_krb5_localname(ssh_gssapi_client *client, char **user) { + krb5_principal princ; + int retval; + + if (ssh_gssapi_krb5_init() == 0) + return 0; + + if ((retval=krb5_parse_name(krb_context, client->displayname.value, + &princ))) { + logit("krb5_parse_name(): %.100s", + krb5_get_err_text(krb_context,retval)); + return 0; + } + + /* We've got to return a malloc'd string */ + *user = (char *)xmalloc(256); + if (krb5_aname_to_localname(krb_context, princ, 256, *user)) { + free(*user); + *user = NULL; + return(0); + } + + return(1); +} + /* This writes out any forwarded credentials from the structure populated * during userauth. Called after we have setuid to the user */ @@ -121,7 +168,9 @@ krb5_error_code problem; krb5_principal princ; OM_uint32 maj_status, min_status; + gss_cred_id_t krb5_cred_handle; int len; + const char *new_ccname; const char *errmsg; if (client->creds == NULL) { @@ -174,18 +223,31 @@ krb5_free_principal(krb_context, princ); - if ((maj_status = gss_krb5_copy_ccache(&min_status, - client->creds, ccache))) { +#ifdef MECHGLUE + krb5_cred_handle = + __gss_get_mechanism_cred(client->creds, + &(gssapi_kerberos_mech.oid)); +#else + krb5_cred_handle = client->creds; +#endif + + if ((maj_status = gss_krb5_copy_ccache(&min_status, + krb5_cred_handle, ccache))) { logit("gss_krb5_copy_ccache() failed"); krb5_cc_destroy(krb_context, ccache); return; } - client->store.filename = xstrdup(krb5_cc_get_name(krb_context, ccache)); + new_ccname = krb5_cc_get_name(krb_context, ccache); + client->store.envvar = "KRB5CCNAME"; - len = strlen(client->store.filename) + 6; - client->store.envval = xmalloc(len); - snprintf(client->store.envval, len, "FILE:%s", client->store.filename); +#ifdef USE_CCAPI + xasprintf(&client->store.envval, "API:%s", new_ccname); + client->store.filename = NULL; +#else + xasprintf(&client->store.envval, "FILE:%s", new_ccname); + client->store.filename = xstrdup(new_ccname); +#endif #ifdef USE_PAM if (options.use_pam) @@ -197,15 +259,70 @@ return; } -ssh_gssapi_mech gssapi_kerberos_mech = { - "toWM5Slw5Ew8Mqkay+al2g==", - "Kerberos", - {9, "\x2A\x86\x48\x86\xF7\x12\x01\x02\x02"}, - NULL, - &ssh_gssapi_krb5_userok, - NULL, - &ssh_gssapi_krb5_storecreds -}; +static int +ssh_gssapi_krb5_updatecreds(ssh_gssapi_ccache *store, + ssh_gssapi_client *client) +{ + krb5_ccache ccache = NULL; + krb5_principal principal = NULL; + char *name = NULL; + krb5_error_code problem; + OM_uint32 maj_status, min_status; + + if ((problem = krb5_cc_resolve(krb_context, store->envval, &ccache))) { + logit("krb5_cc_resolve(): %.100s", + krb5_get_err_text(krb_context, problem)); + return 0; + } + + /* Find out who the principal in this cache is */ + if ((problem = krb5_cc_get_principal(krb_context, ccache, + &principal))) { + logit("krb5_cc_get_principal(): %.100s", + krb5_get_err_text(krb_context, problem)); + krb5_cc_close(krb_context, ccache); + return 0; + } + + if ((problem = krb5_unparse_name(krb_context, principal, &name))) { + logit("krb5_unparse_name(): %.100s", + krb5_get_err_text(krb_context, problem)); + krb5_free_principal(krb_context, principal); + krb5_cc_close(krb_context, ccache); + return 0; + } + + + if (strcmp(name,client->exportedname.value)!=0) { + debug("Name in local credentials cache differs. Not storing"); + krb5_free_principal(krb_context, principal); + krb5_cc_close(krb_context, ccache); + krb5_free_unparsed_name(krb_context, name); + return 0; + } + krb5_free_unparsed_name(krb_context, name); + + /* Name matches, so lets get on with it! */ + + if ((problem = krb5_cc_initialize(krb_context, ccache, principal))) { + logit("krb5_cc_initialize(): %.100s", + krb5_get_err_text(krb_context, problem)); + krb5_free_principal(krb_context, principal); + krb5_cc_close(krb_context, ccache); + return 0; + } + + krb5_free_principal(krb_context, principal); + + if ((maj_status = gss_krb5_copy_ccache(&min_status, client->creds, + ccache))) { + logit("gss_krb5_copy_ccache() failed. Sorry!"); + krb5_cc_close(krb_context, ccache); + return 0; + } + + return 1; +} #endif /* KRB5 */ diff -Naur --exclude=autom4te.cache openssh-7.0p1/gss-serv.c openssh-7.0p1-gssapi/gss-serv.c --- openssh-7.0p1/gss-serv.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/gss-serv.c 2015-08-12 17:11:07.000000000 -0500 @@ -1,7 +1,7 @@ /* $OpenBSD: gss-serv.c,v 1.29 2015/05/22 03:50:02 djm Exp $ */ /* - * Copyright (c) 2001-2003 Simon Wilkinson. All rights reserved. + * Copyright (c) 2001-2009 Simon Wilkinson. All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions @@ -45,29 +45,45 @@ #include "session.h" #include "misc.h" #include "servconf.h" +#include "uidswap.h" +#include "xmalloc.h" #include "ssh-gss.h" +#include "monitor_wrap.h" + +extern ServerOptions options; +extern Authctxt *the_authctxt; extern ServerOptions options; static ssh_gssapi_client gssapi_client = { GSS_C_EMPTY_BUFFER, GSS_C_EMPTY_BUFFER, - GSS_C_NO_CREDENTIAL, NULL, {NULL, NULL, NULL, NULL}}; + GSS_C_NO_CREDENTIAL, GSS_C_NO_NAME, NULL, {NULL, NULL, NULL, NULL}, 0, 0}; ssh_gssapi_mech gssapi_null_mech = - { NULL, NULL, {0, NULL}, NULL, NULL, NULL, NULL}; + { NULL, NULL, {0, NULL}, NULL, NULL, NULL, NULL, NULL}; #ifdef KRB5 extern ssh_gssapi_mech gssapi_kerberos_mech; #endif +#ifdef GSI +extern ssh_gssapi_mech gssapi_gsi_mech; +#endif ssh_gssapi_mech* supported_mechs[]= { #ifdef KRB5 &gssapi_kerberos_mech, #endif +#ifdef GSI + &gssapi_gsi_mech, +#endif &gssapi_null_mech, }; +#ifdef GSS_C_GLOBUS_LIMITED_PROXY_FLAG +static int limited = 0; +#endif + /* * ssh_gssapi_supported_oids() can cause sandbox violations, so prepare the * list of supported mechanisms before privsep is set up. @@ -142,6 +158,29 @@ } /* Unprivileged */ +char * +ssh_gssapi_server_mechanisms() { + gss_OID_set supported; + + ssh_gssapi_supported_oids(&supported); + return (ssh_gssapi_kex_mechs(supported, &ssh_gssapi_server_check_mech, + NULL, NULL)); +} + +/* Unprivileged */ +int +ssh_gssapi_server_check_mech(Gssctxt **dum, gss_OID oid, const char *data, + const char *dummy) { + Gssctxt *ctx = NULL; + int res; + + res = !GSS_ERROR(PRIVSEP(ssh_gssapi_server_ctx(&ctx, oid))); + ssh_gssapi_delete_ctx(&ctx); + + return (res); +} + +/* Unprivileged */ void ssh_gssapi_supported_oids(gss_OID_set *oidset) { @@ -203,6 +242,10 @@ (*flags & GSS_C_INTEG_FLAG))) && (ctx->major == GSS_S_COMPLETE)) { if (ssh_gssapi_getclient(ctx, &gssapi_client)) fatal("Couldn't convert client name"); +#ifdef GSS_C_GLOBUS_LIMITED_PROXY_FLAG + if (flags && (*flags & GSS_C_GLOBUS_LIMITED_PROXY_FLAG)) + limited=1; +#endif } return (status); @@ -222,6 +265,17 @@ tok = ename->value; +#ifdef GSI /* GSI gss_export_name() is broken. */ + if ((ctx->oid->length == gssapi_gsi_mech.oid.length) && + (memcmp(ctx->oid->elements, gssapi_gsi_mech.oid.elements, + gssapi_gsi_mech.oid.length) == 0)) { + name->length = ename->length; + name->value = xmalloc(ename->length+1); + memcpy(name->value, ename->value, ename->length); + return GSS_S_COMPLETE; + } +#endif + /* * Check that ename is long enough for all of the fixed length * header, and that the initial ID bytes are correct @@ -277,8 +331,51 @@ ssh_gssapi_getclient(Gssctxt *ctx, ssh_gssapi_client *client) { int i = 0; + int equal = 0; + gss_name_t new_name = GSS_C_NO_NAME; + gss_buffer_desc ename = GSS_C_EMPTY_BUFFER; + + if (options.gss_store_rekey && client->used && ctx->client_creds) { + if (client->mech->oid.length != ctx->oid->length || + (memcmp(client->mech->oid.elements, + ctx->oid->elements, ctx->oid->length) !=0)) { + debug("Rekeyed credentials have different mechanism"); + return GSS_S_COMPLETE; + } - gss_buffer_desc ename; + /* Call gss_inquire_cred rather than gss_inquire_cred_by_mech + because GSI doesn't support the latter. -jbasney */ + + if ((ctx->major = gss_inquire_cred(&ctx->minor, + ctx->client_creds, &new_name, + NULL, NULL, NULL))) { + ssh_gssapi_error(ctx); + return (ctx->major); + } + + ctx->major = gss_compare_name(&ctx->minor, client->name, + new_name, &equal); + + if (GSS_ERROR(ctx->major)) { + ssh_gssapi_error(ctx); + return (ctx->major); + } + + if (!equal) { + debug("Rekeyed credentials have different name"); + return GSS_S_COMPLETE; + } + + debug("Marking rekeyed credentials for export"); + + gss_release_name(&ctx->minor, &client->name); + gss_release_cred(&ctx->minor, &client->creds); + client->name = new_name; + client->creds = ctx->client_creds; + ctx->client_creds = GSS_C_NO_CREDENTIAL; + client->updated = 1; + return GSS_S_COMPLETE; + } client->mech = NULL; @@ -293,6 +390,16 @@ if (client->mech == NULL) return GSS_S_FAILURE; + /* Call gss_inquire_cred rather than gss_inquire_cred_by_mech + because GSI doesn't support the latter. -jbasney */ + + if (ctx->client_creds && + (ctx->major = gss_inquire_cred(&ctx->minor, + ctx->client_creds, &client->name, NULL, NULL, NULL))) { + ssh_gssapi_error(ctx); + return (ctx->major); + } + if ((ctx->major = gss_display_name(&ctx->minor, ctx->client, &client->displayname, NULL))) { ssh_gssapi_error(ctx); @@ -310,9 +417,15 @@ return (ctx->major); } + gss_release_buffer(&ctx->minor, &ename); + /* We can't copy this structure, so we just move the pointer to it */ client->creds = ctx->client_creds; ctx->client_creds = GSS_C_NO_CREDENTIAL; + + /* needed for globus_gss_assist_map_and_authorize() */ + client->context = ctx->context; + return (ctx->major); } @@ -333,6 +446,11 @@ ssh_gssapi_storecreds(void) { if (gssapi_client.mech && gssapi_client.mech->storecreds) { + if (options.gss_creds_path) { + gssapi_client.store.filename = + expand_authorized_keys(options.gss_creds_path, + the_authctxt->pw); + } (*gssapi_client.mech->storecreds)(&gssapi_client); } else debug("ssh_gssapi_storecreds: Not a GSSAPI mechanism"); @@ -356,8 +474,9 @@ } /* Privileged */ +/* gssapi_keyex arg added for Globus usage */ int -ssh_gssapi_userok(char *user) +ssh_gssapi_userok(char *user, struct passwd *pw, int gssapi_keyex) { OM_uint32 lmin; @@ -366,10 +485,18 @@ debug("No suitable client data"); return 0; } +#ifdef GSS_C_GLOBUS_LIMITED_PROXY_FLAG + if (limited && options.gsi_allow_limited_proxy != 1) { + debug("limited proxy not acceptable for remote login"); + return 0; + } +#endif if (gssapi_client.mech && gssapi_client.mech->userok) - if ((*gssapi_client.mech->userok)(&gssapi_client, user)) + if ((*gssapi_client.mech->userok)(&gssapi_client, user)) { + gssapi_client.used = 1; + gssapi_client.store.owner = pw; return 1; - else { + } else { /* Destroy delegated credentials if userok fails */ gss_release_buffer(&lmin, &gssapi_client.displayname); gss_release_buffer(&lmin, &gssapi_client.exportedname); @@ -383,14 +510,133 @@ return (0); } -/* Privileged */ -OM_uint32 -ssh_gssapi_checkmic(Gssctxt *ctx, gss_buffer_t gssbuf, gss_buffer_t gssmic) +/* ssh_gssapi_checkmic() moved to gss-genr.c so it can be called by + kexgss_client(). */ + +/* Priviledged */ +int +ssh_gssapi_localname(char **user) { - ctx->major = gss_verify_mic(&ctx->minor, ctx->context, - gssbuf, gssmic, NULL); + *user = NULL; + if (gssapi_client.displayname.length==0 || + gssapi_client.displayname.value==NULL) { + debug("No suitable client data"); + return(0);; + } + if (gssapi_client.mech && gssapi_client.mech->localname) { + return((*gssapi_client.mech->localname)(&gssapi_client,user)); + } else { + debug("Unknown client authentication type"); + } + return(0); +} - return (ctx->major); +/* These bits are only used for rekeying. The unpriviledged child is running + * as the user, the monitor is root. + * + * In the child, we want to : + * *) Ask the monitor to store our credentials into the store we specify + * *) If it succeeds, maybe do a PAM update + */ + +/* Stuff for PAM */ + +#ifdef USE_PAM +static int ssh_gssapi_simple_conv(int n, const struct pam_message **msg, + struct pam_response **resp, void *data) +{ + return (PAM_CONV_ERR); +} +#endif + +void +ssh_gssapi_rekey_creds() { + int ok; +#ifdef USE_PAM + int ret; + pam_handle_t *pamh = NULL; + struct pam_conv pamconv = {ssh_gssapi_simple_conv, NULL}; + char *envstr; + char **p;char **pw; +#endif + + if (gssapi_client.store.filename == NULL && + gssapi_client.store.envval == NULL && + gssapi_client.store.envvar == NULL) + return; + + ok = PRIVSEP(ssh_gssapi_update_creds(&gssapi_client.store)); + + if (!ok) + return; + + debug("Rekeyed credentials stored successfully"); + + /* Actually managing to play with the ssh pam stack from here will + * be next to impossible. In any case, we may want different options + * for rekeying. So, use our own :) + */ +#ifdef USE_PAM + if (!use_privsep) { + debug("Not even going to try and do PAM with privsep disabled"); + return; + } + + ret = pam_start("sshd-rekey", gssapi_client.store.owner->pw_name, + &pamconv, &pamh); + if (ret) + return; + + /* Put ssh pam stack env variables in this new pam stack env + * Using pam-pkinit, KRB5CCNAME is set during do_pam_session + * this addition enables pam-pkinit to access KRB5CCNAME if used + * in sshd-rekey stack too + */ + pw = p = fetch_pam_environment(); + while ( *pw != NULL ) { + pam_putenv(pamh,*pw); + pw++; + } + free_pam_environment(p); + + xasprintf(&envstr, "%s=%s", gssapi_client.store.envvar, + gssapi_client.store.envval); + + ret = pam_putenv(pamh, envstr); + if (!ret) + pam_setcred(pamh, PAM_REINITIALIZE_CRED); + pam_end(pamh, PAM_SUCCESS); +#endif +} + +int +ssh_gssapi_update_creds(ssh_gssapi_ccache *store) { + int ok = 0; + + /* Check we've got credentials to store */ + if (!gssapi_client.updated) + return 0; + + gssapi_client.updated = 0; + + temporarily_use_uid(gssapi_client.store.owner); + if (gssapi_client.mech && gssapi_client.mech->updatecreds) + ok = (*gssapi_client.mech->updatecreds)(store, &gssapi_client); + else + debug("No update function for this mechanism"); + + restore_uid(); + + return ok; +} + +/* added for Globus usage */ +void +ssh_gssapi_get_client_info(char **userdn, char **mech) { + *userdn = gssapi_client.displayname.value; + + if (gssapi_client.mech) + *mech = gssapi_client.mech->name; } #endif diff -Naur --exclude=autom4te.cache openssh-7.0p1/kex.c openssh-7.0p1-gssapi/kex.c --- openssh-7.0p1/kex.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/kex.c 2015-08-12 17:11:07.000000000 -0500 @@ -55,6 +55,12 @@ #include "sshbuf.h" #include "digest.h" +#include "canohost.h" + +#ifdef GSSAPI +#include "ssh-gss.h" +#endif + #if OPENSSL_VERSION_NUMBER >= 0x00907000L # if defined(HAVE_EVP_SHA256) # define evp_ssh_sha256 EVP_sha256 @@ -218,6 +224,7 @@ } /* put algorithm proposal into buffer */ +/* used in sshconnect.c as well as kex.c */ int kex_prop2buf(struct sshbuf *b, char *proposal[PROPOSAL_MAX]) { @@ -595,6 +602,26 @@ if (k->name == NULL) return SSH_ERR_NO_KEX_ALG_MATCH; +#ifdef GSSAPI /* substring matching for the GSSAPI methods */ + if (strncmp(k->name, KEX_GSS_GEX_SHA1_ID, + sizeof(KEX_GSS_GEX_SHA1_ID) - 1) == 0) { + k->kex_type = KEX_GSS_GEX_SHA1; + k->hash_alg = SSH_DIGEST_SHA1; + return 0; /* gss-gex-sha1-* */ + } + if (strncmp(k->name, KEX_GSS_GRP1_SHA1_ID, + sizeof(KEX_GSS_GRP1_SHA1_ID) - 1) == 0) { + k->kex_type = KEX_GSS_GRP1_SHA1; + k->hash_alg = SSH_DIGEST_SHA1; + return 0; /* gss-group1-sha1-* */ + } + if (strncmp(k->name, KEX_GSS_GRP14_SHA1_ID, + sizeof(KEX_GSS_GRP14_SHA1_ID) - 1) == 0) { + k->kex_type = KEX_GSS_GRP14_SHA1; + k->hash_alg = SSH_DIGEST_SHA1; + return 0; /* gss-group14-sha1-* */ + } +#endif if ((kexalg = kex_alg_by_name(k->name)) == NULL) return SSH_ERR_INTERNAL_ERROR; k->kex_type = kexalg->type; @@ -652,6 +679,11 @@ int nenc, nmac, ncomp; u_int mode, ctos, need, dh_need, authlen; int r, first_kex_follows; + int log_flag = 0; + int auth_flag; + + auth_flag = ssh_packet_authentication_state(ssh); + debug ("AUTH STATE IS %d", auth_flag); if ((r = kex_buf2prop(kex->my, NULL, &my)) != 0 || (r = kex_buf2prop(kex->peer, &first_kex_follows, &peer)) != 0) @@ -709,11 +741,34 @@ peer[ncomp] = NULL; goto out; } + debug("REQUESTED ENC.NAME is '%s'", newkeys->enc.name); + if (strcmp(newkeys->enc.name, "none") == 0) { + debug("Requesting NONE. Authflag is %d", auth_flag); + if (auth_flag == 1) { + debug("None requested post authentication."); + } else { + fatal("Pre-authentication none cipher requests are not allowed."); + } + } debug("kex: %s %s %s %s", ctos ? "client->server" : "server->client", newkeys->enc.name, authlen == 0 ? newkeys->mac.name : "", newkeys->comp.name); + /* client starts withctos = 0 && log flag = 0 and no log*/ + /* 2nd client pass ctos=1 and flag = 1 so no log*/ + /* server starts with ctos =1 && log_flag = 0 so log */ + /* 2nd sever pass ctos = 1 && log flag = 1 so no log*/ + /* -cjr*/ + if (ctos && !log_flag) { + logit("SSH: Server;Ltype: Kex;Remote: %s-%d;Enc: %s;MAC: %s;Comp: %s", + get_remote_ipaddr(), + get_remote_port(), + newkeys->enc.name, + newkeys->mac.name, + newkeys->comp.name); + } + log_flag = 1; } if ((r = choose_kex(kex, cprop[PROPOSAL_KEX_ALGS], sprop[PROPOSAL_KEX_ALGS])) != 0) { diff -Naur --exclude=autom4te.cache openssh-7.0p1/kex.h openssh-7.0p1-gssapi/kex.h --- openssh-7.0p1/kex.h 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/kex.h 2015-08-12 17:11:07.000000000 -0500 @@ -92,6 +92,9 @@ KEX_DH_GEX_SHA1, KEX_DH_GEX_SHA256, KEX_ECDH_SHA2, + KEX_GSS_GRP1_SHA1, + KEX_GSS_GRP14_SHA1, + KEX_GSS_GEX_SHA1, KEX_C25519_SHA256, KEX_MAX }; @@ -137,6 +140,12 @@ struct sshbuf *peer; sig_atomic_t done; u_int flags; +#ifdef GSSAPI + int gss_deleg_creds; + int gss_trust_dns; + char *gss_host; + char *gss_client; +#endif int hash_alg; int ec_nid; char *client_version_string; @@ -187,6 +196,11 @@ int kexc25519_client(struct ssh *); int kexc25519_server(struct ssh *); +#ifdef GSSAPI +int kexgss_client(struct ssh *); +int kexgss_server(struct ssh *); +#endif + int kex_dh_hash(const char *, const char *, const u_char *, size_t, const u_char *, size_t, const u_char *, size_t, const BIGNUM *, const BIGNUM *, const BIGNUM *, u_char *, size_t *); diff -Naur --exclude=autom4te.cache openssh-7.0p1/kexgssc.c openssh-7.0p1-gssapi/kexgssc.c --- openssh-7.0p1/kexgssc.c 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/kexgssc.c 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,341 @@ +/* + * Copyright (c) 2001-2009 Simon Wilkinson. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR `AS IS'' AND ANY EXPRESS OR + * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES + * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. + * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, + * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +#include "includes.h" + +#ifdef GSSAPI + +#include "includes.h" + +#include +#include + +#include + +#include "xmalloc.h" +#include "buffer.h" +#include "ssh2.h" +#include "key.h" +#include "cipher.h" +#include "digest.h" +#include "kex.h" +#include "log.h" +#include "packet.h" +#include "dh.h" + +#include "ssh-gss.h" + +int +kexgss_client(struct ssh *ssh) { + struct kex *kex = ssh->kex; + gss_buffer_desc send_tok = GSS_C_EMPTY_BUFFER; + gss_buffer_desc recv_tok, gssbuf, msg_tok, *token_ptr; + Gssctxt *ctxt = NULL; + OM_uint32 maj_status, min_status, ret_flags; + u_int klen, slen = 0, strlen; + size_t hashlen; + int kout; + DH *dh = NULL; + BIGNUM *dh_server_pub = NULL; + BIGNUM *shared_secret = NULL; + BIGNUM *p = NULL; + BIGNUM *g = NULL; + u_char *kbuf = NULL; + u_char hash[SSH_DIGEST_MAX_LENGTH]; + u_char *serverhostkey = NULL; + u_char *empty = ""; + char *msg = NULL; + char *lang = NULL; + int type = 0; + int first = 1; + int nbits = 0, min = DH_GRP_MIN, max = DH_GRP_MAX; + + /* Initialise our GSSAPI world */ + ssh_gssapi_build_ctx(&ctxt); + if (ssh_gssapi_id_kex(ctxt, kex->name, kex->kex_type) + == GSS_C_NO_OID) + fatal("Couldn't identify host exchange"); + + if (ssh_gssapi_import_name(ctxt, kex->gss_host)) + fatal("Couldn't import hostname"); + + if (kex->gss_client && + ssh_gssapi_client_identity(ctxt, kex->gss_client)) + fatal("Couldn't acquire client credentials"); + + switch (kex->kex_type) { + case KEX_GSS_GRP1_SHA1: + dh = dh_new_group1(); + break; + case KEX_GSS_GRP14_SHA1: + dh = dh_new_group14(); + break; + case KEX_GSS_GEX_SHA1: + debug("Doing group exchange\n"); + nbits = dh_estimate(kex->we_need * 8); + packet_start(SSH2_MSG_KEXGSS_GROUPREQ); + packet_put_int(min); + packet_put_int(nbits); + packet_put_int(max); + + packet_send(); + + packet_read_expect(SSH2_MSG_KEXGSS_GROUP); + + if ((p = BN_new()) == NULL) + fatal("BN_new() failed"); + packet_get_bignum2(p); + if ((g = BN_new()) == NULL) + fatal("BN_new() failed"); + packet_get_bignum2(g); + packet_check_eom(); + + if (BN_num_bits(p) < min || BN_num_bits(p) > max) + fatal("GSSGRP_GEX group out of range: %d !< %d !< %d", + min, BN_num_bits(p), max); + + dh = dh_new_group(g, p); + break; + default: + fatal("%s: Unexpected KEX type %d", __func__, kex->kex_type); + } + + /* Step 1 - e is dh->pub_key */ + dh_gen_key(dh, kex->we_need * 8); + + /* This is f, we initialise it now to make life easier */ + dh_server_pub = BN_new(); + if (dh_server_pub == NULL) + fatal("dh_server_pub == NULL"); + + token_ptr = GSS_C_NO_BUFFER; + + do { + debug("Calling gss_init_sec_context"); + + maj_status = ssh_gssapi_init_ctx(ctxt, + kex->gss_deleg_creds, token_ptr, &send_tok, + &ret_flags); + + if (GSS_ERROR(maj_status)) { + if (send_tok.length != 0) { + packet_start(SSH2_MSG_KEXGSS_CONTINUE); + packet_put_string(send_tok.value, + send_tok.length); + } + fatal("gss_init_context failed"); + } + + /* If we've got an old receive buffer get rid of it */ + if (token_ptr != GSS_C_NO_BUFFER) + free(recv_tok.value); + + if (maj_status == GSS_S_COMPLETE) { + /* If mutual state flag is not true, kex fails */ + if (!(ret_flags & GSS_C_MUTUAL_FLAG)) + fatal("Mutual authentication failed"); + + /* If integ avail flag is not true kex fails */ + if (!(ret_flags & GSS_C_INTEG_FLAG)) + fatal("Integrity check failed"); + } + + /* + * If we have data to send, then the last message that we + * received cannot have been a 'complete'. + */ + if (send_tok.length != 0) { + if (first) { + packet_start(SSH2_MSG_KEXGSS_INIT); + packet_put_string(send_tok.value, + send_tok.length); + packet_put_bignum2(dh->pub_key); + first = 0; + } else { + packet_start(SSH2_MSG_KEXGSS_CONTINUE); + packet_put_string(send_tok.value, + send_tok.length); + } + packet_send(); + gss_release_buffer(&min_status, &send_tok); + + /* If we've sent them data, they should reply */ + do { + type = packet_read(); + if (type == SSH2_MSG_KEXGSS_HOSTKEY) { + debug("Received KEXGSS_HOSTKEY"); + if (serverhostkey) + fatal("Server host key received more than once"); + serverhostkey = + packet_get_string(&slen); + } + } while (type == SSH2_MSG_KEXGSS_HOSTKEY); + + switch (type) { + case SSH2_MSG_KEXGSS_CONTINUE: + debug("Received GSSAPI_CONTINUE"); + if (maj_status == GSS_S_COMPLETE) + fatal("GSSAPI Continue received from server when complete"); + recv_tok.value = packet_get_string(&strlen); + recv_tok.length = strlen; + break; + case SSH2_MSG_KEXGSS_COMPLETE: + debug("Received GSSAPI_COMPLETE"); + packet_get_bignum2(dh_server_pub); + msg_tok.value = packet_get_string(&strlen); + msg_tok.length = strlen; + + /* Is there a token included? */ + if (packet_get_char()) { + recv_tok.value= + packet_get_string(&strlen); + recv_tok.length = strlen; + /* If we're already complete - protocol error */ + if (maj_status == GSS_S_COMPLETE) + packet_disconnect("Protocol error: received token when complete"); + } else { + /* No token included */ + if (maj_status != GSS_S_COMPLETE) + packet_disconnect("Protocol error: did not receive final token"); + } + break; + case SSH2_MSG_KEXGSS_ERROR: + debug("Received Error"); + maj_status = packet_get_int(); + min_status = packet_get_int(); + msg = packet_get_string(NULL); + lang = packet_get_string(NULL); + fatal("GSSAPI Error: \n%.400s",msg); + default: + packet_disconnect("Protocol error: didn't expect packet type %d", + type); + } + token_ptr = &recv_tok; + } else { + /* No data, and not complete */ + if (maj_status != GSS_S_COMPLETE) + fatal("Not complete, and no token output"); + } + } while (maj_status & GSS_S_CONTINUE_NEEDED); + + /* + * We _must_ have received a COMPLETE message in reply from the + * server, which will have set dh_server_pub and msg_tok + */ + + if (type != SSH2_MSG_KEXGSS_COMPLETE) + fatal("Didn't receive a SSH2_MSG_KEXGSS_COMPLETE when I expected it"); + + /* Check f in range [1, p-1] */ + if (!dh_pub_is_valid(dh, dh_server_pub)) + packet_disconnect("bad server public DH value"); + + /* compute K=f^x mod p */ + klen = DH_size(dh); + kbuf = xmalloc(klen); + kout = DH_compute_key(kbuf, dh_server_pub, dh); + if (kout < 0) + fatal("DH_compute_key: failed"); + + shared_secret = BN_new(); + if (shared_secret == NULL) + fatal("kexgss_client: BN_new failed"); + + if (BN_bin2bn(kbuf, kout, shared_secret) == NULL) + fatal("kexdh_client: BN_bin2bn failed"); + + memset(kbuf, 0, klen); + free(kbuf); + + hashlen = sizeof(hash); + switch (kex->kex_type) { + case KEX_GSS_GRP1_SHA1: + case KEX_GSS_GRP14_SHA1: + kex_dh_hash( kex->client_version_string, + kex->server_version_string, + buffer_ptr(kex->my), buffer_len(kex->my), + buffer_ptr(kex->peer), buffer_len(kex->peer), + (serverhostkey ? serverhostkey : empty), slen, + dh->pub_key, /* e */ + dh_server_pub, /* f */ + shared_secret, /* K */ + hash, &hashlen + ); + break; + case KEX_GSS_GEX_SHA1: + kexgex_hash( + kex->hash_alg, + kex->client_version_string, + kex->server_version_string, + buffer_ptr(kex->my), buffer_len(kex->my), + buffer_ptr(kex->peer), buffer_len(kex->peer), + (serverhostkey ? serverhostkey : empty), slen, + min, nbits, max, + dh->p, dh->g, + dh->pub_key, + dh_server_pub, + shared_secret, + hash, &hashlen + ); + break; + default: + fatal("%s: Unexpected KEX type %d", __func__, kex->kex_type); + } + + gssbuf.value = hash; + gssbuf.length = hashlen; + + /* Verify that the hash matches the MIC we just got. */ + if (GSS_ERROR(ssh_gssapi_checkmic(ctxt, &gssbuf, &msg_tok))) + packet_disconnect("Hash's MIC didn't verify"); + + free(msg_tok.value); + + DH_free(dh); + if (serverhostkey) + free(serverhostkey); + BN_clear_free(dh_server_pub); + + /* save session id */ + if (kex->session_id == NULL) { + kex->session_id_len = hashlen; + kex->session_id = xmalloc(kex->session_id_len); + memcpy(kex->session_id, hash, kex->session_id_len); + } + + if (kex->gss_deleg_creds) + ssh_gssapi_credentials_updated(ctxt); + + if (gss_kex_context == NULL) + gss_kex_context = ctxt; + else + ssh_gssapi_delete_ctx(&ctxt); + + kex_derive_keys_bn(ssh, hash, hashlen, shared_secret); + BN_clear_free(shared_secret); + kex_send_newkeys(ssh); + return 0; +} + +#endif /* GSSAPI */ diff -Naur --exclude=autom4te.cache openssh-7.0p1/kexgsss.c openssh-7.0p1-gssapi/kexgsss.c --- openssh-7.0p1/kexgsss.c 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/kexgsss.c 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,320 @@ +/* + * Copyright (c) 2001-2009 Simon Wilkinson. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR `AS IS'' AND ANY EXPRESS OR + * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES + * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. + * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, + * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +#include "includes.h" + +#ifdef GSSAPI + +#include + +#include +#include + +#include "xmalloc.h" +#include "buffer.h" +#include "ssh2.h" +#include "key.h" +#include "cipher.h" +#include "digest.h" +#include "kex.h" +#include "log.h" +#include "packet.h" +#include "dh.h" +#include "ssh-gss.h" +#include "monitor_wrap.h" +#include "misc.h" +#include "servconf.h" + +static void kex_gss_send_error(Gssctxt *ctxt); +extern ServerOptions options; + +int +kexgss_server(struct ssh *ssh) +{ + struct kex *kex = ssh->kex; + OM_uint32 maj_status, min_status; + + /* + * Some GSSAPI implementations use the input value of ret_flags (an + * output variable) as a means of triggering mechanism specific + * features. Initializing it to zero avoids inadvertently + * activating this non-standard behaviour. + */ + + OM_uint32 ret_flags = 0; + gss_buffer_desc gssbuf, recv_tok, msg_tok; + gss_buffer_desc send_tok = GSS_C_EMPTY_BUFFER; + Gssctxt *ctxt = NULL; + u_int slen, klen; + size_t hashlen; + int kout; + u_char *kbuf = NULL; + u_char hash[SSH_DIGEST_MAX_LENGTH]; + DH *dh = NULL; + int min = -1, max = -1, nbits = -1; + BIGNUM *shared_secret = NULL; + BIGNUM *dh_client_pub = NULL; + int type = 0; + gss_OID oid; + char *mechs = NULL; + + /* Initialise GSSAPI */ + + /* If we're rekeying, privsep means that some of the private structures + * in the GSSAPI code are no longer available. This kludges them back + * into life + */ + if (!ssh_gssapi_oid_table_ok()) + if ((mechs = ssh_gssapi_server_mechanisms())) + free(mechs); + + debug2("%s: Identifying %s", __func__, kex->name); + oid = ssh_gssapi_id_kex(NULL, kex->name, kex->kex_type); + if (oid == GSS_C_NO_OID) + fatal("Unknown gssapi mechanism"); + + debug2("%s: Acquiring credentials", __func__); + + if (GSS_ERROR(PRIVSEP(ssh_gssapi_server_ctx(&ctxt, oid)))) { + kex_gss_send_error(ctxt); + fatal("Unable to acquire credentials for the server"); + } + + switch (kex->kex_type) { + case KEX_GSS_GRP1_SHA1: + dh = dh_new_group1(); + break; + case KEX_GSS_GRP14_SHA1: + dh = dh_new_group14(); + break; + case KEX_GSS_GEX_SHA1: + debug("Doing group exchange"); + packet_read_expect(SSH2_MSG_KEXGSS_GROUPREQ); + min = packet_get_int(); + nbits = packet_get_int(); + max = packet_get_int(); + min = MAX(DH_GRP_MIN, min); + max = MIN(DH_GRP_MAX, max); + packet_check_eom(); + if (max < min || nbits < min || max < nbits) + fatal("GSS_GEX, bad parameters: %d !< %d !< %d", + min, nbits, max); + dh = PRIVSEP(choose_dh(min, nbits, max)); + if (dh == NULL) + packet_disconnect("Protocol error: no matching group found"); + + packet_start(SSH2_MSG_KEXGSS_GROUP); + packet_put_bignum2(dh->p); + packet_put_bignum2(dh->g); + packet_send(); + + packet_write_wait(); + break; + default: + fatal("%s: Unexpected KEX type %d", __func__, kex->kex_type); + } + + dh_gen_key(dh, kex->we_need * 8); + + do { + debug("Wait SSH2_MSG_GSSAPI_INIT"); + type = packet_read(); + switch(type) { + case SSH2_MSG_KEXGSS_INIT: + if (dh_client_pub != NULL) + fatal("Received KEXGSS_INIT after initialising"); + recv_tok.value = packet_get_string(&slen); + recv_tok.length = slen; + + if ((dh_client_pub = BN_new()) == NULL) + fatal("dh_client_pub == NULL"); + + packet_get_bignum2(dh_client_pub); + + /* Send SSH_MSG_KEXGSS_HOSTKEY here, if we want */ + break; + case SSH2_MSG_KEXGSS_CONTINUE: + recv_tok.value = packet_get_string(&slen); + recv_tok.length = slen; + break; + default: + packet_disconnect( + "Protocol error: didn't expect packet type %d", + type); + } + + maj_status = PRIVSEP(ssh_gssapi_accept_ctx(ctxt, &recv_tok, + &send_tok, &ret_flags)); + + free(recv_tok.value); + + if (maj_status != GSS_S_COMPLETE && send_tok.length == 0) + fatal("Zero length token output when incomplete"); + + if (dh_client_pub == NULL) + fatal("No client public key"); + + if (maj_status & GSS_S_CONTINUE_NEEDED) { + debug("Sending GSSAPI_CONTINUE"); + packet_start(SSH2_MSG_KEXGSS_CONTINUE); + packet_put_string((char *)send_tok.value, send_tok.length); + packet_send(); + gss_release_buffer(&min_status, &send_tok); + } + } while (maj_status & GSS_S_CONTINUE_NEEDED); + + if (GSS_ERROR(maj_status)) { + kex_gss_send_error(ctxt); + if (send_tok.length > 0) { + packet_start(SSH2_MSG_KEXGSS_CONTINUE); + packet_put_string((char *)send_tok.value, send_tok.length); + packet_send(); + } + packet_disconnect("GSSAPI Key Exchange handshake failed"); + } + + if (!(ret_flags & GSS_C_MUTUAL_FLAG)) + fatal("Mutual Authentication flag wasn't set"); + + if (!(ret_flags & GSS_C_INTEG_FLAG)) + fatal("Integrity flag wasn't set"); + + if (!dh_pub_is_valid(dh, dh_client_pub)) + packet_disconnect("bad client public DH value"); + + klen = DH_size(dh); + kbuf = xmalloc(klen); + kout = DH_compute_key(kbuf, dh_client_pub, dh); + if (kout < 0) + fatal("DH_compute_key: failed"); + + shared_secret = BN_new(); + if (shared_secret == NULL) + fatal("kexgss_server: BN_new failed"); + + if (BN_bin2bn(kbuf, kout, shared_secret) == NULL) + fatal("kexgss_server: BN_bin2bn failed"); + + memset(kbuf, 0, klen); + free(kbuf); + + hashlen = sizeof(hash); + switch (kex->kex_type) { + case KEX_GSS_GRP1_SHA1: + case KEX_GSS_GRP14_SHA1: + kex_dh_hash( + kex->client_version_string, kex->server_version_string, + buffer_ptr(kex->peer), buffer_len(kex->peer), + buffer_ptr(kex->my), buffer_len(kex->my), + NULL, 0, /* Change this if we start sending host keys */ + dh_client_pub, dh->pub_key, shared_secret, + hash, &hashlen + ); + break; + case KEX_GSS_GEX_SHA1: + kexgex_hash( + kex->hash_alg, + kex->client_version_string, kex->server_version_string, + buffer_ptr(kex->peer), buffer_len(kex->peer), + buffer_ptr(kex->my), buffer_len(kex->my), + NULL, 0, + min, nbits, max, + dh->p, dh->g, + dh_client_pub, + dh->pub_key, + shared_secret, + hash, &hashlen + ); + break; + default: + fatal("%s: Unexpected KEX type %d", __func__, kex->kex_type); + } + + BN_clear_free(dh_client_pub); + + if (kex->session_id == NULL) { + kex->session_id_len = hashlen; + kex->session_id = xmalloc(kex->session_id_len); + memcpy(kex->session_id, hash, kex->session_id_len); + } + + gssbuf.value = hash; + gssbuf.length = hashlen; + + if (GSS_ERROR(PRIVSEP(ssh_gssapi_sign(ctxt,&gssbuf,&msg_tok)))) + fatal("Couldn't get MIC"); + + packet_start(SSH2_MSG_KEXGSS_COMPLETE); + packet_put_bignum2(dh->pub_key); + packet_put_string((char *)msg_tok.value,msg_tok.length); + + if (send_tok.length != 0) { + packet_put_char(1); /* true */ + packet_put_string((char *)send_tok.value, send_tok.length); + } else { + packet_put_char(0); /* false */ + } + packet_send(); + + gss_release_buffer(&min_status, &send_tok); + gss_release_buffer(&min_status, &msg_tok); + + if (gss_kex_context == NULL) + gss_kex_context = ctxt; + else + ssh_gssapi_delete_ctx(&ctxt); + + DH_free(dh); + + kex_derive_keys_bn(ssh, hash, hashlen, shared_secret); + BN_clear_free(shared_secret); + kex_send_newkeys(ssh); + + /* If this was a rekey, then save out any delegated credentials we + * just exchanged. */ + if (options.gss_store_rekey) + ssh_gssapi_rekey_creds(); + + return 0; +} + +static void +kex_gss_send_error(Gssctxt *ctxt) { + char *errstr; + OM_uint32 maj,min; + + errstr=PRIVSEP(ssh_gssapi_last_error(ctxt,&maj,&min)); + if (errstr) { + packet_start(SSH2_MSG_KEXGSS_ERROR); + packet_put_int(maj); + packet_put_int(min); + packet_put_cstring(errstr); + packet_put_cstring(""); + packet_send(); + packet_write_wait(); + /* XXX - We should probably log the error locally here */ + free(errstr); + } +} +#endif /* GSSAPI */ diff -Naur --exclude=autom4te.cache openssh-7.0p1/libtool.m4 openssh-7.0p1-gssapi/libtool.m4 --- openssh-7.0p1/libtool.m4 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/libtool.m4 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,7982 @@ +# libtool.m4 - Configure libtool for the host system. -*-Autoconf-*- +# +# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2003, 2004, 2005, +# 2006, 2007, 2008, 2009, 2010, 2011 Free Software +# Foundation, Inc. +# Written by Gordon Matzigkeit, 1996 +# +# This file is free software; the Free Software Foundation gives +# unlimited permission to copy and/or distribute it, with or without +# modifications, as long as this notice is preserved. + +m4_define([_LT_COPYING], [dnl +# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2003, 2004, 2005, +# 2006, 2007, 2008, 2009, 2010, 2011 Free Software +# Foundation, Inc. +# Written by Gordon Matzigkeit, 1996 +# +# This file is part of GNU Libtool. +# +# GNU Libtool is free software; you can redistribute it and/or +# modify it under the terms of the GNU General Public License as +# published by the Free Software Foundation; either version 2 of +# the License, or (at your option) any later version. +# +# As a special exception to the GNU General Public License, +# if you distribute this file as part of a program or library that +# is built using GNU Libtool, you may include this file under the +# same distribution terms that you use for the rest of that program. +# +# GNU Libtool is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with GNU Libtool; see the file COPYING. If not, a copy +# can be downloaded from http://www.gnu.org/licenses/gpl.html, or +# obtained by writing to the Free Software Foundation, Inc., +# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +]) + +# serial 57 LT_INIT + + +# LT_PREREQ(VERSION) +# ------------------ +# Complain and exit if this libtool version is less that VERSION. +m4_defun([LT_PREREQ], +[m4_if(m4_version_compare(m4_defn([LT_PACKAGE_VERSION]), [$1]), -1, + [m4_default([$3], + [m4_fatal([Libtool version $1 or higher is required], + 63)])], + [$2])]) + + +# _LT_CHECK_BUILDDIR +# ------------------ +# Complain if the absolute build directory name contains unusual characters +m4_defun([_LT_CHECK_BUILDDIR], +[case `pwd` in + *\ * | *\ *) + AC_MSG_WARN([Libtool does not cope well with whitespace in `pwd`]) ;; +esac +]) + + +# LT_INIT([OPTIONS]) +# ------------------ +AC_DEFUN([LT_INIT], +[AC_PREREQ([2.58])dnl We use AC_INCLUDES_DEFAULT +AC_REQUIRE([AC_CONFIG_AUX_DIR_DEFAULT])dnl +AC_BEFORE([$0], [LT_LANG])dnl +AC_BEFORE([$0], [LT_OUTPUT])dnl +AC_BEFORE([$0], [LTDL_INIT])dnl +m4_require([_LT_CHECK_BUILDDIR])dnl + +dnl Autoconf doesn't catch unexpanded LT_ macros by default: +m4_pattern_forbid([^_?LT_[A-Z_]+$])dnl +m4_pattern_allow([^(_LT_EOF|LT_DLGLOBAL|LT_DLLAZY_OR_NOW|LT_MULTI_MODULE)$])dnl +dnl aclocal doesn't pull ltoptions.m4, ltsugar.m4, or ltversion.m4 +dnl unless we require an AC_DEFUNed macro: +AC_REQUIRE([LTOPTIONS_VERSION])dnl +AC_REQUIRE([LTSUGAR_VERSION])dnl +AC_REQUIRE([LTVERSION_VERSION])dnl +AC_REQUIRE([LTOBSOLETE_VERSION])dnl +m4_require([_LT_PROG_LTMAIN])dnl + +_LT_SHELL_INIT([SHELL=${CONFIG_SHELL-/bin/sh}]) + +dnl Parse OPTIONS +_LT_SET_OPTIONS([$0], [$1]) + +# This can be used to rebuild libtool when needed +LIBTOOL_DEPS="$ltmain" + +# Always use our own libtool. +LIBTOOL='$(SHELL) $(top_builddir)/libtool' +AC_SUBST(LIBTOOL)dnl + +_LT_SETUP + +# Only expand once: +m4_define([LT_INIT]) +])# LT_INIT + +# Old names: +AU_ALIAS([AC_PROG_LIBTOOL], [LT_INIT]) +AU_ALIAS([AM_PROG_LIBTOOL], [LT_INIT]) +dnl aclocal-1.4 backwards compatibility: +dnl AC_DEFUN([AC_PROG_LIBTOOL], []) +dnl AC_DEFUN([AM_PROG_LIBTOOL], []) + + +# _LT_CC_BASENAME(CC) +# ------------------- +# Calculate cc_basename. Skip known compiler wrappers and cross-prefix. +m4_defun([_LT_CC_BASENAME], +[for cc_temp in $1""; do + case $cc_temp in + compile | *[[\\/]]compile | ccache | *[[\\/]]ccache ) ;; + distcc | *[[\\/]]distcc | purify | *[[\\/]]purify ) ;; + \-*) ;; + *) break;; + esac +done +cc_basename=`$ECHO "$cc_temp" | $SED "s%.*/%%; s%^$host_alias-%%"` +]) + + +# _LT_FILEUTILS_DEFAULTS +# ---------------------- +# It is okay to use these file commands and assume they have been set +# sensibly after `m4_require([_LT_FILEUTILS_DEFAULTS])'. +m4_defun([_LT_FILEUTILS_DEFAULTS], +[: ${CP="cp -f"} +: ${MV="mv -f"} +: ${RM="rm -f"} +])# _LT_FILEUTILS_DEFAULTS + + +# _LT_SETUP +# --------- +m4_defun([_LT_SETUP], +[AC_REQUIRE([AC_CANONICAL_HOST])dnl +AC_REQUIRE([AC_CANONICAL_BUILD])dnl +AC_REQUIRE([_LT_PREPARE_SED_QUOTE_VARS])dnl +AC_REQUIRE([_LT_PROG_ECHO_BACKSLASH])dnl + +_LT_DECL([], [PATH_SEPARATOR], [1], [The PATH separator for the build system])dnl +dnl +_LT_DECL([], [host_alias], [0], [The host system])dnl +_LT_DECL([], [host], [0])dnl +_LT_DECL([], [host_os], [0])dnl +dnl +_LT_DECL([], [build_alias], [0], [The build system])dnl +_LT_DECL([], [build], [0])dnl +_LT_DECL([], [build_os], [0])dnl +dnl +AC_REQUIRE([AC_PROG_CC])dnl +AC_REQUIRE([LT_PATH_LD])dnl +AC_REQUIRE([LT_PATH_NM])dnl +dnl +AC_REQUIRE([AC_PROG_LN_S])dnl +test -z "$LN_S" && LN_S="ln -s" +_LT_DECL([], [LN_S], [1], [Whether we need soft or hard links])dnl +dnl +AC_REQUIRE([LT_CMD_MAX_LEN])dnl +_LT_DECL([objext], [ac_objext], [0], [Object file suffix (normally "o")])dnl +_LT_DECL([], [exeext], [0], [Executable file suffix (normally "")])dnl +dnl +m4_require([_LT_FILEUTILS_DEFAULTS])dnl +m4_require([_LT_CHECK_SHELL_FEATURES])dnl +m4_require([_LT_PATH_CONVERSION_FUNCTIONS])dnl +m4_require([_LT_CMD_RELOAD])dnl +m4_require([_LT_CHECK_MAGIC_METHOD])dnl +m4_require([_LT_CHECK_SHAREDLIB_FROM_LINKLIB])dnl +m4_require([_LT_CMD_OLD_ARCHIVE])dnl +m4_require([_LT_CMD_GLOBAL_SYMBOLS])dnl +m4_require([_LT_WITH_SYSROOT])dnl + +_LT_CONFIG_LIBTOOL_INIT([ +# See if we are running on zsh, and set the options which allow our +# commands through without removal of \ escapes INIT. +if test -n "\${ZSH_VERSION+set}" ; then + setopt NO_GLOB_SUBST +fi +]) +if test -n "${ZSH_VERSION+set}" ; then + setopt NO_GLOB_SUBST +fi + +_LT_CHECK_OBJDIR + +m4_require([_LT_TAG_COMPILER])dnl + +case $host_os in +aix3*) + # AIX sometimes has problems with the GCC collect2 program. For some + # reason, if we set the COLLECT_NAMES environment variable, the problems + # vanish in a puff of smoke. + if test "X${COLLECT_NAMES+set}" != Xset; then + COLLECT_NAMES= + export COLLECT_NAMES + fi + ;; +esac + +# Global variables: +ofile=libtool +can_build_shared=yes + +# All known linkers require a `.a' archive for static linking (except MSVC, +# which needs '.lib'). +libext=a + +with_gnu_ld="$lt_cv_prog_gnu_ld" + +old_CC="$CC" +old_CFLAGS="$CFLAGS" + +# Set sane defaults for various variables +test -z "$CC" && CC=cc +test -z "$LTCC" && LTCC=$CC +test -z "$LTCFLAGS" && LTCFLAGS=$CFLAGS +test -z "$LD" && LD=ld +test -z "$ac_objext" && ac_objext=o + +_LT_CC_BASENAME([$compiler]) + +# Only perform the check for file, if the check method requires it +test -z "$MAGIC_CMD" && MAGIC_CMD=file +case $deplibs_check_method in +file_magic*) + if test "$file_magic_cmd" = '$MAGIC_CMD'; then + _LT_PATH_MAGIC + fi + ;; +esac + +# Use C for the default configuration in the libtool script +LT_SUPPORTED_TAG([CC]) +_LT_LANG_C_CONFIG +_LT_LANG_DEFAULT_CONFIG +_LT_CONFIG_COMMANDS +])# _LT_SETUP + + +# _LT_PREPARE_SED_QUOTE_VARS +# -------------------------- +# Define a few sed substitution that help us do robust quoting. +m4_defun([_LT_PREPARE_SED_QUOTE_VARS], +[# Backslashify metacharacters that are still active within +# double-quoted strings. +sed_quote_subst='s/\([["`$\\]]\)/\\\1/g' + +# Same as above, but do not quote variable references. +double_quote_subst='s/\([["`\\]]\)/\\\1/g' + +# Sed substitution to delay expansion of an escaped shell variable in a +# double_quote_subst'ed string. +delay_variable_subst='s/\\\\\\\\\\\$/\\\\\\$/g' + +# Sed substitution to delay expansion of an escaped single quote. +delay_single_quote_subst='s/'\''/'\'\\\\\\\'\''/g' + +# Sed substitution to avoid accidental globbing in evaled expressions +no_glob_subst='s/\*/\\\*/g' +]) + +# _LT_PROG_LTMAIN +# --------------- +# Note that this code is called both from `configure', and `config.status' +# now that we use AC_CONFIG_COMMANDS to generate libtool. Notably, +# `config.status' has no value for ac_aux_dir unless we are using Automake, +# so we pass a copy along to make sure it has a sensible value anyway. +m4_defun([_LT_PROG_LTMAIN], +[m4_ifdef([AC_REQUIRE_AUX_FILE], [AC_REQUIRE_AUX_FILE([ltmain.sh])])dnl +_LT_CONFIG_LIBTOOL_INIT([ac_aux_dir='$ac_aux_dir']) +ltmain="$ac_aux_dir/ltmain.sh" +])# _LT_PROG_LTMAIN + + +## ------------------------------------- ## +## Accumulate code for creating libtool. ## +## ------------------------------------- ## + +# So that we can recreate a full libtool script including additional +# tags, we accumulate the chunks of code to send to AC_CONFIG_COMMANDS +# in macros and then make a single call at the end using the `libtool' +# label. + + +# _LT_CONFIG_LIBTOOL_INIT([INIT-COMMANDS]) +# ---------------------------------------- +# Register INIT-COMMANDS to be passed to AC_CONFIG_COMMANDS later. +m4_define([_LT_CONFIG_LIBTOOL_INIT], +[m4_ifval([$1], + [m4_append([_LT_OUTPUT_LIBTOOL_INIT], + [$1 +])])]) + +# Initialize. +m4_define([_LT_OUTPUT_LIBTOOL_INIT]) + + +# _LT_CONFIG_LIBTOOL([COMMANDS]) +# ------------------------------ +# Register COMMANDS to be passed to AC_CONFIG_COMMANDS later. +m4_define([_LT_CONFIG_LIBTOOL], +[m4_ifval([$1], + [m4_append([_LT_OUTPUT_LIBTOOL_COMMANDS], + [$1 +])])]) + +# Initialize. +m4_define([_LT_OUTPUT_LIBTOOL_COMMANDS]) + + +# _LT_CONFIG_SAVE_COMMANDS([COMMANDS], [INIT_COMMANDS]) +# ----------------------------------------------------- +m4_defun([_LT_CONFIG_SAVE_COMMANDS], +[_LT_CONFIG_LIBTOOL([$1]) +_LT_CONFIG_LIBTOOL_INIT([$2]) +]) + + +# _LT_FORMAT_COMMENT([COMMENT]) +# ----------------------------- +# Add leading comment marks to the start of each line, and a trailing +# full-stop to the whole comment if one is not present already. +m4_define([_LT_FORMAT_COMMENT], +[m4_ifval([$1], [ +m4_bpatsubst([m4_bpatsubst([$1], [^ *], [# ])], + [['`$\]], [\\\&])]m4_bmatch([$1], [[!?.]$], [], [.]) +)]) + + + +## ------------------------ ## +## FIXME: Eliminate VARNAME ## +## ------------------------ ## + + +# _LT_DECL([CONFIGNAME], VARNAME, VALUE, [DESCRIPTION], [IS-TAGGED?]) +# ------------------------------------------------------------------- +# CONFIGNAME is the name given to the value in the libtool script. +# VARNAME is the (base) name used in the configure script. +# VALUE may be 0, 1 or 2 for a computed quote escaped value based on +# VARNAME. Any other value will be used directly. +m4_define([_LT_DECL], +[lt_if_append_uniq([lt_decl_varnames], [$2], [, ], + [lt_dict_add_subkey([lt_decl_dict], [$2], [libtool_name], + [m4_ifval([$1], [$1], [$2])]) + lt_dict_add_subkey([lt_decl_dict], [$2], [value], [$3]) + m4_ifval([$4], + [lt_dict_add_subkey([lt_decl_dict], [$2], [description], [$4])]) + lt_dict_add_subkey([lt_decl_dict], [$2], + [tagged?], [m4_ifval([$5], [yes], [no])])]) +]) + + +# _LT_TAGDECL([CONFIGNAME], VARNAME, VALUE, [DESCRIPTION]) +# -------------------------------------------------------- +m4_define([_LT_TAGDECL], [_LT_DECL([$1], [$2], [$3], [$4], [yes])]) + + +# lt_decl_tag_varnames([SEPARATOR], [VARNAME1...]) +# ------------------------------------------------ +m4_define([lt_decl_tag_varnames], +[_lt_decl_filter([tagged?], [yes], $@)]) + + +# _lt_decl_filter(SUBKEY, VALUE, [SEPARATOR], [VARNAME1..]) +# --------------------------------------------------------- +m4_define([_lt_decl_filter], +[m4_case([$#], + [0], [m4_fatal([$0: too few arguments: $#])], + [1], [m4_fatal([$0: too few arguments: $#: $1])], + [2], [lt_dict_filter([lt_decl_dict], [$1], [$2], [], lt_decl_varnames)], + [3], [lt_dict_filter([lt_decl_dict], [$1], [$2], [$3], lt_decl_varnames)], + [lt_dict_filter([lt_decl_dict], $@)])[]dnl +]) + + +# lt_decl_quote_varnames([SEPARATOR], [VARNAME1...]) +# -------------------------------------------------- +m4_define([lt_decl_quote_varnames], +[_lt_decl_filter([value], [1], $@)]) + + +# lt_decl_dquote_varnames([SEPARATOR], [VARNAME1...]) +# --------------------------------------------------- +m4_define([lt_decl_dquote_varnames], +[_lt_decl_filter([value], [2], $@)]) + + +# lt_decl_varnames_tagged([SEPARATOR], [VARNAME1...]) +# --------------------------------------------------- +m4_define([lt_decl_varnames_tagged], +[m4_assert([$# <= 2])dnl +_$0(m4_quote(m4_default([$1], [[, ]])), + m4_ifval([$2], [[$2]], [m4_dquote(lt_decl_tag_varnames)]), + m4_split(m4_normalize(m4_quote(_LT_TAGS)), [ ]))]) +m4_define([_lt_decl_varnames_tagged], +[m4_ifval([$3], [lt_combine([$1], [$2], [_], $3)])]) + + +# lt_decl_all_varnames([SEPARATOR], [VARNAME1...]) +# ------------------------------------------------ +m4_define([lt_decl_all_varnames], +[_$0(m4_quote(m4_default([$1], [[, ]])), + m4_if([$2], [], + m4_quote(lt_decl_varnames), + m4_quote(m4_shift($@))))[]dnl +]) +m4_define([_lt_decl_all_varnames], +[lt_join($@, lt_decl_varnames_tagged([$1], + lt_decl_tag_varnames([[, ]], m4_shift($@))))dnl +]) + + +# _LT_CONFIG_STATUS_DECLARE([VARNAME]) +# ------------------------------------ +# Quote a variable value, and forward it to `config.status' so that its +# declaration there will have the same value as in `configure'. VARNAME +# must have a single quote delimited value for this to work. +m4_define([_LT_CONFIG_STATUS_DECLARE], +[$1='`$ECHO "$][$1" | $SED "$delay_single_quote_subst"`']) + + +# _LT_CONFIG_STATUS_DECLARATIONS +# ------------------------------ +# We delimit libtool config variables with single quotes, so when +# we write them to config.status, we have to be sure to quote all +# embedded single quotes properly. In configure, this macro expands +# each variable declared with _LT_DECL (and _LT_TAGDECL) into: +# +# ='`$ECHO "$" | $SED "$delay_single_quote_subst"`' +m4_defun([_LT_CONFIG_STATUS_DECLARATIONS], +[m4_foreach([_lt_var], m4_quote(lt_decl_all_varnames), + [m4_n([_LT_CONFIG_STATUS_DECLARE(_lt_var)])])]) + + +# _LT_LIBTOOL_TAGS +# ---------------- +# Output comment and list of tags supported by the script +m4_defun([_LT_LIBTOOL_TAGS], +[_LT_FORMAT_COMMENT([The names of the tagged configurations supported by this script])dnl +available_tags="_LT_TAGS"dnl +]) + + +# _LT_LIBTOOL_DECLARE(VARNAME, [TAG]) +# ----------------------------------- +# Extract the dictionary values for VARNAME (optionally with TAG) and +# expand to a commented shell variable setting: +# +# # Some comment about what VAR is for. +# visible_name=$lt_internal_name +m4_define([_LT_LIBTOOL_DECLARE], +[_LT_FORMAT_COMMENT(m4_quote(lt_dict_fetch([lt_decl_dict], [$1], + [description])))[]dnl +m4_pushdef([_libtool_name], + m4_quote(lt_dict_fetch([lt_decl_dict], [$1], [libtool_name])))[]dnl +m4_case(m4_quote(lt_dict_fetch([lt_decl_dict], [$1], [value])), + [0], [_libtool_name=[$]$1], + [1], [_libtool_name=$lt_[]$1], + [2], [_libtool_name=$lt_[]$1], + [_libtool_name=lt_dict_fetch([lt_decl_dict], [$1], [value])])[]dnl +m4_ifval([$2], [_$2])[]m4_popdef([_libtool_name])[]dnl +]) + + +# _LT_LIBTOOL_CONFIG_VARS +# ----------------------- +# Produce commented declarations of non-tagged libtool config variables +# suitable for insertion in the LIBTOOL CONFIG section of the `libtool' +# script. Tagged libtool config variables (even for the LIBTOOL CONFIG +# section) are produced by _LT_LIBTOOL_TAG_VARS. +m4_defun([_LT_LIBTOOL_CONFIG_VARS], +[m4_foreach([_lt_var], + m4_quote(_lt_decl_filter([tagged?], [no], [], lt_decl_varnames)), + [m4_n([_LT_LIBTOOL_DECLARE(_lt_var)])])]) + + +# _LT_LIBTOOL_TAG_VARS(TAG) +# ------------------------- +m4_define([_LT_LIBTOOL_TAG_VARS], +[m4_foreach([_lt_var], m4_quote(lt_decl_tag_varnames), + [m4_n([_LT_LIBTOOL_DECLARE(_lt_var, [$1])])])]) + + +# _LT_TAGVAR(VARNAME, [TAGNAME]) +# ------------------------------ +m4_define([_LT_TAGVAR], [m4_ifval([$2], [$1_$2], [$1])]) + + +# _LT_CONFIG_COMMANDS +# ------------------- +# Send accumulated output to $CONFIG_STATUS. Thanks to the lists of +# variables for single and double quote escaping we saved from calls +# to _LT_DECL, we can put quote escaped variables declarations +# into `config.status', and then the shell code to quote escape them in +# for loops in `config.status'. Finally, any additional code accumulated +# from calls to _LT_CONFIG_LIBTOOL_INIT is expanded. +m4_defun([_LT_CONFIG_COMMANDS], +[AC_PROVIDE_IFELSE([LT_OUTPUT], + dnl If the libtool generation code has been placed in $CONFIG_LT, + dnl instead of duplicating it all over again into config.status, + dnl then we will have config.status run $CONFIG_LT later, so it + dnl needs to know what name is stored there: + [AC_CONFIG_COMMANDS([libtool], + [$SHELL $CONFIG_LT || AS_EXIT(1)], [CONFIG_LT='$CONFIG_LT'])], + dnl If the libtool generation code is destined for config.status, + dnl expand the accumulated commands and init code now: + [AC_CONFIG_COMMANDS([libtool], + [_LT_OUTPUT_LIBTOOL_COMMANDS], [_LT_OUTPUT_LIBTOOL_COMMANDS_INIT])]) +])#_LT_CONFIG_COMMANDS + + +# Initialize. +m4_define([_LT_OUTPUT_LIBTOOL_COMMANDS_INIT], +[ + +# The HP-UX ksh and POSIX shell print the target directory to stdout +# if CDPATH is set. +(unset CDPATH) >/dev/null 2>&1 && unset CDPATH + +sed_quote_subst='$sed_quote_subst' +double_quote_subst='$double_quote_subst' +delay_variable_subst='$delay_variable_subst' +_LT_CONFIG_STATUS_DECLARATIONS +LTCC='$LTCC' +LTCFLAGS='$LTCFLAGS' +compiler='$compiler_DEFAULT' + +# A function that is used when there is no print builtin or printf. +func_fallback_echo () +{ + eval 'cat <<_LTECHO_EOF +\$[]1 +_LTECHO_EOF' +} + +# Quote evaled strings. +for var in lt_decl_all_varnames([[ \ +]], lt_decl_quote_varnames); do + case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in + *[[\\\\\\\`\\"\\\$]]*) + eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED \\"\\\$sed_quote_subst\\"\\\`\\\\\\"" + ;; + *) + eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\"" + ;; + esac +done + +# Double-quote double-evaled strings. +for var in lt_decl_all_varnames([[ \ +]], lt_decl_dquote_varnames); do + case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in + *[[\\\\\\\`\\"\\\$]]*) + eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED -e \\"\\\$double_quote_subst\\" -e \\"\\\$sed_quote_subst\\" -e \\"\\\$delay_variable_subst\\"\\\`\\\\\\"" + ;; + *) + eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\"" + ;; + esac +done + +_LT_OUTPUT_LIBTOOL_INIT +]) + +# _LT_GENERATED_FILE_INIT(FILE, [COMMENT]) +# ------------------------------------ +# Generate a child script FILE with all initialization necessary to +# reuse the environment learned by the parent script, and make the +# file executable. If COMMENT is supplied, it is inserted after the +# `#!' sequence but before initialization text begins. After this +# macro, additional text can be appended to FILE to form the body of +# the child script. The macro ends with non-zero status if the +# file could not be fully written (such as if the disk is full). +m4_ifdef([AS_INIT_GENERATED], +[m4_defun([_LT_GENERATED_FILE_INIT],[AS_INIT_GENERATED($@)])], +[m4_defun([_LT_GENERATED_FILE_INIT], +[m4_require([AS_PREPARE])]dnl +[m4_pushdef([AS_MESSAGE_LOG_FD])]dnl +[lt_write_fail=0 +cat >$1 <<_ASEOF || lt_write_fail=1 +#! $SHELL +# Generated by $as_me. +$2 +SHELL=\${CONFIG_SHELL-$SHELL} +export SHELL +_ASEOF +cat >>$1 <<\_ASEOF || lt_write_fail=1 +AS_SHELL_SANITIZE +_AS_PREPARE +exec AS_MESSAGE_FD>&1 +_ASEOF +test $lt_write_fail = 0 && chmod +x $1[]dnl +m4_popdef([AS_MESSAGE_LOG_FD])])])# _LT_GENERATED_FILE_INIT + +# LT_OUTPUT +# --------- +# This macro allows early generation of the libtool script (before +# AC_OUTPUT is called), incase it is used in configure for compilation +# tests. +AC_DEFUN([LT_OUTPUT], +[: ${CONFIG_LT=./config.lt} +AC_MSG_NOTICE([creating $CONFIG_LT]) +_LT_GENERATED_FILE_INIT(["$CONFIG_LT"], +[# Run this file to recreate a libtool stub with the current configuration.]) + +cat >>"$CONFIG_LT" <<\_LTEOF +lt_cl_silent=false +exec AS_MESSAGE_LOG_FD>>config.log +{ + echo + AS_BOX([Running $as_me.]) +} >&AS_MESSAGE_LOG_FD + +lt_cl_help="\ +\`$as_me' creates a local libtool stub from the current configuration, +for use in further configure time tests before the real libtool is +generated. + +Usage: $[0] [[OPTIONS]] + + -h, --help print this help, then exit + -V, --version print version number, then exit + -q, --quiet do not print progress messages + -d, --debug don't remove temporary files + +Report bugs to ." + +lt_cl_version="\ +m4_ifset([AC_PACKAGE_NAME], [AC_PACKAGE_NAME ])config.lt[]dnl +m4_ifset([AC_PACKAGE_VERSION], [ AC_PACKAGE_VERSION]) +configured by $[0], generated by m4_PACKAGE_STRING. + +Copyright (C) 2011 Free Software Foundation, Inc. +This config.lt script is free software; the Free Software Foundation +gives unlimited permision to copy, distribute and modify it." + +while test $[#] != 0 +do + case $[1] in + --version | --v* | -V ) + echo "$lt_cl_version"; exit 0 ;; + --help | --h* | -h ) + echo "$lt_cl_help"; exit 0 ;; + --debug | --d* | -d ) + debug=: ;; + --quiet | --q* | --silent | --s* | -q ) + lt_cl_silent=: ;; + + -*) AC_MSG_ERROR([unrecognized option: $[1] +Try \`$[0] --help' for more information.]) ;; + + *) AC_MSG_ERROR([unrecognized argument: $[1] +Try \`$[0] --help' for more information.]) ;; + esac + shift +done + +if $lt_cl_silent; then + exec AS_MESSAGE_FD>/dev/null +fi +_LTEOF + +cat >>"$CONFIG_LT" <<_LTEOF +_LT_OUTPUT_LIBTOOL_COMMANDS_INIT +_LTEOF + +cat >>"$CONFIG_LT" <<\_LTEOF +AC_MSG_NOTICE([creating $ofile]) +_LT_OUTPUT_LIBTOOL_COMMANDS +AS_EXIT(0) +_LTEOF +chmod +x "$CONFIG_LT" + +# configure is writing to config.log, but config.lt does its own redirection, +# appending to config.log, which fails on DOS, as config.log is still kept +# open by configure. Here we exec the FD to /dev/null, effectively closing +# config.log, so it can be properly (re)opened and appended to by config.lt. +lt_cl_success=: +test "$silent" = yes && + lt_config_lt_args="$lt_config_lt_args --quiet" +exec AS_MESSAGE_LOG_FD>/dev/null +$SHELL "$CONFIG_LT" $lt_config_lt_args || lt_cl_success=false +exec AS_MESSAGE_LOG_FD>>config.log +$lt_cl_success || AS_EXIT(1) +])# LT_OUTPUT + + +# _LT_CONFIG(TAG) +# --------------- +# If TAG is the built-in tag, create an initial libtool script with a +# default configuration from the untagged config vars. Otherwise add code +# to config.status for appending the configuration named by TAG from the +# matching tagged config vars. +m4_defun([_LT_CONFIG], +[m4_require([_LT_FILEUTILS_DEFAULTS])dnl +_LT_CONFIG_SAVE_COMMANDS([ + m4_define([_LT_TAG], m4_if([$1], [], [C], [$1]))dnl + m4_if(_LT_TAG, [C], [ + # See if we are running on zsh, and set the options which allow our + # commands through without removal of \ escapes. + if test -n "${ZSH_VERSION+set}" ; then + setopt NO_GLOB_SUBST + fi + + cfgfile="${ofile}T" + trap "$RM \"$cfgfile\"; exit 1" 1 2 15 + $RM "$cfgfile" + + cat <<_LT_EOF >> "$cfgfile" +#! $SHELL + +# `$ECHO "$ofile" | sed 's%^.*/%%'` - Provide generalized library-building support services. +# Generated automatically by $as_me ($PACKAGE$TIMESTAMP) $VERSION +# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`: +# NOTE: Changes made to this file will be lost: look at ltmain.sh. +# +_LT_COPYING +_LT_LIBTOOL_TAGS + +# ### BEGIN LIBTOOL CONFIG +_LT_LIBTOOL_CONFIG_VARS +_LT_LIBTOOL_TAG_VARS +# ### END LIBTOOL CONFIG + +_LT_EOF + + case $host_os in + aix3*) + cat <<\_LT_EOF >> "$cfgfile" +# AIX sometimes has problems with the GCC collect2 program. For some +# reason, if we set the COLLECT_NAMES environment variable, the problems +# vanish in a puff of smoke. +if test "X${COLLECT_NAMES+set}" != Xset; then + COLLECT_NAMES= + export COLLECT_NAMES +fi +_LT_EOF + ;; + esac + + _LT_PROG_LTMAIN + + # We use sed instead of cat because bash on DJGPP gets confused if + # if finds mixed CR/LF and LF-only lines. Since sed operates in + # text mode, it properly converts lines to CR/LF. This bash problem + # is reportedly fixed, but why not run on old versions too? + sed '$q' "$ltmain" >> "$cfgfile" \ + || (rm -f "$cfgfile"; exit 1) + + _LT_PROG_REPLACE_SHELLFNS + + mv -f "$cfgfile" "$ofile" || + (rm -f "$ofile" && cp "$cfgfile" "$ofile" && rm -f "$cfgfile") + chmod +x "$ofile" +], +[cat <<_LT_EOF >> "$ofile" + +dnl Unfortunately we have to use $1 here, since _LT_TAG is not expanded +dnl in a comment (ie after a #). +# ### BEGIN LIBTOOL TAG CONFIG: $1 +_LT_LIBTOOL_TAG_VARS(_LT_TAG) +# ### END LIBTOOL TAG CONFIG: $1 +_LT_EOF +])dnl /m4_if +], +[m4_if([$1], [], [ + PACKAGE='$PACKAGE' + VERSION='$VERSION' + TIMESTAMP='$TIMESTAMP' + RM='$RM' + ofile='$ofile'], []) +])dnl /_LT_CONFIG_SAVE_COMMANDS +])# _LT_CONFIG + + +# LT_SUPPORTED_TAG(TAG) +# --------------------- +# Trace this macro to discover what tags are supported by the libtool +# --tag option, using: +# autoconf --trace 'LT_SUPPORTED_TAG:$1' +AC_DEFUN([LT_SUPPORTED_TAG], []) + + +# C support is built-in for now +m4_define([_LT_LANG_C_enabled], []) +m4_define([_LT_TAGS], []) + + +# LT_LANG(LANG) +# ------------- +# Enable libtool support for the given language if not already enabled. +AC_DEFUN([LT_LANG], +[AC_BEFORE([$0], [LT_OUTPUT])dnl +m4_case([$1], + [C], [_LT_LANG(C)], + [C++], [_LT_LANG(CXX)], + [Go], [_LT_LANG(GO)], + [Java], [_LT_LANG(GCJ)], + [Fortran 77], [_LT_LANG(F77)], + [Fortran], [_LT_LANG(FC)], + [Windows Resource], [_LT_LANG(RC)], + [m4_ifdef([_LT_LANG_]$1[_CONFIG], + [_LT_LANG($1)], + [m4_fatal([$0: unsupported language: "$1"])])])dnl +])# LT_LANG + + +# _LT_LANG(LANGNAME) +# ------------------ +m4_defun([_LT_LANG], +[m4_ifdef([_LT_LANG_]$1[_enabled], [], + [LT_SUPPORTED_TAG([$1])dnl + m4_append([_LT_TAGS], [$1 ])dnl + m4_define([_LT_LANG_]$1[_enabled], [])dnl + _LT_LANG_$1_CONFIG($1)])dnl +])# _LT_LANG + + +m4_ifndef([AC_PROG_GO], [ +############################################################ +# NOTE: This macro has been submitted for inclusion into # +# GNU Autoconf as AC_PROG_GO. When it is available in # +# a released version of Autoconf we should remove this # +# macro and use it instead. # +############################################################ +m4_defun([AC_PROG_GO], +[AC_LANG_PUSH(Go)dnl +AC_ARG_VAR([GOC], [Go compiler command])dnl +AC_ARG_VAR([GOFLAGS], [Go compiler flags])dnl +_AC_ARG_VAR_LDFLAGS()dnl +AC_CHECK_TOOL(GOC, gccgo) +if test -z "$GOC"; then + if test -n "$ac_tool_prefix"; then + AC_CHECK_PROG(GOC, [${ac_tool_prefix}gccgo], [${ac_tool_prefix}gccgo]) + fi +fi +if test -z "$GOC"; then + AC_CHECK_PROG(GOC, gccgo, gccgo, false) +fi +])#m4_defun +])#m4_ifndef + + +# _LT_LANG_DEFAULT_CONFIG +# ----------------------- +m4_defun([_LT_LANG_DEFAULT_CONFIG], +[AC_PROVIDE_IFELSE([AC_PROG_CXX], + [LT_LANG(CXX)], + [m4_define([AC_PROG_CXX], defn([AC_PROG_CXX])[LT_LANG(CXX)])]) + +AC_PROVIDE_IFELSE([AC_PROG_F77], + [LT_LANG(F77)], + [m4_define([AC_PROG_F77], defn([AC_PROG_F77])[LT_LANG(F77)])]) + +AC_PROVIDE_IFELSE([AC_PROG_FC], + [LT_LANG(FC)], + [m4_define([AC_PROG_FC], defn([AC_PROG_FC])[LT_LANG(FC)])]) + +dnl The call to [A][M_PROG_GCJ] is quoted like that to stop aclocal +dnl pulling things in needlessly. +AC_PROVIDE_IFELSE([AC_PROG_GCJ], + [LT_LANG(GCJ)], + [AC_PROVIDE_IFELSE([A][M_PROG_GCJ], + [LT_LANG(GCJ)], + [AC_PROVIDE_IFELSE([LT_PROG_GCJ], + [LT_LANG(GCJ)], + [m4_ifdef([AC_PROG_GCJ], + [m4_define([AC_PROG_GCJ], defn([AC_PROG_GCJ])[LT_LANG(GCJ)])]) + m4_ifdef([A][M_PROG_GCJ], + [m4_define([A][M_PROG_GCJ], defn([A][M_PROG_GCJ])[LT_LANG(GCJ)])]) + m4_ifdef([LT_PROG_GCJ], + [m4_define([LT_PROG_GCJ], defn([LT_PROG_GCJ])[LT_LANG(GCJ)])])])])]) + +AC_PROVIDE_IFELSE([AC_PROG_GO], + [LT_LANG(GO)], + [m4_define([AC_PROG_GO], defn([AC_PROG_GO])[LT_LANG(GO)])]) + +AC_PROVIDE_IFELSE([LT_PROG_RC], + [LT_LANG(RC)], + [m4_define([LT_PROG_RC], defn([LT_PROG_RC])[LT_LANG(RC)])]) +])# _LT_LANG_DEFAULT_CONFIG + +# Obsolete macros: +AU_DEFUN([AC_LIBTOOL_CXX], [LT_LANG(C++)]) +AU_DEFUN([AC_LIBTOOL_F77], [LT_LANG(Fortran 77)]) +AU_DEFUN([AC_LIBTOOL_FC], [LT_LANG(Fortran)]) +AU_DEFUN([AC_LIBTOOL_GCJ], [LT_LANG(Java)]) +AU_DEFUN([AC_LIBTOOL_RC], [LT_LANG(Windows Resource)]) +dnl aclocal-1.4 backwards compatibility: +dnl AC_DEFUN([AC_LIBTOOL_CXX], []) +dnl AC_DEFUN([AC_LIBTOOL_F77], []) +dnl AC_DEFUN([AC_LIBTOOL_FC], []) +dnl AC_DEFUN([AC_LIBTOOL_GCJ], []) +dnl AC_DEFUN([AC_LIBTOOL_RC], []) + + +# _LT_TAG_COMPILER +# ---------------- +m4_defun([_LT_TAG_COMPILER], +[AC_REQUIRE([AC_PROG_CC])dnl + +_LT_DECL([LTCC], [CC], [1], [A C compiler])dnl +_LT_DECL([LTCFLAGS], [CFLAGS], [1], [LTCC compiler flags])dnl +_LT_TAGDECL([CC], [compiler], [1], [A language specific compiler])dnl +_LT_TAGDECL([with_gcc], [GCC], [0], [Is the compiler the GNU compiler?])dnl + +# If no C compiler was specified, use CC. +LTCC=${LTCC-"$CC"} + +# If no C compiler flags were specified, use CFLAGS. +LTCFLAGS=${LTCFLAGS-"$CFLAGS"} + +# Allow CC to be a program name with arguments. +compiler=$CC +])# _LT_TAG_COMPILER + + +# _LT_COMPILER_BOILERPLATE +# ------------------------ +# Check for compiler boilerplate output or warnings with +# the simple compiler test code. +m4_defun([_LT_COMPILER_BOILERPLATE], +[m4_require([_LT_DECL_SED])dnl +ac_outfile=conftest.$ac_objext +echo "$lt_simple_compile_test_code" >conftest.$ac_ext +eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err +_lt_compiler_boilerplate=`cat conftest.err` +$RM conftest* +])# _LT_COMPILER_BOILERPLATE + + +# _LT_LINKER_BOILERPLATE +# ---------------------- +# Check for linker boilerplate output or warnings with +# the simple link test code. +m4_defun([_LT_LINKER_BOILERPLATE], +[m4_require([_LT_DECL_SED])dnl +ac_outfile=conftest.$ac_objext +echo "$lt_simple_link_test_code" >conftest.$ac_ext +eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err +_lt_linker_boilerplate=`cat conftest.err` +$RM -r conftest* +])# _LT_LINKER_BOILERPLATE + +# _LT_REQUIRED_DARWIN_CHECKS +# ------------------------- +m4_defun_once([_LT_REQUIRED_DARWIN_CHECKS],[ + case $host_os in + rhapsody* | darwin*) + AC_CHECK_TOOL([DSYMUTIL], [dsymutil], [:]) + AC_CHECK_TOOL([NMEDIT], [nmedit], [:]) + AC_CHECK_TOOL([LIPO], [lipo], [:]) + AC_CHECK_TOOL([OTOOL], [otool], [:]) + AC_CHECK_TOOL([OTOOL64], [otool64], [:]) + _LT_DECL([], [DSYMUTIL], [1], + [Tool to manipulate archived DWARF debug symbol files on Mac OS X]) + _LT_DECL([], [NMEDIT], [1], + [Tool to change global to local symbols on Mac OS X]) + _LT_DECL([], [LIPO], [1], + [Tool to manipulate fat objects and archives on Mac OS X]) + _LT_DECL([], [OTOOL], [1], + [ldd/readelf like tool for Mach-O binaries on Mac OS X]) + _LT_DECL([], [OTOOL64], [1], + [ldd/readelf like tool for 64 bit Mach-O binaries on Mac OS X 10.4]) + + AC_CACHE_CHECK([for -single_module linker flag],[lt_cv_apple_cc_single_mod], + [lt_cv_apple_cc_single_mod=no + if test -z "${LT_MULTI_MODULE}"; then + # By default we will add the -single_module flag. You can override + # by either setting the environment variable LT_MULTI_MODULE + # non-empty at configure time, or by adding -multi_module to the + # link flags. + rm -rf libconftest.dylib* + echo "int foo(void){return 1;}" > conftest.c + echo "$LTCC $LTCFLAGS $LDFLAGS -o libconftest.dylib \ +-dynamiclib -Wl,-single_module conftest.c" >&AS_MESSAGE_LOG_FD + $LTCC $LTCFLAGS $LDFLAGS -o libconftest.dylib \ + -dynamiclib -Wl,-single_module conftest.c 2>conftest.err + _lt_result=$? + # If there is a non-empty error log, and "single_module" + # appears in it, assume the flag caused a linker warning + if test -s conftest.err && $GREP single_module conftest.err; then + cat conftest.err >&AS_MESSAGE_LOG_FD + # Otherwise, if the output was created with a 0 exit code from + # the compiler, it worked. + elif test -f libconftest.dylib && test $_lt_result -eq 0; then + lt_cv_apple_cc_single_mod=yes + else + cat conftest.err >&AS_MESSAGE_LOG_FD + fi + rm -rf libconftest.dylib* + rm -f conftest.* + fi]) + + AC_CACHE_CHECK([for -exported_symbols_list linker flag], + [lt_cv_ld_exported_symbols_list], + [lt_cv_ld_exported_symbols_list=no + save_LDFLAGS=$LDFLAGS + echo "_main" > conftest.sym + LDFLAGS="$LDFLAGS -Wl,-exported_symbols_list,conftest.sym" + AC_LINK_IFELSE([AC_LANG_PROGRAM([],[])], + [lt_cv_ld_exported_symbols_list=yes], + [lt_cv_ld_exported_symbols_list=no]) + LDFLAGS="$save_LDFLAGS" + ]) + + AC_CACHE_CHECK([for -force_load linker flag],[lt_cv_ld_force_load], + [lt_cv_ld_force_load=no + cat > conftest.c << _LT_EOF +int forced_loaded() { return 2;} +_LT_EOF + echo "$LTCC $LTCFLAGS -c -o conftest.o conftest.c" >&AS_MESSAGE_LOG_FD + $LTCC $LTCFLAGS -c -o conftest.o conftest.c 2>&AS_MESSAGE_LOG_FD + echo "$AR cru libconftest.a conftest.o" >&AS_MESSAGE_LOG_FD + $AR cru libconftest.a conftest.o 2>&AS_MESSAGE_LOG_FD + echo "$RANLIB libconftest.a" >&AS_MESSAGE_LOG_FD + $RANLIB libconftest.a 2>&AS_MESSAGE_LOG_FD + cat > conftest.c << _LT_EOF +int main() { return 0;} +_LT_EOF + echo "$LTCC $LTCFLAGS $LDFLAGS -o conftest conftest.c -Wl,-force_load,./libconftest.a" >&AS_MESSAGE_LOG_FD + $LTCC $LTCFLAGS $LDFLAGS -o conftest conftest.c -Wl,-force_load,./libconftest.a 2>conftest.err + _lt_result=$? + if test -s conftest.err && $GREP force_load conftest.err; then + cat conftest.err >&AS_MESSAGE_LOG_FD + elif test -f conftest && test $_lt_result -eq 0 && $GREP forced_load conftest >/dev/null 2>&1 ; then + lt_cv_ld_force_load=yes + else + cat conftest.err >&AS_MESSAGE_LOG_FD + fi + rm -f conftest.err libconftest.a conftest conftest.c + rm -rf conftest.dSYM + ]) + case $host_os in + rhapsody* | darwin1.[[012]]) + _lt_dar_allow_undefined='${wl}-undefined ${wl}suppress' ;; + darwin1.*) + _lt_dar_allow_undefined='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' ;; + darwin*) # darwin 5.x on + # if running on 10.5 or later, the deployment target defaults + # to the OS version, if on x86, and 10.4, the deployment + # target defaults to 10.4. Don't you love it? + case ${MACOSX_DEPLOYMENT_TARGET-10.0},$host in + 10.0,*86*-darwin8*|10.0,*-darwin[[91]]*) + _lt_dar_allow_undefined='${wl}-undefined ${wl}dynamic_lookup' ;; + 10.[[012]]*) + _lt_dar_allow_undefined='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' ;; + 10.*) + _lt_dar_allow_undefined='${wl}-undefined ${wl}dynamic_lookup' ;; + esac + ;; + esac + if test "$lt_cv_apple_cc_single_mod" = "yes"; then + _lt_dar_single_mod='$single_module' + fi + if test "$lt_cv_ld_exported_symbols_list" = "yes"; then + _lt_dar_export_syms=' ${wl}-exported_symbols_list,$output_objdir/${libname}-symbols.expsym' + else + _lt_dar_export_syms='~$NMEDIT -s $output_objdir/${libname}-symbols.expsym ${lib}' + fi + if test "$DSYMUTIL" != ":" && test "$lt_cv_ld_force_load" = "no"; then + _lt_dsymutil='~$DSYMUTIL $lib || :' + else + _lt_dsymutil= + fi + ;; + esac +]) + + +# _LT_DARWIN_LINKER_FEATURES([TAG]) +# --------------------------------- +# Checks for linker and compiler features on darwin +m4_defun([_LT_DARWIN_LINKER_FEATURES], +[ + m4_require([_LT_REQUIRED_DARWIN_CHECKS]) + _LT_TAGVAR(archive_cmds_need_lc, $1)=no + _LT_TAGVAR(hardcode_direct, $1)=no + _LT_TAGVAR(hardcode_automatic, $1)=yes + _LT_TAGVAR(hardcode_shlibpath_var, $1)=unsupported + if test "$lt_cv_ld_force_load" = "yes"; then + _LT_TAGVAR(whole_archive_flag_spec, $1)='`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience ${wl}-force_load,$conv\"; done; func_echo_all \"$new_convenience\"`' + m4_case([$1], [F77], [_LT_TAGVAR(compiler_needs_object, $1)=yes], + [FC], [_LT_TAGVAR(compiler_needs_object, $1)=yes]) + else + _LT_TAGVAR(whole_archive_flag_spec, $1)='' + fi + _LT_TAGVAR(link_all_deplibs, $1)=yes + _LT_TAGVAR(allow_undefined_flag, $1)="$_lt_dar_allow_undefined" + case $cc_basename in + ifort*) _lt_dar_can_shared=yes ;; + *) _lt_dar_can_shared=$GCC ;; + esac + if test "$_lt_dar_can_shared" = "yes"; then + output_verbose_link_cmd=func_echo_all + _LT_TAGVAR(archive_cmds, $1)="\$CC -dynamiclib \$allow_undefined_flag -o \$lib \$libobjs \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring $_lt_dar_single_mod${_lt_dsymutil}" + _LT_TAGVAR(module_cmds, $1)="\$CC \$allow_undefined_flag -o \$lib -bundle \$libobjs \$deplibs \$compiler_flags${_lt_dsymutil}" + _LT_TAGVAR(archive_expsym_cmds, $1)="sed 's,^,_,' < \$export_symbols > \$output_objdir/\${libname}-symbols.expsym~\$CC -dynamiclib \$allow_undefined_flag -o \$lib \$libobjs \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring ${_lt_dar_single_mod}${_lt_dar_export_syms}${_lt_dsymutil}" + _LT_TAGVAR(module_expsym_cmds, $1)="sed -e 's,^,_,' < \$export_symbols > \$output_objdir/\${libname}-symbols.expsym~\$CC \$allow_undefined_flag -o \$lib -bundle \$libobjs \$deplibs \$compiler_flags${_lt_dar_export_syms}${_lt_dsymutil}" + m4_if([$1], [CXX], +[ if test "$lt_cv_apple_cc_single_mod" != "yes"; then + _LT_TAGVAR(archive_cmds, $1)="\$CC -r -keep_private_externs -nostdlib -o \${lib}-master.o \$libobjs~\$CC -dynamiclib \$allow_undefined_flag -o \$lib \${lib}-master.o \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring${_lt_dsymutil}" + _LT_TAGVAR(archive_expsym_cmds, $1)="sed 's,^,_,' < \$export_symbols > \$output_objdir/\${libname}-symbols.expsym~\$CC -r -keep_private_externs -nostdlib -o \${lib}-master.o \$libobjs~\$CC -dynamiclib \$allow_undefined_flag -o \$lib \${lib}-master.o \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring${_lt_dar_export_syms}${_lt_dsymutil}" + fi +],[]) + else + _LT_TAGVAR(ld_shlibs, $1)=no + fi +]) + +# _LT_SYS_MODULE_PATH_AIX([TAGNAME]) +# ---------------------------------- +# Links a minimal program and checks the executable +# for the system default hardcoded library path. In most cases, +# this is /usr/lib:/lib, but when the MPI compilers are used +# the location of the communication and MPI libs are included too. +# If we don't find anything, use the default library path according +# to the aix ld manual. +# Store the results from the different compilers for each TAGNAME. +# Allow to override them for all tags through lt_cv_aix_libpath. +m4_defun([_LT_SYS_MODULE_PATH_AIX], +[m4_require([_LT_DECL_SED])dnl +if test "${lt_cv_aix_libpath+set}" = set; then + aix_libpath=$lt_cv_aix_libpath +else + AC_CACHE_VAL([_LT_TAGVAR([lt_cv_aix_libpath_], [$1])], + [AC_LINK_IFELSE([AC_LANG_PROGRAM],[ + lt_aix_libpath_sed='[ + /Import File Strings/,/^$/ { + /^0/ { + s/^0 *\([^ ]*\) *$/\1/ + p + } + }]' + _LT_TAGVAR([lt_cv_aix_libpath_], [$1])=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"` + # Check for a 64-bit object if we didn't find anything. + if test -z "$_LT_TAGVAR([lt_cv_aix_libpath_], [$1])"; then + _LT_TAGVAR([lt_cv_aix_libpath_], [$1])=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"` + fi],[]) + if test -z "$_LT_TAGVAR([lt_cv_aix_libpath_], [$1])"; then + _LT_TAGVAR([lt_cv_aix_libpath_], [$1])="/usr/lib:/lib" + fi + ]) + aix_libpath=$_LT_TAGVAR([lt_cv_aix_libpath_], [$1]) +fi +])# _LT_SYS_MODULE_PATH_AIX + + +# _LT_SHELL_INIT(ARG) +# ------------------- +m4_define([_LT_SHELL_INIT], +[m4_divert_text([M4SH-INIT], [$1 +])])# _LT_SHELL_INIT + + + +# _LT_PROG_ECHO_BACKSLASH +# ----------------------- +# Find how we can fake an echo command that does not interpret backslash. +# In particular, with Autoconf 2.60 or later we add some code to the start +# of the generated configure script which will find a shell with a builtin +# printf (which we can use as an echo command). +m4_defun([_LT_PROG_ECHO_BACKSLASH], +[ECHO='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\' +ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO +ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO$ECHO + +AC_MSG_CHECKING([how to print strings]) +# Test print first, because it will be a builtin if present. +if test "X`( print -r -- -n ) 2>/dev/null`" = X-n && \ + test "X`print -r -- $ECHO 2>/dev/null`" = "X$ECHO"; then + ECHO='print -r --' +elif test "X`printf %s $ECHO 2>/dev/null`" = "X$ECHO"; then + ECHO='printf %s\n' +else + # Use this function as a fallback that always works. + func_fallback_echo () + { + eval 'cat <<_LTECHO_EOF +$[]1 +_LTECHO_EOF' + } + ECHO='func_fallback_echo' +fi + +# func_echo_all arg... +# Invoke $ECHO with all args, space-separated. +func_echo_all () +{ + $ECHO "$*" +} + +case "$ECHO" in + printf*) AC_MSG_RESULT([printf]) ;; + print*) AC_MSG_RESULT([print -r]) ;; + *) AC_MSG_RESULT([cat]) ;; +esac + +m4_ifdef([_AS_DETECT_SUGGESTED], +[_AS_DETECT_SUGGESTED([ + test -n "${ZSH_VERSION+set}${BASH_VERSION+set}" || ( + ECHO='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\' + ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO + ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO$ECHO + PATH=/empty FPATH=/empty; export PATH FPATH + test "X`printf %s $ECHO`" = "X$ECHO" \ + || test "X`print -r -- $ECHO`" = "X$ECHO" )])]) + +_LT_DECL([], [SHELL], [1], [Shell to use when invoking shell scripts]) +_LT_DECL([], [ECHO], [1], [An echo program that protects backslashes]) +])# _LT_PROG_ECHO_BACKSLASH + + +# _LT_WITH_SYSROOT +# ---------------- +AC_DEFUN([_LT_WITH_SYSROOT], +[AC_MSG_CHECKING([for sysroot]) +AC_ARG_WITH([sysroot], +[ --with-sysroot[=DIR] Search for dependent libraries within DIR + (or the compiler's sysroot if not specified).], +[], [with_sysroot=no]) + +dnl lt_sysroot will always be passed unquoted. We quote it here +dnl in case the user passed a directory name. +lt_sysroot= +case ${with_sysroot} in #( + yes) + if test "$GCC" = yes; then + lt_sysroot=`$CC --print-sysroot 2>/dev/null` + fi + ;; #( + /*) + lt_sysroot=`echo "$with_sysroot" | sed -e "$sed_quote_subst"` + ;; #( + no|'') + ;; #( + *) + AC_MSG_RESULT([${with_sysroot}]) + AC_MSG_ERROR([The sysroot must be an absolute path.]) + ;; +esac + + AC_MSG_RESULT([${lt_sysroot:-no}]) +_LT_DECL([], [lt_sysroot], [0], [The root where to search for ]dnl +[dependent libraries, and in which our libraries should be installed.])]) + +# _LT_ENABLE_LOCK +# --------------- +m4_defun([_LT_ENABLE_LOCK], +[AC_ARG_ENABLE([libtool-lock], + [AS_HELP_STRING([--disable-libtool-lock], + [avoid locking (might break parallel builds)])]) +test "x$enable_libtool_lock" != xno && enable_libtool_lock=yes + +# Some flags need to be propagated to the compiler or linker for good +# libtool support. +case $host in +ia64-*-hpux*) + # Find out which ABI we are using. + echo 'int i;' > conftest.$ac_ext + if AC_TRY_EVAL(ac_compile); then + case `/usr/bin/file conftest.$ac_objext` in + *ELF-32*) + HPUX_IA64_MODE="32" + ;; + *ELF-64*) + HPUX_IA64_MODE="64" + ;; + esac + fi + rm -rf conftest* + ;; +*-*-irix6*) + # Find out which ABI we are using. + echo '[#]line '$LINENO' "configure"' > conftest.$ac_ext + if AC_TRY_EVAL(ac_compile); then + if test "$lt_cv_prog_gnu_ld" = yes; then + case `/usr/bin/file conftest.$ac_objext` in + *32-bit*) + LD="${LD-ld} -melf32bsmip" + ;; + *N32*) + LD="${LD-ld} -melf32bmipn32" + ;; + *64-bit*) + LD="${LD-ld} -melf64bmip" + ;; + esac + else + case `/usr/bin/file conftest.$ac_objext` in + *32-bit*) + LD="${LD-ld} -32" + ;; + *N32*) + LD="${LD-ld} -n32" + ;; + *64-bit*) + LD="${LD-ld} -64" + ;; + esac + fi + fi + rm -rf conftest* + ;; + +x86_64-*kfreebsd*-gnu|x86_64-*linux*|ppc*-*linux*|powerpc*-*linux*| \ +s390*-*linux*|s390*-*tpf*|sparc*-*linux*) + # Find out which ABI we are using. + echo 'int i;' > conftest.$ac_ext + if AC_TRY_EVAL(ac_compile); then + case `/usr/bin/file conftest.o` in + *32-bit*) + case $host in + x86_64-*kfreebsd*-gnu) + LD="${LD-ld} -m elf_i386_fbsd" + ;; + x86_64-*linux*) + LD="${LD-ld} -m elf_i386" + ;; + ppc64-*linux*|powerpc64-*linux*) + LD="${LD-ld} -m elf32ppclinux" + ;; + s390x-*linux*) + LD="${LD-ld} -m elf_s390" + ;; + sparc64-*linux*) + LD="${LD-ld} -m elf32_sparc" + ;; + esac + ;; + *64-bit*) + case $host in + x86_64-*kfreebsd*-gnu) + LD="${LD-ld} -m elf_x86_64_fbsd" + ;; + x86_64-*linux*) + LD="${LD-ld} -m elf_x86_64" + ;; + ppc*-*linux*|powerpc*-*linux*) + LD="${LD-ld} -m elf64ppc" + ;; + s390*-*linux*|s390*-*tpf*) + LD="${LD-ld} -m elf64_s390" + ;; + sparc*-*linux*) + LD="${LD-ld} -m elf64_sparc" + ;; + esac + ;; + esac + fi + rm -rf conftest* + ;; + +*-*-sco3.2v5*) + # On SCO OpenServer 5, we need -belf to get full-featured binaries. + SAVE_CFLAGS="$CFLAGS" + CFLAGS="$CFLAGS -belf" + AC_CACHE_CHECK([whether the C compiler needs -belf], lt_cv_cc_needs_belf, + [AC_LANG_PUSH(C) + AC_LINK_IFELSE([AC_LANG_PROGRAM([[]],[[]])],[lt_cv_cc_needs_belf=yes],[lt_cv_cc_needs_belf=no]) + AC_LANG_POP]) + if test x"$lt_cv_cc_needs_belf" != x"yes"; then + # this is probably gcc 2.8.0, egcs 1.0 or newer; no need for -belf + CFLAGS="$SAVE_CFLAGS" + fi + ;; +*-*solaris*) + # Find out which ABI we are using. + echo 'int i;' > conftest.$ac_ext + if AC_TRY_EVAL(ac_compile); then + case `/usr/bin/file conftest.o` in + *64-bit*) + case $lt_cv_prog_gnu_ld in + yes*) + case $host in + i?86-*-solaris*) + LD="${LD-ld} -m elf_x86_64" + ;; + sparc*-*-solaris*) + LD="${LD-ld} -m elf64_sparc" + ;; + esac + # GNU ld 2.21 introduced _sol2 emulations. Use them if available. + if ${LD-ld} -V | grep _sol2 >/dev/null 2>&1; then + LD="${LD-ld}_sol2" + fi + ;; + *) + if ${LD-ld} -64 -r -o conftest2.o conftest.o >/dev/null 2>&1; then + LD="${LD-ld} -64" + fi + ;; + esac + ;; + esac + fi + rm -rf conftest* + ;; +esac + +need_locks="$enable_libtool_lock" +])# _LT_ENABLE_LOCK + + +# _LT_PROG_AR +# ----------- +m4_defun([_LT_PROG_AR], +[AC_CHECK_TOOLS(AR, [ar], false) +: ${AR=ar} +: ${AR_FLAGS=cru} +_LT_DECL([], [AR], [1], [The archiver]) +_LT_DECL([], [AR_FLAGS], [1], [Flags to create an archive]) + +AC_CACHE_CHECK([for archiver @FILE support], [lt_cv_ar_at_file], + [lt_cv_ar_at_file=no + AC_COMPILE_IFELSE([AC_LANG_PROGRAM], + [echo conftest.$ac_objext > conftest.lst + lt_ar_try='$AR $AR_FLAGS libconftest.a @conftest.lst >&AS_MESSAGE_LOG_FD' + AC_TRY_EVAL([lt_ar_try]) + if test "$ac_status" -eq 0; then + # Ensure the archiver fails upon bogus file names. + rm -f conftest.$ac_objext libconftest.a + AC_TRY_EVAL([lt_ar_try]) + if test "$ac_status" -ne 0; then + lt_cv_ar_at_file=@ + fi + fi + rm -f conftest.* libconftest.a + ]) + ]) + +if test "x$lt_cv_ar_at_file" = xno; then + archiver_list_spec= +else + archiver_list_spec=$lt_cv_ar_at_file +fi +_LT_DECL([], [archiver_list_spec], [1], + [How to feed a file listing to the archiver]) +])# _LT_PROG_AR + + +# _LT_CMD_OLD_ARCHIVE +# ------------------- +m4_defun([_LT_CMD_OLD_ARCHIVE], +[_LT_PROG_AR + +AC_CHECK_TOOL(STRIP, strip, :) +test -z "$STRIP" && STRIP=: +_LT_DECL([], [STRIP], [1], [A symbol stripping program]) + +AC_CHECK_TOOL(RANLIB, ranlib, :) +test -z "$RANLIB" && RANLIB=: +_LT_DECL([], [RANLIB], [1], + [Commands used to install an old-style archive]) + +# Determine commands to create old-style static archives. +old_archive_cmds='$AR $AR_FLAGS $oldlib$oldobjs' +old_postinstall_cmds='chmod 644 $oldlib' +old_postuninstall_cmds= + +if test -n "$RANLIB"; then + case $host_os in + openbsd*) + old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB -t \$tool_oldlib" + ;; + *) + old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB \$tool_oldlib" + ;; + esac + old_archive_cmds="$old_archive_cmds~\$RANLIB \$tool_oldlib" +fi + +case $host_os in + darwin*) + lock_old_archive_extraction=yes ;; + *) + lock_old_archive_extraction=no ;; +esac +_LT_DECL([], [old_postinstall_cmds], [2]) +_LT_DECL([], [old_postuninstall_cmds], [2]) +_LT_TAGDECL([], [old_archive_cmds], [2], + [Commands used to build an old-style archive]) +_LT_DECL([], [lock_old_archive_extraction], [0], + [Whether to use a lock for old archive extraction]) +])# _LT_CMD_OLD_ARCHIVE + + +# _LT_COMPILER_OPTION(MESSAGE, VARIABLE-NAME, FLAGS, +# [OUTPUT-FILE], [ACTION-SUCCESS], [ACTION-FAILURE]) +# ---------------------------------------------------------------- +# Check whether the given compiler option works +AC_DEFUN([_LT_COMPILER_OPTION], +[m4_require([_LT_FILEUTILS_DEFAULTS])dnl +m4_require([_LT_DECL_SED])dnl +AC_CACHE_CHECK([$1], [$2], + [$2=no + m4_if([$4], , [ac_outfile=conftest.$ac_objext], [ac_outfile=$4]) + echo "$lt_simple_compile_test_code" > conftest.$ac_ext + lt_compiler_flag="$3" + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + # The option is referenced via a variable to avoid confusing sed. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [[^ ]]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&AS_MESSAGE_LOG_FD) + (eval "$lt_compile" 2>conftest.err) + ac_status=$? + cat conftest.err >&AS_MESSAGE_LOG_FD + echo "$as_me:$LINENO: \$? = $ac_status" >&AS_MESSAGE_LOG_FD + if (exit $ac_status) && test -s "$ac_outfile"; then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings other than the usual output. + $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' >conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then + $2=yes + fi + fi + $RM conftest* +]) + +if test x"[$]$2" = xyes; then + m4_if([$5], , :, [$5]) +else + m4_if([$6], , :, [$6]) +fi +])# _LT_COMPILER_OPTION + +# Old name: +AU_ALIAS([AC_LIBTOOL_COMPILER_OPTION], [_LT_COMPILER_OPTION]) +dnl aclocal-1.4 backwards compatibility: +dnl AC_DEFUN([AC_LIBTOOL_COMPILER_OPTION], []) + + +# _LT_LINKER_OPTION(MESSAGE, VARIABLE-NAME, FLAGS, +# [ACTION-SUCCESS], [ACTION-FAILURE]) +# ---------------------------------------------------- +# Check whether the given linker option works +AC_DEFUN([_LT_LINKER_OPTION], +[m4_require([_LT_FILEUTILS_DEFAULTS])dnl +m4_require([_LT_DECL_SED])dnl +AC_CACHE_CHECK([$1], [$2], + [$2=no + save_LDFLAGS="$LDFLAGS" + LDFLAGS="$LDFLAGS $3" + echo "$lt_simple_link_test_code" > conftest.$ac_ext + if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then + # The linker can only warn and ignore the option if not recognized + # So say no if there are warnings + if test -s conftest.err; then + # Append any errors to the config.log. + cat conftest.err 1>&AS_MESSAGE_LOG_FD + $ECHO "$_lt_linker_boilerplate" | $SED '/^$/d' > conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if diff conftest.exp conftest.er2 >/dev/null; then + $2=yes + fi + else + $2=yes + fi + fi + $RM -r conftest* + LDFLAGS="$save_LDFLAGS" +]) + +if test x"[$]$2" = xyes; then + m4_if([$4], , :, [$4]) +else + m4_if([$5], , :, [$5]) +fi +])# _LT_LINKER_OPTION + +# Old name: +AU_ALIAS([AC_LIBTOOL_LINKER_OPTION], [_LT_LINKER_OPTION]) +dnl aclocal-1.4 backwards compatibility: +dnl AC_DEFUN([AC_LIBTOOL_LINKER_OPTION], []) + + +# LT_CMD_MAX_LEN +#--------------- +AC_DEFUN([LT_CMD_MAX_LEN], +[AC_REQUIRE([AC_CANONICAL_HOST])dnl +# find the maximum length of command line arguments +AC_MSG_CHECKING([the maximum length of command line arguments]) +AC_CACHE_VAL([lt_cv_sys_max_cmd_len], [dnl + i=0 + teststring="ABCD" + + case $build_os in + msdosdjgpp*) + # On DJGPP, this test can blow up pretty badly due to problems in libc + # (any single argument exceeding 2000 bytes causes a buffer overrun + # during glob expansion). Even if it were fixed, the result of this + # check would be larger than it should be. + lt_cv_sys_max_cmd_len=12288; # 12K is about right + ;; + + gnu*) + # Under GNU Hurd, this test is not required because there is + # no limit to the length of command line arguments. + # Libtool will interpret -1 as no limit whatsoever + lt_cv_sys_max_cmd_len=-1; + ;; + + cygwin* | mingw* | cegcc*) + # On Win9x/ME, this test blows up -- it succeeds, but takes + # about 5 minutes as the teststring grows exponentially. + # Worse, since 9x/ME are not pre-emptively multitasking, + # you end up with a "frozen" computer, even though with patience + # the test eventually succeeds (with a max line length of 256k). + # Instead, let's just punt: use the minimum linelength reported by + # all of the supported platforms: 8192 (on NT/2K/XP). + lt_cv_sys_max_cmd_len=8192; + ;; + + mint*) + # On MiNT this can take a long time and run out of memory. + lt_cv_sys_max_cmd_len=8192; + ;; + + amigaos*) + # On AmigaOS with pdksh, this test takes hours, literally. + # So we just punt and use a minimum line length of 8192. + lt_cv_sys_max_cmd_len=8192; + ;; + + netbsd* | freebsd* | openbsd* | darwin* | dragonfly*) + # This has been around since 386BSD, at least. Likely further. + if test -x /sbin/sysctl; then + lt_cv_sys_max_cmd_len=`/sbin/sysctl -n kern.argmax` + elif test -x /usr/sbin/sysctl; then + lt_cv_sys_max_cmd_len=`/usr/sbin/sysctl -n kern.argmax` + else + lt_cv_sys_max_cmd_len=65536 # usable default for all BSDs + fi + # And add a safety zone + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4` + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3` + ;; + + interix*) + # We know the value 262144 and hardcode it with a safety zone (like BSD) + lt_cv_sys_max_cmd_len=196608 + ;; + + os2*) + # The test takes a long time on OS/2. + lt_cv_sys_max_cmd_len=8192 + ;; + + osf*) + # Dr. Hans Ekkehard Plesser reports seeing a kernel panic running configure + # due to this test when exec_disable_arg_limit is 1 on Tru64. It is not + # nice to cause kernel panics so lets avoid the loop below. + # First set a reasonable default. + lt_cv_sys_max_cmd_len=16384 + # + if test -x /sbin/sysconfig; then + case `/sbin/sysconfig -q proc exec_disable_arg_limit` in + *1*) lt_cv_sys_max_cmd_len=-1 ;; + esac + fi + ;; + sco3.2v5*) + lt_cv_sys_max_cmd_len=102400 + ;; + sysv5* | sco5v6* | sysv4.2uw2*) + kargmax=`grep ARG_MAX /etc/conf/cf.d/stune 2>/dev/null` + if test -n "$kargmax"; then + lt_cv_sys_max_cmd_len=`echo $kargmax | sed 's/.*[[ ]]//'` + else + lt_cv_sys_max_cmd_len=32768 + fi + ;; + *) + lt_cv_sys_max_cmd_len=`(getconf ARG_MAX) 2> /dev/null` + if test -n "$lt_cv_sys_max_cmd_len"; then + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4` + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3` + else + # Make teststring a little bigger before we do anything with it. + # a 1K string should be a reasonable start. + for i in 1 2 3 4 5 6 7 8 ; do + teststring=$teststring$teststring + done + SHELL=${SHELL-${CONFIG_SHELL-/bin/sh}} + # If test is not a shell built-in, we'll probably end up computing a + # maximum length that is only half of the actual maximum length, but + # we can't tell. + while { test "X"`env echo "$teststring$teststring" 2>/dev/null` \ + = "X$teststring$teststring"; } >/dev/null 2>&1 && + test $i != 17 # 1/2 MB should be enough + do + i=`expr $i + 1` + teststring=$teststring$teststring + done + # Only check the string length outside the loop. + lt_cv_sys_max_cmd_len=`expr "X$teststring" : ".*" 2>&1` + teststring= + # Add a significant safety factor because C++ compilers can tack on + # massive amounts of additional arguments before passing them to the + # linker. It appears as though 1/2 is a usable value. + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 2` + fi + ;; + esac +]) +if test -n $lt_cv_sys_max_cmd_len ; then + AC_MSG_RESULT($lt_cv_sys_max_cmd_len) +else + AC_MSG_RESULT(none) +fi +max_cmd_len=$lt_cv_sys_max_cmd_len +_LT_DECL([], [max_cmd_len], [0], + [What is the maximum length of a command?]) +])# LT_CMD_MAX_LEN + +# Old name: +AU_ALIAS([AC_LIBTOOL_SYS_MAX_CMD_LEN], [LT_CMD_MAX_LEN]) +dnl aclocal-1.4 backwards compatibility: +dnl AC_DEFUN([AC_LIBTOOL_SYS_MAX_CMD_LEN], []) + + +# _LT_HEADER_DLFCN +# ---------------- +m4_defun([_LT_HEADER_DLFCN], +[AC_CHECK_HEADERS([dlfcn.h], [], [], [AC_INCLUDES_DEFAULT])dnl +])# _LT_HEADER_DLFCN + + +# _LT_TRY_DLOPEN_SELF (ACTION-IF-TRUE, ACTION-IF-TRUE-W-USCORE, +# ACTION-IF-FALSE, ACTION-IF-CROSS-COMPILING) +# ---------------------------------------------------------------- +m4_defun([_LT_TRY_DLOPEN_SELF], +[m4_require([_LT_HEADER_DLFCN])dnl +if test "$cross_compiling" = yes; then : + [$4] +else + lt_dlunknown=0; lt_dlno_uscore=1; lt_dlneed_uscore=2 + lt_status=$lt_dlunknown + cat > conftest.$ac_ext <<_LT_EOF +[#line $LINENO "configure" +#include "confdefs.h" + +#if HAVE_DLFCN_H +#include +#endif + +#include + +#ifdef RTLD_GLOBAL +# define LT_DLGLOBAL RTLD_GLOBAL +#else +# ifdef DL_GLOBAL +# define LT_DLGLOBAL DL_GLOBAL +# else +# define LT_DLGLOBAL 0 +# endif +#endif + +/* We may have to define LT_DLLAZY_OR_NOW in the command line if we + find out it does not work in some platform. */ +#ifndef LT_DLLAZY_OR_NOW +# ifdef RTLD_LAZY +# define LT_DLLAZY_OR_NOW RTLD_LAZY +# else +# ifdef DL_LAZY +# define LT_DLLAZY_OR_NOW DL_LAZY +# else +# ifdef RTLD_NOW +# define LT_DLLAZY_OR_NOW RTLD_NOW +# else +# ifdef DL_NOW +# define LT_DLLAZY_OR_NOW DL_NOW +# else +# define LT_DLLAZY_OR_NOW 0 +# endif +# endif +# endif +# endif +#endif + +/* When -fvisbility=hidden is used, assume the code has been annotated + correspondingly for the symbols needed. */ +#if defined(__GNUC__) && (((__GNUC__ == 3) && (__GNUC_MINOR__ >= 3)) || (__GNUC__ > 3)) +int fnord () __attribute__((visibility("default"))); +#endif + +int fnord () { return 42; } +int main () +{ + void *self = dlopen (0, LT_DLGLOBAL|LT_DLLAZY_OR_NOW); + int status = $lt_dlunknown; + + if (self) + { + if (dlsym (self,"fnord")) status = $lt_dlno_uscore; + else + { + if (dlsym( self,"_fnord")) status = $lt_dlneed_uscore; + else puts (dlerror ()); + } + /* dlclose (self); */ + } + else + puts (dlerror ()); + + return status; +}] +_LT_EOF + if AC_TRY_EVAL(ac_link) && test -s conftest${ac_exeext} 2>/dev/null; then + (./conftest; exit; ) >&AS_MESSAGE_LOG_FD 2>/dev/null + lt_status=$? + case x$lt_status in + x$lt_dlno_uscore) $1 ;; + x$lt_dlneed_uscore) $2 ;; + x$lt_dlunknown|x*) $3 ;; + esac + else : + # compilation failed + $3 + fi +fi +rm -fr conftest* +])# _LT_TRY_DLOPEN_SELF + + +# LT_SYS_DLOPEN_SELF +# ------------------ +AC_DEFUN([LT_SYS_DLOPEN_SELF], +[m4_require([_LT_HEADER_DLFCN])dnl +if test "x$enable_dlopen" != xyes; then + enable_dlopen=unknown + enable_dlopen_self=unknown + enable_dlopen_self_static=unknown +else + lt_cv_dlopen=no + lt_cv_dlopen_libs= + + case $host_os in + beos*) + lt_cv_dlopen="load_add_on" + lt_cv_dlopen_libs= + lt_cv_dlopen_self=yes + ;; + + mingw* | pw32* | cegcc*) + lt_cv_dlopen="LoadLibrary" + lt_cv_dlopen_libs= + ;; + + cygwin*) + lt_cv_dlopen="dlopen" + lt_cv_dlopen_libs= + ;; + + darwin*) + # if libdl is installed we need to link against it + AC_CHECK_LIB([dl], [dlopen], + [lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-ldl"],[ + lt_cv_dlopen="dyld" + lt_cv_dlopen_libs= + lt_cv_dlopen_self=yes + ]) + ;; + + *) + AC_CHECK_FUNC([shl_load], + [lt_cv_dlopen="shl_load"], + [AC_CHECK_LIB([dld], [shl_load], + [lt_cv_dlopen="shl_load" lt_cv_dlopen_libs="-ldld"], + [AC_CHECK_FUNC([dlopen], + [lt_cv_dlopen="dlopen"], + [AC_CHECK_LIB([dl], [dlopen], + [lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-ldl"], + [AC_CHECK_LIB([svld], [dlopen], + [lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-lsvld"], + [AC_CHECK_LIB([dld], [dld_link], + [lt_cv_dlopen="dld_link" lt_cv_dlopen_libs="-ldld"]) + ]) + ]) + ]) + ]) + ]) + ;; + esac + + if test "x$lt_cv_dlopen" != xno; then + enable_dlopen=yes + else + enable_dlopen=no + fi + + case $lt_cv_dlopen in + dlopen) + save_CPPFLAGS="$CPPFLAGS" + test "x$ac_cv_header_dlfcn_h" = xyes && CPPFLAGS="$CPPFLAGS -DHAVE_DLFCN_H" + + save_LDFLAGS="$LDFLAGS" + wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $export_dynamic_flag_spec\" + + save_LIBS="$LIBS" + LIBS="$lt_cv_dlopen_libs $LIBS" + + AC_CACHE_CHECK([whether a program can dlopen itself], + lt_cv_dlopen_self, [dnl + _LT_TRY_DLOPEN_SELF( + lt_cv_dlopen_self=yes, lt_cv_dlopen_self=yes, + lt_cv_dlopen_self=no, lt_cv_dlopen_self=cross) + ]) + + if test "x$lt_cv_dlopen_self" = xyes; then + wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $lt_prog_compiler_static\" + AC_CACHE_CHECK([whether a statically linked program can dlopen itself], + lt_cv_dlopen_self_static, [dnl + _LT_TRY_DLOPEN_SELF( + lt_cv_dlopen_self_static=yes, lt_cv_dlopen_self_static=yes, + lt_cv_dlopen_self_static=no, lt_cv_dlopen_self_static=cross) + ]) + fi + + CPPFLAGS="$save_CPPFLAGS" + LDFLAGS="$save_LDFLAGS" + LIBS="$save_LIBS" + ;; + esac + + case $lt_cv_dlopen_self in + yes|no) enable_dlopen_self=$lt_cv_dlopen_self ;; + *) enable_dlopen_self=unknown ;; + esac + + case $lt_cv_dlopen_self_static in + yes|no) enable_dlopen_self_static=$lt_cv_dlopen_self_static ;; + *) enable_dlopen_self_static=unknown ;; + esac +fi +_LT_DECL([dlopen_support], [enable_dlopen], [0], + [Whether dlopen is supported]) +_LT_DECL([dlopen_self], [enable_dlopen_self], [0], + [Whether dlopen of programs is supported]) +_LT_DECL([dlopen_self_static], [enable_dlopen_self_static], [0], + [Whether dlopen of statically linked programs is supported]) +])# LT_SYS_DLOPEN_SELF + +# Old name: +AU_ALIAS([AC_LIBTOOL_DLOPEN_SELF], [LT_SYS_DLOPEN_SELF]) +dnl aclocal-1.4 backwards compatibility: +dnl AC_DEFUN([AC_LIBTOOL_DLOPEN_SELF], []) + + +# _LT_COMPILER_C_O([TAGNAME]) +# --------------------------- +# Check to see if options -c and -o are simultaneously supported by compiler. +# This macro does not hard code the compiler like AC_PROG_CC_C_O. +m4_defun([_LT_COMPILER_C_O], +[m4_require([_LT_DECL_SED])dnl +m4_require([_LT_FILEUTILS_DEFAULTS])dnl +m4_require([_LT_TAG_COMPILER])dnl +AC_CACHE_CHECK([if $compiler supports -c -o file.$ac_objext], + [_LT_TAGVAR(lt_cv_prog_compiler_c_o, $1)], + [_LT_TAGVAR(lt_cv_prog_compiler_c_o, $1)=no + $RM -r conftest 2>/dev/null + mkdir conftest + cd conftest + mkdir out + echo "$lt_simple_compile_test_code" > conftest.$ac_ext + + lt_compiler_flag="-o out/conftest2.$ac_objext" + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [[^ ]]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&AS_MESSAGE_LOG_FD) + (eval "$lt_compile" 2>out/conftest.err) + ac_status=$? + cat out/conftest.err >&AS_MESSAGE_LOG_FD + echo "$as_me:$LINENO: \$? = $ac_status" >&AS_MESSAGE_LOG_FD + if (exit $ac_status) && test -s out/conftest2.$ac_objext + then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings + $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' > out/conftest.exp + $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2 + if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then + _LT_TAGVAR(lt_cv_prog_compiler_c_o, $1)=yes + fi + fi + chmod u+w . 2>&AS_MESSAGE_LOG_FD + $RM conftest* + # SGI C++ compiler will create directory out/ii_files/ for + # template instantiation + test -d out/ii_files && $RM out/ii_files/* && rmdir out/ii_files + $RM out/* && rmdir out + cd .. + $RM -r conftest + $RM conftest* +]) +_LT_TAGDECL([compiler_c_o], [lt_cv_prog_compiler_c_o], [1], + [Does compiler simultaneously support -c and -o options?]) +])# _LT_COMPILER_C_O + + +# _LT_COMPILER_FILE_LOCKS([TAGNAME]) +# ---------------------------------- +# Check to see if we can do hard links to lock some files if needed +m4_defun([_LT_COMPILER_FILE_LOCKS], +[m4_require([_LT_ENABLE_LOCK])dnl +m4_require([_LT_FILEUTILS_DEFAULTS])dnl +_LT_COMPILER_C_O([$1]) + +hard_links="nottested" +if test "$_LT_TAGVAR(lt_cv_prog_compiler_c_o, $1)" = no && test "$need_locks" != no; then + # do not overwrite the value of need_locks provided by the user + AC_MSG_CHECKING([if we can lock with hard links]) + hard_links=yes + $RM conftest* + ln conftest.a conftest.b 2>/dev/null && hard_links=no + touch conftest.a + ln conftest.a conftest.b 2>&5 || hard_links=no + ln conftest.a conftest.b 2>/dev/null && hard_links=no + AC_MSG_RESULT([$hard_links]) + if test "$hard_links" = no; then + AC_MSG_WARN([`$CC' does not support `-c -o', so `make -j' may be unsafe]) + need_locks=warn + fi +else + need_locks=no +fi +_LT_DECL([], [need_locks], [1], [Must we lock files when doing compilation?]) +])# _LT_COMPILER_FILE_LOCKS + + +# _LT_CHECK_OBJDIR +# ---------------- +m4_defun([_LT_CHECK_OBJDIR], +[AC_CACHE_CHECK([for objdir], [lt_cv_objdir], +[rm -f .libs 2>/dev/null +mkdir .libs 2>/dev/null +if test -d .libs; then + lt_cv_objdir=.libs +else + # MS-DOS does not allow filenames that begin with a dot. + lt_cv_objdir=_libs +fi +rmdir .libs 2>/dev/null]) +objdir=$lt_cv_objdir +_LT_DECL([], [objdir], [0], + [The name of the directory that contains temporary libtool files])dnl +m4_pattern_allow([LT_OBJDIR])dnl +AC_DEFINE_UNQUOTED(LT_OBJDIR, "$lt_cv_objdir/", + [Define to the sub-directory in which libtool stores uninstalled libraries.]) +])# _LT_CHECK_OBJDIR + + +# _LT_LINKER_HARDCODE_LIBPATH([TAGNAME]) +# -------------------------------------- +# Check hardcoding attributes. +m4_defun([_LT_LINKER_HARDCODE_LIBPATH], +[AC_MSG_CHECKING([how to hardcode library paths into programs]) +_LT_TAGVAR(hardcode_action, $1)= +if test -n "$_LT_TAGVAR(hardcode_libdir_flag_spec, $1)" || + test -n "$_LT_TAGVAR(runpath_var, $1)" || + test "X$_LT_TAGVAR(hardcode_automatic, $1)" = "Xyes" ; then + + # We can hardcode non-existent directories. + if test "$_LT_TAGVAR(hardcode_direct, $1)" != no && + # If the only mechanism to avoid hardcoding is shlibpath_var, we + # have to relink, otherwise we might link with an installed library + # when we should be linking with a yet-to-be-installed one + ## test "$_LT_TAGVAR(hardcode_shlibpath_var, $1)" != no && + test "$_LT_TAGVAR(hardcode_minus_L, $1)" != no; then + # Linking always hardcodes the temporary library directory. + _LT_TAGVAR(hardcode_action, $1)=relink + else + # We can link without hardcoding, and we can hardcode nonexisting dirs. + _LT_TAGVAR(hardcode_action, $1)=immediate + fi +else + # We cannot hardcode anything, or else we can only hardcode existing + # directories. + _LT_TAGVAR(hardcode_action, $1)=unsupported +fi +AC_MSG_RESULT([$_LT_TAGVAR(hardcode_action, $1)]) + +if test "$_LT_TAGVAR(hardcode_action, $1)" = relink || + test "$_LT_TAGVAR(inherit_rpath, $1)" = yes; then + # Fast installation is not supported + enable_fast_install=no +elif test "$shlibpath_overrides_runpath" = yes || + test "$enable_shared" = no; then + # Fast installation is not necessary + enable_fast_install=needless +fi +_LT_TAGDECL([], [hardcode_action], [0], + [How to hardcode a shared library path into an executable]) +])# _LT_LINKER_HARDCODE_LIBPATH + + +# _LT_CMD_STRIPLIB +# ---------------- +m4_defun([_LT_CMD_STRIPLIB], +[m4_require([_LT_DECL_EGREP]) +striplib= +old_striplib= +AC_MSG_CHECKING([whether stripping libraries is possible]) +if test -n "$STRIP" && $STRIP -V 2>&1 | $GREP "GNU strip" >/dev/null; then + test -z "$old_striplib" && old_striplib="$STRIP --strip-debug" + test -z "$striplib" && striplib="$STRIP --strip-unneeded" + AC_MSG_RESULT([yes]) +else +# FIXME - insert some real tests, host_os isn't really good enough + case $host_os in + darwin*) + if test -n "$STRIP" ; then + striplib="$STRIP -x" + old_striplib="$STRIP -S" + AC_MSG_RESULT([yes]) + else + AC_MSG_RESULT([no]) + fi + ;; + *) + AC_MSG_RESULT([no]) + ;; + esac +fi +_LT_DECL([], [old_striplib], [1], [Commands to strip libraries]) +_LT_DECL([], [striplib], [1]) +])# _LT_CMD_STRIPLIB + + +# _LT_SYS_DYNAMIC_LINKER([TAG]) +# ----------------------------- +# PORTME Fill in your ld.so characteristics +m4_defun([_LT_SYS_DYNAMIC_LINKER], +[AC_REQUIRE([AC_CANONICAL_HOST])dnl +m4_require([_LT_DECL_EGREP])dnl +m4_require([_LT_FILEUTILS_DEFAULTS])dnl +m4_require([_LT_DECL_OBJDUMP])dnl +m4_require([_LT_DECL_SED])dnl +m4_require([_LT_CHECK_SHELL_FEATURES])dnl +AC_MSG_CHECKING([dynamic linker characteristics]) +m4_if([$1], + [], [ +if test "$GCC" = yes; then + case $host_os in + darwin*) lt_awk_arg="/^libraries:/,/LR/" ;; + *) lt_awk_arg="/^libraries:/" ;; + esac + case $host_os in + mingw* | cegcc*) lt_sed_strip_eq="s,=\([[A-Za-z]]:\),\1,g" ;; + *) lt_sed_strip_eq="s,=/,/,g" ;; + esac + lt_search_path_spec=`$CC -print-search-dirs | awk $lt_awk_arg | $SED -e "s/^libraries://" -e $lt_sed_strip_eq` + case $lt_search_path_spec in + *\;*) + # if the path contains ";" then we assume it to be the separator + # otherwise default to the standard path separator (i.e. ":") - it is + # assumed that no part of a normal pathname contains ";" but that should + # okay in the real world where ";" in dirpaths is itself problematic. + lt_search_path_spec=`$ECHO "$lt_search_path_spec" | $SED 's/;/ /g'` + ;; + *) + lt_search_path_spec=`$ECHO "$lt_search_path_spec" | $SED "s/$PATH_SEPARATOR/ /g"` + ;; + esac + # Ok, now we have the path, separated by spaces, we can step through it + # and add multilib dir if necessary. + lt_tmp_lt_search_path_spec= + lt_multi_os_dir=`$CC $CPPFLAGS $CFLAGS $LDFLAGS -print-multi-os-directory 2>/dev/null` + for lt_sys_path in $lt_search_path_spec; do + if test -d "$lt_sys_path/$lt_multi_os_dir"; then + lt_tmp_lt_search_path_spec="$lt_tmp_lt_search_path_spec $lt_sys_path/$lt_multi_os_dir" + else + test -d "$lt_sys_path" && \ + lt_tmp_lt_search_path_spec="$lt_tmp_lt_search_path_spec $lt_sys_path" + fi + done + lt_search_path_spec=`$ECHO "$lt_tmp_lt_search_path_spec" | awk ' +BEGIN {RS=" "; FS="/|\n";} { + lt_foo=""; + lt_count=0; + for (lt_i = NF; lt_i > 0; lt_i--) { + if ($lt_i != "" && $lt_i != ".") { + if ($lt_i == "..") { + lt_count++; + } else { + if (lt_count == 0) { + lt_foo="/" $lt_i lt_foo; + } else { + lt_count--; + } + } + } + } + if (lt_foo != "") { lt_freq[[lt_foo]]++; } + if (lt_freq[[lt_foo]] == 1) { print lt_foo; } +}'` + # AWK program above erroneously prepends '/' to C:/dos/paths + # for these hosts. + case $host_os in + mingw* | cegcc*) lt_search_path_spec=`$ECHO "$lt_search_path_spec" |\ + $SED 's,/\([[A-Za-z]]:\),\1,g'` ;; + esac + sys_lib_search_path_spec=`$ECHO "$lt_search_path_spec" | $lt_NL2SP` +else + sys_lib_search_path_spec="/lib /usr/lib /usr/local/lib" +fi]) +library_names_spec= +libname_spec='lib$name' +soname_spec= +shrext_cmds=".so" +postinstall_cmds= +postuninstall_cmds= +finish_cmds= +finish_eval= +shlibpath_var= +shlibpath_overrides_runpath=unknown +version_type=none +dynamic_linker="$host_os ld.so" +sys_lib_dlsearch_path_spec="/lib /usr/lib" +need_lib_prefix=unknown +hardcode_into_libs=no + +# when you set need_version to no, make sure it does not cause -set_version +# flags to be left without arguments +need_version=unknown + +case $host_os in +aix3*) + version_type=linux # correct to gnu/linux during the next big refactor + library_names_spec='${libname}${release}${shared_ext}$versuffix $libname.a' + shlibpath_var=LIBPATH + + # AIX 3 has no versioning support, so we append a major version to the name. + soname_spec='${libname}${release}${shared_ext}$major' + ;; + +aix[[4-9]]*) + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + hardcode_into_libs=yes + if test "$host_cpu" = ia64; then + # AIX 5 supports IA64 + library_names_spec='${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext}$versuffix $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + else + # With GCC up to 2.95.x, collect2 would create an import file + # for dependence libraries. The import file would start with + # the line `#! .'. This would cause the generated library to + # depend on `.', always an invalid library. This was fixed in + # development snapshots of GCC prior to 3.0. + case $host_os in + aix4 | aix4.[[01]] | aix4.[[01]].*) + if { echo '#if __GNUC__ > 2 || (__GNUC__ == 2 && __GNUC_MINOR__ >= 97)' + echo ' yes ' + echo '#endif'; } | ${CC} -E - | $GREP yes > /dev/null; then + : + else + can_build_shared=no + fi + ;; + esac + # AIX (on Power*) has no versioning support, so currently we can not hardcode correct + # soname into executable. Probably we can add versioning support to + # collect2, so additional links can be useful in future. + if test "$aix_use_runtimelinking" = yes; then + # If using run time linking (on AIX 4.2 or later) use lib.so + # instead of lib.a to let people know that these are not + # typical AIX shared libraries. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + else + # We preserve .a as extension for shared libraries through AIX4.2 + # and later when we are not doing run time linking. + library_names_spec='${libname}${release}.a $libname.a' + soname_spec='${libname}${release}${shared_ext}$major' + fi + shlibpath_var=LIBPATH + fi + ;; + +amigaos*) + case $host_cpu in + powerpc) + # Since July 2007 AmigaOS4 officially supports .so libraries. + # When compiling the executable, add -use-dynld -Lsobjs: to the compileline. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + ;; + m68k) + library_names_spec='$libname.ixlibrary $libname.a' + # Create ${libname}_ixlibrary.a entries in /sys/libs. + finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`func_echo_all "$lib" | $SED '\''s%^.*/\([[^/]]*\)\.ixlibrary$%\1%'\''`; test $RM /sys/libs/${libname}_ixlibrary.a; $show "cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a"; cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a || exit 1; done' + ;; + esac + ;; + +beos*) + library_names_spec='${libname}${shared_ext}' + dynamic_linker="$host_os ld.so" + shlibpath_var=LIBRARY_PATH + ;; + +bsdi[[45]]*) + version_type=linux # correct to gnu/linux during the next big refactor + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + finish_cmds='PATH="\$PATH:/sbin" ldconfig $libdir' + shlibpath_var=LD_LIBRARY_PATH + sys_lib_search_path_spec="/shlib /usr/lib /usr/X11/lib /usr/contrib/lib /lib /usr/local/lib" + sys_lib_dlsearch_path_spec="/shlib /usr/lib /usr/local/lib" + # the default ld.so.conf also contains /usr/contrib/lib and + # /usr/X11R6/lib (/usr/X11 is a link to /usr/X11R6), but let us allow + # libtool to hard-code these into programs + ;; + +cygwin* | mingw* | pw32* | cegcc*) + version_type=windows + shrext_cmds=".dll" + need_version=no + need_lib_prefix=no + + case $GCC,$cc_basename in + yes,*) + # gcc + library_names_spec='$libname.dll.a' + # DLL is installed to $(libdir)/../bin by postinstall_cmds + postinstall_cmds='base_file=`basename \${file}`~ + dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i; echo \$dlname'\''`~ + dldir=$destdir/`dirname \$dlpath`~ + test -d \$dldir || mkdir -p \$dldir~ + $install_prog $dir/$dlname \$dldir/$dlname~ + chmod a+x \$dldir/$dlname~ + if test -n '\''$stripme'\'' && test -n '\''$striplib'\''; then + eval '\''$striplib \$dldir/$dlname'\'' || exit \$?; + fi' + postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~ + dlpath=$dir/\$dldll~ + $RM \$dlpath' + shlibpath_overrides_runpath=yes + + case $host_os in + cygwin*) + # Cygwin DLLs use 'cyg' prefix rather than 'lib' + soname_spec='`echo ${libname} | sed -e 's/^lib/cyg/'``echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext}' +m4_if([$1], [],[ + sys_lib_search_path_spec="$sys_lib_search_path_spec /usr/lib/w32api"]) + ;; + mingw* | cegcc*) + # MinGW DLLs use traditional 'lib' prefix + soname_spec='${libname}`echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext}' + ;; + pw32*) + # pw32 DLLs use 'pw' prefix rather than 'lib' + library_names_spec='`echo ${libname} | sed -e 's/^lib/pw/'``echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext}' + ;; + esac + dynamic_linker='Win32 ld.exe' + ;; + + *,cl*) + # Native MSVC + libname_spec='$name' + soname_spec='${libname}`echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext}' + library_names_spec='${libname}.dll.lib' + + case $build_os in + mingw*) + sys_lib_search_path_spec= + lt_save_ifs=$IFS + IFS=';' + for lt_path in $LIB + do + IFS=$lt_save_ifs + # Let DOS variable expansion print the short 8.3 style file name. + lt_path=`cd "$lt_path" 2>/dev/null && cmd //C "for %i in (".") do @echo %~si"` + sys_lib_search_path_spec="$sys_lib_search_path_spec $lt_path" + done + IFS=$lt_save_ifs + # Convert to MSYS style. + sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | sed -e 's|\\\\|/|g' -e 's| \\([[a-zA-Z]]\\):| /\\1|g' -e 's|^ ||'` + ;; + cygwin*) + # Convert to unix form, then to dos form, then back to unix form + # but this time dos style (no spaces!) so that the unix form looks + # like /cygdrive/c/PROGRA~1:/cygdr... + sys_lib_search_path_spec=`cygpath --path --unix "$LIB"` + sys_lib_search_path_spec=`cygpath --path --dos "$sys_lib_search_path_spec" 2>/dev/null` + sys_lib_search_path_spec=`cygpath --path --unix "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"` + ;; + *) + sys_lib_search_path_spec="$LIB" + if $ECHO "$sys_lib_search_path_spec" | [$GREP ';[c-zC-Z]:/' >/dev/null]; then + # It is most probably a Windows format PATH. + sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'` + else + sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"` + fi + # FIXME: find the short name or the path components, as spaces are + # common. (e.g. "Program Files" -> "PROGRA~1") + ;; + esac + + # DLL is installed to $(libdir)/../bin by postinstall_cmds + postinstall_cmds='base_file=`basename \${file}`~ + dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i; echo \$dlname'\''`~ + dldir=$destdir/`dirname \$dlpath`~ + test -d \$dldir || mkdir -p \$dldir~ + $install_prog $dir/$dlname \$dldir/$dlname' + postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~ + dlpath=$dir/\$dldll~ + $RM \$dlpath' + shlibpath_overrides_runpath=yes + dynamic_linker='Win32 link.exe' + ;; + + *) + # Assume MSVC wrapper + library_names_spec='${libname}`echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext} $libname.lib' + dynamic_linker='Win32 ld.exe' + ;; + esac + # FIXME: first we should search . and the directory the executable is in + shlibpath_var=PATH + ;; + +darwin* | rhapsody*) + dynamic_linker="$host_os dyld" + version_type=darwin + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${major}$shared_ext ${libname}$shared_ext' + soname_spec='${libname}${release}${major}$shared_ext' + shlibpath_overrides_runpath=yes + shlibpath_var=DYLD_LIBRARY_PATH + shrext_cmds='`test .$module = .yes && echo .so || echo .dylib`' +m4_if([$1], [],[ + sys_lib_search_path_spec="$sys_lib_search_path_spec /usr/local/lib"]) + sys_lib_dlsearch_path_spec='/usr/local/lib /lib /usr/lib' + ;; + +dgux*) + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname$shared_ext' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + ;; + +freebsd* | dragonfly*) + # DragonFly does not have aout. When/if they implement a new + # versioning mechanism, adjust this. + if test -x /usr/bin/objformat; then + objformat=`/usr/bin/objformat` + else + case $host_os in + freebsd[[23]].*) objformat=aout ;; + *) objformat=elf ;; + esac + fi + version_type=freebsd-$objformat + case $version_type in + freebsd-elf*) + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}' + need_version=no + need_lib_prefix=no + ;; + freebsd-*) + library_names_spec='${libname}${release}${shared_ext}$versuffix $libname${shared_ext}$versuffix' + need_version=yes + ;; + esac + shlibpath_var=LD_LIBRARY_PATH + case $host_os in + freebsd2.*) + shlibpath_overrides_runpath=yes + ;; + freebsd3.[[01]]* | freebsdelf3.[[01]]*) + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + freebsd3.[[2-9]]* | freebsdelf3.[[2-9]]* | \ + freebsd4.[[0-5]] | freebsdelf4.[[0-5]] | freebsd4.1.1 | freebsdelf4.1.1) + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + *) # from 4.6 on, and DragonFly + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + esac + ;; + +gnu*) + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + +haiku*) + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + dynamic_linker="$host_os runtime_loader" + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LIBRARY_PATH + shlibpath_overrides_runpath=yes + sys_lib_dlsearch_path_spec='/boot/home/config/lib /boot/common/lib /boot/system/lib' + hardcode_into_libs=yes + ;; + +hpux9* | hpux10* | hpux11*) + # Give a soname corresponding to the major version so that dld.sl refuses to + # link against other versions. + version_type=sunos + need_lib_prefix=no + need_version=no + case $host_cpu in + ia64*) + shrext_cmds='.so' + hardcode_into_libs=yes + dynamic_linker="$host_os dld.so" + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes # Unless +noenvvar is specified. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + if test "X$HPUX_IA64_MODE" = X32; then + sys_lib_search_path_spec="/usr/lib/hpux32 /usr/local/lib/hpux32 /usr/local/lib" + else + sys_lib_search_path_spec="/usr/lib/hpux64 /usr/local/lib/hpux64" + fi + sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec + ;; + hppa*64*) + shrext_cmds='.sl' + hardcode_into_libs=yes + dynamic_linker="$host_os dld.sl" + shlibpath_var=LD_LIBRARY_PATH # How should we handle SHLIB_PATH + shlibpath_overrides_runpath=yes # Unless +noenvvar is specified. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + sys_lib_search_path_spec="/usr/lib/pa20_64 /usr/ccs/lib/pa20_64" + sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec + ;; + *) + shrext_cmds='.sl' + dynamic_linker="$host_os dld.sl" + shlibpath_var=SHLIB_PATH + shlibpath_overrides_runpath=no # +s is required to enable SHLIB_PATH + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + ;; + esac + # HP-UX runs *really* slowly unless shared libraries are mode 555, ... + postinstall_cmds='chmod 555 $lib' + # or fails outright, so override atomically: + install_override_mode=555 + ;; + +interix[[3-9]]*) + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + dynamic_linker='Interix 3.x ld.so.1 (PE, like ELF)' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + +irix5* | irix6* | nonstopux*) + case $host_os in + nonstopux*) version_type=nonstopux ;; + *) + if test "$lt_cv_prog_gnu_ld" = yes; then + version_type=linux # correct to gnu/linux during the next big refactor + else + version_type=irix + fi ;; + esac + need_lib_prefix=no + need_version=no + soname_spec='${libname}${release}${shared_ext}$major' + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext} $libname${shared_ext}' + case $host_os in + irix5* | nonstopux*) + libsuff= shlibsuff= + ;; + *) + case $LD in # libtool.m4 will add one of these switches to LD + *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ") + libsuff= shlibsuff= libmagic=32-bit;; + *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ") + libsuff=32 shlibsuff=N32 libmagic=N32;; + *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ") + libsuff=64 shlibsuff=64 libmagic=64-bit;; + *) libsuff= shlibsuff= libmagic=never-match;; + esac + ;; + esac + shlibpath_var=LD_LIBRARY${shlibsuff}_PATH + shlibpath_overrides_runpath=no + sys_lib_search_path_spec="/usr/lib${libsuff} /lib${libsuff} /usr/local/lib${libsuff}" + sys_lib_dlsearch_path_spec="/usr/lib${libsuff} /lib${libsuff}" + hardcode_into_libs=yes + ;; + +# No shared lib support for Linux oldld, aout, or coff. +linux*oldld* | linux*aout* | linux*coff*) + dynamic_linker=no + ;; + +# This must be glibc/ELF. +linux* | k*bsd*-gnu | kopensolaris*-gnu) + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + + # Some binutils ld are patched to set DT_RUNPATH + AC_CACHE_VAL([lt_cv_shlibpath_overrides_runpath], + [lt_cv_shlibpath_overrides_runpath=no + save_LDFLAGS=$LDFLAGS + save_libdir=$libdir + eval "libdir=/foo; wl=\"$_LT_TAGVAR(lt_prog_compiler_wl, $1)\"; \ + LDFLAGS=\"\$LDFLAGS $_LT_TAGVAR(hardcode_libdir_flag_spec, $1)\"" + AC_LINK_IFELSE([AC_LANG_PROGRAM([],[])], + [AS_IF([ ($OBJDUMP -p conftest$ac_exeext) 2>/dev/null | grep "RUNPATH.*$libdir" >/dev/null], + [lt_cv_shlibpath_overrides_runpath=yes])]) + LDFLAGS=$save_LDFLAGS + libdir=$save_libdir + ]) + shlibpath_overrides_runpath=$lt_cv_shlibpath_overrides_runpath + + # This implies no fast_install, which is unacceptable. + # Some rework will be needed to allow for fast_install + # before this can be enabled. + hardcode_into_libs=yes + + # Append ld.so.conf contents to the search path + if test -f /etc/ld.so.conf; then + lt_ld_extra=`awk '/^include / { system(sprintf("cd /etc; cat %s 2>/dev/null", \[$]2)); skip = 1; } { if (!skip) print \[$]0; skip = 0; }' < /etc/ld.so.conf | $SED -e 's/#.*//;/^[ ]*hwcap[ ]/d;s/[:, ]/ /g;s/=[^=]*$//;s/=[^= ]* / /g;s/"//g;/^$/d' | tr '\n' ' '` + sys_lib_dlsearch_path_spec="/lib /usr/lib $lt_ld_extra" + fi + + # We used to test for /lib/ld.so.1 and disable shared libraries on + # powerpc, because MkLinux only supported shared libraries with the + # GNU dynamic linker. Since this was broken with cross compilers, + # most powerpc-linux boxes support dynamic linking these days and + # people can always --disable-shared, the test was removed, and we + # assume the GNU/Linux dynamic linker is in use. + dynamic_linker='GNU/Linux ld.so' + ;; + +netbsd*) + version_type=sunos + need_lib_prefix=no + need_version=no + if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir' + dynamic_linker='NetBSD (a.out) ld.so' + else + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + dynamic_linker='NetBSD ld.elf_so' + fi + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + +newsos6) + version_type=linux # correct to gnu/linux during the next big refactor + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + ;; + +*nto* | *qnx*) + version_type=qnx + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + dynamic_linker='ldqnx.so' + ;; + +openbsd*) + version_type=sunos + sys_lib_dlsearch_path_spec="/usr/lib" + need_lib_prefix=no + # Some older versions of OpenBSD (3.3 at least) *do* need versioned libs. + case $host_os in + openbsd3.3 | openbsd3.3.*) need_version=yes ;; + *) need_version=no ;; + esac + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir' + shlibpath_var=LD_LIBRARY_PATH + if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then + case $host_os in + openbsd2.[[89]] | openbsd2.[[89]].*) + shlibpath_overrides_runpath=no + ;; + *) + shlibpath_overrides_runpath=yes + ;; + esac + else + shlibpath_overrides_runpath=yes + fi + ;; + +os2*) + libname_spec='$name' + shrext_cmds=".dll" + need_lib_prefix=no + library_names_spec='$libname${shared_ext} $libname.a' + dynamic_linker='OS/2 ld.exe' + shlibpath_var=LIBPATH + ;; + +osf3* | osf4* | osf5*) + version_type=osf + need_lib_prefix=no + need_version=no + soname_spec='${libname}${release}${shared_ext}$major' + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + sys_lib_search_path_spec="/usr/shlib /usr/ccs/lib /usr/lib/cmplrs/cc /usr/lib /usr/local/lib /var/shlib" + sys_lib_dlsearch_path_spec="$sys_lib_search_path_spec" + ;; + +rdos*) + dynamic_linker=no + ;; + +solaris*) + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + # ldd complains unless libraries are executable + postinstall_cmds='chmod +x $lib' + ;; + +sunos4*) + version_type=sunos + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + if test "$with_gnu_ld" = yes; then + need_lib_prefix=no + fi + need_version=yes + ;; + +sysv4 | sysv4.3*) + version_type=linux # correct to gnu/linux during the next big refactor + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + case $host_vendor in + sni) + shlibpath_overrides_runpath=no + need_lib_prefix=no + runpath_var=LD_RUN_PATH + ;; + siemens) + need_lib_prefix=no + ;; + motorola) + need_lib_prefix=no + need_version=no + shlibpath_overrides_runpath=no + sys_lib_search_path_spec='/lib /usr/lib /usr/ccs/lib' + ;; + esac + ;; + +sysv4*MP*) + if test -d /usr/nec ;then + version_type=linux # correct to gnu/linux during the next big refactor + library_names_spec='$libname${shared_ext}.$versuffix $libname${shared_ext}.$major $libname${shared_ext}' + soname_spec='$libname${shared_ext}.$major' + shlibpath_var=LD_LIBRARY_PATH + fi + ;; + +sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*) + version_type=freebsd-elf + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + if test "$with_gnu_ld" = yes; then + sys_lib_search_path_spec='/usr/local/lib /usr/gnu/lib /usr/ccs/lib /usr/lib /lib' + else + sys_lib_search_path_spec='/usr/ccs/lib /usr/lib' + case $host_os in + sco3.2v5*) + sys_lib_search_path_spec="$sys_lib_search_path_spec /lib" + ;; + esac + fi + sys_lib_dlsearch_path_spec='/usr/lib' + ;; + +tpf*) + # TPF is a cross-target only. Preferred cross-host = GNU/Linux. + version_type=linux # correct to gnu/linux during the next big refactor + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + +uts4*) + version_type=linux # correct to gnu/linux during the next big refactor + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + ;; + +*) + dynamic_linker=no + ;; +esac +AC_MSG_RESULT([$dynamic_linker]) +test "$dynamic_linker" = no && can_build_shared=no + +variables_saved_for_relink="PATH $shlibpath_var $runpath_var" +if test "$GCC" = yes; then + variables_saved_for_relink="$variables_saved_for_relink GCC_EXEC_PREFIX COMPILER_PATH LIBRARY_PATH" +fi + +if test "${lt_cv_sys_lib_search_path_spec+set}" = set; then + sys_lib_search_path_spec="$lt_cv_sys_lib_search_path_spec" +fi +if test "${lt_cv_sys_lib_dlsearch_path_spec+set}" = set; then + sys_lib_dlsearch_path_spec="$lt_cv_sys_lib_dlsearch_path_spec" +fi + +_LT_DECL([], [variables_saved_for_relink], [1], + [Variables whose values should be saved in libtool wrapper scripts and + restored at link time]) +_LT_DECL([], [need_lib_prefix], [0], + [Do we need the "lib" prefix for modules?]) +_LT_DECL([], [need_version], [0], [Do we need a version for libraries?]) +_LT_DECL([], [version_type], [0], [Library versioning type]) +_LT_DECL([], [runpath_var], [0], [Shared library runtime path variable]) +_LT_DECL([], [shlibpath_var], [0],[Shared library path variable]) +_LT_DECL([], [shlibpath_overrides_runpath], [0], + [Is shlibpath searched before the hard-coded library search path?]) +_LT_DECL([], [libname_spec], [1], [Format of library name prefix]) +_LT_DECL([], [library_names_spec], [1], + [[List of archive names. First name is the real one, the rest are links. + The last name is the one that the linker finds with -lNAME]]) +_LT_DECL([], [soname_spec], [1], + [[The coded name of the library, if different from the real name]]) +_LT_DECL([], [install_override_mode], [1], + [Permission mode override for installation of shared libraries]) +_LT_DECL([], [postinstall_cmds], [2], + [Command to use after installation of a shared archive]) +_LT_DECL([], [postuninstall_cmds], [2], + [Command to use after uninstallation of a shared archive]) +_LT_DECL([], [finish_cmds], [2], + [Commands used to finish a libtool library installation in a directory]) +_LT_DECL([], [finish_eval], [1], + [[As "finish_cmds", except a single script fragment to be evaled but + not shown]]) +_LT_DECL([], [hardcode_into_libs], [0], + [Whether we should hardcode library paths into libraries]) +_LT_DECL([], [sys_lib_search_path_spec], [2], + [Compile-time system search path for libraries]) +_LT_DECL([], [sys_lib_dlsearch_path_spec], [2], + [Run-time system search path for libraries]) +])# _LT_SYS_DYNAMIC_LINKER + + +# _LT_PATH_TOOL_PREFIX(TOOL) +# -------------------------- +# find a file program which can recognize shared library +AC_DEFUN([_LT_PATH_TOOL_PREFIX], +[m4_require([_LT_DECL_EGREP])dnl +AC_MSG_CHECKING([for $1]) +AC_CACHE_VAL(lt_cv_path_MAGIC_CMD, +[case $MAGIC_CMD in +[[\\/*] | ?:[\\/]*]) + lt_cv_path_MAGIC_CMD="$MAGIC_CMD" # Let the user override the test with a path. + ;; +*) + lt_save_MAGIC_CMD="$MAGIC_CMD" + lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR +dnl $ac_dummy forces splitting on constant user-supplied paths. +dnl POSIX.2 word splitting is done only on the output of word expansions, +dnl not every word. This closes a longstanding sh security hole. + ac_dummy="m4_if([$2], , $PATH, [$2])" + for ac_dir in $ac_dummy; do + IFS="$lt_save_ifs" + test -z "$ac_dir" && ac_dir=. + if test -f $ac_dir/$1; then + lt_cv_path_MAGIC_CMD="$ac_dir/$1" + if test -n "$file_magic_test_file"; then + case $deplibs_check_method in + "file_magic "*) + file_magic_regex=`expr "$deplibs_check_method" : "file_magic \(.*\)"` + MAGIC_CMD="$lt_cv_path_MAGIC_CMD" + if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null | + $EGREP "$file_magic_regex" > /dev/null; then + : + else + cat <<_LT_EOF 1>&2 + +*** Warning: the command libtool uses to detect shared libraries, +*** $file_magic_cmd, produces output that libtool cannot recognize. +*** The result is that libtool may fail to recognize shared libraries +*** as such. This will affect the creation of libtool libraries that +*** depend on shared libraries, but programs linked with such libtool +*** libraries will work regardless of this problem. Nevertheless, you +*** may want to report the problem to your system manager and/or to +*** bug-libtool@gnu.org + +_LT_EOF + fi ;; + esac + fi + break + fi + done + IFS="$lt_save_ifs" + MAGIC_CMD="$lt_save_MAGIC_CMD" + ;; +esac]) +MAGIC_CMD="$lt_cv_path_MAGIC_CMD" +if test -n "$MAGIC_CMD"; then + AC_MSG_RESULT($MAGIC_CMD) +else + AC_MSG_RESULT(no) +fi +_LT_DECL([], [MAGIC_CMD], [0], + [Used to examine libraries when file_magic_cmd begins with "file"])dnl +])# _LT_PATH_TOOL_PREFIX + +# Old name: +AU_ALIAS([AC_PATH_TOOL_PREFIX], [_LT_PATH_TOOL_PREFIX]) +dnl aclocal-1.4 backwards compatibility: +dnl AC_DEFUN([AC_PATH_TOOL_PREFIX], []) + + +# _LT_PATH_MAGIC +# -------------- +# find a file program which can recognize a shared library +m4_defun([_LT_PATH_MAGIC], +[_LT_PATH_TOOL_PREFIX(${ac_tool_prefix}file, /usr/bin$PATH_SEPARATOR$PATH) +if test -z "$lt_cv_path_MAGIC_CMD"; then + if test -n "$ac_tool_prefix"; then + _LT_PATH_TOOL_PREFIX(file, /usr/bin$PATH_SEPARATOR$PATH) + else + MAGIC_CMD=: + fi +fi +])# _LT_PATH_MAGIC + + +# LT_PATH_LD +# ---------- +# find the pathname to the GNU or non-GNU linker +AC_DEFUN([LT_PATH_LD], +[AC_REQUIRE([AC_PROG_CC])dnl +AC_REQUIRE([AC_CANONICAL_HOST])dnl +AC_REQUIRE([AC_CANONICAL_BUILD])dnl +m4_require([_LT_DECL_SED])dnl +m4_require([_LT_DECL_EGREP])dnl +m4_require([_LT_PROG_ECHO_BACKSLASH])dnl + +AC_ARG_WITH([gnu-ld], + [AS_HELP_STRING([--with-gnu-ld], + [assume the C compiler uses GNU ld @<:@default=no@:>@])], + [test "$withval" = no || with_gnu_ld=yes], + [with_gnu_ld=no])dnl + +ac_prog=ld +if test "$GCC" = yes; then + # Check if gcc -print-prog-name=ld gives a path. + AC_MSG_CHECKING([for ld used by $CC]) + case $host in + *-*-mingw*) + # gcc leaves a trailing carriage return which upsets mingw + ac_prog=`($CC -print-prog-name=ld) 2>&5 | tr -d '\015'` ;; + *) + ac_prog=`($CC -print-prog-name=ld) 2>&5` ;; + esac + case $ac_prog in + # Accept absolute paths. + [[\\/]]* | ?:[[\\/]]*) + re_direlt='/[[^/]][[^/]]*/\.\./' + # Canonicalize the pathname of ld + ac_prog=`$ECHO "$ac_prog"| $SED 's%\\\\%/%g'` + while $ECHO "$ac_prog" | $GREP "$re_direlt" > /dev/null 2>&1; do + ac_prog=`$ECHO $ac_prog| $SED "s%$re_direlt%/%"` + done + test -z "$LD" && LD="$ac_prog" + ;; + "") + # If it fails, then pretend we aren't using GCC. + ac_prog=ld + ;; + *) + # If it is relative, then search for the first ld in PATH. + with_gnu_ld=unknown + ;; + esac +elif test "$with_gnu_ld" = yes; then + AC_MSG_CHECKING([for GNU ld]) +else + AC_MSG_CHECKING([for non-GNU ld]) +fi +AC_CACHE_VAL(lt_cv_path_LD, +[if test -z "$LD"; then + lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR + for ac_dir in $PATH; do + IFS="$lt_save_ifs" + test -z "$ac_dir" && ac_dir=. + if test -f "$ac_dir/$ac_prog" || test -f "$ac_dir/$ac_prog$ac_exeext"; then + lt_cv_path_LD="$ac_dir/$ac_prog" + # Check to see if the program is GNU ld. I'd rather use --version, + # but apparently some variants of GNU ld only accept -v. + # Break only if it was the GNU/non-GNU ld that we prefer. + case `"$lt_cv_path_LD" -v 2>&1 &1 /dev/null 2>&1; then + lt_cv_deplibs_check_method='file_magic ^x86 archive import|^x86 DLL' + lt_cv_file_magic_cmd='func_win32_libid' + else + # Keep this pattern in sync with the one in func_win32_libid. + lt_cv_deplibs_check_method='file_magic file format (pei*-i386(.*architecture: i386)?|pe-arm-wince|pe-x86-64)' + lt_cv_file_magic_cmd='$OBJDUMP -f' + fi + ;; + +cegcc*) + # use the weaker test based on 'objdump'. See mingw*. + lt_cv_deplibs_check_method='file_magic file format pe-arm-.*little(.*architecture: arm)?' + lt_cv_file_magic_cmd='$OBJDUMP -f' + ;; + +darwin* | rhapsody*) + lt_cv_deplibs_check_method=pass_all + ;; + +freebsd* | dragonfly*) + if echo __ELF__ | $CC -E - | $GREP __ELF__ > /dev/null; then + case $host_cpu in + i*86 ) + # Not sure whether the presence of OpenBSD here was a mistake. + # Let's accept both of them until this is cleared up. + lt_cv_deplibs_check_method='file_magic (FreeBSD|OpenBSD|DragonFly)/i[[3-9]]86 (compact )?demand paged shared library' + lt_cv_file_magic_cmd=/usr/bin/file + lt_cv_file_magic_test_file=`echo /usr/lib/libc.so.*` + ;; + esac + else + lt_cv_deplibs_check_method=pass_all + fi + ;; + +gnu*) + lt_cv_deplibs_check_method=pass_all + ;; + +haiku*) + lt_cv_deplibs_check_method=pass_all + ;; + +hpux10.20* | hpux11*) + lt_cv_file_magic_cmd=/usr/bin/file + case $host_cpu in + ia64*) + lt_cv_deplibs_check_method='file_magic (s[[0-9]][[0-9]][[0-9]]|ELF-[[0-9]][[0-9]]) shared object file - IA64' + lt_cv_file_magic_test_file=/usr/lib/hpux32/libc.so + ;; + hppa*64*) + [lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|ELF[ -][0-9][0-9])(-bit)?( [LM]SB)? shared object( file)?[, -]* PA-RISC [0-9]\.[0-9]'] + lt_cv_file_magic_test_file=/usr/lib/pa20_64/libc.sl + ;; + *) + lt_cv_deplibs_check_method='file_magic (s[[0-9]][[0-9]][[0-9]]|PA-RISC[[0-9]]\.[[0-9]]) shared library' + lt_cv_file_magic_test_file=/usr/lib/libc.sl + ;; + esac + ;; + +interix[[3-9]]*) + # PIC code is broken on Interix 3.x, that's why |\.a not |_pic\.a here + lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so|\.a)$' + ;; + +irix5* | irix6* | nonstopux*) + case $LD in + *-32|*"-32 ") libmagic=32-bit;; + *-n32|*"-n32 ") libmagic=N32;; + *-64|*"-64 ") libmagic=64-bit;; + *) libmagic=never-match;; + esac + lt_cv_deplibs_check_method=pass_all + ;; + +# This must be glibc/ELF. +linux* | k*bsd*-gnu | kopensolaris*-gnu) + lt_cv_deplibs_check_method=pass_all + ;; + +netbsd*) + if echo __ELF__ | $CC -E - | $GREP __ELF__ > /dev/null; then + lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so\.[[0-9]]+\.[[0-9]]+|_pic\.a)$' + else + lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so|_pic\.a)$' + fi + ;; + +newos6*) + lt_cv_deplibs_check_method='file_magic ELF [[0-9]][[0-9]]*-bit [[ML]]SB (executable|dynamic lib)' + lt_cv_file_magic_cmd=/usr/bin/file + lt_cv_file_magic_test_file=/usr/lib/libnls.so + ;; + +*nto* | *qnx*) + lt_cv_deplibs_check_method=pass_all + ;; + +openbsd*) + if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then + lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so\.[[0-9]]+\.[[0-9]]+|\.so|_pic\.a)$' + else + lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so\.[[0-9]]+\.[[0-9]]+|_pic\.a)$' + fi + ;; + +osf3* | osf4* | osf5*) + lt_cv_deplibs_check_method=pass_all + ;; + +rdos*) + lt_cv_deplibs_check_method=pass_all + ;; + +solaris*) + lt_cv_deplibs_check_method=pass_all + ;; + +sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*) + lt_cv_deplibs_check_method=pass_all + ;; + +sysv4 | sysv4.3*) + case $host_vendor in + motorola) + lt_cv_deplibs_check_method='file_magic ELF [[0-9]][[0-9]]*-bit [[ML]]SB (shared object|dynamic lib) M[[0-9]][[0-9]]* Version [[0-9]]' + lt_cv_file_magic_test_file=`echo /usr/lib/libc.so*` + ;; + ncr) + lt_cv_deplibs_check_method=pass_all + ;; + sequent) + lt_cv_file_magic_cmd='/bin/file' + lt_cv_deplibs_check_method='file_magic ELF [[0-9]][[0-9]]*-bit [[LM]]SB (shared object|dynamic lib )' + ;; + sni) + lt_cv_file_magic_cmd='/bin/file' + lt_cv_deplibs_check_method="file_magic ELF [[0-9]][[0-9]]*-bit [[LM]]SB dynamic lib" + lt_cv_file_magic_test_file=/lib/libc.so + ;; + siemens) + lt_cv_deplibs_check_method=pass_all + ;; + pc) + lt_cv_deplibs_check_method=pass_all + ;; + esac + ;; + +tpf*) + lt_cv_deplibs_check_method=pass_all + ;; +esac +]) + +file_magic_glob= +want_nocaseglob=no +if test "$build" = "$host"; then + case $host_os in + mingw* | pw32*) + if ( shopt | grep nocaseglob ) >/dev/null 2>&1; then + want_nocaseglob=yes + else + file_magic_glob=`echo aAbBcCdDeEfFgGhHiIjJkKlLmMnNoOpPqQrRsStTuUvVwWxXyYzZ | $SED -e "s/\(..\)/s\/[[\1]]\/[[\1]]\/g;/g"` + fi + ;; + esac +fi + +file_magic_cmd=$lt_cv_file_magic_cmd +deplibs_check_method=$lt_cv_deplibs_check_method +test -z "$deplibs_check_method" && deplibs_check_method=unknown + +_LT_DECL([], [deplibs_check_method], [1], + [Method to check whether dependent libraries are shared objects]) +_LT_DECL([], [file_magic_cmd], [1], + [Command to use when deplibs_check_method = "file_magic"]) +_LT_DECL([], [file_magic_glob], [1], + [How to find potential files when deplibs_check_method = "file_magic"]) +_LT_DECL([], [want_nocaseglob], [1], + [Find potential files using nocaseglob when deplibs_check_method = "file_magic"]) +])# _LT_CHECK_MAGIC_METHOD + + +# LT_PATH_NM +# ---------- +# find the pathname to a BSD- or MS-compatible name lister +AC_DEFUN([LT_PATH_NM], +[AC_REQUIRE([AC_PROG_CC])dnl +AC_CACHE_CHECK([for BSD- or MS-compatible name lister (nm)], lt_cv_path_NM, +[if test -n "$NM"; then + # Let the user override the test. + lt_cv_path_NM="$NM" +else + lt_nm_to_check="${ac_tool_prefix}nm" + if test -n "$ac_tool_prefix" && test "$build" = "$host"; then + lt_nm_to_check="$lt_nm_to_check nm" + fi + for lt_tmp_nm in $lt_nm_to_check; do + lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR + for ac_dir in $PATH /usr/ccs/bin/elf /usr/ccs/bin /usr/ucb /bin; do + IFS="$lt_save_ifs" + test -z "$ac_dir" && ac_dir=. + tmp_nm="$ac_dir/$lt_tmp_nm" + if test -f "$tmp_nm" || test -f "$tmp_nm$ac_exeext" ; then + # Check to see if the nm accepts a BSD-compat flag. + # Adding the `sed 1q' prevents false positives on HP-UX, which says: + # nm: unknown option "B" ignored + # Tru64's nm complains that /dev/null is an invalid object file + case `"$tmp_nm" -B /dev/null 2>&1 | sed '1q'` in + */dev/null* | *'Invalid file or object type'*) + lt_cv_path_NM="$tmp_nm -B" + break + ;; + *) + case `"$tmp_nm" -p /dev/null 2>&1 | sed '1q'` in + */dev/null*) + lt_cv_path_NM="$tmp_nm -p" + break + ;; + *) + lt_cv_path_NM=${lt_cv_path_NM="$tmp_nm"} # keep the first match, but + continue # so that we can try to find one that supports BSD flags + ;; + esac + ;; + esac + fi + done + IFS="$lt_save_ifs" + done + : ${lt_cv_path_NM=no} +fi]) +if test "$lt_cv_path_NM" != "no"; then + NM="$lt_cv_path_NM" +else + # Didn't find any BSD compatible name lister, look for dumpbin. + if test -n "$DUMPBIN"; then : + # Let the user override the test. + else + AC_CHECK_TOOLS(DUMPBIN, [dumpbin "link -dump"], :) + case `$DUMPBIN -symbols /dev/null 2>&1 | sed '1q'` in + *COFF*) + DUMPBIN="$DUMPBIN -symbols" + ;; + *) + DUMPBIN=: + ;; + esac + fi + AC_SUBST([DUMPBIN]) + if test "$DUMPBIN" != ":"; then + NM="$DUMPBIN" + fi +fi +test -z "$NM" && NM=nm +AC_SUBST([NM]) +_LT_DECL([], [NM], [1], [A BSD- or MS-compatible name lister])dnl + +AC_CACHE_CHECK([the name lister ($NM) interface], [lt_cv_nm_interface], + [lt_cv_nm_interface="BSD nm" + echo "int some_variable = 0;" > conftest.$ac_ext + (eval echo "\"\$as_me:$LINENO: $ac_compile\"" >&AS_MESSAGE_LOG_FD) + (eval "$ac_compile" 2>conftest.err) + cat conftest.err >&AS_MESSAGE_LOG_FD + (eval echo "\"\$as_me:$LINENO: $NM \\\"conftest.$ac_objext\\\"\"" >&AS_MESSAGE_LOG_FD) + (eval "$NM \"conftest.$ac_objext\"" 2>conftest.err > conftest.out) + cat conftest.err >&AS_MESSAGE_LOG_FD + (eval echo "\"\$as_me:$LINENO: output\"" >&AS_MESSAGE_LOG_FD) + cat conftest.out >&AS_MESSAGE_LOG_FD + if $GREP 'External.*some_variable' conftest.out > /dev/null; then + lt_cv_nm_interface="MS dumpbin" + fi + rm -f conftest*]) +])# LT_PATH_NM + +# Old names: +AU_ALIAS([AM_PROG_NM], [LT_PATH_NM]) +AU_ALIAS([AC_PROG_NM], [LT_PATH_NM]) +dnl aclocal-1.4 backwards compatibility: +dnl AC_DEFUN([AM_PROG_NM], []) +dnl AC_DEFUN([AC_PROG_NM], []) + +# _LT_CHECK_SHAREDLIB_FROM_LINKLIB +# -------------------------------- +# how to determine the name of the shared library +# associated with a specific link library. +# -- PORTME fill in with the dynamic library characteristics +m4_defun([_LT_CHECK_SHAREDLIB_FROM_LINKLIB], +[m4_require([_LT_DECL_EGREP]) +m4_require([_LT_DECL_OBJDUMP]) +m4_require([_LT_DECL_DLLTOOL]) +AC_CACHE_CHECK([how to associate runtime and link libraries], +lt_cv_sharedlib_from_linklib_cmd, +[lt_cv_sharedlib_from_linklib_cmd='unknown' + +case $host_os in +cygwin* | mingw* | pw32* | cegcc*) + # two different shell functions defined in ltmain.sh + # decide which to use based on capabilities of $DLLTOOL + case `$DLLTOOL --help 2>&1` in + *--identify-strict*) + lt_cv_sharedlib_from_linklib_cmd=func_cygming_dll_for_implib + ;; + *) + lt_cv_sharedlib_from_linklib_cmd=func_cygming_dll_for_implib_fallback + ;; + esac + ;; +*) + # fallback: assume linklib IS sharedlib + lt_cv_sharedlib_from_linklib_cmd="$ECHO" + ;; +esac +]) +sharedlib_from_linklib_cmd=$lt_cv_sharedlib_from_linklib_cmd +test -z "$sharedlib_from_linklib_cmd" && sharedlib_from_linklib_cmd=$ECHO + +_LT_DECL([], [sharedlib_from_linklib_cmd], [1], + [Command to associate shared and link libraries]) +])# _LT_CHECK_SHAREDLIB_FROM_LINKLIB + + +# _LT_PATH_MANIFEST_TOOL +# ---------------------- +# locate the manifest tool +m4_defun([_LT_PATH_MANIFEST_TOOL], +[AC_CHECK_TOOL(MANIFEST_TOOL, mt, :) +test -z "$MANIFEST_TOOL" && MANIFEST_TOOL=mt +AC_CACHE_CHECK([if $MANIFEST_TOOL is a manifest tool], [lt_cv_path_mainfest_tool], + [lt_cv_path_mainfest_tool=no + echo "$as_me:$LINENO: $MANIFEST_TOOL '-?'" >&AS_MESSAGE_LOG_FD + $MANIFEST_TOOL '-?' 2>conftest.err > conftest.out + cat conftest.err >&AS_MESSAGE_LOG_FD + if $GREP 'Manifest Tool' conftest.out > /dev/null; then + lt_cv_path_mainfest_tool=yes + fi + rm -f conftest*]) +if test "x$lt_cv_path_mainfest_tool" != xyes; then + MANIFEST_TOOL=: +fi +_LT_DECL([], [MANIFEST_TOOL], [1], [Manifest tool])dnl +])# _LT_PATH_MANIFEST_TOOL + + +# LT_LIB_M +# -------- +# check for math library +AC_DEFUN([LT_LIB_M], +[AC_REQUIRE([AC_CANONICAL_HOST])dnl +LIBM= +case $host in +*-*-beos* | *-*-cegcc* | *-*-cygwin* | *-*-haiku* | *-*-pw32* | *-*-darwin*) + # These system don't have libm, or don't need it + ;; +*-ncr-sysv4.3*) + AC_CHECK_LIB(mw, _mwvalidcheckl, LIBM="-lmw") + AC_CHECK_LIB(m, cos, LIBM="$LIBM -lm") + ;; +*) + AC_CHECK_LIB(m, cos, LIBM="-lm") + ;; +esac +AC_SUBST([LIBM]) +])# LT_LIB_M + +# Old name: +AU_ALIAS([AC_CHECK_LIBM], [LT_LIB_M]) +dnl aclocal-1.4 backwards compatibility: +dnl AC_DEFUN([AC_CHECK_LIBM], []) + + +# _LT_COMPILER_NO_RTTI([TAGNAME]) +# ------------------------------- +m4_defun([_LT_COMPILER_NO_RTTI], +[m4_require([_LT_TAG_COMPILER])dnl + +_LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)= + +if test "$GCC" = yes; then + case $cc_basename in + nvcc*) + _LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)=' -Xcompiler -fno-builtin' ;; + *) + _LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)=' -fno-builtin' ;; + esac + + _LT_COMPILER_OPTION([if $compiler supports -fno-rtti -fno-exceptions], + lt_cv_prog_compiler_rtti_exceptions, + [-fno-rtti -fno-exceptions], [], + [_LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)="$_LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1) -fno-rtti -fno-exceptions"]) +fi +_LT_TAGDECL([no_builtin_flag], [lt_prog_compiler_no_builtin_flag], [1], + [Compiler flag to turn off builtin functions]) +])# _LT_COMPILER_NO_RTTI + + +# _LT_CMD_GLOBAL_SYMBOLS +# ---------------------- +m4_defun([_LT_CMD_GLOBAL_SYMBOLS], +[AC_REQUIRE([AC_CANONICAL_HOST])dnl +AC_REQUIRE([AC_PROG_CC])dnl +AC_REQUIRE([AC_PROG_AWK])dnl +AC_REQUIRE([LT_PATH_NM])dnl +AC_REQUIRE([LT_PATH_LD])dnl +m4_require([_LT_DECL_SED])dnl +m4_require([_LT_DECL_EGREP])dnl +m4_require([_LT_TAG_COMPILER])dnl + +# Check for command to grab the raw symbol name followed by C symbol from nm. +AC_MSG_CHECKING([command to parse $NM output from $compiler object]) +AC_CACHE_VAL([lt_cv_sys_global_symbol_pipe], +[ +# These are sane defaults that work on at least a few old systems. +# [They come from Ultrix. What could be older than Ultrix?!! ;)] + +# Character class describing NM global symbol codes. +symcode='[[BCDEGRST]]' + +# Regexp to match symbols that can be accessed directly from C. +sympat='\([[_A-Za-z]][[_A-Za-z0-9]]*\)' + +# Define system-specific variables. +case $host_os in +aix*) + symcode='[[BCDT]]' + ;; +cygwin* | mingw* | pw32* | cegcc*) + symcode='[[ABCDGISTW]]' + ;; +hpux*) + if test "$host_cpu" = ia64; then + symcode='[[ABCDEGRST]]' + fi + ;; +irix* | nonstopux*) + symcode='[[BCDEGRST]]' + ;; +osf*) + symcode='[[BCDEGQRST]]' + ;; +solaris*) + symcode='[[BDRT]]' + ;; +sco3.2v5*) + symcode='[[DT]]' + ;; +sysv4.2uw2*) + symcode='[[DT]]' + ;; +sysv5* | sco5v6* | unixware* | OpenUNIX*) + symcode='[[ABDT]]' + ;; +sysv4) + symcode='[[DFNSTU]]' + ;; +esac + +# If we're using GNU nm, then use its standard symbol codes. +case `$NM -V 2>&1` in +*GNU* | *'with BFD'*) + symcode='[[ABCDGIRSTW]]' ;; +esac + +# Transform an extracted symbol line into a proper C declaration. +# Some systems (esp. on ia64) link data and code symbols differently, +# so use this general approach. +lt_cv_sys_global_symbol_to_cdecl="sed -n -e 's/^T .* \(.*\)$/extern int \1();/p' -e 's/^$symcode* .* \(.*\)$/extern char \1;/p'" + +# Transform an extracted symbol line into symbol name and symbol address +lt_cv_sys_global_symbol_to_c_name_address="sed -n -e 's/^: \([[^ ]]*\)[[ ]]*$/ {\\\"\1\\\", (void *) 0},/p' -e 's/^$symcode* \([[^ ]]*\) \([[^ ]]*\)$/ {\"\2\", (void *) \&\2},/p'" +lt_cv_sys_global_symbol_to_c_name_address_lib_prefix="sed -n -e 's/^: \([[^ ]]*\)[[ ]]*$/ {\\\"\1\\\", (void *) 0},/p' -e 's/^$symcode* \([[^ ]]*\) \(lib[[^ ]]*\)$/ {\"\2\", (void *) \&\2},/p' -e 's/^$symcode* \([[^ ]]*\) \([[^ ]]*\)$/ {\"lib\2\", (void *) \&\2},/p'" + +# Handle CRLF in mingw tool chain +opt_cr= +case $build_os in +mingw*) + opt_cr=`$ECHO 'x\{0,1\}' | tr x '\015'` # option cr in regexp + ;; +esac + +# Try without a prefix underscore, then with it. +for ac_symprfx in "" "_"; do + + # Transform symcode, sympat, and symprfx into a raw symbol and a C symbol. + symxfrm="\\1 $ac_symprfx\\2 \\2" + + # Write the raw and C identifiers. + if test "$lt_cv_nm_interface" = "MS dumpbin"; then + # Fake it for dumpbin and say T for any non-static function + # and D for any global variable. + # Also find C++ and __fastcall symbols from MSVC++, + # which start with @ or ?. + lt_cv_sys_global_symbol_pipe="$AWK ['"\ +" {last_section=section; section=\$ 3};"\ +" /^COFF SYMBOL TABLE/{for(i in hide) delete hide[i]};"\ +" /Section length .*#relocs.*(pick any)/{hide[last_section]=1};"\ +" \$ 0!~/External *\|/{next};"\ +" / 0+ UNDEF /{next}; / UNDEF \([^|]\)*()/{next};"\ +" {if(hide[section]) next};"\ +" {f=0}; \$ 0~/\(\).*\|/{f=1}; {printf f ? \"T \" : \"D \"};"\ +" {split(\$ 0, a, /\||\r/); split(a[2], s)};"\ +" s[1]~/^[@?]/{print s[1], s[1]; next};"\ +" s[1]~prfx {split(s[1],t,\"@\"); print t[1], substr(t[1],length(prfx))}"\ +" ' prfx=^$ac_symprfx]" + else + lt_cv_sys_global_symbol_pipe="sed -n -e 's/^.*[[ ]]\($symcode$symcode*\)[[ ]][[ ]]*$ac_symprfx$sympat$opt_cr$/$symxfrm/p'" + fi + lt_cv_sys_global_symbol_pipe="$lt_cv_sys_global_symbol_pipe | sed '/ __gnu_lto/d'" + + # Check to see that the pipe works correctly. + pipe_works=no + + rm -f conftest* + cat > conftest.$ac_ext <<_LT_EOF +#ifdef __cplusplus +extern "C" { +#endif +char nm_test_var; +void nm_test_func(void); +void nm_test_func(void){} +#ifdef __cplusplus +} +#endif +int main(){nm_test_var='a';nm_test_func();return(0);} +_LT_EOF + + if AC_TRY_EVAL(ac_compile); then + # Now try to grab the symbols. + nlist=conftest.nm + if AC_TRY_EVAL(NM conftest.$ac_objext \| "$lt_cv_sys_global_symbol_pipe" \> $nlist) && test -s "$nlist"; then + # Try sorting and uniquifying the output. + if sort "$nlist" | uniq > "$nlist"T; then + mv -f "$nlist"T "$nlist" + else + rm -f "$nlist"T + fi + + # Make sure that we snagged all the symbols we need. + if $GREP ' nm_test_var$' "$nlist" >/dev/null; then + if $GREP ' nm_test_func$' "$nlist" >/dev/null; then + cat <<_LT_EOF > conftest.$ac_ext +/* Keep this code in sync between libtool.m4, ltmain, lt_system.h, and tests. */ +#if defined(_WIN32) || defined(__CYGWIN__) || defined(_WIN32_WCE) +/* DATA imports from DLLs on WIN32 con't be const, because runtime + relocations are performed -- see ld's documentation on pseudo-relocs. */ +# define LT@&t@_DLSYM_CONST +#elif defined(__osf__) +/* This system does not cope well with relocations in const data. */ +# define LT@&t@_DLSYM_CONST +#else +# define LT@&t@_DLSYM_CONST const +#endif + +#ifdef __cplusplus +extern "C" { +#endif + +_LT_EOF + # Now generate the symbol file. + eval "$lt_cv_sys_global_symbol_to_cdecl"' < "$nlist" | $GREP -v main >> conftest.$ac_ext' + + cat <<_LT_EOF >> conftest.$ac_ext + +/* The mapping between symbol names and symbols. */ +LT@&t@_DLSYM_CONST struct { + const char *name; + void *address; +} +lt__PROGRAM__LTX_preloaded_symbols[[]] = +{ + { "@PROGRAM@", (void *) 0 }, +_LT_EOF + $SED "s/^$symcode$symcode* \(.*\) \(.*\)$/ {\"\2\", (void *) \&\2},/" < "$nlist" | $GREP -v main >> conftest.$ac_ext + cat <<\_LT_EOF >> conftest.$ac_ext + {0, (void *) 0} +}; + +/* This works around a problem in FreeBSD linker */ +#ifdef FREEBSD_WORKAROUND +static const void *lt_preloaded_setup() { + return lt__PROGRAM__LTX_preloaded_symbols; +} +#endif + +#ifdef __cplusplus +} +#endif +_LT_EOF + # Now try linking the two files. + mv conftest.$ac_objext conftstm.$ac_objext + lt_globsym_save_LIBS=$LIBS + lt_globsym_save_CFLAGS=$CFLAGS + LIBS="conftstm.$ac_objext" + CFLAGS="$CFLAGS$_LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)" + if AC_TRY_EVAL(ac_link) && test -s conftest${ac_exeext}; then + pipe_works=yes + fi + LIBS=$lt_globsym_save_LIBS + CFLAGS=$lt_globsym_save_CFLAGS + else + echo "cannot find nm_test_func in $nlist" >&AS_MESSAGE_LOG_FD + fi + else + echo "cannot find nm_test_var in $nlist" >&AS_MESSAGE_LOG_FD + fi + else + echo "cannot run $lt_cv_sys_global_symbol_pipe" >&AS_MESSAGE_LOG_FD + fi + else + echo "$progname: failed program was:" >&AS_MESSAGE_LOG_FD + cat conftest.$ac_ext >&5 + fi + rm -rf conftest* conftst* + + # Do not use the global_symbol_pipe unless it works. + if test "$pipe_works" = yes; then + break + else + lt_cv_sys_global_symbol_pipe= + fi +done +]) +if test -z "$lt_cv_sys_global_symbol_pipe"; then + lt_cv_sys_global_symbol_to_cdecl= +fi +if test -z "$lt_cv_sys_global_symbol_pipe$lt_cv_sys_global_symbol_to_cdecl"; then + AC_MSG_RESULT(failed) +else + AC_MSG_RESULT(ok) +fi + +# Response file support. +if test "$lt_cv_nm_interface" = "MS dumpbin"; then + nm_file_list_spec='@' +elif $NM --help 2>/dev/null | grep '[[@]]FILE' >/dev/null; then + nm_file_list_spec='@' +fi + +_LT_DECL([global_symbol_pipe], [lt_cv_sys_global_symbol_pipe], [1], + [Take the output of nm and produce a listing of raw symbols and C names]) +_LT_DECL([global_symbol_to_cdecl], [lt_cv_sys_global_symbol_to_cdecl], [1], + [Transform the output of nm in a proper C declaration]) +_LT_DECL([global_symbol_to_c_name_address], + [lt_cv_sys_global_symbol_to_c_name_address], [1], + [Transform the output of nm in a C name address pair]) +_LT_DECL([global_symbol_to_c_name_address_lib_prefix], + [lt_cv_sys_global_symbol_to_c_name_address_lib_prefix], [1], + [Transform the output of nm in a C name address pair when lib prefix is needed]) +_LT_DECL([], [nm_file_list_spec], [1], + [Specify filename containing input files for $NM]) +]) # _LT_CMD_GLOBAL_SYMBOLS + + +# _LT_COMPILER_PIC([TAGNAME]) +# --------------------------- +m4_defun([_LT_COMPILER_PIC], +[m4_require([_LT_TAG_COMPILER])dnl +_LT_TAGVAR(lt_prog_compiler_wl, $1)= +_LT_TAGVAR(lt_prog_compiler_pic, $1)= +_LT_TAGVAR(lt_prog_compiler_static, $1)= + +m4_if([$1], [CXX], [ + # C++ specific cases for pic, static, wl, etc. + if test "$GXX" = yes; then + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-static' + + case $host_os in + aix*) + # All AIX code is PIC. + if test "$host_cpu" = ia64; then + # AIX 5 now supports IA64 processor + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + fi + ;; + + amigaos*) + case $host_cpu in + powerpc) + # see comment about AmigaOS4 .so support + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC' + ;; + m68k) + # FIXME: we need at least 68020 code to build shared libraries, but + # adding the `-m68020' flag to GCC prevents building anything better, + # like `-m68040'. + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-m68020 -resident32 -malways-restore-a4' + ;; + esac + ;; + + beos* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*) + # PIC is the default for these OSes. + ;; + mingw* | cygwin* | os2* | pw32* | cegcc*) + # This hack is so that the source file can tell whether it is being + # built for inclusion in a dll (and should export symbols for example). + # Although the cygwin gcc ignores -fPIC, still need this for old-style + # (--disable-auto-import) libraries + m4_if([$1], [GCJ], [], + [_LT_TAGVAR(lt_prog_compiler_pic, $1)='-DDLL_EXPORT']) + ;; + darwin* | rhapsody*) + # PIC is the default on this platform + # Common symbols not allowed in MH_DYLIB files + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fno-common' + ;; + *djgpp*) + # DJGPP does not support shared libraries at all + _LT_TAGVAR(lt_prog_compiler_pic, $1)= + ;; + haiku*) + # PIC is the default for Haiku. + # The "-static" flag exists, but is broken. + _LT_TAGVAR(lt_prog_compiler_static, $1)= + ;; + interix[[3-9]]*) + # Interix 3.x gcc -fpic/-fPIC options generate broken code. + # Instead, we relocate shared libraries at runtime. + ;; + sysv4*MP*) + if test -d /usr/nec; then + _LT_TAGVAR(lt_prog_compiler_pic, $1)=-Kconform_pic + fi + ;; + hpux*) + # PIC is the default for 64-bit PA HP-UX, but not for 32-bit + # PA HP-UX. On IA64 HP-UX, PIC is the default but the pic flag + # sets the default TLS model and affects inlining. + case $host_cpu in + hppa*64*) + ;; + *) + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC' + ;; + esac + ;; + *qnx* | *nto*) + # QNX uses GNU C++, but need to define -shared option too, otherwise + # it will coredump. + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC -shared' + ;; + *) + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC' + ;; + esac + else + case $host_os in + aix[[4-9]]*) + # All AIX code is PIC. + if test "$host_cpu" = ia64; then + # AIX 5 now supports IA64 processor + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + else + _LT_TAGVAR(lt_prog_compiler_static, $1)='-bnso -bI:/lib/syscalls.exp' + fi + ;; + chorus*) + case $cc_basename in + cxch68*) + # Green Hills C++ Compiler + # _LT_TAGVAR(lt_prog_compiler_static, $1)="--no_auto_instantiation -u __main -u __premain -u _abort -r $COOL_DIR/lib/libOrb.a $MVME_DIR/lib/CC/libC.a $MVME_DIR/lib/classix/libcx.s.a" + ;; + esac + ;; + mingw* | cygwin* | os2* | pw32* | cegcc*) + # This hack is so that the source file can tell whether it is being + # built for inclusion in a dll (and should export symbols for example). + m4_if([$1], [GCJ], [], + [_LT_TAGVAR(lt_prog_compiler_pic, $1)='-DDLL_EXPORT']) + ;; + dgux*) + case $cc_basename in + ec++*) + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + ;; + ghcx*) + # Green Hills C++ Compiler + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-pic' + ;; + *) + ;; + esac + ;; + freebsd* | dragonfly*) + # FreeBSD uses GNU C++ + ;; + hpux9* | hpux10* | hpux11*) + case $cc_basename in + CC*) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_TAGVAR(lt_prog_compiler_static, $1)='${wl}-a ${wl}archive' + if test "$host_cpu" != ia64; then + _LT_TAGVAR(lt_prog_compiler_pic, $1)='+Z' + fi + ;; + aCC*) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_TAGVAR(lt_prog_compiler_static, $1)='${wl}-a ${wl}archive' + case $host_cpu in + hppa*64*|ia64*) + # +Z the default + ;; + *) + _LT_TAGVAR(lt_prog_compiler_pic, $1)='+Z' + ;; + esac + ;; + *) + ;; + esac + ;; + interix*) + # This is c89, which is MS Visual C++ (no shared libs) + # Anyone wants to do a port? + ;; + irix5* | irix6* | nonstopux*) + case $cc_basename in + CC*) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared' + # CC pic flag -KPIC is the default. + ;; + *) + ;; + esac + ;; + linux* | k*bsd*-gnu | kopensolaris*-gnu) + case $cc_basename in + KCC*) + # KAI C++ Compiler + _LT_TAGVAR(lt_prog_compiler_wl, $1)='--backend -Wl,' + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC' + ;; + ecpc* ) + # old Intel C++ for x86_64 which still supported -KPIC. + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-static' + ;; + icpc* ) + # Intel C++, used to be incompatible with GCC. + # ICC 10 doesn't accept -KPIC any more. + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-static' + ;; + pgCC* | pgcpp*) + # Portland Group C++ compiler + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fpic' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + ;; + cxx*) + # Compaq C++ + # Make sure the PIC flag is empty. It appears that all Alpha + # Linux and Compaq Tru64 Unix objects are PIC. + _LT_TAGVAR(lt_prog_compiler_pic, $1)= + _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared' + ;; + xlc* | xlC* | bgxl[[cC]]* | mpixl[[cC]]*) + # IBM XL 8.0, 9.0 on PPC and BlueGene + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-qpic' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-qstaticlink' + ;; + *) + case `$CC -V 2>&1 | sed 5q` in + *Sun\ C*) + # Sun C++ 5.9 + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld ' + ;; + esac + ;; + esac + ;; + lynxos*) + ;; + m88k*) + ;; + mvs*) + case $cc_basename in + cxx*) + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-W c,exportall' + ;; + *) + ;; + esac + ;; + netbsd*) + ;; + *qnx* | *nto*) + # QNX uses GNU C++, but need to define -shared option too, otherwise + # it will coredump. + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC -shared' + ;; + osf3* | osf4* | osf5*) + case $cc_basename in + KCC*) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='--backend -Wl,' + ;; + RCC*) + # Rational C++ 2.4.1 + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-pic' + ;; + cxx*) + # Digital/Compaq C++ + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + # Make sure the PIC flag is empty. It appears that all Alpha + # Linux and Compaq Tru64 Unix objects are PIC. + _LT_TAGVAR(lt_prog_compiler_pic, $1)= + _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared' + ;; + *) + ;; + esac + ;; + psos*) + ;; + solaris*) + case $cc_basename in + CC* | sunCC*) + # Sun C++ 4.2, 5.x and Centerline C++ + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld ' + ;; + gcx*) + # Green Hills C++ Compiler + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-PIC' + ;; + *) + ;; + esac + ;; + sunos4*) + case $cc_basename in + CC*) + # Sun C++ 4.x + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-pic' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + ;; + lcc*) + # Lucid + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-pic' + ;; + *) + ;; + esac + ;; + sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*) + case $cc_basename in + CC*) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + ;; + esac + ;; + tandem*) + case $cc_basename in + NCC*) + # NonStop-UX NCC 3.20 + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + ;; + *) + ;; + esac + ;; + vxworks*) + ;; + *) + _LT_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no + ;; + esac + fi +], +[ + if test "$GCC" = yes; then + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-static' + + case $host_os in + aix*) + # All AIX code is PIC. + if test "$host_cpu" = ia64; then + # AIX 5 now supports IA64 processor + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + fi + ;; + + amigaos*) + case $host_cpu in + powerpc) + # see comment about AmigaOS4 .so support + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC' + ;; + m68k) + # FIXME: we need at least 68020 code to build shared libraries, but + # adding the `-m68020' flag to GCC prevents building anything better, + # like `-m68040'. + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-m68020 -resident32 -malways-restore-a4' + ;; + esac + ;; + + beos* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*) + # PIC is the default for these OSes. + ;; + + mingw* | cygwin* | pw32* | os2* | cegcc*) + # This hack is so that the source file can tell whether it is being + # built for inclusion in a dll (and should export symbols for example). + # Although the cygwin gcc ignores -fPIC, still need this for old-style + # (--disable-auto-import) libraries + m4_if([$1], [GCJ], [], + [_LT_TAGVAR(lt_prog_compiler_pic, $1)='-DDLL_EXPORT']) + ;; + + darwin* | rhapsody*) + # PIC is the default on this platform + # Common symbols not allowed in MH_DYLIB files + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fno-common' + ;; + + haiku*) + # PIC is the default for Haiku. + # The "-static" flag exists, but is broken. + _LT_TAGVAR(lt_prog_compiler_static, $1)= + ;; + + hpux*) + # PIC is the default for 64-bit PA HP-UX, but not for 32-bit + # PA HP-UX. On IA64 HP-UX, PIC is the default but the pic flag + # sets the default TLS model and affects inlining. + case $host_cpu in + hppa*64*) + # +Z the default + ;; + *) + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC' + ;; + esac + ;; + + interix[[3-9]]*) + # Interix 3.x gcc -fpic/-fPIC options generate broken code. + # Instead, we relocate shared libraries at runtime. + ;; + + msdosdjgpp*) + # Just because we use GCC doesn't mean we suddenly get shared libraries + # on systems that don't support them. + _LT_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no + enable_shared=no + ;; + + *nto* | *qnx*) + # QNX uses GNU C++, but need to define -shared option too, otherwise + # it will coredump. + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC -shared' + ;; + + sysv4*MP*) + if test -d /usr/nec; then + _LT_TAGVAR(lt_prog_compiler_pic, $1)=-Kconform_pic + fi + ;; + + *) + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC' + ;; + esac + + case $cc_basename in + nvcc*) # Cuda Compiler Driver 2.2 + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Xlinker ' + if test -n "$_LT_TAGVAR(lt_prog_compiler_pic, $1)"; then + _LT_TAGVAR(lt_prog_compiler_pic, $1)="-Xcompiler $_LT_TAGVAR(lt_prog_compiler_pic, $1)" + fi + ;; + esac + else + # PORTME Check for flag to pass linker flags through the system compiler. + case $host_os in + aix*) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + if test "$host_cpu" = ia64; then + # AIX 5 now supports IA64 processor + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + else + _LT_TAGVAR(lt_prog_compiler_static, $1)='-bnso -bI:/lib/syscalls.exp' + fi + ;; + + mingw* | cygwin* | pw32* | os2* | cegcc*) + # This hack is so that the source file can tell whether it is being + # built for inclusion in a dll (and should export symbols for example). + m4_if([$1], [GCJ], [], + [_LT_TAGVAR(lt_prog_compiler_pic, $1)='-DDLL_EXPORT']) + ;; + + hpux9* | hpux10* | hpux11*) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but + # not for PA HP-UX. + case $host_cpu in + hppa*64*|ia64*) + # +Z the default + ;; + *) + _LT_TAGVAR(lt_prog_compiler_pic, $1)='+Z' + ;; + esac + # Is there a better lt_prog_compiler_static that works with the bundled CC? + _LT_TAGVAR(lt_prog_compiler_static, $1)='${wl}-a ${wl}archive' + ;; + + irix5* | irix6* | nonstopux*) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + # PIC (with -KPIC) is the default. + _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared' + ;; + + linux* | k*bsd*-gnu | kopensolaris*-gnu) + case $cc_basename in + # old Intel for x86_64 which still supported -KPIC. + ecc*) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-static' + ;; + # icc used to be incompatible with GCC. + # ICC 10 doesn't accept -KPIC any more. + icc* | ifort*) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-static' + ;; + # Lahey Fortran 8.1. + lf95*) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_TAGVAR(lt_prog_compiler_pic, $1)='--shared' + _LT_TAGVAR(lt_prog_compiler_static, $1)='--static' + ;; + nagfor*) + # NAG Fortran compiler + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,-Wl,,' + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-PIC' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + ;; + pgcc* | pgf77* | pgf90* | pgf95* | pgfortran*) + # Portland Group compilers (*not* the Pentium gcc compiler, + # which looks to be a dead project) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fpic' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + ;; + ccc*) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + # All Alpha code is PIC. + _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared' + ;; + xl* | bgxl* | bgf* | mpixl*) + # IBM XL C 8.0/Fortran 10.1, 11.1 on PPC and BlueGene + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-qpic' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-qstaticlink' + ;; + *) + case `$CC -V 2>&1 | sed 5q` in + *Sun\ Ceres\ Fortran* | *Sun*Fortran*\ [[1-7]].* | *Sun*Fortran*\ 8.[[0-3]]*) + # Sun Fortran 8.3 passes all unrecognized flags to the linker + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + _LT_TAGVAR(lt_prog_compiler_wl, $1)='' + ;; + *Sun\ F* | *Sun*Fortran*) + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld ' + ;; + *Sun\ C*) + # Sun C 5.9 + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + ;; + *Intel*\ [[CF]]*Compiler*) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-static' + ;; + *Portland\ Group*) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fpic' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + ;; + esac + ;; + esac + ;; + + newsos6) + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + ;; + + *nto* | *qnx*) + # QNX uses GNU C++, but need to define -shared option too, otherwise + # it will coredump. + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC -shared' + ;; + + osf3* | osf4* | osf5*) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + # All OSF/1 code is PIC. + _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared' + ;; + + rdos*) + _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared' + ;; + + solaris*) + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + case $cc_basename in + f77* | f90* | f95* | sunf77* | sunf90* | sunf95*) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld ';; + *) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,';; + esac + ;; + + sunos4*) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld ' + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-PIC' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + ;; + + sysv4 | sysv4.2uw2* | sysv4.3*) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + ;; + + sysv4*MP*) + if test -d /usr/nec ;then + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-Kconform_pic' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + fi + ;; + + sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + ;; + + unicos*) + _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no + ;; + + uts4*) + _LT_TAGVAR(lt_prog_compiler_pic, $1)='-pic' + _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + ;; + + *) + _LT_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no + ;; + esac + fi +]) +case $host_os in + # For platforms which do not support PIC, -DPIC is meaningless: + *djgpp*) + _LT_TAGVAR(lt_prog_compiler_pic, $1)= + ;; + *) + _LT_TAGVAR(lt_prog_compiler_pic, $1)="$_LT_TAGVAR(lt_prog_compiler_pic, $1)@&t@m4_if([$1],[],[ -DPIC],[m4_if([$1],[CXX],[ -DPIC],[])])" + ;; +esac + +AC_CACHE_CHECK([for $compiler option to produce PIC], + [_LT_TAGVAR(lt_cv_prog_compiler_pic, $1)], + [_LT_TAGVAR(lt_cv_prog_compiler_pic, $1)=$_LT_TAGVAR(lt_prog_compiler_pic, $1)]) +_LT_TAGVAR(lt_prog_compiler_pic, $1)=$_LT_TAGVAR(lt_cv_prog_compiler_pic, $1) + +# +# Check to make sure the PIC flag actually works. +# +if test -n "$_LT_TAGVAR(lt_prog_compiler_pic, $1)"; then + _LT_COMPILER_OPTION([if $compiler PIC flag $_LT_TAGVAR(lt_prog_compiler_pic, $1) works], + [_LT_TAGVAR(lt_cv_prog_compiler_pic_works, $1)], + [$_LT_TAGVAR(lt_prog_compiler_pic, $1)@&t@m4_if([$1],[],[ -DPIC],[m4_if([$1],[CXX],[ -DPIC],[])])], [], + [case $_LT_TAGVAR(lt_prog_compiler_pic, $1) in + "" | " "*) ;; + *) _LT_TAGVAR(lt_prog_compiler_pic, $1)=" $_LT_TAGVAR(lt_prog_compiler_pic, $1)" ;; + esac], + [_LT_TAGVAR(lt_prog_compiler_pic, $1)= + _LT_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no]) +fi +_LT_TAGDECL([pic_flag], [lt_prog_compiler_pic], [1], + [Additional compiler flags for building library objects]) + +_LT_TAGDECL([wl], [lt_prog_compiler_wl], [1], + [How to pass a linker flag through the compiler]) +# +# Check to make sure the static flag actually works. +# +wl=$_LT_TAGVAR(lt_prog_compiler_wl, $1) eval lt_tmp_static_flag=\"$_LT_TAGVAR(lt_prog_compiler_static, $1)\" +_LT_LINKER_OPTION([if $compiler static flag $lt_tmp_static_flag works], + _LT_TAGVAR(lt_cv_prog_compiler_static_works, $1), + $lt_tmp_static_flag, + [], + [_LT_TAGVAR(lt_prog_compiler_static, $1)=]) +_LT_TAGDECL([link_static_flag], [lt_prog_compiler_static], [1], + [Compiler flag to prevent dynamic linking]) +])# _LT_COMPILER_PIC + + +# _LT_LINKER_SHLIBS([TAGNAME]) +# ---------------------------- +# See if the linker supports building shared libraries. +m4_defun([_LT_LINKER_SHLIBS], +[AC_REQUIRE([LT_PATH_LD])dnl +AC_REQUIRE([LT_PATH_NM])dnl +m4_require([_LT_PATH_MANIFEST_TOOL])dnl +m4_require([_LT_FILEUTILS_DEFAULTS])dnl +m4_require([_LT_DECL_EGREP])dnl +m4_require([_LT_DECL_SED])dnl +m4_require([_LT_CMD_GLOBAL_SYMBOLS])dnl +m4_require([_LT_TAG_COMPILER])dnl +AC_MSG_CHECKING([whether the $compiler linker ($LD) supports shared libraries]) +m4_if([$1], [CXX], [ + _LT_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols' + _LT_TAGVAR(exclude_expsyms, $1)=['_GLOBAL_OFFSET_TABLE_|_GLOBAL__F[ID]_.*'] + case $host_os in + aix[[4-9]]*) + # If we're using GNU nm, then we don't want the "-C" option. + # -C means demangle to AIX nm, but means don't demangle with GNU nm + # Also, AIX nm treats weak defined symbols like other global defined + # symbols, whereas GNU nm marks them as "W". + if $NM -V 2>&1 | $GREP 'GNU' > /dev/null; then + _LT_TAGVAR(export_symbols_cmds, $1)='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B") || (\$ 2 == "W")) && ([substr](\$ 3,1,1) != ".")) { print \$ 3 } }'\'' | sort -u > $export_symbols' + else + _LT_TAGVAR(export_symbols_cmds, $1)='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B")) && ([substr](\$ 3,1,1) != ".")) { print \$ 3 } }'\'' | sort -u > $export_symbols' + fi + ;; + pw32*) + _LT_TAGVAR(export_symbols_cmds, $1)="$ltdll_cmds" + ;; + cygwin* | mingw* | cegcc*) + case $cc_basename in + cl*) + _LT_TAGVAR(exclude_expsyms, $1)='_NULL_IMPORT_DESCRIPTOR|_IMPORT_DESCRIPTOR_.*' + ;; + *) + _LT_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[[BCDGRS]][[ ]]/s/.*[[ ]]\([[^ ]]*\)/\1 DATA/;s/^.*[[ ]]__nm__\([[^ ]]*\)[[ ]][[^ ]]*/\1 DATA/;/^I[[ ]]/d;/^[[AITW]][[ ]]/s/.* //'\'' | sort | uniq > $export_symbols' + _LT_TAGVAR(exclude_expsyms, $1)=['[_]+GLOBAL_OFFSET_TABLE_|[_]+GLOBAL__[FID]_.*|[_]+head_[A-Za-z0-9_]+_dll|[A-Za-z0-9_]+_dll_iname'] + ;; + esac + ;; + *) + _LT_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols' + ;; + esac +], [ + runpath_var= + _LT_TAGVAR(allow_undefined_flag, $1)= + _LT_TAGVAR(always_export_symbols, $1)=no + _LT_TAGVAR(archive_cmds, $1)= + _LT_TAGVAR(archive_expsym_cmds, $1)= + _LT_TAGVAR(compiler_needs_object, $1)=no + _LT_TAGVAR(enable_shared_with_static_runtimes, $1)=no + _LT_TAGVAR(export_dynamic_flag_spec, $1)= + _LT_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols' + _LT_TAGVAR(hardcode_automatic, $1)=no + _LT_TAGVAR(hardcode_direct, $1)=no + _LT_TAGVAR(hardcode_direct_absolute, $1)=no + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)= + _LT_TAGVAR(hardcode_libdir_separator, $1)= + _LT_TAGVAR(hardcode_minus_L, $1)=no + _LT_TAGVAR(hardcode_shlibpath_var, $1)=unsupported + _LT_TAGVAR(inherit_rpath, $1)=no + _LT_TAGVAR(link_all_deplibs, $1)=unknown + _LT_TAGVAR(module_cmds, $1)= + _LT_TAGVAR(module_expsym_cmds, $1)= + _LT_TAGVAR(old_archive_from_new_cmds, $1)= + _LT_TAGVAR(old_archive_from_expsyms_cmds, $1)= + _LT_TAGVAR(thread_safe_flag_spec, $1)= + _LT_TAGVAR(whole_archive_flag_spec, $1)= + # include_expsyms should be a list of space-separated symbols to be *always* + # included in the symbol list + _LT_TAGVAR(include_expsyms, $1)= + # exclude_expsyms can be an extended regexp of symbols to exclude + # it will be wrapped by ` (' and `)$', so one must not match beginning or + # end of line. Example: `a|bc|.*d.*' will exclude the symbols `a' and `bc', + # as well as any symbol that contains `d'. + _LT_TAGVAR(exclude_expsyms, $1)=['_GLOBAL_OFFSET_TABLE_|_GLOBAL__F[ID]_.*'] + # Although _GLOBAL_OFFSET_TABLE_ is a valid symbol C name, most a.out + # platforms (ab)use it in PIC code, but their linkers get confused if + # the symbol is explicitly referenced. Since portable code cannot + # rely on this symbol name, it's probably fine to never include it in + # preloaded symbol tables. + # Exclude shared library initialization/finalization symbols. +dnl Note also adjust exclude_expsyms for C++ above. + extract_expsyms_cmds= + + case $host_os in + cygwin* | mingw* | pw32* | cegcc*) + # FIXME: the MSVC++ port hasn't been tested in a loooong time + # When not using gcc, we currently assume that we are using + # Microsoft Visual C++. + if test "$GCC" != yes; then + with_gnu_ld=no + fi + ;; + interix*) + # we just hope/assume this is gcc and not c89 (= MSVC++) + with_gnu_ld=yes + ;; + openbsd*) + with_gnu_ld=no + ;; + esac + + _LT_TAGVAR(ld_shlibs, $1)=yes + + # On some targets, GNU ld is compatible enough with the native linker + # that we're better off using the native interface for both. + lt_use_gnu_ld_interface=no + if test "$with_gnu_ld" = yes; then + case $host_os in + aix*) + # The AIX port of GNU ld has always aspired to compatibility + # with the native linker. However, as the warning in the GNU ld + # block says, versions before 2.19.5* couldn't really create working + # shared libraries, regardless of the interface used. + case `$LD -v 2>&1` in + *\ \(GNU\ Binutils\)\ 2.19.5*) ;; + *\ \(GNU\ Binutils\)\ 2.[[2-9]]*) ;; + *\ \(GNU\ Binutils\)\ [[3-9]]*) ;; + *) + lt_use_gnu_ld_interface=yes + ;; + esac + ;; + *) + lt_use_gnu_ld_interface=yes + ;; + esac + fi + + if test "$lt_use_gnu_ld_interface" = yes; then + # If archive_cmds runs LD, not CC, wlarc should be empty + wlarc='${wl}' + + # Set some defaults for GNU ld with shared library support. These + # are reset later if shared libraries are not supported. Putting them + # here allows them to be overridden if necessary. + runpath_var=LD_RUN_PATH + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir' + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic' + # ancient GNU ld didn't support --whole-archive et. al. + if $LD --help 2>&1 | $GREP 'no-whole-archive' > /dev/null; then + _LT_TAGVAR(whole_archive_flag_spec, $1)="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive' + else + _LT_TAGVAR(whole_archive_flag_spec, $1)= + fi + supports_anon_versioning=no + case `$LD -v 2>&1` in + *GNU\ gold*) supports_anon_versioning=yes ;; + *\ [[01]].* | *\ 2.[[0-9]].* | *\ 2.10.*) ;; # catch versions < 2.11 + *\ 2.11.93.0.2\ *) supports_anon_versioning=yes ;; # RH7.3 ... + *\ 2.11.92.0.12\ *) supports_anon_versioning=yes ;; # Mandrake 8.2 ... + *\ 2.11.*) ;; # other 2.11 versions + *) supports_anon_versioning=yes ;; + esac + + # See if GNU ld supports shared libraries. + case $host_os in + aix[[3-9]]*) + # On AIX/PPC, the GNU linker is very broken + if test "$host_cpu" != ia64; then + _LT_TAGVAR(ld_shlibs, $1)=no + cat <<_LT_EOF 1>&2 + +*** Warning: the GNU linker, at least up to release 2.19, is reported +*** to be unable to reliably create shared libraries on AIX. +*** Therefore, libtool is disabling shared libraries support. If you +*** really care for shared libraries, you may want to install binutils +*** 2.20 or above, or modify your PATH so that a non-GNU linker is found. +*** You will then need to restart the configuration process. + +_LT_EOF + fi + ;; + + amigaos*) + case $host_cpu in + powerpc) + # see comment about AmigaOS4 .so support + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + _LT_TAGVAR(archive_expsym_cmds, $1)='' + ;; + m68k) + _LT_TAGVAR(archive_cmds, $1)='$RM $output_objdir/a2ixlibrary.data~$ECHO "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$ECHO "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$ECHO "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$ECHO "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)' + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir' + _LT_TAGVAR(hardcode_minus_L, $1)=yes + ;; + esac + ;; + + beos*) + if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then + _LT_TAGVAR(allow_undefined_flag, $1)=unsupported + # Joseph Beckenbach says some releases of gcc + # support --undefined. This deserves some investigation. FIXME + _LT_TAGVAR(archive_cmds, $1)='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + else + _LT_TAGVAR(ld_shlibs, $1)=no + fi + ;; + + cygwin* | mingw* | pw32* | cegcc*) + # _LT_TAGVAR(hardcode_libdir_flag_spec, $1) is actually meaningless, + # as there is no search path for DLLs. + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir' + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-all-symbols' + _LT_TAGVAR(allow_undefined_flag, $1)=unsupported + _LT_TAGVAR(always_export_symbols, $1)=no + _LT_TAGVAR(enable_shared_with_static_runtimes, $1)=yes + _LT_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[[BCDGRS]][[ ]]/s/.*[[ ]]\([[^ ]]*\)/\1 DATA/;s/^.*[[ ]]__nm__\([[^ ]]*\)[[ ]][[^ ]]*/\1 DATA/;/^I[[ ]]/d;/^[[AITW]][[ ]]/s/.* //'\'' | sort | uniq > $export_symbols' + _LT_TAGVAR(exclude_expsyms, $1)=['[_]+GLOBAL_OFFSET_TABLE_|[_]+GLOBAL__[FID]_.*|[_]+head_[A-Za-z0-9_]+_dll|[A-Za-z0-9_]+_dll_iname'] + + if $LD --help 2>&1 | $GREP 'auto-import' > /dev/null; then + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib' + # If the export-symbols file already is a .def file (1st line + # is EXPORTS), use it as is; otherwise, prepend... + _LT_TAGVAR(archive_expsym_cmds, $1)='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then + cp $export_symbols $output_objdir/$soname.def; + else + echo EXPORTS > $output_objdir/$soname.def; + cat $export_symbols >> $output_objdir/$soname.def; + fi~ + $CC -shared $output_objdir/$soname.def $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib' + else + _LT_TAGVAR(ld_shlibs, $1)=no + fi + ;; + + haiku*) + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + _LT_TAGVAR(link_all_deplibs, $1)=yes + ;; + + interix[[3-9]]*) + _LT_TAGVAR(hardcode_direct, $1)=no + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir' + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E' + # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc. + # Instead, shared libraries are loaded at an image base (0x10000000 by + # default) and relocated if they conflict, which is a slow very memory + # consuming and fragmenting process. To avoid this, we pick a random, + # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link + # time. Moving up from 0x10000000 also allows more sbrk(2) space. + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib' + _LT_TAGVAR(archive_expsym_cmds, $1)='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib' + ;; + + gnu* | linux* | tpf* | k*bsd*-gnu | kopensolaris*-gnu) + tmp_diet=no + if test "$host_os" = linux-dietlibc; then + case $cc_basename in + diet\ *) tmp_diet=yes;; # linux-dietlibc with static linking (!diet-dyn) + esac + fi + if $LD --help 2>&1 | $EGREP ': supported targets:.* elf' > /dev/null \ + && test "$tmp_diet" = no + then + tmp_addflag=' $pic_flag' + tmp_sharedflag='-shared' + case $cc_basename,$host_cpu in + pgcc*) # Portland Group C compiler + _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive' + tmp_addflag=' $pic_flag' + ;; + pgf77* | pgf90* | pgf95* | pgfortran*) + # Portland Group f77 and f90 compilers + _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive' + tmp_addflag=' $pic_flag -Mnomain' ;; + ecc*,ia64* | icc*,ia64*) # Intel C compiler on ia64 + tmp_addflag=' -i_dynamic' ;; + efc*,ia64* | ifort*,ia64*) # Intel Fortran compiler on ia64 + tmp_addflag=' -i_dynamic -nofor_main' ;; + ifc* | ifort*) # Intel Fortran compiler + tmp_addflag=' -nofor_main' ;; + lf95*) # Lahey Fortran 8.1 + _LT_TAGVAR(whole_archive_flag_spec, $1)= + tmp_sharedflag='--shared' ;; + xl[[cC]]* | bgxl[[cC]]* | mpixl[[cC]]*) # IBM XL C 8.0 on PPC (deal with xlf below) + tmp_sharedflag='-qmkshrobj' + tmp_addflag= ;; + nvcc*) # Cuda Compiler Driver 2.2 + _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive' + _LT_TAGVAR(compiler_needs_object, $1)=yes + ;; + esac + case `$CC -V 2>&1 | sed 5q` in + *Sun\ C*) # Sun C 5.9 + _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`new_convenience=; for conv in $convenience\"\"; do test -z \"$conv\" || new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive' + _LT_TAGVAR(compiler_needs_object, $1)=yes + tmp_sharedflag='-G' ;; + *Sun\ F*) # Sun Fortran 8.3 + tmp_sharedflag='-G' ;; + esac + _LT_TAGVAR(archive_cmds, $1)='$CC '"$tmp_sharedflag""$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + + if test "x$supports_anon_versioning" = xyes; then + _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $output_objdir/$libname.ver~ + cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~ + echo "local: *; };" >> $output_objdir/$libname.ver~ + $CC '"$tmp_sharedflag""$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-version-script ${wl}$output_objdir/$libname.ver -o $lib' + fi + + case $cc_basename in + xlf* | bgf* | bgxlf* | mpixlf*) + # IBM XL Fortran 10.1 on PPC cannot create shared libs itself + _LT_TAGVAR(whole_archive_flag_spec, $1)='--whole-archive$convenience --no-whole-archive' + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir' + _LT_TAGVAR(archive_cmds, $1)='$LD -shared $libobjs $deplibs $linker_flags -soname $soname -o $lib' + if test "x$supports_anon_versioning" = xyes; then + _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $output_objdir/$libname.ver~ + cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~ + echo "local: *; };" >> $output_objdir/$libname.ver~ + $LD -shared $libobjs $deplibs $linker_flags -soname $soname -version-script $output_objdir/$libname.ver -o $lib' + fi + ;; + esac + else + _LT_TAGVAR(ld_shlibs, $1)=no + fi + ;; + + netbsd*) + if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then + _LT_TAGVAR(archive_cmds, $1)='$LD -Bshareable $libobjs $deplibs $linker_flags -o $lib' + wlarc= + else + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + fi + ;; + + solaris*) + if $LD -v 2>&1 | $GREP 'BFD 2\.8' > /dev/null; then + _LT_TAGVAR(ld_shlibs, $1)=no + cat <<_LT_EOF 1>&2 + +*** Warning: The releases 2.8.* of the GNU linker cannot reliably +*** create shared libraries on Solaris systems. Therefore, libtool +*** is disabling shared libraries support. We urge you to upgrade GNU +*** binutils to release 2.9.1 or newer. Another option is to modify +*** your PATH or compiler configuration so that the native linker is +*** used, and then restart. + +_LT_EOF + elif $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + else + _LT_TAGVAR(ld_shlibs, $1)=no + fi + ;; + + sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX*) + case `$LD -v 2>&1` in + *\ [[01]].* | *\ 2.[[0-9]].* | *\ 2.1[[0-5]].*) + _LT_TAGVAR(ld_shlibs, $1)=no + cat <<_LT_EOF 1>&2 + +*** Warning: Releases of the GNU linker prior to 2.16.91.0.3 can not +*** reliably create shared libraries on SCO systems. Therefore, libtool +*** is disabling shared libraries support. We urge you to upgrade GNU +*** binutils to release 2.16.91.0.3 or newer. Another option is to modify +*** your PATH or compiler configuration so that the native linker is +*** used, and then restart. + +_LT_EOF + ;; + *) + # For security reasons, it is highly recommended that you always + # use absolute paths for naming shared libraries, and exclude the + # DT_RUNPATH tag from executables and libraries. But doing so + # requires that you compile everything twice, which is a pain. + if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir' + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + else + _LT_TAGVAR(ld_shlibs, $1)=no + fi + ;; + esac + ;; + + sunos4*) + _LT_TAGVAR(archive_cmds, $1)='$LD -assert pure-text -Bshareable -o $lib $libobjs $deplibs $linker_flags' + wlarc= + _LT_TAGVAR(hardcode_direct, $1)=yes + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + + *) + if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + else + _LT_TAGVAR(ld_shlibs, $1)=no + fi + ;; + esac + + if test "$_LT_TAGVAR(ld_shlibs, $1)" = no; then + runpath_var= + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)= + _LT_TAGVAR(export_dynamic_flag_spec, $1)= + _LT_TAGVAR(whole_archive_flag_spec, $1)= + fi + else + # PORTME fill in a description of your system's linker (not GNU ld) + case $host_os in + aix3*) + _LT_TAGVAR(allow_undefined_flag, $1)=unsupported + _LT_TAGVAR(always_export_symbols, $1)=yes + _LT_TAGVAR(archive_expsym_cmds, $1)='$LD -o $output_objdir/$soname $libobjs $deplibs $linker_flags -bE:$export_symbols -T512 -H512 -bM:SRE~$AR $AR_FLAGS $lib $output_objdir/$soname' + # Note: this linker hardcodes the directories in LIBPATH if there + # are no directories specified by -L. + _LT_TAGVAR(hardcode_minus_L, $1)=yes + if test "$GCC" = yes && test -z "$lt_prog_compiler_static"; then + # Neither direct hardcoding nor static linking is supported with a + # broken collect2. + _LT_TAGVAR(hardcode_direct, $1)=unsupported + fi + ;; + + aix[[4-9]]*) + if test "$host_cpu" = ia64; then + # On IA64, the linker does run time linking by default, so we don't + # have to do anything special. + aix_use_runtimelinking=no + exp_sym_flag='-Bexport' + no_entry_flag="" + else + # If we're using GNU nm, then we don't want the "-C" option. + # -C means demangle to AIX nm, but means don't demangle with GNU nm + # Also, AIX nm treats weak defined symbols like other global + # defined symbols, whereas GNU nm marks them as "W". + if $NM -V 2>&1 | $GREP 'GNU' > /dev/null; then + _LT_TAGVAR(export_symbols_cmds, $1)='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B") || (\$ 2 == "W")) && ([substr](\$ 3,1,1) != ".")) { print \$ 3 } }'\'' | sort -u > $export_symbols' + else + _LT_TAGVAR(export_symbols_cmds, $1)='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B")) && ([substr](\$ 3,1,1) != ".")) { print \$ 3 } }'\'' | sort -u > $export_symbols' + fi + aix_use_runtimelinking=no + + # Test if we are trying to use run time linking or normal + # AIX style linking. If -brtl is somewhere in LDFLAGS, we + # need to do runtime linking. + case $host_os in aix4.[[23]]|aix4.[[23]].*|aix[[5-9]]*) + for ld_flag in $LDFLAGS; do + if (test $ld_flag = "-brtl" || test $ld_flag = "-Wl,-brtl"); then + aix_use_runtimelinking=yes + break + fi + done + ;; + esac + + exp_sym_flag='-bexport' + no_entry_flag='-bnoentry' + fi + + # When large executables or shared objects are built, AIX ld can + # have problems creating the table of contents. If linking a library + # or program results in "error TOC overflow" add -mminimal-toc to + # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not + # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS. + + _LT_TAGVAR(archive_cmds, $1)='' + _LT_TAGVAR(hardcode_direct, $1)=yes + _LT_TAGVAR(hardcode_direct_absolute, $1)=yes + _LT_TAGVAR(hardcode_libdir_separator, $1)=':' + _LT_TAGVAR(link_all_deplibs, $1)=yes + _LT_TAGVAR(file_list_spec, $1)='${wl}-f,' + + if test "$GCC" = yes; then + case $host_os in aix4.[[012]]|aix4.[[012]].*) + # We only want to do this on AIX 4.2 and lower, the check + # below for broken collect2 doesn't work under 4.3+ + collect2name=`${CC} -print-prog-name=collect2` + if test -f "$collect2name" && + strings "$collect2name" | $GREP resolve_lib_name >/dev/null + then + # We have reworked collect2 + : + else + # We have old collect2 + _LT_TAGVAR(hardcode_direct, $1)=unsupported + # It fails to find uninstalled libraries when the uninstalled + # path is not listed in the libpath. Setting hardcode_minus_L + # to unsupported forces relinking + _LT_TAGVAR(hardcode_minus_L, $1)=yes + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir' + _LT_TAGVAR(hardcode_libdir_separator, $1)= + fi + ;; + esac + shared_flag='-shared' + if test "$aix_use_runtimelinking" = yes; then + shared_flag="$shared_flag "'${wl}-G' + fi + else + # not using gcc + if test "$host_cpu" = ia64; then + # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release + # chokes on -Wl,-G. The following line is correct: + shared_flag='-G' + else + if test "$aix_use_runtimelinking" = yes; then + shared_flag='${wl}-G' + else + shared_flag='${wl}-bM:SRE' + fi + fi + fi + + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-bexpall' + # It seems that -bexpall does not export symbols beginning with + # underscore (_), so it is better to generate a list of symbols to export. + _LT_TAGVAR(always_export_symbols, $1)=yes + if test "$aix_use_runtimelinking" = yes; then + # Warning - without using the other runtime loading flags (-brtl), + # -berok will link without error, but may produce a broken library. + _LT_TAGVAR(allow_undefined_flag, $1)='-berok' + # Determine the default libpath from the value encoded in an + # empty executable. + _LT_SYS_MODULE_PATH_AIX([$1]) + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-blibpath:$libdir:'"$aix_libpath" + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then func_echo_all "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag" + else + if test "$host_cpu" = ia64; then + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R $libdir:/usr/lib:/lib' + _LT_TAGVAR(allow_undefined_flag, $1)="-z nodefs" + _LT_TAGVAR(archive_expsym_cmds, $1)="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols" + else + # Determine the default libpath from the value encoded in an + # empty executable. + _LT_SYS_MODULE_PATH_AIX([$1]) + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-blibpath:$libdir:'"$aix_libpath" + # Warning - without using the other run time loading flags, + # -berok will link without error, but may produce a broken library. + _LT_TAGVAR(no_undefined_flag, $1)=' ${wl}-bernotok' + _LT_TAGVAR(allow_undefined_flag, $1)=' ${wl}-berok' + if test "$with_gnu_ld" = yes; then + # We only use this code for GNU lds that support --whole-archive. + _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive$convenience ${wl}--no-whole-archive' + else + # Exported symbols can be pulled into shared objects from archives + _LT_TAGVAR(whole_archive_flag_spec, $1)='$convenience' + fi + _LT_TAGVAR(archive_cmds_need_lc, $1)=yes + # This is similar to how AIX traditionally builds its shared libraries. + _LT_TAGVAR(archive_expsym_cmds, $1)="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname' + fi + fi + ;; + + amigaos*) + case $host_cpu in + powerpc) + # see comment about AmigaOS4 .so support + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + _LT_TAGVAR(archive_expsym_cmds, $1)='' + ;; + m68k) + _LT_TAGVAR(archive_cmds, $1)='$RM $output_objdir/a2ixlibrary.data~$ECHO "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$ECHO "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$ECHO "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$ECHO "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)' + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir' + _LT_TAGVAR(hardcode_minus_L, $1)=yes + ;; + esac + ;; + + bsdi[[45]]*) + _LT_TAGVAR(export_dynamic_flag_spec, $1)=-rdynamic + ;; + + cygwin* | mingw* | pw32* | cegcc*) + # When not using gcc, we currently assume that we are using + # Microsoft Visual C++. + # hardcode_libdir_flag_spec is actually meaningless, as there is + # no search path for DLLs. + case $cc_basename in + cl*) + # Native MSVC + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)=' ' + _LT_TAGVAR(allow_undefined_flag, $1)=unsupported + _LT_TAGVAR(always_export_symbols, $1)=yes + _LT_TAGVAR(file_list_spec, $1)='@' + # Tell ltmain to make .lib files, not .a files. + libext=lib + # Tell ltmain to make .dll files, not .so files. + shrext_cmds=".dll" + # FIXME: Setting linknames here is a bad hack. + _LT_TAGVAR(archive_cmds, $1)='$CC -o $output_objdir/$soname $libobjs $compiler_flags $deplibs -Wl,-dll~linknames=' + _LT_TAGVAR(archive_expsym_cmds, $1)='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then + sed -n -e 's/\\\\\\\(.*\\\\\\\)/-link\\\ -EXPORT:\\\\\\\1/' -e '1\\\!p' < $export_symbols > $output_objdir/$soname.exp; + else + sed -e 's/\\\\\\\(.*\\\\\\\)/-link\\\ -EXPORT:\\\\\\\1/' < $export_symbols > $output_objdir/$soname.exp; + fi~ + $CC -o $tool_output_objdir$soname $libobjs $compiler_flags $deplibs "@$tool_output_objdir$soname.exp" -Wl,-DLL,-IMPLIB:"$tool_output_objdir$libname.dll.lib"~ + linknames=' + # The linker will not automatically build a static lib if we build a DLL. + # _LT_TAGVAR(old_archive_from_new_cmds, $1)='true' + _LT_TAGVAR(enable_shared_with_static_runtimes, $1)=yes + _LT_TAGVAR(exclude_expsyms, $1)='_NULL_IMPORT_DESCRIPTOR|_IMPORT_DESCRIPTOR_.*' + _LT_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[[BCDGRS]][[ ]]/s/.*[[ ]]\([[^ ]]*\)/\1,DATA/'\'' | $SED -e '\''/^[[AITW]][[ ]]/s/.*[[ ]]//'\'' | sort | uniq > $export_symbols' + # Don't use ranlib + _LT_TAGVAR(old_postinstall_cmds, $1)='chmod 644 $oldlib' + _LT_TAGVAR(postlink_cmds, $1)='lt_outputfile="@OUTPUT@"~ + lt_tool_outputfile="@TOOL_OUTPUT@"~ + case $lt_outputfile in + *.exe|*.EXE) ;; + *) + lt_outputfile="$lt_outputfile.exe" + lt_tool_outputfile="$lt_tool_outputfile.exe" + ;; + esac~ + if test "$MANIFEST_TOOL" != ":" && test -f "$lt_outputfile.manifest"; then + $MANIFEST_TOOL -manifest "$lt_tool_outputfile.manifest" -outputresource:"$lt_tool_outputfile" || exit 1; + $RM "$lt_outputfile.manifest"; + fi' + ;; + *) + # Assume MSVC wrapper + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)=' ' + _LT_TAGVAR(allow_undefined_flag, $1)=unsupported + # Tell ltmain to make .lib files, not .a files. + libext=lib + # Tell ltmain to make .dll files, not .so files. + shrext_cmds=".dll" + # FIXME: Setting linknames here is a bad hack. + _LT_TAGVAR(archive_cmds, $1)='$CC -o $lib $libobjs $compiler_flags `func_echo_all "$deplibs" | $SED '\''s/ -lc$//'\''` -link -dll~linknames=' + # The linker will automatically build a .lib file if we build a DLL. + _LT_TAGVAR(old_archive_from_new_cmds, $1)='true' + # FIXME: Should let the user specify the lib program. + _LT_TAGVAR(old_archive_cmds, $1)='lib -OUT:$oldlib$oldobjs$old_deplibs' + _LT_TAGVAR(enable_shared_with_static_runtimes, $1)=yes + ;; + esac + ;; + + darwin* | rhapsody*) + _LT_DARWIN_LINKER_FEATURES($1) + ;; + + dgux*) + _LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir' + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + + # FreeBSD 2.2.[012] allows us to include c++rt0.o to get C++ constructor + # support. Future versions do this automatically, but an explicit c++rt0.o + # does not break anything, and helps significantly (at the cost of a little + # extra space). + freebsd2.2*) + _LT_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags /usr/lib/c++rt0.o' + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir' + _LT_TAGVAR(hardcode_direct, $1)=yes + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + + # Unfortunately, older versions of FreeBSD 2 do not have this feature. + freebsd2.*) + _LT_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' + _LT_TAGVAR(hardcode_direct, $1)=yes + _LT_TAGVAR(hardcode_minus_L, $1)=yes + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + + # FreeBSD 3 and greater uses gcc -shared to do shared libraries. + freebsd* | dragonfly*) + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags' + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir' + _LT_TAGVAR(hardcode_direct, $1)=yes + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + + hpux9*) + if test "$GCC" = yes; then + _LT_TAGVAR(archive_cmds, $1)='$RM $output_objdir/$soname~$CC -shared $pic_flag ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $libobjs $deplibs $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib' + else + _LT_TAGVAR(archive_cmds, $1)='$RM $output_objdir/$soname~$LD -b +b $install_libdir -o $output_objdir/$soname $libobjs $deplibs $linker_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib' + fi + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir' + _LT_TAGVAR(hardcode_libdir_separator, $1)=: + _LT_TAGVAR(hardcode_direct, $1)=yes + + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + _LT_TAGVAR(hardcode_minus_L, $1)=yes + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E' + ;; + + hpux10*) + if test "$GCC" = yes && test "$with_gnu_ld" = no; then + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags' + else + _LT_TAGVAR(archive_cmds, $1)='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags' + fi + if test "$with_gnu_ld" = no; then + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir' + _LT_TAGVAR(hardcode_libdir_separator, $1)=: + _LT_TAGVAR(hardcode_direct, $1)=yes + _LT_TAGVAR(hardcode_direct_absolute, $1)=yes + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E' + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + _LT_TAGVAR(hardcode_minus_L, $1)=yes + fi + ;; + + hpux11*) + if test "$GCC" = yes && test "$with_gnu_ld" = no; then + case $host_cpu in + hppa*64*) + _LT_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + ia64*) + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags' + ;; + *) + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags' + ;; + esac + else + case $host_cpu in + hppa*64*) + _LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + ia64*) + _LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags' + ;; + *) + m4_if($1, [], [ + # Older versions of the 11.00 compiler do not understand -b yet + # (HP92453-01 A.11.01.20 doesn't, HP92453-01 B.11.X.35175-35176.GP does) + _LT_LINKER_OPTION([if $CC understands -b], + _LT_TAGVAR(lt_cv_prog_compiler__b, $1), [-b], + [_LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'], + [_LT_TAGVAR(archive_cmds, $1)='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags'])], + [_LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags']) + ;; + esac + fi + if test "$with_gnu_ld" = no; then + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir' + _LT_TAGVAR(hardcode_libdir_separator, $1)=: + + case $host_cpu in + hppa*64*|ia64*) + _LT_TAGVAR(hardcode_direct, $1)=no + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + *) + _LT_TAGVAR(hardcode_direct, $1)=yes + _LT_TAGVAR(hardcode_direct_absolute, $1)=yes + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E' + + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + _LT_TAGVAR(hardcode_minus_L, $1)=yes + ;; + esac + fi + ;; + + irix5* | irix6* | nonstopux*) + if test "$GCC" = yes; then + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + # Try to use the -exported_symbol ld option, if it does not + # work, assume that -exports_file does not work either and + # implicitly export all symbols. + # This should be the same for all languages, so no per-tag cache variable. + AC_CACHE_CHECK([whether the $host_os linker accepts -exported_symbol], + [lt_cv_irix_exported_symbol], + [save_LDFLAGS="$LDFLAGS" + LDFLAGS="$LDFLAGS -shared ${wl}-exported_symbol ${wl}foo ${wl}-update_registry ${wl}/dev/null" + AC_LINK_IFELSE( + [AC_LANG_SOURCE( + [AC_LANG_CASE([C], [[int foo (void) { return 0; }]], + [C++], [[int foo (void) { return 0; }]], + [Fortran 77], [[ + subroutine foo + end]], + [Fortran], [[ + subroutine foo + end]])])], + [lt_cv_irix_exported_symbol=yes], + [lt_cv_irix_exported_symbol=no]) + LDFLAGS="$save_LDFLAGS"]) + if test "$lt_cv_irix_exported_symbol" = yes; then + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations ${wl}-exports_file ${wl}$export_symbols -o $lib' + fi + else + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib' + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -exports_file $export_symbols -o $lib' + fi + _LT_TAGVAR(archive_cmds_need_lc, $1)='no' + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir' + _LT_TAGVAR(hardcode_libdir_separator, $1)=: + _LT_TAGVAR(inherit_rpath, $1)=yes + _LT_TAGVAR(link_all_deplibs, $1)=yes + ;; + + netbsd*) + if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then + _LT_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' # a.out + else + _LT_TAGVAR(archive_cmds, $1)='$LD -shared -o $lib $libobjs $deplibs $linker_flags' # ELF + fi + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir' + _LT_TAGVAR(hardcode_direct, $1)=yes + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + + newsos6) + _LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + _LT_TAGVAR(hardcode_direct, $1)=yes + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir' + _LT_TAGVAR(hardcode_libdir_separator, $1)=: + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + + *nto* | *qnx*) + ;; + + openbsd*) + if test -f /usr/libexec/ld.so; then + _LT_TAGVAR(hardcode_direct, $1)=yes + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + _LT_TAGVAR(hardcode_direct_absolute, $1)=yes + if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags' + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-retain-symbols-file,$export_symbols' + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir' + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E' + else + case $host_os in + openbsd[[01]].* | openbsd2.[[0-7]] | openbsd2.[[0-7]].*) + _LT_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir' + ;; + *) + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags' + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir' + ;; + esac + fi + else + _LT_TAGVAR(ld_shlibs, $1)=no + fi + ;; + + os2*) + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir' + _LT_TAGVAR(hardcode_minus_L, $1)=yes + _LT_TAGVAR(allow_undefined_flag, $1)=unsupported + _LT_TAGVAR(archive_cmds, $1)='$ECHO "LIBRARY $libname INITINSTANCE" > $output_objdir/$libname.def~$ECHO "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~echo DATA >> $output_objdir/$libname.def~echo " SINGLE NONSHARED" >> $output_objdir/$libname.def~echo EXPORTS >> $output_objdir/$libname.def~emxexp $libobjs >> $output_objdir/$libname.def~$CC -Zdll -Zcrtdll -o $lib $libobjs $deplibs $compiler_flags $output_objdir/$libname.def' + _LT_TAGVAR(old_archive_from_new_cmds, $1)='emximp -o $output_objdir/$libname.a $output_objdir/$libname.def' + ;; + + osf3*) + if test "$GCC" = yes; then + _LT_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*' + _LT_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + else + _LT_TAGVAR(allow_undefined_flag, $1)=' -expect_unresolved \*' + _LT_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib' + fi + _LT_TAGVAR(archive_cmds_need_lc, $1)='no' + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir' + _LT_TAGVAR(hardcode_libdir_separator, $1)=: + ;; + + osf4* | osf5*) # as osf3* with the addition of -msym flag + if test "$GCC" = yes; then + _LT_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*' + _LT_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $pic_flag $libobjs $deplibs $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir' + else + _LT_TAGVAR(allow_undefined_flag, $1)=' -expect_unresolved \*' + _LT_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags -msym -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib' + _LT_TAGVAR(archive_expsym_cmds, $1)='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done; printf "%s\\n" "-hidden">> $lib.exp~ + $CC -shared${allow_undefined_flag} ${wl}-input ${wl}$lib.exp $compiler_flags $libobjs $deplibs -soname $soname `test -n "$verstring" && $ECHO "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib~$RM $lib.exp' + + # Both c and cxx compiler support -rpath directly + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-rpath $libdir' + fi + _LT_TAGVAR(archive_cmds_need_lc, $1)='no' + _LT_TAGVAR(hardcode_libdir_separator, $1)=: + ;; + + solaris*) + _LT_TAGVAR(no_undefined_flag, $1)=' -z defs' + if test "$GCC" = yes; then + wlarc='${wl}' + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag ${wl}-z ${wl}text ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags' + _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~ + $CC -shared $pic_flag ${wl}-z ${wl}text ${wl}-M ${wl}$lib.exp ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags~$RM $lib.exp' + else + case `$CC -V 2>&1` in + *"Compilers 5.0"*) + wlarc='' + _LT_TAGVAR(archive_cmds, $1)='$LD -G${allow_undefined_flag} -h $soname -o $lib $libobjs $deplibs $linker_flags' + _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~ + $LD -G${allow_undefined_flag} -M $lib.exp -h $soname -o $lib $libobjs $deplibs $linker_flags~$RM $lib.exp' + ;; + *) + wlarc='${wl}' + _LT_TAGVAR(archive_cmds, $1)='$CC -G${allow_undefined_flag} -h $soname -o $lib $libobjs $deplibs $compiler_flags' + _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~ + $CC -G${allow_undefined_flag} -M $lib.exp -h $soname -o $lib $libobjs $deplibs $compiler_flags~$RM $lib.exp' + ;; + esac + fi + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir' + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + case $host_os in + solaris2.[[0-5]] | solaris2.[[0-5]].*) ;; + *) + # The compiler driver will combine and reorder linker options, + # but understands `-z linker_flag'. GCC discards it without `$wl', + # but is careful enough not to reorder. + # Supported since Solaris 2.6 (maybe 2.5.1?) + if test "$GCC" = yes; then + _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}-z ${wl}allextract$convenience ${wl}-z ${wl}defaultextract' + else + _LT_TAGVAR(whole_archive_flag_spec, $1)='-z allextract$convenience -z defaultextract' + fi + ;; + esac + _LT_TAGVAR(link_all_deplibs, $1)=yes + ;; + + sunos4*) + if test "x$host_vendor" = xsequent; then + # Use $CC to link under sequent, because it throws in some extra .o + # files that make .init and .fini sections work. + _LT_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h $soname -o $lib $libobjs $deplibs $compiler_flags' + else + _LT_TAGVAR(archive_cmds, $1)='$LD -assert pure-text -Bstatic -o $lib $libobjs $deplibs $linker_flags' + fi + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir' + _LT_TAGVAR(hardcode_direct, $1)=yes + _LT_TAGVAR(hardcode_minus_L, $1)=yes + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + + sysv4) + case $host_vendor in + sni) + _LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + _LT_TAGVAR(hardcode_direct, $1)=yes # is this really true??? + ;; + siemens) + ## LD is ld it makes a PLAMLIB + ## CC just makes a GrossModule. + _LT_TAGVAR(archive_cmds, $1)='$LD -G -o $lib $libobjs $deplibs $linker_flags' + _LT_TAGVAR(reload_cmds, $1)='$CC -r -o $output$reload_objs' + _LT_TAGVAR(hardcode_direct, $1)=no + ;; + motorola) + _LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + _LT_TAGVAR(hardcode_direct, $1)=no #Motorola manual says yes, but my tests say they lie + ;; + esac + runpath_var='LD_RUN_PATH' + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + + sysv4.3*) + _LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + _LT_TAGVAR(export_dynamic_flag_spec, $1)='-Bexport' + ;; + + sysv4*MP*) + if test -d /usr/nec; then + _LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + runpath_var=LD_RUN_PATH + hardcode_runpath_var=yes + _LT_TAGVAR(ld_shlibs, $1)=yes + fi + ;; + + sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[[01]].[[10]]* | unixware7* | sco3.2v5.0.[[024]]*) + _LT_TAGVAR(no_undefined_flag, $1)='${wl}-z,text' + _LT_TAGVAR(archive_cmds_need_lc, $1)=no + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + runpath_var='LD_RUN_PATH' + + if test "$GCC" = yes; then + _LT_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + else + _LT_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + fi + ;; + + sysv5* | sco3.2v5* | sco5v6*) + # Note: We can NOT use -z defs as we might desire, because we do not + # link with -lc, and that would cause any symbols used from libc to + # always be unresolved, which means just about no library would + # ever link correctly. If we're not using GNU ld we use -z text + # though, which does catch some bad symbols but isn't as heavy-handed + # as -z defs. + _LT_TAGVAR(no_undefined_flag, $1)='${wl}-z,text' + _LT_TAGVAR(allow_undefined_flag, $1)='${wl}-z,nodefs' + _LT_TAGVAR(archive_cmds_need_lc, $1)=no + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R,$libdir' + _LT_TAGVAR(hardcode_libdir_separator, $1)=':' + _LT_TAGVAR(link_all_deplibs, $1)=yes + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-Bexport' + runpath_var='LD_RUN_PATH' + + if test "$GCC" = yes; then + _LT_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + else + _LT_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + fi + ;; + + uts4*) + _LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir' + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + + *) + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + esac + + if test x$host_vendor = xsni; then + case $host in + sysv4 | sysv4.2uw2* | sysv4.3* | sysv5*) + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-Blargedynsym' + ;; + esac + fi + fi +]) +AC_MSG_RESULT([$_LT_TAGVAR(ld_shlibs, $1)]) +test "$_LT_TAGVAR(ld_shlibs, $1)" = no && can_build_shared=no + +_LT_TAGVAR(with_gnu_ld, $1)=$with_gnu_ld + +_LT_DECL([], [libext], [0], [Old archive suffix (normally "a")])dnl +_LT_DECL([], [shrext_cmds], [1], [Shared library suffix (normally ".so")])dnl +_LT_DECL([], [extract_expsyms_cmds], [2], + [The commands to extract the exported symbol list from a shared archive]) + +# +# Do we need to explicitly link libc? +# +case "x$_LT_TAGVAR(archive_cmds_need_lc, $1)" in +x|xyes) + # Assume -lc should be added + _LT_TAGVAR(archive_cmds_need_lc, $1)=yes + + if test "$enable_shared" = yes && test "$GCC" = yes; then + case $_LT_TAGVAR(archive_cmds, $1) in + *'~'*) + # FIXME: we may have to deal with multi-command sequences. + ;; + '$CC '*) + # Test whether the compiler implicitly links with -lc since on some + # systems, -lgcc has to come before -lc. If gcc already passes -lc + # to ld, don't add -lc before -lgcc. + AC_CACHE_CHECK([whether -lc should be explicitly linked in], + [lt_cv_]_LT_TAGVAR(archive_cmds_need_lc, $1), + [$RM conftest* + echo "$lt_simple_compile_test_code" > conftest.$ac_ext + + if AC_TRY_EVAL(ac_compile) 2>conftest.err; then + soname=conftest + lib=conftest + libobjs=conftest.$ac_objext + deplibs= + wl=$_LT_TAGVAR(lt_prog_compiler_wl, $1) + pic_flag=$_LT_TAGVAR(lt_prog_compiler_pic, $1) + compiler_flags=-v + linker_flags=-v + verstring= + output_objdir=. + libname=conftest + lt_save_allow_undefined_flag=$_LT_TAGVAR(allow_undefined_flag, $1) + _LT_TAGVAR(allow_undefined_flag, $1)= + if AC_TRY_EVAL(_LT_TAGVAR(archive_cmds, $1) 2\>\&1 \| $GREP \" -lc \" \>/dev/null 2\>\&1) + then + lt_cv_[]_LT_TAGVAR(archive_cmds_need_lc, $1)=no + else + lt_cv_[]_LT_TAGVAR(archive_cmds_need_lc, $1)=yes + fi + _LT_TAGVAR(allow_undefined_flag, $1)=$lt_save_allow_undefined_flag + else + cat conftest.err 1>&5 + fi + $RM conftest* + ]) + _LT_TAGVAR(archive_cmds_need_lc, $1)=$lt_cv_[]_LT_TAGVAR(archive_cmds_need_lc, $1) + ;; + esac + fi + ;; +esac + +_LT_TAGDECL([build_libtool_need_lc], [archive_cmds_need_lc], [0], + [Whether or not to add -lc for building shared libraries]) +_LT_TAGDECL([allow_libtool_libs_with_static_runtimes], + [enable_shared_with_static_runtimes], [0], + [Whether or not to disallow shared libs when runtime libs are static]) +_LT_TAGDECL([], [export_dynamic_flag_spec], [1], + [Compiler flag to allow reflexive dlopens]) +_LT_TAGDECL([], [whole_archive_flag_spec], [1], + [Compiler flag to generate shared objects directly from archives]) +_LT_TAGDECL([], [compiler_needs_object], [1], + [Whether the compiler copes with passing no objects directly]) +_LT_TAGDECL([], [old_archive_from_new_cmds], [2], + [Create an old-style archive from a shared archive]) +_LT_TAGDECL([], [old_archive_from_expsyms_cmds], [2], + [Create a temporary old-style archive to link instead of a shared archive]) +_LT_TAGDECL([], [archive_cmds], [2], [Commands used to build a shared archive]) +_LT_TAGDECL([], [archive_expsym_cmds], [2]) +_LT_TAGDECL([], [module_cmds], [2], + [Commands used to build a loadable module if different from building + a shared archive.]) +_LT_TAGDECL([], [module_expsym_cmds], [2]) +_LT_TAGDECL([], [with_gnu_ld], [1], + [Whether we are building with GNU ld or not]) +_LT_TAGDECL([], [allow_undefined_flag], [1], + [Flag that allows shared libraries with undefined symbols to be built]) +_LT_TAGDECL([], [no_undefined_flag], [1], + [Flag that enforces no undefined symbols]) +_LT_TAGDECL([], [hardcode_libdir_flag_spec], [1], + [Flag to hardcode $libdir into a binary during linking. + This must work even if $libdir does not exist]) +_LT_TAGDECL([], [hardcode_libdir_separator], [1], + [Whether we need a single "-rpath" flag with a separated argument]) +_LT_TAGDECL([], [hardcode_direct], [0], + [Set to "yes" if using DIR/libNAME${shared_ext} during linking hardcodes + DIR into the resulting binary]) +_LT_TAGDECL([], [hardcode_direct_absolute], [0], + [Set to "yes" if using DIR/libNAME${shared_ext} during linking hardcodes + DIR into the resulting binary and the resulting library dependency is + "absolute", i.e impossible to change by setting ${shlibpath_var} if the + library is relocated]) +_LT_TAGDECL([], [hardcode_minus_L], [0], + [Set to "yes" if using the -LDIR flag during linking hardcodes DIR + into the resulting binary]) +_LT_TAGDECL([], [hardcode_shlibpath_var], [0], + [Set to "yes" if using SHLIBPATH_VAR=DIR during linking hardcodes DIR + into the resulting binary]) +_LT_TAGDECL([], [hardcode_automatic], [0], + [Set to "yes" if building a shared library automatically hardcodes DIR + into the library and all subsequent libraries and executables linked + against it]) +_LT_TAGDECL([], [inherit_rpath], [0], + [Set to yes if linker adds runtime paths of dependent libraries + to runtime path list]) +_LT_TAGDECL([], [link_all_deplibs], [0], + [Whether libtool must link a program against all its dependency libraries]) +_LT_TAGDECL([], [always_export_symbols], [0], + [Set to "yes" if exported symbols are required]) +_LT_TAGDECL([], [export_symbols_cmds], [2], + [The commands to list exported symbols]) +_LT_TAGDECL([], [exclude_expsyms], [1], + [Symbols that should not be listed in the preloaded symbols]) +_LT_TAGDECL([], [include_expsyms], [1], + [Symbols that must always be exported]) +_LT_TAGDECL([], [prelink_cmds], [2], + [Commands necessary for linking programs (against libraries) with templates]) +_LT_TAGDECL([], [postlink_cmds], [2], + [Commands necessary for finishing linking programs]) +_LT_TAGDECL([], [file_list_spec], [1], + [Specify filename containing input files]) +dnl FIXME: Not yet implemented +dnl _LT_TAGDECL([], [thread_safe_flag_spec], [1], +dnl [Compiler flag to generate thread safe objects]) +])# _LT_LINKER_SHLIBS + + +# _LT_LANG_C_CONFIG([TAG]) +# ------------------------ +# Ensure that the configuration variables for a C compiler are suitably +# defined. These variables are subsequently used by _LT_CONFIG to write +# the compiler configuration to `libtool'. +m4_defun([_LT_LANG_C_CONFIG], +[m4_require([_LT_DECL_EGREP])dnl +lt_save_CC="$CC" +AC_LANG_PUSH(C) + +# Source file extension for C test sources. +ac_ext=c + +# Object file extension for compiled C test sources. +objext=o +_LT_TAGVAR(objext, $1)=$objext + +# Code to be used in simple compile tests +lt_simple_compile_test_code="int some_variable = 0;" + +# Code to be used in simple link tests +lt_simple_link_test_code='int main(){return(0);}' + +_LT_TAG_COMPILER +# Save the default compiler, since it gets overwritten when the other +# tags are being tested, and _LT_TAGVAR(compiler, []) is a NOP. +compiler_DEFAULT=$CC + +# save warnings/boilerplate of simple test code +_LT_COMPILER_BOILERPLATE +_LT_LINKER_BOILERPLATE + +## CAVEAT EMPTOR: +## There is no encapsulation within the following macros, do not change +## the running order or otherwise move them around unless you know exactly +## what you are doing... +if test -n "$compiler"; then + _LT_COMPILER_NO_RTTI($1) + _LT_COMPILER_PIC($1) + _LT_COMPILER_C_O($1) + _LT_COMPILER_FILE_LOCKS($1) + _LT_LINKER_SHLIBS($1) + _LT_SYS_DYNAMIC_LINKER($1) + _LT_LINKER_HARDCODE_LIBPATH($1) + LT_SYS_DLOPEN_SELF + _LT_CMD_STRIPLIB + + # Report which library types will actually be built + AC_MSG_CHECKING([if libtool supports shared libraries]) + AC_MSG_RESULT([$can_build_shared]) + + AC_MSG_CHECKING([whether to build shared libraries]) + test "$can_build_shared" = "no" && enable_shared=no + + # On AIX, shared libraries and static libraries use the same namespace, and + # are all built from PIC. + case $host_os in + aix3*) + test "$enable_shared" = yes && enable_static=no + if test -n "$RANLIB"; then + archive_cmds="$archive_cmds~\$RANLIB \$lib" + postinstall_cmds='$RANLIB $lib' + fi + ;; + + aix[[4-9]]*) + if test "$host_cpu" != ia64 && test "$aix_use_runtimelinking" = no ; then + test "$enable_shared" = yes && enable_static=no + fi + ;; + esac + AC_MSG_RESULT([$enable_shared]) + + AC_MSG_CHECKING([whether to build static libraries]) + # Make sure either enable_shared or enable_static is yes. + test "$enable_shared" = yes || enable_static=yes + AC_MSG_RESULT([$enable_static]) + + _LT_CONFIG($1) +fi +AC_LANG_POP +CC="$lt_save_CC" +])# _LT_LANG_C_CONFIG + + +# _LT_LANG_CXX_CONFIG([TAG]) +# -------------------------- +# Ensure that the configuration variables for a C++ compiler are suitably +# defined. These variables are subsequently used by _LT_CONFIG to write +# the compiler configuration to `libtool'. +m4_defun([_LT_LANG_CXX_CONFIG], +[m4_require([_LT_FILEUTILS_DEFAULTS])dnl +m4_require([_LT_DECL_EGREP])dnl +m4_require([_LT_PATH_MANIFEST_TOOL])dnl +if test -n "$CXX" && ( test "X$CXX" != "Xno" && + ( (test "X$CXX" = "Xg++" && `g++ -v >/dev/null 2>&1` ) || + (test "X$CXX" != "Xg++"))) ; then + AC_PROG_CXXCPP +else + _lt_caught_CXX_error=yes +fi + +AC_LANG_PUSH(C++) +_LT_TAGVAR(archive_cmds_need_lc, $1)=no +_LT_TAGVAR(allow_undefined_flag, $1)= +_LT_TAGVAR(always_export_symbols, $1)=no +_LT_TAGVAR(archive_expsym_cmds, $1)= +_LT_TAGVAR(compiler_needs_object, $1)=no +_LT_TAGVAR(export_dynamic_flag_spec, $1)= +_LT_TAGVAR(hardcode_direct, $1)=no +_LT_TAGVAR(hardcode_direct_absolute, $1)=no +_LT_TAGVAR(hardcode_libdir_flag_spec, $1)= +_LT_TAGVAR(hardcode_libdir_separator, $1)= +_LT_TAGVAR(hardcode_minus_L, $1)=no +_LT_TAGVAR(hardcode_shlibpath_var, $1)=unsupported +_LT_TAGVAR(hardcode_automatic, $1)=no +_LT_TAGVAR(inherit_rpath, $1)=no +_LT_TAGVAR(module_cmds, $1)= +_LT_TAGVAR(module_expsym_cmds, $1)= +_LT_TAGVAR(link_all_deplibs, $1)=unknown +_LT_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds +_LT_TAGVAR(reload_flag, $1)=$reload_flag +_LT_TAGVAR(reload_cmds, $1)=$reload_cmds +_LT_TAGVAR(no_undefined_flag, $1)= +_LT_TAGVAR(whole_archive_flag_spec, $1)= +_LT_TAGVAR(enable_shared_with_static_runtimes, $1)=no + +# Source file extension for C++ test sources. +ac_ext=cpp + +# Object file extension for compiled C++ test sources. +objext=o +_LT_TAGVAR(objext, $1)=$objext + +# No sense in running all these tests if we already determined that +# the CXX compiler isn't working. Some variables (like enable_shared) +# are currently assumed to apply to all compilers on this platform, +# and will be corrupted by setting them based on a non-working compiler. +if test "$_lt_caught_CXX_error" != yes; then + # Code to be used in simple compile tests + lt_simple_compile_test_code="int some_variable = 0;" + + # Code to be used in simple link tests + lt_simple_link_test_code='int main(int, char *[[]]) { return(0); }' + + # ltmain only uses $CC for tagged configurations so make sure $CC is set. + _LT_TAG_COMPILER + + # save warnings/boilerplate of simple test code + _LT_COMPILER_BOILERPLATE + _LT_LINKER_BOILERPLATE + + # Allow CC to be a program name with arguments. + lt_save_CC=$CC + lt_save_CFLAGS=$CFLAGS + lt_save_LD=$LD + lt_save_GCC=$GCC + GCC=$GXX + lt_save_with_gnu_ld=$with_gnu_ld + lt_save_path_LD=$lt_cv_path_LD + if test -n "${lt_cv_prog_gnu_ldcxx+set}"; then + lt_cv_prog_gnu_ld=$lt_cv_prog_gnu_ldcxx + else + $as_unset lt_cv_prog_gnu_ld + fi + if test -n "${lt_cv_path_LDCXX+set}"; then + lt_cv_path_LD=$lt_cv_path_LDCXX + else + $as_unset lt_cv_path_LD + fi + test -z "${LDCXX+set}" || LD=$LDCXX + CC=${CXX-"c++"} + CFLAGS=$CXXFLAGS + compiler=$CC + _LT_TAGVAR(compiler, $1)=$CC + _LT_CC_BASENAME([$compiler]) + + if test -n "$compiler"; then + # We don't want -fno-exception when compiling C++ code, so set the + # no_builtin_flag separately + if test "$GXX" = yes; then + _LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)=' -fno-builtin' + else + _LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)= + fi + + if test "$GXX" = yes; then + # Set up default GNU C++ configuration + + LT_PATH_LD + + # Check if GNU C++ uses GNU ld as the underlying linker, since the + # archiving commands below assume that GNU ld is being used. + if test "$with_gnu_ld" = yes; then + _LT_TAGVAR(archive_cmds, $1)='$CC $pic_flag -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib' + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC $pic_flag -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir' + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic' + + # If archive_cmds runs LD, not CC, wlarc should be empty + # XXX I think wlarc can be eliminated in ltcf-cxx, but I need to + # investigate it a little bit more. (MM) + wlarc='${wl}' + + # ancient GNU ld didn't support --whole-archive et. al. + if eval "`$CC -print-prog-name=ld` --help 2>&1" | + $GREP 'no-whole-archive' > /dev/null; then + _LT_TAGVAR(whole_archive_flag_spec, $1)="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive' + else + _LT_TAGVAR(whole_archive_flag_spec, $1)= + fi + else + with_gnu_ld=no + wlarc= + + # A generic and very simple default shared library creation + # command for GNU C++ for the case where it uses the native + # linker, instead of GNU ld. If possible, this setting should + # overridden to take advantage of the native linker features on + # the platform it is being used on. + _LT_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $lib' + fi + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP -v "^Configured with:" | $GREP "\-L"' + + else + GXX=no + with_gnu_ld=no + wlarc= + fi + + # PORTME: fill in a description of your system's C++ link characteristics + AC_MSG_CHECKING([whether the $compiler linker ($LD) supports shared libraries]) + _LT_TAGVAR(ld_shlibs, $1)=yes + case $host_os in + aix3*) + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + aix[[4-9]]*) + if test "$host_cpu" = ia64; then + # On IA64, the linker does run time linking by default, so we don't + # have to do anything special. + aix_use_runtimelinking=no + exp_sym_flag='-Bexport' + no_entry_flag="" + else + aix_use_runtimelinking=no + + # Test if we are trying to use run time linking or normal + # AIX style linking. If -brtl is somewhere in LDFLAGS, we + # need to do runtime linking. + case $host_os in aix4.[[23]]|aix4.[[23]].*|aix[[5-9]]*) + for ld_flag in $LDFLAGS; do + case $ld_flag in + *-brtl*) + aix_use_runtimelinking=yes + break + ;; + esac + done + ;; + esac + + exp_sym_flag='-bexport' + no_entry_flag='-bnoentry' + fi + + # When large executables or shared objects are built, AIX ld can + # have problems creating the table of contents. If linking a library + # or program results in "error TOC overflow" add -mminimal-toc to + # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not + # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS. + + _LT_TAGVAR(archive_cmds, $1)='' + _LT_TAGVAR(hardcode_direct, $1)=yes + _LT_TAGVAR(hardcode_direct_absolute, $1)=yes + _LT_TAGVAR(hardcode_libdir_separator, $1)=':' + _LT_TAGVAR(link_all_deplibs, $1)=yes + _LT_TAGVAR(file_list_spec, $1)='${wl}-f,' + + if test "$GXX" = yes; then + case $host_os in aix4.[[012]]|aix4.[[012]].*) + # We only want to do this on AIX 4.2 and lower, the check + # below for broken collect2 doesn't work under 4.3+ + collect2name=`${CC} -print-prog-name=collect2` + if test -f "$collect2name" && + strings "$collect2name" | $GREP resolve_lib_name >/dev/null + then + # We have reworked collect2 + : + else + # We have old collect2 + _LT_TAGVAR(hardcode_direct, $1)=unsupported + # It fails to find uninstalled libraries when the uninstalled + # path is not listed in the libpath. Setting hardcode_minus_L + # to unsupported forces relinking + _LT_TAGVAR(hardcode_minus_L, $1)=yes + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir' + _LT_TAGVAR(hardcode_libdir_separator, $1)= + fi + esac + shared_flag='-shared' + if test "$aix_use_runtimelinking" = yes; then + shared_flag="$shared_flag "'${wl}-G' + fi + else + # not using gcc + if test "$host_cpu" = ia64; then + # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release + # chokes on -Wl,-G. The following line is correct: + shared_flag='-G' + else + if test "$aix_use_runtimelinking" = yes; then + shared_flag='${wl}-G' + else + shared_flag='${wl}-bM:SRE' + fi + fi + fi + + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-bexpall' + # It seems that -bexpall does not export symbols beginning with + # underscore (_), so it is better to generate a list of symbols to + # export. + _LT_TAGVAR(always_export_symbols, $1)=yes + if test "$aix_use_runtimelinking" = yes; then + # Warning - without using the other runtime loading flags (-brtl), + # -berok will link without error, but may produce a broken library. + _LT_TAGVAR(allow_undefined_flag, $1)='-berok' + # Determine the default libpath from the value encoded in an empty + # executable. + _LT_SYS_MODULE_PATH_AIX([$1]) + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-blibpath:$libdir:'"$aix_libpath" + + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then func_echo_all "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag" + else + if test "$host_cpu" = ia64; then + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R $libdir:/usr/lib:/lib' + _LT_TAGVAR(allow_undefined_flag, $1)="-z nodefs" + _LT_TAGVAR(archive_expsym_cmds, $1)="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols" + else + # Determine the default libpath from the value encoded in an + # empty executable. + _LT_SYS_MODULE_PATH_AIX([$1]) + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-blibpath:$libdir:'"$aix_libpath" + # Warning - without using the other run time loading flags, + # -berok will link without error, but may produce a broken library. + _LT_TAGVAR(no_undefined_flag, $1)=' ${wl}-bernotok' + _LT_TAGVAR(allow_undefined_flag, $1)=' ${wl}-berok' + if test "$with_gnu_ld" = yes; then + # We only use this code for GNU lds that support --whole-archive. + _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive$convenience ${wl}--no-whole-archive' + else + # Exported symbols can be pulled into shared objects from archives + _LT_TAGVAR(whole_archive_flag_spec, $1)='$convenience' + fi + _LT_TAGVAR(archive_cmds_need_lc, $1)=yes + # This is similar to how AIX traditionally builds its shared + # libraries. + _LT_TAGVAR(archive_expsym_cmds, $1)="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname' + fi + fi + ;; + + beos*) + if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then + _LT_TAGVAR(allow_undefined_flag, $1)=unsupported + # Joseph Beckenbach says some releases of gcc + # support --undefined. This deserves some investigation. FIXME + _LT_TAGVAR(archive_cmds, $1)='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + else + _LT_TAGVAR(ld_shlibs, $1)=no + fi + ;; + + chorus*) + case $cc_basename in + *) + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + esac + ;; + + cygwin* | mingw* | pw32* | cegcc*) + case $GXX,$cc_basename in + ,cl* | no,cl*) + # Native MSVC + # hardcode_libdir_flag_spec is actually meaningless, as there is + # no search path for DLLs. + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)=' ' + _LT_TAGVAR(allow_undefined_flag, $1)=unsupported + _LT_TAGVAR(always_export_symbols, $1)=yes + _LT_TAGVAR(file_list_spec, $1)='@' + # Tell ltmain to make .lib files, not .a files. + libext=lib + # Tell ltmain to make .dll files, not .so files. + shrext_cmds=".dll" + # FIXME: Setting linknames here is a bad hack. + _LT_TAGVAR(archive_cmds, $1)='$CC -o $output_objdir/$soname $libobjs $compiler_flags $deplibs -Wl,-dll~linknames=' + _LT_TAGVAR(archive_expsym_cmds, $1)='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then + $SED -n -e 's/\\\\\\\(.*\\\\\\\)/-link\\\ -EXPORT:\\\\\\\1/' -e '1\\\!p' < $export_symbols > $output_objdir/$soname.exp; + else + $SED -e 's/\\\\\\\(.*\\\\\\\)/-link\\\ -EXPORT:\\\\\\\1/' < $export_symbols > $output_objdir/$soname.exp; + fi~ + $CC -o $tool_output_objdir$soname $libobjs $compiler_flags $deplibs "@$tool_output_objdir$soname.exp" -Wl,-DLL,-IMPLIB:"$tool_output_objdir$libname.dll.lib"~ + linknames=' + # The linker will not automatically build a static lib if we build a DLL. + # _LT_TAGVAR(old_archive_from_new_cmds, $1)='true' + _LT_TAGVAR(enable_shared_with_static_runtimes, $1)=yes + # Don't use ranlib + _LT_TAGVAR(old_postinstall_cmds, $1)='chmod 644 $oldlib' + _LT_TAGVAR(postlink_cmds, $1)='lt_outputfile="@OUTPUT@"~ + lt_tool_outputfile="@TOOL_OUTPUT@"~ + case $lt_outputfile in + *.exe|*.EXE) ;; + *) + lt_outputfile="$lt_outputfile.exe" + lt_tool_outputfile="$lt_tool_outputfile.exe" + ;; + esac~ + func_to_tool_file "$lt_outputfile"~ + if test "$MANIFEST_TOOL" != ":" && test -f "$lt_outputfile.manifest"; then + $MANIFEST_TOOL -manifest "$lt_tool_outputfile.manifest" -outputresource:"$lt_tool_outputfile" || exit 1; + $RM "$lt_outputfile.manifest"; + fi' + ;; + *) + # g++ + # _LT_TAGVAR(hardcode_libdir_flag_spec, $1) is actually meaningless, + # as there is no search path for DLLs. + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir' + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-all-symbols' + _LT_TAGVAR(allow_undefined_flag, $1)=unsupported + _LT_TAGVAR(always_export_symbols, $1)=no + _LT_TAGVAR(enable_shared_with_static_runtimes, $1)=yes + + if $LD --help 2>&1 | $GREP 'auto-import' > /dev/null; then + _LT_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib' + # If the export-symbols file already is a .def file (1st line + # is EXPORTS), use it as is; otherwise, prepend... + _LT_TAGVAR(archive_expsym_cmds, $1)='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then + cp $export_symbols $output_objdir/$soname.def; + else + echo EXPORTS > $output_objdir/$soname.def; + cat $export_symbols >> $output_objdir/$soname.def; + fi~ + $CC -shared -nostdlib $output_objdir/$soname.def $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib' + else + _LT_TAGVAR(ld_shlibs, $1)=no + fi + ;; + esac + ;; + darwin* | rhapsody*) + _LT_DARWIN_LINKER_FEATURES($1) + ;; + + dgux*) + case $cc_basename in + ec++*) + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + ghcx*) + # Green Hills C++ Compiler + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + *) + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + esac + ;; + + freebsd2.*) + # C++ shared libraries reported to be fairly broken before + # switch to ELF + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + + freebsd-elf*) + _LT_TAGVAR(archive_cmds_need_lc, $1)=no + ;; + + freebsd* | dragonfly*) + # FreeBSD 3 and later use GNU C++ and GNU ld with standard ELF + # conventions + _LT_TAGVAR(ld_shlibs, $1)=yes + ;; + + gnu*) + ;; + + haiku*) + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + _LT_TAGVAR(link_all_deplibs, $1)=yes + ;; + + hpux9*) + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir' + _LT_TAGVAR(hardcode_libdir_separator, $1)=: + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E' + _LT_TAGVAR(hardcode_direct, $1)=yes + _LT_TAGVAR(hardcode_minus_L, $1)=yes # Not in the search PATH, + # but as the default + # location of the library. + + case $cc_basename in + CC*) + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + aCC*) + _LT_TAGVAR(archive_cmds, $1)='$RM $output_objdir/$soname~$CC -b ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib' + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + # + # There doesn't appear to be a way to prevent this compiler from + # explicitly linking system object files so we need to strip them + # from the output so that they don't get included in the library + # dependencies. + output_verbose_link_cmd='templist=`($CC -b $CFLAGS -v conftest.$objext 2>&1) | $EGREP "\-L"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; func_echo_all "$list"' + ;; + *) + if test "$GXX" = yes; then + _LT_TAGVAR(archive_cmds, $1)='$RM $output_objdir/$soname~$CC -shared -nostdlib $pic_flag ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib' + else + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + fi + ;; + esac + ;; + + hpux10*|hpux11*) + if test $with_gnu_ld = no; then + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir' + _LT_TAGVAR(hardcode_libdir_separator, $1)=: + + case $host_cpu in + hppa*64*|ia64*) + ;; + *) + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E' + ;; + esac + fi + case $host_cpu in + hppa*64*|ia64*) + _LT_TAGVAR(hardcode_direct, $1)=no + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + *) + _LT_TAGVAR(hardcode_direct, $1)=yes + _LT_TAGVAR(hardcode_direct_absolute, $1)=yes + _LT_TAGVAR(hardcode_minus_L, $1)=yes # Not in the search PATH, + # but as the default + # location of the library. + ;; + esac + + case $cc_basename in + CC*) + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + aCC*) + case $host_cpu in + hppa*64*) + _LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + ;; + ia64*) + _LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + ;; + *) + _LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + ;; + esac + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + # + # There doesn't appear to be a way to prevent this compiler from + # explicitly linking system object files so we need to strip them + # from the output so that they don't get included in the library + # dependencies. + output_verbose_link_cmd='templist=`($CC -b $CFLAGS -v conftest.$objext 2>&1) | $GREP "\-L"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; func_echo_all "$list"' + ;; + *) + if test "$GXX" = yes; then + if test $with_gnu_ld = no; then + case $host_cpu in + hppa*64*) + _LT_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib -fPIC ${wl}+h ${wl}$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + ;; + ia64*) + _LT_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $pic_flag ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + ;; + *) + _LT_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $pic_flag ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + ;; + esac + fi + else + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + fi + ;; + esac + ;; + + interix[[3-9]]*) + _LT_TAGVAR(hardcode_direct, $1)=no + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir' + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E' + # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc. + # Instead, shared libraries are loaded at an image base (0x10000000 by + # default) and relocated if they conflict, which is a slow very memory + # consuming and fragmenting process. To avoid this, we pick a random, + # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link + # time. Moving up from 0x10000000 also allows more sbrk(2) space. + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib' + _LT_TAGVAR(archive_expsym_cmds, $1)='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib' + ;; + irix5* | irix6*) + case $cc_basename in + CC*) + # SGI C++ + _LT_TAGVAR(archive_cmds, $1)='$CC -shared -all -multigot $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib' + + # Archives containing C++ object files must be created using + # "CC -ar", where "CC" is the IRIX C++ compiler. This is + # necessary to make sure instantiated templates are included + # in the archive. + _LT_TAGVAR(old_archive_cmds, $1)='$CC -ar -WR,-u -o $oldlib $oldobjs' + ;; + *) + if test "$GXX" = yes; then + if test "$with_gnu_ld" = no; then + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + else + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` -o $lib' + fi + fi + _LT_TAGVAR(link_all_deplibs, $1)=yes + ;; + esac + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir' + _LT_TAGVAR(hardcode_libdir_separator, $1)=: + _LT_TAGVAR(inherit_rpath, $1)=yes + ;; + + linux* | k*bsd*-gnu | kopensolaris*-gnu) + case $cc_basename in + KCC*) + # Kuck and Associates, Inc. (KAI) C++ Compiler + + # KCC will only create a shared library if the output file + # ends with ".so" (or ".sl" for HP-UX), so rename the library + # to its proper name (with version) after linking. + _LT_TAGVAR(archive_cmds, $1)='tempext=`echo $shared_ext | $SED -e '\''s/\([[^()0-9A-Za-z{}]]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib; mv \$templib $lib' + _LT_TAGVAR(archive_expsym_cmds, $1)='tempext=`echo $shared_ext | $SED -e '\''s/\([[^()0-9A-Za-z{}]]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib ${wl}-retain-symbols-file,$export_symbols; mv \$templib $lib' + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + # + # There doesn't appear to be a way to prevent this compiler from + # explicitly linking system object files so we need to strip them + # from the output so that they don't get included in the library + # dependencies. + output_verbose_link_cmd='templist=`$CC $CFLAGS -v conftest.$objext -o libconftest$shared_ext 2>&1 | $GREP "ld"`; rm -f libconftest$shared_ext; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; func_echo_all "$list"' + + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir' + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic' + + # Archives containing C++ object files must be created using + # "CC -Bstatic", where "CC" is the KAI C++ compiler. + _LT_TAGVAR(old_archive_cmds, $1)='$CC -Bstatic -o $oldlib $oldobjs' + ;; + icpc* | ecpc* ) + # Intel C++ + with_gnu_ld=yes + # version 8.0 and above of icpc choke on multiply defined symbols + # if we add $predep_objects and $postdep_objects, however 7.1 and + # earlier do not add the objects themselves. + case `$CC -V 2>&1` in + *"Version 7."*) + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib' + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + ;; + *) # Version 8.0 or newer + tmp_idyn= + case $host_cpu in + ia64*) tmp_idyn=' -i_dynamic';; + esac + _LT_TAGVAR(archive_cmds, $1)='$CC -shared'"$tmp_idyn"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared'"$tmp_idyn"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + ;; + esac + _LT_TAGVAR(archive_cmds_need_lc, $1)=no + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir' + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic' + _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive$convenience ${wl}--no-whole-archive' + ;; + pgCC* | pgcpp*) + # Portland Group C++ compiler + case `$CC -V` in + *pgCC\ [[1-5]].* | *pgcpp\ [[1-5]].*) + _LT_TAGVAR(prelink_cmds, $1)='tpldir=Template.dir~ + rm -rf $tpldir~ + $CC --prelink_objects --instantiation_dir $tpldir $objs $libobjs $compile_deplibs~ + compile_command="$compile_command `find $tpldir -name \*.o | sort | $NL2SP`"' + _LT_TAGVAR(old_archive_cmds, $1)='tpldir=Template.dir~ + rm -rf $tpldir~ + $CC --prelink_objects --instantiation_dir $tpldir $oldobjs$old_deplibs~ + $AR $AR_FLAGS $oldlib$oldobjs$old_deplibs `find $tpldir -name \*.o | sort | $NL2SP`~ + $RANLIB $oldlib' + _LT_TAGVAR(archive_cmds, $1)='tpldir=Template.dir~ + rm -rf $tpldir~ + $CC --prelink_objects --instantiation_dir $tpldir $predep_objects $libobjs $deplibs $convenience $postdep_objects~ + $CC -shared $pic_flag $predep_objects $libobjs $deplibs `find $tpldir -name \*.o | sort | $NL2SP` $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname -o $lib' + _LT_TAGVAR(archive_expsym_cmds, $1)='tpldir=Template.dir~ + rm -rf $tpldir~ + $CC --prelink_objects --instantiation_dir $tpldir $predep_objects $libobjs $deplibs $convenience $postdep_objects~ + $CC -shared $pic_flag $predep_objects $libobjs $deplibs `find $tpldir -name \*.o | sort | $NL2SP` $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname ${wl}-retain-symbols-file ${wl}$export_symbols -o $lib' + ;; + *) # Version 6 and above use weak symbols + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname -o $lib' + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname ${wl}-retain-symbols-file ${wl}$export_symbols -o $lib' + ;; + esac + + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}--rpath ${wl}$libdir' + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic' + _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive' + ;; + cxx*) + # Compaq C++ + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib' + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib ${wl}-retain-symbols-file $wl$export_symbols' + + runpath_var=LD_RUN_PATH + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-rpath $libdir' + _LT_TAGVAR(hardcode_libdir_separator, $1)=: + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + # + # There doesn't appear to be a way to prevent this compiler from + # explicitly linking system object files so we need to strip them + # from the output so that they don't get included in the library + # dependencies. + output_verbose_link_cmd='templist=`$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP "ld"`; templist=`func_echo_all "$templist" | $SED "s/\(^.*ld.*\)\( .*ld .*$\)/\1/"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; func_echo_all "X$list" | $Xsed' + ;; + xl* | mpixl* | bgxl*) + # IBM XL 8.0 on PPC, with GNU ld + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir' + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic' + _LT_TAGVAR(archive_cmds, $1)='$CC -qmkshrobj $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + if test "x$supports_anon_versioning" = xyes; then + _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $output_objdir/$libname.ver~ + cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~ + echo "local: *; };" >> $output_objdir/$libname.ver~ + $CC -qmkshrobj $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-version-script ${wl}$output_objdir/$libname.ver -o $lib' + fi + ;; + *) + case `$CC -V 2>&1 | sed 5q` in + *Sun\ C*) + # Sun C++ 5.9 + _LT_TAGVAR(no_undefined_flag, $1)=' -zdefs' + _LT_TAGVAR(archive_cmds, $1)='$CC -G${allow_undefined_flag} -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -G${allow_undefined_flag} -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-retain-symbols-file ${wl}$export_symbols' + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir' + _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`new_convenience=; for conv in $convenience\"\"; do test -z \"$conv\" || new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive' + _LT_TAGVAR(compiler_needs_object, $1)=yes + + # Not sure whether something based on + # $CC $CFLAGS -v conftest.$objext -o libconftest$shared_ext 2>&1 + # would be better. + output_verbose_link_cmd='func_echo_all' + + # Archives containing C++ object files must be created using + # "CC -xar", where "CC" is the Sun C++ compiler. This is + # necessary to make sure instantiated templates are included + # in the archive. + _LT_TAGVAR(old_archive_cmds, $1)='$CC -xar -o $oldlib $oldobjs' + ;; + esac + ;; + esac + ;; + + lynxos*) + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + + m88k*) + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + + mvs*) + case $cc_basename in + cxx*) + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + *) + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + esac + ;; + + netbsd*) + if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then + _LT_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $predep_objects $libobjs $deplibs $postdep_objects $linker_flags' + wlarc= + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir' + _LT_TAGVAR(hardcode_direct, $1)=yes + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + fi + # Workaround some broken pre-1.5 toolchains + output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP conftest.$objext | $SED -e "s:-lgcc -lc -lgcc::"' + ;; + + *nto* | *qnx*) + _LT_TAGVAR(ld_shlibs, $1)=yes + ;; + + openbsd2*) + # C++ shared libraries are fairly broken + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + + openbsd*) + if test -f /usr/libexec/ld.so; then + _LT_TAGVAR(hardcode_direct, $1)=yes + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + _LT_TAGVAR(hardcode_direct_absolute, $1)=yes + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $lib' + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir' + if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-retain-symbols-file,$export_symbols -o $lib' + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E' + _LT_TAGVAR(whole_archive_flag_spec, $1)="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive' + fi + output_verbose_link_cmd=func_echo_all + else + _LT_TAGVAR(ld_shlibs, $1)=no + fi + ;; + + osf3* | osf4* | osf5*) + case $cc_basename in + KCC*) + # Kuck and Associates, Inc. (KAI) C++ Compiler + + # KCC will only create a shared library if the output file + # ends with ".so" (or ".sl" for HP-UX), so rename the library + # to its proper name (with version) after linking. + _LT_TAGVAR(archive_cmds, $1)='tempext=`echo $shared_ext | $SED -e '\''s/\([[^()0-9A-Za-z{}]]\)/\\\\\1/g'\''`; templib=`echo "$lib" | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib; mv \$templib $lib' + + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir' + _LT_TAGVAR(hardcode_libdir_separator, $1)=: + + # Archives containing C++ object files must be created using + # the KAI C++ compiler. + case $host in + osf3*) _LT_TAGVAR(old_archive_cmds, $1)='$CC -Bstatic -o $oldlib $oldobjs' ;; + *) _LT_TAGVAR(old_archive_cmds, $1)='$CC -o $oldlib $oldobjs' ;; + esac + ;; + RCC*) + # Rational C++ 2.4.1 + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + cxx*) + case $host in + osf3*) + _LT_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*' + _LT_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $soname `test -n "$verstring" && func_echo_all "${wl}-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib' + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir' + ;; + *) + _LT_TAGVAR(allow_undefined_flag, $1)=' -expect_unresolved \*' + _LT_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -msym -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib' + _LT_TAGVAR(archive_expsym_cmds, $1)='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done~ + echo "-hidden">> $lib.exp~ + $CC -shared$allow_undefined_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -msym -soname $soname ${wl}-input ${wl}$lib.exp `test -n "$verstring" && $ECHO "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib~ + $RM $lib.exp' + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-rpath $libdir' + ;; + esac + + _LT_TAGVAR(hardcode_libdir_separator, $1)=: + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + # + # There doesn't appear to be a way to prevent this compiler from + # explicitly linking system object files so we need to strip them + # from the output so that they don't get included in the library + # dependencies. + output_verbose_link_cmd='templist=`$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP "ld" | $GREP -v "ld:"`; templist=`func_echo_all "$templist" | $SED "s/\(^.*ld.*\)\( .*ld.*$\)/\1/"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; func_echo_all "$list"' + ;; + *) + if test "$GXX" = yes && test "$with_gnu_ld" = no; then + _LT_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*' + case $host in + osf3*) + _LT_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib ${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + ;; + *) + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -nostdlib ${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + ;; + esac + + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir' + _LT_TAGVAR(hardcode_libdir_separator, $1)=: + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP -v "^Configured with:" | $GREP "\-L"' + + else + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + fi + ;; + esac + ;; + + psos*) + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + + sunos4*) + case $cc_basename in + CC*) + # Sun C++ 4.x + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + lcc*) + # Lucid + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + *) + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + esac + ;; + + solaris*) + case $cc_basename in + CC* | sunCC*) + # Sun C++ 4.2, 5.x and Centerline C++ + _LT_TAGVAR(archive_cmds_need_lc,$1)=yes + _LT_TAGVAR(no_undefined_flag, $1)=' -zdefs' + _LT_TAGVAR(archive_cmds, $1)='$CC -G${allow_undefined_flag} -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~ + $CC -G${allow_undefined_flag} ${wl}-M ${wl}$lib.exp -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$RM $lib.exp' + + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir' + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + case $host_os in + solaris2.[[0-5]] | solaris2.[[0-5]].*) ;; + *) + # The compiler driver will combine and reorder linker options, + # but understands `-z linker_flag'. + # Supported since Solaris 2.6 (maybe 2.5.1?) + _LT_TAGVAR(whole_archive_flag_spec, $1)='-z allextract$convenience -z defaultextract' + ;; + esac + _LT_TAGVAR(link_all_deplibs, $1)=yes + + output_verbose_link_cmd='func_echo_all' + + # Archives containing C++ object files must be created using + # "CC -xar", where "CC" is the Sun C++ compiler. This is + # necessary to make sure instantiated templates are included + # in the archive. + _LT_TAGVAR(old_archive_cmds, $1)='$CC -xar -o $oldlib $oldobjs' + ;; + gcx*) + # Green Hills C++ Compiler + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib' + + # The C++ compiler must be used to create the archive. + _LT_TAGVAR(old_archive_cmds, $1)='$CC $LDFLAGS -archive -o $oldlib $oldobjs' + ;; + *) + # GNU C++ compiler with Solaris linker + if test "$GXX" = yes && test "$with_gnu_ld" = no; then + _LT_TAGVAR(no_undefined_flag, $1)=' ${wl}-z ${wl}defs' + if $CC --version | $GREP -v '^2\.7' > /dev/null; then + _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -nostdlib $LDFLAGS $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib' + _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~ + $CC -shared $pic_flag -nostdlib ${wl}-M $wl$lib.exp -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$RM $lib.exp' + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP -v "^Configured with:" | $GREP "\-L"' + else + # g++ 2.7 appears to require `-G' NOT `-shared' on this + # platform. + _LT_TAGVAR(archive_cmds, $1)='$CC -G -nostdlib $LDFLAGS $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib' + _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~ + $CC -G -nostdlib ${wl}-M $wl$lib.exp -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$RM $lib.exp' + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + output_verbose_link_cmd='$CC -G $CFLAGS -v conftest.$objext 2>&1 | $GREP -v "^Configured with:" | $GREP "\-L"' + fi + + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R $wl$libdir' + case $host_os in + solaris2.[[0-5]] | solaris2.[[0-5]].*) ;; + *) + _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}-z ${wl}allextract$convenience ${wl}-z ${wl}defaultextract' + ;; + esac + fi + ;; + esac + ;; + + sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[[01]].[[10]]* | unixware7* | sco3.2v5.0.[[024]]*) + _LT_TAGVAR(no_undefined_flag, $1)='${wl}-z,text' + _LT_TAGVAR(archive_cmds_need_lc, $1)=no + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + runpath_var='LD_RUN_PATH' + + case $cc_basename in + CC*) + _LT_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + *) + _LT_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + esac + ;; + + sysv5* | sco3.2v5* | sco5v6*) + # Note: We can NOT use -z defs as we might desire, because we do not + # link with -lc, and that would cause any symbols used from libc to + # always be unresolved, which means just about no library would + # ever link correctly. If we're not using GNU ld we use -z text + # though, which does catch some bad symbols but isn't as heavy-handed + # as -z defs. + _LT_TAGVAR(no_undefined_flag, $1)='${wl}-z,text' + _LT_TAGVAR(allow_undefined_flag, $1)='${wl}-z,nodefs' + _LT_TAGVAR(archive_cmds_need_lc, $1)=no + _LT_TAGVAR(hardcode_shlibpath_var, $1)=no + _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R,$libdir' + _LT_TAGVAR(hardcode_libdir_separator, $1)=':' + _LT_TAGVAR(link_all_deplibs, $1)=yes + _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-Bexport' + runpath_var='LD_RUN_PATH' + + case $cc_basename in + CC*) + _LT_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + _LT_TAGVAR(old_archive_cmds, $1)='$CC -Tprelink_objects $oldobjs~ + '"$_LT_TAGVAR(old_archive_cmds, $1)" + _LT_TAGVAR(reload_cmds, $1)='$CC -Tprelink_objects $reload_objs~ + '"$_LT_TAGVAR(reload_cmds, $1)" + ;; + *) + _LT_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + esac + ;; + + tandem*) + case $cc_basename in + NCC*) + # NonStop-UX NCC 3.20 + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + *) + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + esac + ;; + + vxworks*) + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + + *) + # FIXME: insert proper C++ library support + _LT_TAGVAR(ld_shlibs, $1)=no + ;; + esac + + AC_MSG_RESULT([$_LT_TAGVAR(ld_shlibs, $1)]) + test "$_LT_TAGVAR(ld_shlibs, $1)" = no && can_build_shared=no + + _LT_TAGVAR(GCC, $1)="$GXX" + _LT_TAGVAR(LD, $1)="$LD" + + ## CAVEAT EMPTOR: + ## There is no encapsulation within the following macros, do not change + ## the running order or otherwise move them around unless you know exactly + ## what you are doing... + _LT_SYS_HIDDEN_LIBDEPS($1) + _LT_COMPILER_PIC($1) + _LT_COMPILER_C_O($1) + _LT_COMPILER_FILE_LOCKS($1) + _LT_LINKER_SHLIBS($1) + _LT_SYS_DYNAMIC_LINKER($1) + _LT_LINKER_HARDCODE_LIBPATH($1) + + _LT_CONFIG($1) + fi # test -n "$compiler" + + CC=$lt_save_CC + CFLAGS=$lt_save_CFLAGS + LDCXX=$LD + LD=$lt_save_LD + GCC=$lt_save_GCC + with_gnu_ld=$lt_save_with_gnu_ld + lt_cv_path_LDCXX=$lt_cv_path_LD + lt_cv_path_LD=$lt_save_path_LD + lt_cv_prog_gnu_ldcxx=$lt_cv_prog_gnu_ld + lt_cv_prog_gnu_ld=$lt_save_with_gnu_ld +fi # test "$_lt_caught_CXX_error" != yes + +AC_LANG_POP +])# _LT_LANG_CXX_CONFIG + + +# _LT_FUNC_STRIPNAME_CNF +# ---------------------- +# func_stripname_cnf prefix suffix name +# strip PREFIX and SUFFIX off of NAME. +# PREFIX and SUFFIX must not contain globbing or regex special +# characters, hashes, percent signs, but SUFFIX may contain a leading +# dot (in which case that matches only a dot). +# +# This function is identical to the (non-XSI) version of func_stripname, +# except this one can be used by m4 code that may be executed by configure, +# rather than the libtool script. +m4_defun([_LT_FUNC_STRIPNAME_CNF],[dnl +AC_REQUIRE([_LT_DECL_SED]) +AC_REQUIRE([_LT_PROG_ECHO_BACKSLASH]) +func_stripname_cnf () +{ + case ${2} in + .*) func_stripname_result=`$ECHO "${3}" | $SED "s%^${1}%%; s%\\\\${2}\$%%"`;; + *) func_stripname_result=`$ECHO "${3}" | $SED "s%^${1}%%; s%${2}\$%%"`;; + esac +} # func_stripname_cnf +])# _LT_FUNC_STRIPNAME_CNF + +# _LT_SYS_HIDDEN_LIBDEPS([TAGNAME]) +# --------------------------------- +# Figure out "hidden" library dependencies from verbose +# compiler output when linking a shared library. +# Parse the compiler output and extract the necessary +# objects, libraries and library flags. +m4_defun([_LT_SYS_HIDDEN_LIBDEPS], +[m4_require([_LT_FILEUTILS_DEFAULTS])dnl +AC_REQUIRE([_LT_FUNC_STRIPNAME_CNF])dnl +# Dependencies to place before and after the object being linked: +_LT_TAGVAR(predep_objects, $1)= +_LT_TAGVAR(postdep_objects, $1)= +_LT_TAGVAR(predeps, $1)= +_LT_TAGVAR(postdeps, $1)= +_LT_TAGVAR(compiler_lib_search_path, $1)= + +dnl we can't use the lt_simple_compile_test_code here, +dnl because it contains code intended for an executable, +dnl not a library. It's possible we should let each +dnl tag define a new lt_????_link_test_code variable, +dnl but it's only used here... +m4_if([$1], [], [cat > conftest.$ac_ext <<_LT_EOF +int a; +void foo (void) { a = 0; } +_LT_EOF +], [$1], [CXX], [cat > conftest.$ac_ext <<_LT_EOF +class Foo +{ +public: + Foo (void) { a = 0; } +private: + int a; +}; +_LT_EOF +], [$1], [F77], [cat > conftest.$ac_ext <<_LT_EOF + subroutine foo + implicit none + integer*4 a + a=0 + return + end +_LT_EOF +], [$1], [FC], [cat > conftest.$ac_ext <<_LT_EOF + subroutine foo + implicit none + integer a + a=0 + return + end +_LT_EOF +], [$1], [GCJ], [cat > conftest.$ac_ext <<_LT_EOF +public class foo { + private int a; + public void bar (void) { + a = 0; + } +}; +_LT_EOF +], [$1], [GO], [cat > conftest.$ac_ext <<_LT_EOF +package foo +func foo() { +} +_LT_EOF +]) + +_lt_libdeps_save_CFLAGS=$CFLAGS +case "$CC $CFLAGS " in #( +*\ -flto*\ *) CFLAGS="$CFLAGS -fno-lto" ;; +*\ -fwhopr*\ *) CFLAGS="$CFLAGS -fno-whopr" ;; +*\ -fuse-linker-plugin*\ *) CFLAGS="$CFLAGS -fno-use-linker-plugin" ;; +esac + +dnl Parse the compiler output and extract the necessary +dnl objects, libraries and library flags. +if AC_TRY_EVAL(ac_compile); then + # Parse the compiler output and extract the necessary + # objects, libraries and library flags. + + # Sentinel used to keep track of whether or not we are before + # the conftest object file. + pre_test_object_deps_done=no + + for p in `eval "$output_verbose_link_cmd"`; do + case ${prev}${p} in + + -L* | -R* | -l*) + # Some compilers place space between "-{L,R}" and the path. + # Remove the space. + if test $p = "-L" || + test $p = "-R"; then + prev=$p + continue + fi + + # Expand the sysroot to ease extracting the directories later. + if test -z "$prev"; then + case $p in + -L*) func_stripname_cnf '-L' '' "$p"; prev=-L; p=$func_stripname_result ;; + -R*) func_stripname_cnf '-R' '' "$p"; prev=-R; p=$func_stripname_result ;; + -l*) func_stripname_cnf '-l' '' "$p"; prev=-l; p=$func_stripname_result ;; + esac + fi + case $p in + =*) func_stripname_cnf '=' '' "$p"; p=$lt_sysroot$func_stripname_result ;; + esac + if test "$pre_test_object_deps_done" = no; then + case ${prev} in + -L | -R) + # Internal compiler library paths should come after those + # provided the user. The postdeps already come after the + # user supplied libs so there is no need to process them. + if test -z "$_LT_TAGVAR(compiler_lib_search_path, $1)"; then + _LT_TAGVAR(compiler_lib_search_path, $1)="${prev}${p}" + else + _LT_TAGVAR(compiler_lib_search_path, $1)="${_LT_TAGVAR(compiler_lib_search_path, $1)} ${prev}${p}" + fi + ;; + # The "-l" case would never come before the object being + # linked, so don't bother handling this case. + esac + else + if test -z "$_LT_TAGVAR(postdeps, $1)"; then + _LT_TAGVAR(postdeps, $1)="${prev}${p}" + else + _LT_TAGVAR(postdeps, $1)="${_LT_TAGVAR(postdeps, $1)} ${prev}${p}" + fi + fi + prev= + ;; + + *.lto.$objext) ;; # Ignore GCC LTO objects + *.$objext) + # This assumes that the test object file only shows up + # once in the compiler output. + if test "$p" = "conftest.$objext"; then + pre_test_object_deps_done=yes + continue + fi + + if test "$pre_test_object_deps_done" = no; then + if test -z "$_LT_TAGVAR(predep_objects, $1)"; then + _LT_TAGVAR(predep_objects, $1)="$p" + else + _LT_TAGVAR(predep_objects, $1)="$_LT_TAGVAR(predep_objects, $1) $p" + fi + else + if test -z "$_LT_TAGVAR(postdep_objects, $1)"; then + _LT_TAGVAR(postdep_objects, $1)="$p" + else + _LT_TAGVAR(postdep_objects, $1)="$_LT_TAGVAR(postdep_objects, $1) $p" + fi + fi + ;; + + *) ;; # Ignore the rest. + + esac + done + + # Clean up. + rm -f a.out a.exe +else + echo "libtool.m4: error: problem compiling $1 test program" +fi + +$RM -f confest.$objext +CFLAGS=$_lt_libdeps_save_CFLAGS + +# PORTME: override above test on systems where it is broken +m4_if([$1], [CXX], +[case $host_os in +interix[[3-9]]*) + # Interix 3.5 installs completely hosed .la files for C++, so rather than + # hack all around it, let's just trust "g++" to DTRT. + _LT_TAGVAR(predep_objects,$1)= + _LT_TAGVAR(postdep_objects,$1)= + _LT_TAGVAR(postdeps,$1)= + ;; + +linux*) + case `$CC -V 2>&1 | sed 5q` in + *Sun\ C*) + # Sun C++ 5.9 + + # The more standards-conforming stlport4 library is + # incompatible with the Cstd library. Avoid specifying + # it if it's in CXXFLAGS. Ignore libCrun as + # -library=stlport4 depends on it. + case " $CXX $CXXFLAGS " in + *" -library=stlport4 "*) + solaris_use_stlport4=yes + ;; + esac + + if test "$solaris_use_stlport4" != yes; then + _LT_TAGVAR(postdeps,$1)='-library=Cstd -library=Crun' + fi + ;; + esac + ;; + +solaris*) + case $cc_basename in + CC* | sunCC*) + # The more standards-conforming stlport4 library is + # incompatible with the Cstd library. Avoid specifying + # it if it's in CXXFLAGS. Ignore libCrun as + # -library=stlport4 depends on it. + case " $CXX $CXXFLAGS " in + *" -library=stlport4 "*) + solaris_use_stlport4=yes + ;; + esac + + # Adding this requires a known-good setup of shared libraries for + # Sun compiler versions before 5.6, else PIC objects from an old + # archive will be linked into the output, leading to subtle bugs. + if test "$solaris_use_stlport4" != yes; then + _LT_TAGVAR(postdeps,$1)='-library=Cstd -library=Crun' + fi + ;; + esac + ;; +esac +]) + +case " $_LT_TAGVAR(postdeps, $1) " in +*" -lc "*) _LT_TAGVAR(archive_cmds_need_lc, $1)=no ;; +esac + _LT_TAGVAR(compiler_lib_search_dirs, $1)= +if test -n "${_LT_TAGVAR(compiler_lib_search_path, $1)}"; then + _LT_TAGVAR(compiler_lib_search_dirs, $1)=`echo " ${_LT_TAGVAR(compiler_lib_search_path, $1)}" | ${SED} -e 's! -L! !g' -e 's!^ !!'` +fi +_LT_TAGDECL([], [compiler_lib_search_dirs], [1], + [The directories searched by this compiler when creating a shared library]) +_LT_TAGDECL([], [predep_objects], [1], + [Dependencies to place before and after the objects being linked to + create a shared library]) +_LT_TAGDECL([], [postdep_objects], [1]) +_LT_TAGDECL([], [predeps], [1]) +_LT_TAGDECL([], [postdeps], [1]) +_LT_TAGDECL([], [compiler_lib_search_path], [1], + [The library search path used internally by the compiler when linking + a shared library]) +])# _LT_SYS_HIDDEN_LIBDEPS + + +# _LT_LANG_F77_CONFIG([TAG]) +# -------------------------- +# Ensure that the configuration variables for a Fortran 77 compiler are +# suitably defined. These variables are subsequently used by _LT_CONFIG +# to write the compiler configuration to `libtool'. +m4_defun([_LT_LANG_F77_CONFIG], +[AC_LANG_PUSH(Fortran 77) +if test -z "$F77" || test "X$F77" = "Xno"; then + _lt_disable_F77=yes +fi + +_LT_TAGVAR(archive_cmds_need_lc, $1)=no +_LT_TAGVAR(allow_undefined_flag, $1)= +_LT_TAGVAR(always_export_symbols, $1)=no +_LT_TAGVAR(archive_expsym_cmds, $1)= +_LT_TAGVAR(export_dynamic_flag_spec, $1)= +_LT_TAGVAR(hardcode_direct, $1)=no +_LT_TAGVAR(hardcode_direct_absolute, $1)=no +_LT_TAGVAR(hardcode_libdir_flag_spec, $1)= +_LT_TAGVAR(hardcode_libdir_separator, $1)= +_LT_TAGVAR(hardcode_minus_L, $1)=no +_LT_TAGVAR(hardcode_automatic, $1)=no +_LT_TAGVAR(inherit_rpath, $1)=no +_LT_TAGVAR(module_cmds, $1)= +_LT_TAGVAR(module_expsym_cmds, $1)= +_LT_TAGVAR(link_all_deplibs, $1)=unknown +_LT_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds +_LT_TAGVAR(reload_flag, $1)=$reload_flag +_LT_TAGVAR(reload_cmds, $1)=$reload_cmds +_LT_TAGVAR(no_undefined_flag, $1)= +_LT_TAGVAR(whole_archive_flag_spec, $1)= +_LT_TAGVAR(enable_shared_with_static_runtimes, $1)=no + +# Source file extension for f77 test sources. +ac_ext=f + +# Object file extension for compiled f77 test sources. +objext=o +_LT_TAGVAR(objext, $1)=$objext + +# No sense in running all these tests if we already determined that +# the F77 compiler isn't working. Some variables (like enable_shared) +# are currently assumed to apply to all compilers on this platform, +# and will be corrupted by setting them based on a non-working compiler. +if test "$_lt_disable_F77" != yes; then + # Code to be used in simple compile tests + lt_simple_compile_test_code="\ + subroutine t + return + end +" + + # Code to be used in simple link tests + lt_simple_link_test_code="\ + program t + end +" + + # ltmain only uses $CC for tagged configurations so make sure $CC is set. + _LT_TAG_COMPILER + + # save warnings/boilerplate of simple test code + _LT_COMPILER_BOILERPLATE + _LT_LINKER_BOILERPLATE + + # Allow CC to be a program name with arguments. + lt_save_CC="$CC" + lt_save_GCC=$GCC + lt_save_CFLAGS=$CFLAGS + CC=${F77-"f77"} + CFLAGS=$FFLAGS + compiler=$CC + _LT_TAGVAR(compiler, $1)=$CC + _LT_CC_BASENAME([$compiler]) + GCC=$G77 + if test -n "$compiler"; then + AC_MSG_CHECKING([if libtool supports shared libraries]) + AC_MSG_RESULT([$can_build_shared]) + + AC_MSG_CHECKING([whether to build shared libraries]) + test "$can_build_shared" = "no" && enable_shared=no + + # On AIX, shared libraries and static libraries use the same namespace, and + # are all built from PIC. + case $host_os in + aix3*) + test "$enable_shared" = yes && enable_static=no + if test -n "$RANLIB"; then + archive_cmds="$archive_cmds~\$RANLIB \$lib" + postinstall_cmds='$RANLIB $lib' + fi + ;; + aix[[4-9]]*) + if test "$host_cpu" != ia64 && test "$aix_use_runtimelinking" = no ; then + test "$enable_shared" = yes && enable_static=no + fi + ;; + esac + AC_MSG_RESULT([$enable_shared]) + + AC_MSG_CHECKING([whether to build static libraries]) + # Make sure either enable_shared or enable_static is yes. + test "$enable_shared" = yes || enable_static=yes + AC_MSG_RESULT([$enable_static]) + + _LT_TAGVAR(GCC, $1)="$G77" + _LT_TAGVAR(LD, $1)="$LD" + + ## CAVEAT EMPTOR: + ## There is no encapsulation within the following macros, do not change + ## the running order or otherwise move them around unless you know exactly + ## what you are doing... + _LT_COMPILER_PIC($1) + _LT_COMPILER_C_O($1) + _LT_COMPILER_FILE_LOCKS($1) + _LT_LINKER_SHLIBS($1) + _LT_SYS_DYNAMIC_LINKER($1) + _LT_LINKER_HARDCODE_LIBPATH($1) + + _LT_CONFIG($1) + fi # test -n "$compiler" + + GCC=$lt_save_GCC + CC="$lt_save_CC" + CFLAGS="$lt_save_CFLAGS" +fi # test "$_lt_disable_F77" != yes + +AC_LANG_POP +])# _LT_LANG_F77_CONFIG + + +# _LT_LANG_FC_CONFIG([TAG]) +# ------------------------- +# Ensure that the configuration variables for a Fortran compiler are +# suitably defined. These variables are subsequently used by _LT_CONFIG +# to write the compiler configuration to `libtool'. +m4_defun([_LT_LANG_FC_CONFIG], +[AC_LANG_PUSH(Fortran) + +if test -z "$FC" || test "X$FC" = "Xno"; then + _lt_disable_FC=yes +fi + +_LT_TAGVAR(archive_cmds_need_lc, $1)=no +_LT_TAGVAR(allow_undefined_flag, $1)= +_LT_TAGVAR(always_export_symbols, $1)=no +_LT_TAGVAR(archive_expsym_cmds, $1)= +_LT_TAGVAR(export_dynamic_flag_spec, $1)= +_LT_TAGVAR(hardcode_direct, $1)=no +_LT_TAGVAR(hardcode_direct_absolute, $1)=no +_LT_TAGVAR(hardcode_libdir_flag_spec, $1)= +_LT_TAGVAR(hardcode_libdir_separator, $1)= +_LT_TAGVAR(hardcode_minus_L, $1)=no +_LT_TAGVAR(hardcode_automatic, $1)=no +_LT_TAGVAR(inherit_rpath, $1)=no +_LT_TAGVAR(module_cmds, $1)= +_LT_TAGVAR(module_expsym_cmds, $1)= +_LT_TAGVAR(link_all_deplibs, $1)=unknown +_LT_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds +_LT_TAGVAR(reload_flag, $1)=$reload_flag +_LT_TAGVAR(reload_cmds, $1)=$reload_cmds +_LT_TAGVAR(no_undefined_flag, $1)= +_LT_TAGVAR(whole_archive_flag_spec, $1)= +_LT_TAGVAR(enable_shared_with_static_runtimes, $1)=no + +# Source file extension for fc test sources. +ac_ext=${ac_fc_srcext-f} + +# Object file extension for compiled fc test sources. +objext=o +_LT_TAGVAR(objext, $1)=$objext + +# No sense in running all these tests if we already determined that +# the FC compiler isn't working. Some variables (like enable_shared) +# are currently assumed to apply to all compilers on this platform, +# and will be corrupted by setting them based on a non-working compiler. +if test "$_lt_disable_FC" != yes; then + # Code to be used in simple compile tests + lt_simple_compile_test_code="\ + subroutine t + return + end +" + + # Code to be used in simple link tests + lt_simple_link_test_code="\ + program t + end +" + + # ltmain only uses $CC for tagged configurations so make sure $CC is set. + _LT_TAG_COMPILER + + # save warnings/boilerplate of simple test code + _LT_COMPILER_BOILERPLATE + _LT_LINKER_BOILERPLATE + + # Allow CC to be a program name with arguments. + lt_save_CC="$CC" + lt_save_GCC=$GCC + lt_save_CFLAGS=$CFLAGS + CC=${FC-"f95"} + CFLAGS=$FCFLAGS + compiler=$CC + GCC=$ac_cv_fc_compiler_gnu + + _LT_TAGVAR(compiler, $1)=$CC + _LT_CC_BASENAME([$compiler]) + + if test -n "$compiler"; then + AC_MSG_CHECKING([if libtool supports shared libraries]) + AC_MSG_RESULT([$can_build_shared]) + + AC_MSG_CHECKING([whether to build shared libraries]) + test "$can_build_shared" = "no" && enable_shared=no + + # On AIX, shared libraries and static libraries use the same namespace, and + # are all built from PIC. + case $host_os in + aix3*) + test "$enable_shared" = yes && enable_static=no + if test -n "$RANLIB"; then + archive_cmds="$archive_cmds~\$RANLIB \$lib" + postinstall_cmds='$RANLIB $lib' + fi + ;; + aix[[4-9]]*) + if test "$host_cpu" != ia64 && test "$aix_use_runtimelinking" = no ; then + test "$enable_shared" = yes && enable_static=no + fi + ;; + esac + AC_MSG_RESULT([$enable_shared]) + + AC_MSG_CHECKING([whether to build static libraries]) + # Make sure either enable_shared or enable_static is yes. + test "$enable_shared" = yes || enable_static=yes + AC_MSG_RESULT([$enable_static]) + + _LT_TAGVAR(GCC, $1)="$ac_cv_fc_compiler_gnu" + _LT_TAGVAR(LD, $1)="$LD" + + ## CAVEAT EMPTOR: + ## There is no encapsulation within the following macros, do not change + ## the running order or otherwise move them around unless you know exactly + ## what you are doing... + _LT_SYS_HIDDEN_LIBDEPS($1) + _LT_COMPILER_PIC($1) + _LT_COMPILER_C_O($1) + _LT_COMPILER_FILE_LOCKS($1) + _LT_LINKER_SHLIBS($1) + _LT_SYS_DYNAMIC_LINKER($1) + _LT_LINKER_HARDCODE_LIBPATH($1) + + _LT_CONFIG($1) + fi # test -n "$compiler" + + GCC=$lt_save_GCC + CC=$lt_save_CC + CFLAGS=$lt_save_CFLAGS +fi # test "$_lt_disable_FC" != yes + +AC_LANG_POP +])# _LT_LANG_FC_CONFIG + + +# _LT_LANG_GCJ_CONFIG([TAG]) +# -------------------------- +# Ensure that the configuration variables for the GNU Java Compiler compiler +# are suitably defined. These variables are subsequently used by _LT_CONFIG +# to write the compiler configuration to `libtool'. +m4_defun([_LT_LANG_GCJ_CONFIG], +[AC_REQUIRE([LT_PROG_GCJ])dnl +AC_LANG_SAVE + +# Source file extension for Java test sources. +ac_ext=java + +# Object file extension for compiled Java test sources. +objext=o +_LT_TAGVAR(objext, $1)=$objext + +# Code to be used in simple compile tests +lt_simple_compile_test_code="class foo {}" + +# Code to be used in simple link tests +lt_simple_link_test_code='public class conftest { public static void main(String[[]] argv) {}; }' + +# ltmain only uses $CC for tagged configurations so make sure $CC is set. +_LT_TAG_COMPILER + +# save warnings/boilerplate of simple test code +_LT_COMPILER_BOILERPLATE +_LT_LINKER_BOILERPLATE + +# Allow CC to be a program name with arguments. +lt_save_CC=$CC +lt_save_CFLAGS=$CFLAGS +lt_save_GCC=$GCC +GCC=yes +CC=${GCJ-"gcj"} +CFLAGS=$GCJFLAGS +compiler=$CC +_LT_TAGVAR(compiler, $1)=$CC +_LT_TAGVAR(LD, $1)="$LD" +_LT_CC_BASENAME([$compiler]) + +# GCJ did not exist at the time GCC didn't implicitly link libc in. +_LT_TAGVAR(archive_cmds_need_lc, $1)=no + +_LT_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds +_LT_TAGVAR(reload_flag, $1)=$reload_flag +_LT_TAGVAR(reload_cmds, $1)=$reload_cmds + +## CAVEAT EMPTOR: +## There is no encapsulation within the following macros, do not change +## the running order or otherwise move them around unless you know exactly +## what you are doing... +if test -n "$compiler"; then + _LT_COMPILER_NO_RTTI($1) + _LT_COMPILER_PIC($1) + _LT_COMPILER_C_O($1) + _LT_COMPILER_FILE_LOCKS($1) + _LT_LINKER_SHLIBS($1) + _LT_LINKER_HARDCODE_LIBPATH($1) + + _LT_CONFIG($1) +fi + +AC_LANG_RESTORE + +GCC=$lt_save_GCC +CC=$lt_save_CC +CFLAGS=$lt_save_CFLAGS +])# _LT_LANG_GCJ_CONFIG + + +# _LT_LANG_GO_CONFIG([TAG]) +# -------------------------- +# Ensure that the configuration variables for the GNU Go compiler +# are suitably defined. These variables are subsequently used by _LT_CONFIG +# to write the compiler configuration to `libtool'. +m4_defun([_LT_LANG_GO_CONFIG], +[AC_REQUIRE([LT_PROG_GO])dnl +AC_LANG_SAVE + +# Source file extension for Go test sources. +ac_ext=go + +# Object file extension for compiled Go test sources. +objext=o +_LT_TAGVAR(objext, $1)=$objext + +# Code to be used in simple compile tests +lt_simple_compile_test_code="package main; func main() { }" + +# Code to be used in simple link tests +lt_simple_link_test_code='package main; func main() { }' + +# ltmain only uses $CC for tagged configurations so make sure $CC is set. +_LT_TAG_COMPILER + +# save warnings/boilerplate of simple test code +_LT_COMPILER_BOILERPLATE +_LT_LINKER_BOILERPLATE + +# Allow CC to be a program name with arguments. +lt_save_CC=$CC +lt_save_CFLAGS=$CFLAGS +lt_save_GCC=$GCC +GCC=yes +CC=${GOC-"gccgo"} +CFLAGS=$GOFLAGS +compiler=$CC +_LT_TAGVAR(compiler, $1)=$CC +_LT_TAGVAR(LD, $1)="$LD" +_LT_CC_BASENAME([$compiler]) + +# Go did not exist at the time GCC didn't implicitly link libc in. +_LT_TAGVAR(archive_cmds_need_lc, $1)=no + +_LT_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds +_LT_TAGVAR(reload_flag, $1)=$reload_flag +_LT_TAGVAR(reload_cmds, $1)=$reload_cmds + +## CAVEAT EMPTOR: +## There is no encapsulation within the following macros, do not change +## the running order or otherwise move them around unless you know exactly +## what you are doing... +if test -n "$compiler"; then + _LT_COMPILER_NO_RTTI($1) + _LT_COMPILER_PIC($1) + _LT_COMPILER_C_O($1) + _LT_COMPILER_FILE_LOCKS($1) + _LT_LINKER_SHLIBS($1) + _LT_LINKER_HARDCODE_LIBPATH($1) + + _LT_CONFIG($1) +fi + +AC_LANG_RESTORE + +GCC=$lt_save_GCC +CC=$lt_save_CC +CFLAGS=$lt_save_CFLAGS +])# _LT_LANG_GO_CONFIG + + +# _LT_LANG_RC_CONFIG([TAG]) +# ------------------------- +# Ensure that the configuration variables for the Windows resource compiler +# are suitably defined. These variables are subsequently used by _LT_CONFIG +# to write the compiler configuration to `libtool'. +m4_defun([_LT_LANG_RC_CONFIG], +[AC_REQUIRE([LT_PROG_RC])dnl +AC_LANG_SAVE + +# Source file extension for RC test sources. +ac_ext=rc + +# Object file extension for compiled RC test sources. +objext=o +_LT_TAGVAR(objext, $1)=$objext + +# Code to be used in simple compile tests +lt_simple_compile_test_code='sample MENU { MENUITEM "&Soup", 100, CHECKED }' + +# Code to be used in simple link tests +lt_simple_link_test_code="$lt_simple_compile_test_code" + +# ltmain only uses $CC for tagged configurations so make sure $CC is set. +_LT_TAG_COMPILER + +# save warnings/boilerplate of simple test code +_LT_COMPILER_BOILERPLATE +_LT_LINKER_BOILERPLATE + +# Allow CC to be a program name with arguments. +lt_save_CC="$CC" +lt_save_CFLAGS=$CFLAGS +lt_save_GCC=$GCC +GCC= +CC=${RC-"windres"} +CFLAGS= +compiler=$CC +_LT_TAGVAR(compiler, $1)=$CC +_LT_CC_BASENAME([$compiler]) +_LT_TAGVAR(lt_cv_prog_compiler_c_o, $1)=yes + +if test -n "$compiler"; then + : + _LT_CONFIG($1) +fi + +GCC=$lt_save_GCC +AC_LANG_RESTORE +CC=$lt_save_CC +CFLAGS=$lt_save_CFLAGS +])# _LT_LANG_RC_CONFIG + + +# LT_PROG_GCJ +# ----------- +AC_DEFUN([LT_PROG_GCJ], +[m4_ifdef([AC_PROG_GCJ], [AC_PROG_GCJ], + [m4_ifdef([A][M_PROG_GCJ], [A][M_PROG_GCJ], + [AC_CHECK_TOOL(GCJ, gcj,) + test "x${GCJFLAGS+set}" = xset || GCJFLAGS="-g -O2" + AC_SUBST(GCJFLAGS)])])[]dnl +]) + +# Old name: +AU_ALIAS([LT_AC_PROG_GCJ], [LT_PROG_GCJ]) +dnl aclocal-1.4 backwards compatibility: +dnl AC_DEFUN([LT_AC_PROG_GCJ], []) + + +# LT_PROG_GO +# ---------- +AC_DEFUN([LT_PROG_GO], +[AC_CHECK_TOOL(GOC, gccgo,) +]) + + +# LT_PROG_RC +# ---------- +AC_DEFUN([LT_PROG_RC], +[AC_CHECK_TOOL(RC, windres,) +]) + +# Old name: +AU_ALIAS([LT_AC_PROG_RC], [LT_PROG_RC]) +dnl aclocal-1.4 backwards compatibility: +dnl AC_DEFUN([LT_AC_PROG_RC], []) + + +# _LT_DECL_EGREP +# -------------- +# If we don't have a new enough Autoconf to choose the best grep +# available, choose the one first in the user's PATH. +m4_defun([_LT_DECL_EGREP], +[AC_REQUIRE([AC_PROG_EGREP])dnl +AC_REQUIRE([AC_PROG_FGREP])dnl +test -z "$GREP" && GREP=grep +_LT_DECL([], [GREP], [1], [A grep program that handles long lines]) +_LT_DECL([], [EGREP], [1], [An ERE matcher]) +_LT_DECL([], [FGREP], [1], [A literal string matcher]) +dnl Non-bleeding-edge autoconf doesn't subst GREP, so do it here too +AC_SUBST([GREP]) +]) + + +# _LT_DECL_OBJDUMP +# -------------- +# If we don't have a new enough Autoconf to choose the best objdump +# available, choose the one first in the user's PATH. +m4_defun([_LT_DECL_OBJDUMP], +[AC_CHECK_TOOL(OBJDUMP, objdump, false) +test -z "$OBJDUMP" && OBJDUMP=objdump +_LT_DECL([], [OBJDUMP], [1], [An object symbol dumper]) +AC_SUBST([OBJDUMP]) +]) + +# _LT_DECL_DLLTOOL +# ---------------- +# Ensure DLLTOOL variable is set. +m4_defun([_LT_DECL_DLLTOOL], +[AC_CHECK_TOOL(DLLTOOL, dlltool, false) +test -z "$DLLTOOL" && DLLTOOL=dlltool +_LT_DECL([], [DLLTOOL], [1], [DLL creation program]) +AC_SUBST([DLLTOOL]) +]) + +# _LT_DECL_SED +# ------------ +# Check for a fully-functional sed program, that truncates +# as few characters as possible. Prefer GNU sed if found. +m4_defun([_LT_DECL_SED], +[AC_PROG_SED +test -z "$SED" && SED=sed +Xsed="$SED -e 1s/^X//" +_LT_DECL([], [SED], [1], [A sed program that does not truncate output]) +_LT_DECL([], [Xsed], ["\$SED -e 1s/^X//"], + [Sed that helps us avoid accidentally triggering echo(1) options like -n]) +])# _LT_DECL_SED + +m4_ifndef([AC_PROG_SED], [ +############################################################ +# NOTE: This macro has been submitted for inclusion into # +# GNU Autoconf as AC_PROG_SED. When it is available in # +# a released version of Autoconf we should remove this # +# macro and use it instead. # +############################################################ + +m4_defun([AC_PROG_SED], +[AC_MSG_CHECKING([for a sed that does not truncate output]) +AC_CACHE_VAL(lt_cv_path_SED, +[# Loop through the user's path and test for sed and gsed. +# Then use that list of sed's as ones to test for truncation. +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for lt_ac_prog in sed gsed; do + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$lt_ac_prog$ac_exec_ext"; then + lt_ac_sed_list="$lt_ac_sed_list $as_dir/$lt_ac_prog$ac_exec_ext" + fi + done + done +done +IFS=$as_save_IFS +lt_ac_max=0 +lt_ac_count=0 +# Add /usr/xpg4/bin/sed as it is typically found on Solaris +# along with /bin/sed that truncates output. +for lt_ac_sed in $lt_ac_sed_list /usr/xpg4/bin/sed; do + test ! -f $lt_ac_sed && continue + cat /dev/null > conftest.in + lt_ac_count=0 + echo $ECHO_N "0123456789$ECHO_C" >conftest.in + # Check for GNU sed and select it if it is found. + if "$lt_ac_sed" --version 2>&1 < /dev/null | grep 'GNU' > /dev/null; then + lt_cv_path_SED=$lt_ac_sed + break + fi + while true; do + cat conftest.in conftest.in >conftest.tmp + mv conftest.tmp conftest.in + cp conftest.in conftest.nl + echo >>conftest.nl + $lt_ac_sed -e 's/a$//' < conftest.nl >conftest.out || break + cmp -s conftest.out conftest.nl || break + # 10000 chars as input seems more than enough + test $lt_ac_count -gt 10 && break + lt_ac_count=`expr $lt_ac_count + 1` + if test $lt_ac_count -gt $lt_ac_max; then + lt_ac_max=$lt_ac_count + lt_cv_path_SED=$lt_ac_sed + fi + done +done +]) +SED=$lt_cv_path_SED +AC_SUBST([SED]) +AC_MSG_RESULT([$SED]) +])#AC_PROG_SED +])#m4_ifndef + +# Old name: +AU_ALIAS([LT_AC_PROG_SED], [AC_PROG_SED]) +dnl aclocal-1.4 backwards compatibility: +dnl AC_DEFUN([LT_AC_PROG_SED], []) + + +# _LT_CHECK_SHELL_FEATURES +# ------------------------ +# Find out whether the shell is Bourne or XSI compatible, +# or has some other useful features. +m4_defun([_LT_CHECK_SHELL_FEATURES], +[AC_MSG_CHECKING([whether the shell understands some XSI constructs]) +# Try some XSI features +xsi_shell=no +( _lt_dummy="a/b/c" + test "${_lt_dummy##*/},${_lt_dummy%/*},${_lt_dummy#??}"${_lt_dummy%"$_lt_dummy"}, \ + = c,a/b,b/c, \ + && eval 'test $(( 1 + 1 )) -eq 2 \ + && test "${#_lt_dummy}" -eq 5' ) >/dev/null 2>&1 \ + && xsi_shell=yes +AC_MSG_RESULT([$xsi_shell]) +_LT_CONFIG_LIBTOOL_INIT([xsi_shell='$xsi_shell']) + +AC_MSG_CHECKING([whether the shell understands "+="]) +lt_shell_append=no +( foo=bar; set foo baz; eval "$[1]+=\$[2]" && test "$foo" = barbaz ) \ + >/dev/null 2>&1 \ + && lt_shell_append=yes +AC_MSG_RESULT([$lt_shell_append]) +_LT_CONFIG_LIBTOOL_INIT([lt_shell_append='$lt_shell_append']) + +if ( (MAIL=60; unset MAIL) || exit) >/dev/null 2>&1; then + lt_unset=unset +else + lt_unset=false +fi +_LT_DECL([], [lt_unset], [0], [whether the shell understands "unset"])dnl + +# test EBCDIC or ASCII +case `echo X|tr X '\101'` in + A) # ASCII based system + # \n is not interpreted correctly by Solaris 8 /usr/ucb/tr + lt_SP2NL='tr \040 \012' + lt_NL2SP='tr \015\012 \040\040' + ;; + *) # EBCDIC based system + lt_SP2NL='tr \100 \n' + lt_NL2SP='tr \r\n \100\100' + ;; +esac +_LT_DECL([SP2NL], [lt_SP2NL], [1], [turn spaces into newlines])dnl +_LT_DECL([NL2SP], [lt_NL2SP], [1], [turn newlines into spaces])dnl +])# _LT_CHECK_SHELL_FEATURES + + +# _LT_PROG_FUNCTION_REPLACE (FUNCNAME, REPLACEMENT-BODY) +# ------------------------------------------------------ +# In `$cfgfile', look for function FUNCNAME delimited by `^FUNCNAME ()$' and +# '^} FUNCNAME ', and replace its body with REPLACEMENT-BODY. +m4_defun([_LT_PROG_FUNCTION_REPLACE], +[dnl { +sed -e '/^$1 ()$/,/^} # $1 /c\ +$1 ()\ +{\ +m4_bpatsubsts([$2], [$], [\\], [^\([ ]\)], [\\\1]) +} # Extended-shell $1 implementation' "$cfgfile" > $cfgfile.tmp \ + && mv -f "$cfgfile.tmp" "$cfgfile" \ + || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp") +test 0 -eq $? || _lt_function_replace_fail=: +]) + + +# _LT_PROG_REPLACE_SHELLFNS +# ------------------------- +# Replace existing portable implementations of several shell functions with +# equivalent extended shell implementations where those features are available.. +m4_defun([_LT_PROG_REPLACE_SHELLFNS], +[if test x"$xsi_shell" = xyes; then + _LT_PROG_FUNCTION_REPLACE([func_dirname], [dnl + case ${1} in + */*) func_dirname_result="${1%/*}${2}" ;; + * ) func_dirname_result="${3}" ;; + esac]) + + _LT_PROG_FUNCTION_REPLACE([func_basename], [dnl + func_basename_result="${1##*/}"]) + + _LT_PROG_FUNCTION_REPLACE([func_dirname_and_basename], [dnl + case ${1} in + */*) func_dirname_result="${1%/*}${2}" ;; + * ) func_dirname_result="${3}" ;; + esac + func_basename_result="${1##*/}"]) + + _LT_PROG_FUNCTION_REPLACE([func_stripname], [dnl + # pdksh 5.2.14 does not do ${X%$Y} correctly if both X and Y are + # positional parameters, so assign one to ordinary parameter first. + func_stripname_result=${3} + func_stripname_result=${func_stripname_result#"${1}"} + func_stripname_result=${func_stripname_result%"${2}"}]) + + _LT_PROG_FUNCTION_REPLACE([func_split_long_opt], [dnl + func_split_long_opt_name=${1%%=*} + func_split_long_opt_arg=${1#*=}]) + + _LT_PROG_FUNCTION_REPLACE([func_split_short_opt], [dnl + func_split_short_opt_arg=${1#??} + func_split_short_opt_name=${1%"$func_split_short_opt_arg"}]) + + _LT_PROG_FUNCTION_REPLACE([func_lo2o], [dnl + case ${1} in + *.lo) func_lo2o_result=${1%.lo}.${objext} ;; + *) func_lo2o_result=${1} ;; + esac]) + + _LT_PROG_FUNCTION_REPLACE([func_xform], [ func_xform_result=${1%.*}.lo]) + + _LT_PROG_FUNCTION_REPLACE([func_arith], [ func_arith_result=$(( $[*] ))]) + + _LT_PROG_FUNCTION_REPLACE([func_len], [ func_len_result=${#1}]) +fi + +if test x"$lt_shell_append" = xyes; then + _LT_PROG_FUNCTION_REPLACE([func_append], [ eval "${1}+=\\${2}"]) + + _LT_PROG_FUNCTION_REPLACE([func_append_quoted], [dnl + func_quote_for_eval "${2}" +dnl m4 expansion turns \\\\ into \\, and then the shell eval turns that into \ + eval "${1}+=\\\\ \\$func_quote_for_eval_result"]) + + # Save a `func_append' function call where possible by direct use of '+=' + sed -e 's%func_append \([[a-zA-Z_]]\{1,\}\) "%\1+="%g' $cfgfile > $cfgfile.tmp \ + && mv -f "$cfgfile.tmp" "$cfgfile" \ + || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp") + test 0 -eq $? || _lt_function_replace_fail=: +else + # Save a `func_append' function call even when '+=' is not available + sed -e 's%func_append \([[a-zA-Z_]]\{1,\}\) "%\1="$\1%g' $cfgfile > $cfgfile.tmp \ + && mv -f "$cfgfile.tmp" "$cfgfile" \ + || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp") + test 0 -eq $? || _lt_function_replace_fail=: +fi + +if test x"$_lt_function_replace_fail" = x":"; then + AC_MSG_WARN([Unable to substitute extended shell functions in $ofile]) +fi +]) + +# _LT_PATH_CONVERSION_FUNCTIONS +# ----------------------------- +# Determine which file name conversion functions should be used by +# func_to_host_file (and, implicitly, by func_to_host_path). These are needed +# for certain cross-compile configurations and native mingw. +m4_defun([_LT_PATH_CONVERSION_FUNCTIONS], +[AC_REQUIRE([AC_CANONICAL_HOST])dnl +AC_REQUIRE([AC_CANONICAL_BUILD])dnl +AC_MSG_CHECKING([how to convert $build file names to $host format]) +AC_CACHE_VAL(lt_cv_to_host_file_cmd, +[case $host in + *-*-mingw* ) + case $build in + *-*-mingw* ) # actually msys + lt_cv_to_host_file_cmd=func_convert_file_msys_to_w32 + ;; + *-*-cygwin* ) + lt_cv_to_host_file_cmd=func_convert_file_cygwin_to_w32 + ;; + * ) # otherwise, assume *nix + lt_cv_to_host_file_cmd=func_convert_file_nix_to_w32 + ;; + esac + ;; + *-*-cygwin* ) + case $build in + *-*-mingw* ) # actually msys + lt_cv_to_host_file_cmd=func_convert_file_msys_to_cygwin + ;; + *-*-cygwin* ) + lt_cv_to_host_file_cmd=func_convert_file_noop + ;; + * ) # otherwise, assume *nix + lt_cv_to_host_file_cmd=func_convert_file_nix_to_cygwin + ;; + esac + ;; + * ) # unhandled hosts (and "normal" native builds) + lt_cv_to_host_file_cmd=func_convert_file_noop + ;; +esac +]) +to_host_file_cmd=$lt_cv_to_host_file_cmd +AC_MSG_RESULT([$lt_cv_to_host_file_cmd]) +_LT_DECL([to_host_file_cmd], [lt_cv_to_host_file_cmd], + [0], [convert $build file names to $host format])dnl + +AC_MSG_CHECKING([how to convert $build file names to toolchain format]) +AC_CACHE_VAL(lt_cv_to_tool_file_cmd, +[#assume ordinary cross tools, or native build. +lt_cv_to_tool_file_cmd=func_convert_file_noop +case $host in + *-*-mingw* ) + case $build in + *-*-mingw* ) # actually msys + lt_cv_to_tool_file_cmd=func_convert_file_msys_to_w32 + ;; + esac + ;; +esac +]) +to_tool_file_cmd=$lt_cv_to_tool_file_cmd +AC_MSG_RESULT([$lt_cv_to_tool_file_cmd]) +_LT_DECL([to_tool_file_cmd], [lt_cv_to_tool_file_cmd], + [0], [convert $build files to toolchain format])dnl +])# _LT_PATH_CONVERSION_FUNCTIONS diff -Naur --exclude=autom4te.cache openssh-7.0p1/ltmain.sh openssh-7.0p1-gssapi/ltmain.sh --- openssh-7.0p1/ltmain.sh 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/ltmain.sh 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,9655 @@ + +# libtool (GNU libtool) 2.4.2 +# Written by Gordon Matzigkeit , 1996 + +# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2003, 2004, 2005, 2006, +# 2007, 2008, 2009, 2010, 2011 Free Software Foundation, Inc. +# This is free software; see the source for copying conditions. There is NO +# warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. + +# GNU Libtool is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# As a special exception to the GNU General Public License, +# if you distribute this file as part of a program or library that +# is built using GNU Libtool, you may include this file under the +# same distribution terms that you use for the rest of that program. +# +# GNU Libtool is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with GNU Libtool; see the file COPYING. If not, a copy +# can be downloaded from http://www.gnu.org/licenses/gpl.html, +# or obtained by writing to the Free Software Foundation, Inc., +# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. + +# Usage: $progname [OPTION]... [MODE-ARG]... +# +# Provide generalized library-building support services. +# +# --config show all configuration variables +# --debug enable verbose shell tracing +# -n, --dry-run display commands without modifying any files +# --features display basic configuration information and exit +# --mode=MODE use operation mode MODE +# --preserve-dup-deps don't remove duplicate dependency libraries +# --quiet, --silent don't print informational messages +# --no-quiet, --no-silent +# print informational messages (default) +# --no-warn don't display warning messages +# --tag=TAG use configuration variables from tag TAG +# -v, --verbose print more informational messages than default +# --no-verbose don't print the extra informational messages +# --version print version information +# -h, --help, --help-all print short, long, or detailed help message +# +# MODE must be one of the following: +# +# clean remove files from the build directory +# compile compile a source file into a libtool object +# execute automatically set library path, then run a program +# finish complete the installation of libtool libraries +# install install libraries or executables +# link create a library or an executable +# uninstall remove libraries from an installed directory +# +# MODE-ARGS vary depending on the MODE. When passed as first option, +# `--mode=MODE' may be abbreviated as `MODE' or a unique abbreviation of that. +# Try `$progname --help --mode=MODE' for a more detailed description of MODE. +# +# When reporting a bug, please describe a test case to reproduce it and +# include the following information: +# +# host-triplet: $host +# shell: $SHELL +# compiler: $LTCC +# compiler flags: $LTCFLAGS +# linker: $LD (gnu? $with_gnu_ld) +# $progname: (GNU libtool) 2.4.2 +# automake: $automake_version +# autoconf: $autoconf_version +# +# Report bugs to . +# GNU libtool home page: . +# General help using GNU software: . + +PROGRAM=libtool +PACKAGE=libtool +VERSION=2.4.2 +TIMESTAMP="" +package_revision=1.3337 + +# Be Bourne compatible +if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then + emulate sh + NULLCMD=: + # Zsh 3.x and 4.x performs word splitting on ${1+"$@"}, which + # is contrary to our usage. Disable this feature. + alias -g '${1+"$@"}'='"$@"' + setopt NO_GLOB_SUBST +else + case `(set -o) 2>/dev/null` in *posix*) set -o posix;; esac +fi +BIN_SH=xpg4; export BIN_SH # for Tru64 +DUALCASE=1; export DUALCASE # for MKS sh + +# A function that is used when there is no print builtin or printf. +func_fallback_echo () +{ + eval 'cat <<_LTECHO_EOF +$1 +_LTECHO_EOF' +} + +# NLS nuisances: We save the old values to restore during execute mode. +lt_user_locale= +lt_safe_locale= +for lt_var in LANG LANGUAGE LC_ALL LC_CTYPE LC_COLLATE LC_MESSAGES +do + eval "if test \"\${$lt_var+set}\" = set; then + save_$lt_var=\$$lt_var + $lt_var=C + export $lt_var + lt_user_locale=\"$lt_var=\\\$save_\$lt_var; \$lt_user_locale\" + lt_safe_locale=\"$lt_var=C; \$lt_safe_locale\" + fi" +done +LC_ALL=C +LANGUAGE=C +export LANGUAGE LC_ALL + +$lt_unset CDPATH + + +# Work around backward compatibility issue on IRIX 6.5. On IRIX 6.4+, sh +# is ksh but when the shell is invoked as "sh" and the current value of +# the _XPG environment variable is not equal to 1 (one), the special +# positional parameter $0, within a function call, is the name of the +# function. +progpath="$0" + + + +: ${CP="cp -f"} +test "${ECHO+set}" = set || ECHO=${as_echo-'printf %s\n'} +: ${MAKE="make"} +: ${MKDIR="mkdir"} +: ${MV="mv -f"} +: ${RM="rm -f"} +: ${SHELL="${CONFIG_SHELL-/bin/sh}"} +: ${Xsed="$SED -e 1s/^X//"} + +# Global variables: +EXIT_SUCCESS=0 +EXIT_FAILURE=1 +EXIT_MISMATCH=63 # $? = 63 is used to indicate version mismatch to missing. +EXIT_SKIP=77 # $? = 77 is used to indicate a skipped test to automake. + +exit_status=$EXIT_SUCCESS + +# Make sure IFS has a sensible default +lt_nl=' +' +IFS=" $lt_nl" + +dirname="s,/[^/]*$,," +basename="s,^.*/,," + +# func_dirname file append nondir_replacement +# Compute the dirname of FILE. If nonempty, add APPEND to the result, +# otherwise set result to NONDIR_REPLACEMENT. +func_dirname () +{ + func_dirname_result=`$ECHO "${1}" | $SED "$dirname"` + if test "X$func_dirname_result" = "X${1}"; then + func_dirname_result="${3}" + else + func_dirname_result="$func_dirname_result${2}" + fi +} # func_dirname may be replaced by extended shell implementation + + +# func_basename file +func_basename () +{ + func_basename_result=`$ECHO "${1}" | $SED "$basename"` +} # func_basename may be replaced by extended shell implementation + + +# func_dirname_and_basename file append nondir_replacement +# perform func_basename and func_dirname in a single function +# call: +# dirname: Compute the dirname of FILE. If nonempty, +# add APPEND to the result, otherwise set result +# to NONDIR_REPLACEMENT. +# value returned in "$func_dirname_result" +# basename: Compute filename of FILE. +# value retuned in "$func_basename_result" +# Implementation must be kept synchronized with func_dirname +# and func_basename. For efficiency, we do not delegate to +# those functions but instead duplicate the functionality here. +func_dirname_and_basename () +{ + # Extract subdirectory from the argument. + func_dirname_result=`$ECHO "${1}" | $SED -e "$dirname"` + if test "X$func_dirname_result" = "X${1}"; then + func_dirname_result="${3}" + else + func_dirname_result="$func_dirname_result${2}" + fi + func_basename_result=`$ECHO "${1}" | $SED -e "$basename"` +} # func_dirname_and_basename may be replaced by extended shell implementation + + +# func_stripname prefix suffix name +# strip PREFIX and SUFFIX off of NAME. +# PREFIX and SUFFIX must not contain globbing or regex special +# characters, hashes, percent signs, but SUFFIX may contain a leading +# dot (in which case that matches only a dot). +# func_strip_suffix prefix name +func_stripname () +{ + case ${2} in + .*) func_stripname_result=`$ECHO "${3}" | $SED "s%^${1}%%; s%\\\\${2}\$%%"`;; + *) func_stripname_result=`$ECHO "${3}" | $SED "s%^${1}%%; s%${2}\$%%"`;; + esac +} # func_stripname may be replaced by extended shell implementation + + +# These SED scripts presuppose an absolute path with a trailing slash. +pathcar='s,^/\([^/]*\).*$,\1,' +pathcdr='s,^/[^/]*,,' +removedotparts=':dotsl + s@/\./@/@g + t dotsl + s,/\.$,/,' +collapseslashes='s@/\{1,\}@/@g' +finalslash='s,/*$,/,' + +# func_normal_abspath PATH +# Remove doubled-up and trailing slashes, "." path components, +# and cancel out any ".." path components in PATH after making +# it an absolute path. +# value returned in "$func_normal_abspath_result" +func_normal_abspath () +{ + # Start from root dir and reassemble the path. + func_normal_abspath_result= + func_normal_abspath_tpath=$1 + func_normal_abspath_altnamespace= + case $func_normal_abspath_tpath in + "") + # Empty path, that just means $cwd. + func_stripname '' '/' "`pwd`" + func_normal_abspath_result=$func_stripname_result + return + ;; + # The next three entries are used to spot a run of precisely + # two leading slashes without using negated character classes; + # we take advantage of case's first-match behaviour. + ///*) + # Unusual form of absolute path, do nothing. + ;; + //*) + # Not necessarily an ordinary path; POSIX reserves leading '//' + # and for example Cygwin uses it to access remote file shares + # over CIFS/SMB, so we conserve a leading double slash if found. + func_normal_abspath_altnamespace=/ + ;; + /*) + # Absolute path, do nothing. + ;; + *) + # Relative path, prepend $cwd. + func_normal_abspath_tpath=`pwd`/$func_normal_abspath_tpath + ;; + esac + # Cancel out all the simple stuff to save iterations. We also want + # the path to end with a slash for ease of parsing, so make sure + # there is one (and only one) here. + func_normal_abspath_tpath=`$ECHO "$func_normal_abspath_tpath" | $SED \ + -e "$removedotparts" -e "$collapseslashes" -e "$finalslash"` + while :; do + # Processed it all yet? + if test "$func_normal_abspath_tpath" = / ; then + # If we ascended to the root using ".." the result may be empty now. + if test -z "$func_normal_abspath_result" ; then + func_normal_abspath_result=/ + fi + break + fi + func_normal_abspath_tcomponent=`$ECHO "$func_normal_abspath_tpath" | $SED \ + -e "$pathcar"` + func_normal_abspath_tpath=`$ECHO "$func_normal_abspath_tpath" | $SED \ + -e "$pathcdr"` + # Figure out what to do with it + case $func_normal_abspath_tcomponent in + "") + # Trailing empty path component, ignore it. + ;; + ..) + # Parent dir; strip last assembled component from result. + func_dirname "$func_normal_abspath_result" + func_normal_abspath_result=$func_dirname_result + ;; + *) + # Actual path component, append it. + func_normal_abspath_result=$func_normal_abspath_result/$func_normal_abspath_tcomponent + ;; + esac + done + # Restore leading double-slash if one was found on entry. + func_normal_abspath_result=$func_normal_abspath_altnamespace$func_normal_abspath_result +} + +# func_relative_path SRCDIR DSTDIR +# generates a relative path from SRCDIR to DSTDIR, with a trailing +# slash if non-empty, suitable for immediately appending a filename +# without needing to append a separator. +# value returned in "$func_relative_path_result" +func_relative_path () +{ + func_relative_path_result= + func_normal_abspath "$1" + func_relative_path_tlibdir=$func_normal_abspath_result + func_normal_abspath "$2" + func_relative_path_tbindir=$func_normal_abspath_result + + # Ascend the tree starting from libdir + while :; do + # check if we have found a prefix of bindir + case $func_relative_path_tbindir in + $func_relative_path_tlibdir) + # found an exact match + func_relative_path_tcancelled= + break + ;; + $func_relative_path_tlibdir*) + # found a matching prefix + func_stripname "$func_relative_path_tlibdir" '' "$func_relative_path_tbindir" + func_relative_path_tcancelled=$func_stripname_result + if test -z "$func_relative_path_result"; then + func_relative_path_result=. + fi + break + ;; + *) + func_dirname $func_relative_path_tlibdir + func_relative_path_tlibdir=${func_dirname_result} + if test "x$func_relative_path_tlibdir" = x ; then + # Have to descend all the way to the root! + func_relative_path_result=../$func_relative_path_result + func_relative_path_tcancelled=$func_relative_path_tbindir + break + fi + func_relative_path_result=../$func_relative_path_result + ;; + esac + done + + # Now calculate path; take care to avoid doubling-up slashes. + func_stripname '' '/' "$func_relative_path_result" + func_relative_path_result=$func_stripname_result + func_stripname '/' '/' "$func_relative_path_tcancelled" + if test "x$func_stripname_result" != x ; then + func_relative_path_result=${func_relative_path_result}/${func_stripname_result} + fi + + # Normalisation. If bindir is libdir, return empty string, + # else relative path ending with a slash; either way, target + # file name can be directly appended. + if test ! -z "$func_relative_path_result"; then + func_stripname './' '' "$func_relative_path_result/" + func_relative_path_result=$func_stripname_result + fi +} + +# The name of this program: +func_dirname_and_basename "$progpath" +progname=$func_basename_result + +# Make sure we have an absolute path for reexecution: +case $progpath in + [\\/]*|[A-Za-z]:\\*) ;; + *[\\/]*) + progdir=$func_dirname_result + progdir=`cd "$progdir" && pwd` + progpath="$progdir/$progname" + ;; + *) + save_IFS="$IFS" + IFS=${PATH_SEPARATOR-:} + for progdir in $PATH; do + IFS="$save_IFS" + test -x "$progdir/$progname" && break + done + IFS="$save_IFS" + test -n "$progdir" || progdir=`pwd` + progpath="$progdir/$progname" + ;; +esac + +# Sed substitution that helps us do robust quoting. It backslashifies +# metacharacters that are still active within double-quoted strings. +Xsed="${SED}"' -e 1s/^X//' +sed_quote_subst='s/\([`"$\\]\)/\\\1/g' + +# Same as above, but do not quote variable references. +double_quote_subst='s/\(["`\\]\)/\\\1/g' + +# Sed substitution that turns a string into a regex matching for the +# string literally. +sed_make_literal_regex='s,[].[^$\\*\/],\\&,g' + +# Sed substitution that converts a w32 file name or path +# which contains forward slashes, into one that contains +# (escaped) backslashes. A very naive implementation. +lt_sed_naive_backslashify='s|\\\\*|\\|g;s|/|\\|g;s|\\|\\\\|g' + +# Re-`\' parameter expansions in output of double_quote_subst that were +# `\'-ed in input to the same. If an odd number of `\' preceded a '$' +# in input to double_quote_subst, that '$' was protected from expansion. +# Since each input `\' is now two `\'s, look for any number of runs of +# four `\'s followed by two `\'s and then a '$'. `\' that '$'. +bs='\\' +bs2='\\\\' +bs4='\\\\\\\\' +dollar='\$' +sed_double_backslash="\ + s/$bs4/&\\ +/g + s/^$bs2$dollar/$bs&/ + s/\\([^$bs]\\)$bs2$dollar/\\1$bs2$bs$dollar/g + s/\n//g" + +# Standard options: +opt_dry_run=false +opt_help=false +opt_quiet=false +opt_verbose=false +opt_warning=: + +# func_echo arg... +# Echo program name prefixed message, along with the current mode +# name if it has been set yet. +func_echo () +{ + $ECHO "$progname: ${opt_mode+$opt_mode: }$*" +} + +# func_verbose arg... +# Echo program name prefixed message in verbose mode only. +func_verbose () +{ + $opt_verbose && func_echo ${1+"$@"} + + # A bug in bash halts the script if the last line of a function + # fails when set -e is in force, so we need another command to + # work around that: + : +} + +# func_echo_all arg... +# Invoke $ECHO with all args, space-separated. +func_echo_all () +{ + $ECHO "$*" +} + +# func_error arg... +# Echo program name prefixed message to standard error. +func_error () +{ + $ECHO "$progname: ${opt_mode+$opt_mode: }"${1+"$@"} 1>&2 +} + +# func_warning arg... +# Echo program name prefixed warning message to standard error. +func_warning () +{ + $opt_warning && $ECHO "$progname: ${opt_mode+$opt_mode: }warning: "${1+"$@"} 1>&2 + + # bash bug again: + : +} + +# func_fatal_error arg... +# Echo program name prefixed message to standard error, and exit. +func_fatal_error () +{ + func_error ${1+"$@"} + exit $EXIT_FAILURE +} + +# func_fatal_help arg... +# Echo program name prefixed message to standard error, followed by +# a help hint, and exit. +func_fatal_help () +{ + func_error ${1+"$@"} + func_fatal_error "$help" +} +help="Try \`$progname --help' for more information." ## default + + +# func_grep expression filename +# Check whether EXPRESSION matches any line of FILENAME, without output. +func_grep () +{ + $GREP "$1" "$2" >/dev/null 2>&1 +} + + +# func_mkdir_p directory-path +# Make sure the entire path to DIRECTORY-PATH is available. +func_mkdir_p () +{ + my_directory_path="$1" + my_dir_list= + + if test -n "$my_directory_path" && test "$opt_dry_run" != ":"; then + + # Protect directory names starting with `-' + case $my_directory_path in + -*) my_directory_path="./$my_directory_path" ;; + esac + + # While some portion of DIR does not yet exist... + while test ! -d "$my_directory_path"; do + # ...make a list in topmost first order. Use a colon delimited + # list incase some portion of path contains whitespace. + my_dir_list="$my_directory_path:$my_dir_list" + + # If the last portion added has no slash in it, the list is done + case $my_directory_path in */*) ;; *) break ;; esac + + # ...otherwise throw away the child directory and loop + my_directory_path=`$ECHO "$my_directory_path" | $SED -e "$dirname"` + done + my_dir_list=`$ECHO "$my_dir_list" | $SED 's,:*$,,'` + + save_mkdir_p_IFS="$IFS"; IFS=':' + for my_dir in $my_dir_list; do + IFS="$save_mkdir_p_IFS" + # mkdir can fail with a `File exist' error if two processes + # try to create one of the directories concurrently. Don't + # stop in that case! + $MKDIR "$my_dir" 2>/dev/null || : + done + IFS="$save_mkdir_p_IFS" + + # Bail out if we (or some other process) failed to create a directory. + test -d "$my_directory_path" || \ + func_fatal_error "Failed to create \`$1'" + fi +} + + +# func_mktempdir [string] +# Make a temporary directory that won't clash with other running +# libtool processes, and avoids race conditions if possible. If +# given, STRING is the basename for that directory. +func_mktempdir () +{ + my_template="${TMPDIR-/tmp}/${1-$progname}" + + if test "$opt_dry_run" = ":"; then + # Return a directory name, but don't create it in dry-run mode + my_tmpdir="${my_template}-$$" + else + + # If mktemp works, use that first and foremost + my_tmpdir=`mktemp -d "${my_template}-XXXXXXXX" 2>/dev/null` + + if test ! -d "$my_tmpdir"; then + # Failing that, at least try and use $RANDOM to avoid a race + my_tmpdir="${my_template}-${RANDOM-0}$$" + + save_mktempdir_umask=`umask` + umask 0077 + $MKDIR "$my_tmpdir" + umask $save_mktempdir_umask + fi + + # If we're not in dry-run mode, bomb out on failure + test -d "$my_tmpdir" || \ + func_fatal_error "cannot create temporary directory \`$my_tmpdir'" + fi + + $ECHO "$my_tmpdir" +} + + +# func_quote_for_eval arg +# Aesthetically quote ARG to be evaled later. +# This function returns two values: FUNC_QUOTE_FOR_EVAL_RESULT +# is double-quoted, suitable for a subsequent eval, whereas +# FUNC_QUOTE_FOR_EVAL_UNQUOTED_RESULT has merely all characters +# which are still active within double quotes backslashified. +func_quote_for_eval () +{ + case $1 in + *[\\\`\"\$]*) + func_quote_for_eval_unquoted_result=`$ECHO "$1" | $SED "$sed_quote_subst"` ;; + *) + func_quote_for_eval_unquoted_result="$1" ;; + esac + + case $func_quote_for_eval_unquoted_result in + # Double-quote args containing shell metacharacters to delay + # word splitting, command substitution and and variable + # expansion for a subsequent eval. + # Many Bourne shells cannot handle close brackets correctly + # in scan sets, so we specify it separately. + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"") + func_quote_for_eval_result="\"$func_quote_for_eval_unquoted_result\"" + ;; + *) + func_quote_for_eval_result="$func_quote_for_eval_unquoted_result" + esac +} + + +# func_quote_for_expand arg +# Aesthetically quote ARG to be evaled later; same as above, +# but do not quote variable references. +func_quote_for_expand () +{ + case $1 in + *[\\\`\"]*) + my_arg=`$ECHO "$1" | $SED \ + -e "$double_quote_subst" -e "$sed_double_backslash"` ;; + *) + my_arg="$1" ;; + esac + + case $my_arg in + # Double-quote args containing shell metacharacters to delay + # word splitting and command substitution for a subsequent eval. + # Many Bourne shells cannot handle close brackets correctly + # in scan sets, so we specify it separately. + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"") + my_arg="\"$my_arg\"" + ;; + esac + + func_quote_for_expand_result="$my_arg" +} + + +# func_show_eval cmd [fail_exp] +# Unless opt_silent is true, then output CMD. Then, if opt_dryrun is +# not true, evaluate CMD. If the evaluation of CMD fails, and FAIL_EXP +# is given, then evaluate it. +func_show_eval () +{ + my_cmd="$1" + my_fail_exp="${2-:}" + + ${opt_silent-false} || { + func_quote_for_expand "$my_cmd" + eval "func_echo $func_quote_for_expand_result" + } + + if ${opt_dry_run-false}; then :; else + eval "$my_cmd" + my_status=$? + if test "$my_status" -eq 0; then :; else + eval "(exit $my_status); $my_fail_exp" + fi + fi +} + + +# func_show_eval_locale cmd [fail_exp] +# Unless opt_silent is true, then output CMD. Then, if opt_dryrun is +# not true, evaluate CMD. If the evaluation of CMD fails, and FAIL_EXP +# is given, then evaluate it. Use the saved locale for evaluation. +func_show_eval_locale () +{ + my_cmd="$1" + my_fail_exp="${2-:}" + + ${opt_silent-false} || { + func_quote_for_expand "$my_cmd" + eval "func_echo $func_quote_for_expand_result" + } + + if ${opt_dry_run-false}; then :; else + eval "$lt_user_locale + $my_cmd" + my_status=$? + eval "$lt_safe_locale" + if test "$my_status" -eq 0; then :; else + eval "(exit $my_status); $my_fail_exp" + fi + fi +} + +# func_tr_sh +# Turn $1 into a string suitable for a shell variable name. +# Result is stored in $func_tr_sh_result. All characters +# not in the set a-zA-Z0-9_ are replaced with '_'. Further, +# if $1 begins with a digit, a '_' is prepended as well. +func_tr_sh () +{ + case $1 in + [0-9]* | *[!a-zA-Z0-9_]*) + func_tr_sh_result=`$ECHO "$1" | $SED 's/^\([0-9]\)/_\1/; s/[^a-zA-Z0-9_]/_/g'` + ;; + * ) + func_tr_sh_result=$1 + ;; + esac +} + + +# func_version +# Echo version message to standard output and exit. +func_version () +{ + $opt_debug + + $SED -n '/(C)/!b go + :more + /\./!{ + N + s/\n# / / + b more + } + :go + /^# '$PROGRAM' (GNU /,/# warranty; / { + s/^# // + s/^# *$// + s/\((C)\)[ 0-9,-]*\( [1-9][0-9]*\)/\1\2/ + p + }' < "$progpath" + exit $? +} + +# func_usage +# Echo short help message to standard output and exit. +func_usage () +{ + $opt_debug + + $SED -n '/^# Usage:/,/^# *.*--help/ { + s/^# // + s/^# *$// + s/\$progname/'$progname'/ + p + }' < "$progpath" + echo + $ECHO "run \`$progname --help | more' for full usage" + exit $? +} + +# func_help [NOEXIT] +# Echo long help message to standard output and exit, +# unless 'noexit' is passed as argument. +func_help () +{ + $opt_debug + + $SED -n '/^# Usage:/,/# Report bugs to/ { + :print + s/^# // + s/^# *$// + s*\$progname*'$progname'* + s*\$host*'"$host"'* + s*\$SHELL*'"$SHELL"'* + s*\$LTCC*'"$LTCC"'* + s*\$LTCFLAGS*'"$LTCFLAGS"'* + s*\$LD*'"$LD"'* + s/\$with_gnu_ld/'"$with_gnu_ld"'/ + s/\$automake_version/'"`(${AUTOMAKE-automake} --version) 2>/dev/null |$SED 1q`"'/ + s/\$autoconf_version/'"`(${AUTOCONF-autoconf} --version) 2>/dev/null |$SED 1q`"'/ + p + d + } + /^# .* home page:/b print + /^# General help using/b print + ' < "$progpath" + ret=$? + if test -z "$1"; then + exit $ret + fi +} + +# func_missing_arg argname +# Echo program name prefixed message to standard error and set global +# exit_cmd. +func_missing_arg () +{ + $opt_debug + + func_error "missing argument for $1." + exit_cmd=exit +} + + +# func_split_short_opt shortopt +# Set func_split_short_opt_name and func_split_short_opt_arg shell +# variables after splitting SHORTOPT after the 2nd character. +func_split_short_opt () +{ + my_sed_short_opt='1s/^\(..\).*$/\1/;q' + my_sed_short_rest='1s/^..\(.*\)$/\1/;q' + + func_split_short_opt_name=`$ECHO "$1" | $SED "$my_sed_short_opt"` + func_split_short_opt_arg=`$ECHO "$1" | $SED "$my_sed_short_rest"` +} # func_split_short_opt may be replaced by extended shell implementation + + +# func_split_long_opt longopt +# Set func_split_long_opt_name and func_split_long_opt_arg shell +# variables after splitting LONGOPT at the `=' sign. +func_split_long_opt () +{ + my_sed_long_opt='1s/^\(--[^=]*\)=.*/\1/;q' + my_sed_long_arg='1s/^--[^=]*=//' + + func_split_long_opt_name=`$ECHO "$1" | $SED "$my_sed_long_opt"` + func_split_long_opt_arg=`$ECHO "$1" | $SED "$my_sed_long_arg"` +} # func_split_long_opt may be replaced by extended shell implementation + +exit_cmd=: + + + + + +magic="%%%MAGIC variable%%%" +magic_exe="%%%MAGIC EXE variable%%%" + +# Global variables. +nonopt= +preserve_args= +lo2o="s/\\.lo\$/.${objext}/" +o2lo="s/\\.${objext}\$/.lo/" +extracted_archives= +extracted_serial=0 + +# If this variable is set in any of the actions, the command in it +# will be execed at the end. This prevents here-documents from being +# left over by shells. +exec_cmd= + +# func_append var value +# Append VALUE to the end of shell variable VAR. +func_append () +{ + eval "${1}=\$${1}\${2}" +} # func_append may be replaced by extended shell implementation + +# func_append_quoted var value +# Quote VALUE and append to the end of shell variable VAR, separated +# by a space. +func_append_quoted () +{ + func_quote_for_eval "${2}" + eval "${1}=\$${1}\\ \$func_quote_for_eval_result" +} # func_append_quoted may be replaced by extended shell implementation + + +# func_arith arithmetic-term... +func_arith () +{ + func_arith_result=`expr "${@}"` +} # func_arith may be replaced by extended shell implementation + + +# func_len string +# STRING may not start with a hyphen. +func_len () +{ + func_len_result=`expr "${1}" : ".*" 2>/dev/null || echo $max_cmd_len` +} # func_len may be replaced by extended shell implementation + + +# func_lo2o object +func_lo2o () +{ + func_lo2o_result=`$ECHO "${1}" | $SED "$lo2o"` +} # func_lo2o may be replaced by extended shell implementation + + +# func_xform libobj-or-source +func_xform () +{ + func_xform_result=`$ECHO "${1}" | $SED 's/\.[^.]*$/.lo/'` +} # func_xform may be replaced by extended shell implementation + + +# func_fatal_configuration arg... +# Echo program name prefixed message to standard error, followed by +# a configuration failure hint, and exit. +func_fatal_configuration () +{ + func_error ${1+"$@"} + func_error "See the $PACKAGE documentation for more information." + func_fatal_error "Fatal configuration error." +} + + +# func_config +# Display the configuration for all the tags in this script. +func_config () +{ + re_begincf='^# ### BEGIN LIBTOOL' + re_endcf='^# ### END LIBTOOL' + + # Default configuration. + $SED "1,/$re_begincf CONFIG/d;/$re_endcf CONFIG/,\$d" < "$progpath" + + # Now print the configurations for the tags. + for tagname in $taglist; do + $SED -n "/$re_begincf TAG CONFIG: $tagname\$/,/$re_endcf TAG CONFIG: $tagname\$/p" < "$progpath" + done + + exit $? +} + +# func_features +# Display the features supported by this script. +func_features () +{ + echo "host: $host" + if test "$build_libtool_libs" = yes; then + echo "enable shared libraries" + else + echo "disable shared libraries" + fi + if test "$build_old_libs" = yes; then + echo "enable static libraries" + else + echo "disable static libraries" + fi + + exit $? +} + +# func_enable_tag tagname +# Verify that TAGNAME is valid, and either flag an error and exit, or +# enable the TAGNAME tag. We also add TAGNAME to the global $taglist +# variable here. +func_enable_tag () +{ + # Global variable: + tagname="$1" + + re_begincf="^# ### BEGIN LIBTOOL TAG CONFIG: $tagname\$" + re_endcf="^# ### END LIBTOOL TAG CONFIG: $tagname\$" + sed_extractcf="/$re_begincf/,/$re_endcf/p" + + # Validate tagname. + case $tagname in + *[!-_A-Za-z0-9,/]*) + func_fatal_error "invalid tag name: $tagname" + ;; + esac + + # Don't test for the "default" C tag, as we know it's + # there but not specially marked. + case $tagname in + CC) ;; + *) + if $GREP "$re_begincf" "$progpath" >/dev/null 2>&1; then + taglist="$taglist $tagname" + + # Evaluate the configuration. Be careful to quote the path + # and the sed script, to avoid splitting on whitespace, but + # also don't use non-portable quotes within backquotes within + # quotes we have to do it in 2 steps: + extractedcf=`$SED -n -e "$sed_extractcf" < "$progpath"` + eval "$extractedcf" + else + func_error "ignoring unknown tag $tagname" + fi + ;; + esac +} + +# func_check_version_match +# Ensure that we are using m4 macros, and libtool script from the same +# release of libtool. +func_check_version_match () +{ + if test "$package_revision" != "$macro_revision"; then + if test "$VERSION" != "$macro_version"; then + if test -z "$macro_version"; then + cat >&2 <<_LT_EOF +$progname: Version mismatch error. This is $PACKAGE $VERSION, but the +$progname: definition of this LT_INIT comes from an older release. +$progname: You should recreate aclocal.m4 with macros from $PACKAGE $VERSION +$progname: and run autoconf again. +_LT_EOF + else + cat >&2 <<_LT_EOF +$progname: Version mismatch error. This is $PACKAGE $VERSION, but the +$progname: definition of this LT_INIT comes from $PACKAGE $macro_version. +$progname: You should recreate aclocal.m4 with macros from $PACKAGE $VERSION +$progname: and run autoconf again. +_LT_EOF + fi + else + cat >&2 <<_LT_EOF +$progname: Version mismatch error. This is $PACKAGE $VERSION, revision $package_revision, +$progname: but the definition of this LT_INIT comes from revision $macro_revision. +$progname: You should recreate aclocal.m4 with macros from revision $package_revision +$progname: of $PACKAGE $VERSION and run autoconf again. +_LT_EOF + fi + + exit $EXIT_MISMATCH + fi +} + + +# Shorthand for --mode=foo, only valid as the first argument +case $1 in +clean|clea|cle|cl) + shift; set dummy --mode clean ${1+"$@"}; shift + ;; +compile|compil|compi|comp|com|co|c) + shift; set dummy --mode compile ${1+"$@"}; shift + ;; +execute|execut|execu|exec|exe|ex|e) + shift; set dummy --mode execute ${1+"$@"}; shift + ;; +finish|finis|fini|fin|fi|f) + shift; set dummy --mode finish ${1+"$@"}; shift + ;; +install|instal|insta|inst|ins|in|i) + shift; set dummy --mode install ${1+"$@"}; shift + ;; +link|lin|li|l) + shift; set dummy --mode link ${1+"$@"}; shift + ;; +uninstall|uninstal|uninsta|uninst|unins|unin|uni|un|u) + shift; set dummy --mode uninstall ${1+"$@"}; shift + ;; +esac + + + +# Option defaults: +opt_debug=: +opt_dry_run=false +opt_config=false +opt_preserve_dup_deps=false +opt_features=false +opt_finish=false +opt_help=false +opt_help_all=false +opt_silent=: +opt_warning=: +opt_verbose=: +opt_silent=false +opt_verbose=false + + +# Parse options once, thoroughly. This comes as soon as possible in the +# script to make things like `--version' happen as quickly as we can. +{ + # this just eases exit handling + while test $# -gt 0; do + opt="$1" + shift + case $opt in + --debug|-x) opt_debug='set -x' + func_echo "enabling shell trace mode" + $opt_debug + ;; + --dry-run|--dryrun|-n) + opt_dry_run=: + ;; + --config) + opt_config=: +func_config + ;; + --dlopen|-dlopen) + optarg="$1" + opt_dlopen="${opt_dlopen+$opt_dlopen +}$optarg" + shift + ;; + --preserve-dup-deps) + opt_preserve_dup_deps=: + ;; + --features) + opt_features=: +func_features + ;; + --finish) + opt_finish=: +set dummy --mode finish ${1+"$@"}; shift + ;; + --help) + opt_help=: + ;; + --help-all) + opt_help_all=: +opt_help=': help-all' + ;; + --mode) + test $# = 0 && func_missing_arg $opt && break + optarg="$1" + opt_mode="$optarg" +case $optarg in + # Valid mode arguments: + clean|compile|execute|finish|install|link|relink|uninstall) ;; + + # Catch anything else as an error + *) func_error "invalid argument for $opt" + exit_cmd=exit + break + ;; +esac + shift + ;; + --no-silent|--no-quiet) + opt_silent=false +func_append preserve_args " $opt" + ;; + --no-warning|--no-warn) + opt_warning=false +func_append preserve_args " $opt" + ;; + --no-verbose) + opt_verbose=false +func_append preserve_args " $opt" + ;; + --silent|--quiet) + opt_silent=: +func_append preserve_args " $opt" + opt_verbose=false + ;; + --verbose|-v) + opt_verbose=: +func_append preserve_args " $opt" +opt_silent=false + ;; + --tag) + test $# = 0 && func_missing_arg $opt && break + optarg="$1" + opt_tag="$optarg" +func_append preserve_args " $opt $optarg" +func_enable_tag "$optarg" + shift + ;; + + -\?|-h) func_usage ;; + --help) func_help ;; + --version) func_version ;; + + # Separate optargs to long options: + --*=*) + func_split_long_opt "$opt" + set dummy "$func_split_long_opt_name" "$func_split_long_opt_arg" ${1+"$@"} + shift + ;; + + # Separate non-argument short options: + -\?*|-h*|-n*|-v*) + func_split_short_opt "$opt" + set dummy "$func_split_short_opt_name" "-$func_split_short_opt_arg" ${1+"$@"} + shift + ;; + + --) break ;; + -*) func_fatal_help "unrecognized option \`$opt'" ;; + *) set dummy "$opt" ${1+"$@"}; shift; break ;; + esac + done + + # Validate options: + + # save first non-option argument + if test "$#" -gt 0; then + nonopt="$opt" + shift + fi + + # preserve --debug + test "$opt_debug" = : || func_append preserve_args " --debug" + + case $host in + *cygwin* | *mingw* | *pw32* | *cegcc*) + # don't eliminate duplications in $postdeps and $predeps + opt_duplicate_compiler_generated_deps=: + ;; + *) + opt_duplicate_compiler_generated_deps=$opt_preserve_dup_deps + ;; + esac + + $opt_help || { + # Sanity checks first: + func_check_version_match + + if test "$build_libtool_libs" != yes && test "$build_old_libs" != yes; then + func_fatal_configuration "not configured to build any kind of library" + fi + + # Darwin sucks + eval std_shrext=\"$shrext_cmds\" + + # Only execute mode is allowed to have -dlopen flags. + if test -n "$opt_dlopen" && test "$opt_mode" != execute; then + func_error "unrecognized option \`-dlopen'" + $ECHO "$help" 1>&2 + exit $EXIT_FAILURE + fi + + # Change the help message to a mode-specific one. + generic_help="$help" + help="Try \`$progname --help --mode=$opt_mode' for more information." + } + + + # Bail if the options were screwed + $exit_cmd $EXIT_FAILURE +} + + + + +## ----------- ## +## Main. ## +## ----------- ## + +# func_lalib_p file +# True iff FILE is a libtool `.la' library or `.lo' object file. +# This function is only a basic sanity check; it will hardly flush out +# determined imposters. +func_lalib_p () +{ + test -f "$1" && + $SED -e 4q "$1" 2>/dev/null \ + | $GREP "^# Generated by .*$PACKAGE" > /dev/null 2>&1 +} + +# func_lalib_unsafe_p file +# True iff FILE is a libtool `.la' library or `.lo' object file. +# This function implements the same check as func_lalib_p without +# resorting to external programs. To this end, it redirects stdin and +# closes it afterwards, without saving the original file descriptor. +# As a safety measure, use it only where a negative result would be +# fatal anyway. Works if `file' does not exist. +func_lalib_unsafe_p () +{ + lalib_p=no + if test -f "$1" && test -r "$1" && exec 5<&0 <"$1"; then + for lalib_p_l in 1 2 3 4 + do + read lalib_p_line + case "$lalib_p_line" in + \#\ Generated\ by\ *$PACKAGE* ) lalib_p=yes; break;; + esac + done + exec 0<&5 5<&- + fi + test "$lalib_p" = yes +} + +# func_ltwrapper_script_p file +# True iff FILE is a libtool wrapper script +# This function is only a basic sanity check; it will hardly flush out +# determined imposters. +func_ltwrapper_script_p () +{ + func_lalib_p "$1" +} + +# func_ltwrapper_executable_p file +# True iff FILE is a libtool wrapper executable +# This function is only a basic sanity check; it will hardly flush out +# determined imposters. +func_ltwrapper_executable_p () +{ + func_ltwrapper_exec_suffix= + case $1 in + *.exe) ;; + *) func_ltwrapper_exec_suffix=.exe ;; + esac + $GREP "$magic_exe" "$1$func_ltwrapper_exec_suffix" >/dev/null 2>&1 +} + +# func_ltwrapper_scriptname file +# Assumes file is an ltwrapper_executable +# uses $file to determine the appropriate filename for a +# temporary ltwrapper_script. +func_ltwrapper_scriptname () +{ + func_dirname_and_basename "$1" "" "." + func_stripname '' '.exe' "$func_basename_result" + func_ltwrapper_scriptname_result="$func_dirname_result/$objdir/${func_stripname_result}_ltshwrapper" +} + +# func_ltwrapper_p file +# True iff FILE is a libtool wrapper script or wrapper executable +# This function is only a basic sanity check; it will hardly flush out +# determined imposters. +func_ltwrapper_p () +{ + func_ltwrapper_script_p "$1" || func_ltwrapper_executable_p "$1" +} + + +# func_execute_cmds commands fail_cmd +# Execute tilde-delimited COMMANDS. +# If FAIL_CMD is given, eval that upon failure. +# FAIL_CMD may read-access the current command in variable CMD! +func_execute_cmds () +{ + $opt_debug + save_ifs=$IFS; IFS='~' + for cmd in $1; do + IFS=$save_ifs + eval cmd=\"$cmd\" + func_show_eval "$cmd" "${2-:}" + done + IFS=$save_ifs +} + + +# func_source file +# Source FILE, adding directory component if necessary. +# Note that it is not necessary on cygwin/mingw to append a dot to +# FILE even if both FILE and FILE.exe exist: automatic-append-.exe +# behavior happens only for exec(3), not for open(2)! Also, sourcing +# `FILE.' does not work on cygwin managed mounts. +func_source () +{ + $opt_debug + case $1 in + */* | *\\*) . "$1" ;; + *) . "./$1" ;; + esac +} + + +# func_resolve_sysroot PATH +# Replace a leading = in PATH with a sysroot. Store the result into +# func_resolve_sysroot_result +func_resolve_sysroot () +{ + func_resolve_sysroot_result=$1 + case $func_resolve_sysroot_result in + =*) + func_stripname '=' '' "$func_resolve_sysroot_result" + func_resolve_sysroot_result=$lt_sysroot$func_stripname_result + ;; + esac +} + +# func_replace_sysroot PATH +# If PATH begins with the sysroot, replace it with = and +# store the result into func_replace_sysroot_result. +func_replace_sysroot () +{ + case "$lt_sysroot:$1" in + ?*:"$lt_sysroot"*) + func_stripname "$lt_sysroot" '' "$1" + func_replace_sysroot_result="=$func_stripname_result" + ;; + *) + # Including no sysroot. + func_replace_sysroot_result=$1 + ;; + esac +} + +# func_infer_tag arg +# Infer tagged configuration to use if any are available and +# if one wasn't chosen via the "--tag" command line option. +# Only attempt this if the compiler in the base compile +# command doesn't match the default compiler. +# arg is usually of the form 'gcc ...' +func_infer_tag () +{ + $opt_debug + if test -n "$available_tags" && test -z "$tagname"; then + CC_quoted= + for arg in $CC; do + func_append_quoted CC_quoted "$arg" + done + CC_expanded=`func_echo_all $CC` + CC_quoted_expanded=`func_echo_all $CC_quoted` + case $@ in + # Blanks in the command may have been stripped by the calling shell, + # but not from the CC environment variable when configure was run. + " $CC "* | "$CC "* | " $CC_expanded "* | "$CC_expanded "* | \ + " $CC_quoted"* | "$CC_quoted "* | " $CC_quoted_expanded "* | "$CC_quoted_expanded "*) ;; + # Blanks at the start of $base_compile will cause this to fail + # if we don't check for them as well. + *) + for z in $available_tags; do + if $GREP "^# ### BEGIN LIBTOOL TAG CONFIG: $z$" < "$progpath" > /dev/null; then + # Evaluate the configuration. + eval "`${SED} -n -e '/^# ### BEGIN LIBTOOL TAG CONFIG: '$z'$/,/^# ### END LIBTOOL TAG CONFIG: '$z'$/p' < $progpath`" + CC_quoted= + for arg in $CC; do + # Double-quote args containing other shell metacharacters. + func_append_quoted CC_quoted "$arg" + done + CC_expanded=`func_echo_all $CC` + CC_quoted_expanded=`func_echo_all $CC_quoted` + case "$@ " in + " $CC "* | "$CC "* | " $CC_expanded "* | "$CC_expanded "* | \ + " $CC_quoted"* | "$CC_quoted "* | " $CC_quoted_expanded "* | "$CC_quoted_expanded "*) + # The compiler in the base compile command matches + # the one in the tagged configuration. + # Assume this is the tagged configuration we want. + tagname=$z + break + ;; + esac + fi + done + # If $tagname still isn't set, then no tagged configuration + # was found and let the user know that the "--tag" command + # line option must be used. + if test -z "$tagname"; then + func_echo "unable to infer tagged configuration" + func_fatal_error "specify a tag with \`--tag'" +# else +# func_verbose "using $tagname tagged configuration" + fi + ;; + esac + fi +} + + + +# func_write_libtool_object output_name pic_name nonpic_name +# Create a libtool object file (analogous to a ".la" file), +# but don't create it if we're doing a dry run. +func_write_libtool_object () +{ + write_libobj=${1} + if test "$build_libtool_libs" = yes; then + write_lobj=\'${2}\' + else + write_lobj=none + fi + + if test "$build_old_libs" = yes; then + write_oldobj=\'${3}\' + else + write_oldobj=none + fi + + $opt_dry_run || { + cat >${write_libobj}T </dev/null` + if test "$?" -eq 0 && test -n "${func_convert_core_file_wine_to_w32_tmp}"; then + func_convert_core_file_wine_to_w32_result=`$ECHO "$func_convert_core_file_wine_to_w32_tmp" | + $SED -e "$lt_sed_naive_backslashify"` + else + func_convert_core_file_wine_to_w32_result= + fi + fi +} +# end: func_convert_core_file_wine_to_w32 + + +# func_convert_core_path_wine_to_w32 ARG +# Helper function used by path conversion functions when $build is *nix, and +# $host is mingw, cygwin, or some other w32 environment. Relies on a correctly +# configured wine environment available, with the winepath program in $build's +# $PATH. Assumes ARG has no leading or trailing path separator characters. +# +# ARG is path to be converted from $build format to win32. +# Result is available in $func_convert_core_path_wine_to_w32_result. +# Unconvertible file (directory) names in ARG are skipped; if no directory names +# are convertible, then the result may be empty. +func_convert_core_path_wine_to_w32 () +{ + $opt_debug + # unfortunately, winepath doesn't convert paths, only file names + func_convert_core_path_wine_to_w32_result="" + if test -n "$1"; then + oldIFS=$IFS + IFS=: + for func_convert_core_path_wine_to_w32_f in $1; do + IFS=$oldIFS + func_convert_core_file_wine_to_w32 "$func_convert_core_path_wine_to_w32_f" + if test -n "$func_convert_core_file_wine_to_w32_result" ; then + if test -z "$func_convert_core_path_wine_to_w32_result"; then + func_convert_core_path_wine_to_w32_result="$func_convert_core_file_wine_to_w32_result" + else + func_append func_convert_core_path_wine_to_w32_result ";$func_convert_core_file_wine_to_w32_result" + fi + fi + done + IFS=$oldIFS + fi +} +# end: func_convert_core_path_wine_to_w32 + + +# func_cygpath ARGS... +# Wrapper around calling the cygpath program via LT_CYGPATH. This is used when +# when (1) $build is *nix and Cygwin is hosted via a wine environment; or (2) +# $build is MSYS and $host is Cygwin, or (3) $build is Cygwin. In case (1) or +# (2), returns the Cygwin file name or path in func_cygpath_result (input +# file name or path is assumed to be in w32 format, as previously converted +# from $build's *nix or MSYS format). In case (3), returns the w32 file name +# or path in func_cygpath_result (input file name or path is assumed to be in +# Cygwin format). Returns an empty string on error. +# +# ARGS are passed to cygpath, with the last one being the file name or path to +# be converted. +# +# Specify the absolute *nix (or w32) name to cygpath in the LT_CYGPATH +# environment variable; do not put it in $PATH. +func_cygpath () +{ + $opt_debug + if test -n "$LT_CYGPATH" && test -f "$LT_CYGPATH"; then + func_cygpath_result=`$LT_CYGPATH "$@" 2>/dev/null` + if test "$?" -ne 0; then + # on failure, ensure result is empty + func_cygpath_result= + fi + else + func_cygpath_result= + func_error "LT_CYGPATH is empty or specifies non-existent file: \`$LT_CYGPATH'" + fi +} +#end: func_cygpath + + +# func_convert_core_msys_to_w32 ARG +# Convert file name or path ARG from MSYS format to w32 format. Return +# result in func_convert_core_msys_to_w32_result. +func_convert_core_msys_to_w32 () +{ + $opt_debug + # awkward: cmd appends spaces to result + func_convert_core_msys_to_w32_result=`( cmd //c echo "$1" ) 2>/dev/null | + $SED -e 's/[ ]*$//' -e "$lt_sed_naive_backslashify"` +} +#end: func_convert_core_msys_to_w32 + + +# func_convert_file_check ARG1 ARG2 +# Verify that ARG1 (a file name in $build format) was converted to $host +# format in ARG2. Otherwise, emit an error message, but continue (resetting +# func_to_host_file_result to ARG1). +func_convert_file_check () +{ + $opt_debug + if test -z "$2" && test -n "$1" ; then + func_error "Could not determine host file name corresponding to" + func_error " \`$1'" + func_error "Continuing, but uninstalled executables may not work." + # Fallback: + func_to_host_file_result="$1" + fi +} +# end func_convert_file_check + + +# func_convert_path_check FROM_PATHSEP TO_PATHSEP FROM_PATH TO_PATH +# Verify that FROM_PATH (a path in $build format) was converted to $host +# format in TO_PATH. Otherwise, emit an error message, but continue, resetting +# func_to_host_file_result to a simplistic fallback value (see below). +func_convert_path_check () +{ + $opt_debug + if test -z "$4" && test -n "$3"; then + func_error "Could not determine the host path corresponding to" + func_error " \`$3'" + func_error "Continuing, but uninstalled executables may not work." + # Fallback. This is a deliberately simplistic "conversion" and + # should not be "improved". See libtool.info. + if test "x$1" != "x$2"; then + lt_replace_pathsep_chars="s|$1|$2|g" + func_to_host_path_result=`echo "$3" | + $SED -e "$lt_replace_pathsep_chars"` + else + func_to_host_path_result="$3" + fi + fi +} +# end func_convert_path_check + + +# func_convert_path_front_back_pathsep FRONTPAT BACKPAT REPL ORIG +# Modifies func_to_host_path_result by prepending REPL if ORIG matches FRONTPAT +# and appending REPL if ORIG matches BACKPAT. +func_convert_path_front_back_pathsep () +{ + $opt_debug + case $4 in + $1 ) func_to_host_path_result="$3$func_to_host_path_result" + ;; + esac + case $4 in + $2 ) func_append func_to_host_path_result "$3" + ;; + esac +} +# end func_convert_path_front_back_pathsep + + +################################################## +# $build to $host FILE NAME CONVERSION FUNCTIONS # +################################################## +# invoked via `$to_host_file_cmd ARG' +# +# In each case, ARG is the path to be converted from $build to $host format. +# Result will be available in $func_to_host_file_result. + + +# func_to_host_file ARG +# Converts the file name ARG from $build format to $host format. Return result +# in func_to_host_file_result. +func_to_host_file () +{ + $opt_debug + $to_host_file_cmd "$1" +} +# end func_to_host_file + + +# func_to_tool_file ARG LAZY +# converts the file name ARG from $build format to toolchain format. Return +# result in func_to_tool_file_result. If the conversion in use is listed +# in (the comma separated) LAZY, no conversion takes place. +func_to_tool_file () +{ + $opt_debug + case ,$2, in + *,"$to_tool_file_cmd",*) + func_to_tool_file_result=$1 + ;; + *) + $to_tool_file_cmd "$1" + func_to_tool_file_result=$func_to_host_file_result + ;; + esac +} +# end func_to_tool_file + + +# func_convert_file_noop ARG +# Copy ARG to func_to_host_file_result. +func_convert_file_noop () +{ + func_to_host_file_result="$1" +} +# end func_convert_file_noop + + +# func_convert_file_msys_to_w32 ARG +# Convert file name ARG from (mingw) MSYS to (mingw) w32 format; automatic +# conversion to w32 is not available inside the cwrapper. Returns result in +# func_to_host_file_result. +func_convert_file_msys_to_w32 () +{ + $opt_debug + func_to_host_file_result="$1" + if test -n "$1"; then + func_convert_core_msys_to_w32 "$1" + func_to_host_file_result="$func_convert_core_msys_to_w32_result" + fi + func_convert_file_check "$1" "$func_to_host_file_result" +} +# end func_convert_file_msys_to_w32 + + +# func_convert_file_cygwin_to_w32 ARG +# Convert file name ARG from Cygwin to w32 format. Returns result in +# func_to_host_file_result. +func_convert_file_cygwin_to_w32 () +{ + $opt_debug + func_to_host_file_result="$1" + if test -n "$1"; then + # because $build is cygwin, we call "the" cygpath in $PATH; no need to use + # LT_CYGPATH in this case. + func_to_host_file_result=`cygpath -m "$1"` + fi + func_convert_file_check "$1" "$func_to_host_file_result" +} +# end func_convert_file_cygwin_to_w32 + + +# func_convert_file_nix_to_w32 ARG +# Convert file name ARG from *nix to w32 format. Requires a wine environment +# and a working winepath. Returns result in func_to_host_file_result. +func_convert_file_nix_to_w32 () +{ + $opt_debug + func_to_host_file_result="$1" + if test -n "$1"; then + func_convert_core_file_wine_to_w32 "$1" + func_to_host_file_result="$func_convert_core_file_wine_to_w32_result" + fi + func_convert_file_check "$1" "$func_to_host_file_result" +} +# end func_convert_file_nix_to_w32 + + +# func_convert_file_msys_to_cygwin ARG +# Convert file name ARG from MSYS to Cygwin format. Requires LT_CYGPATH set. +# Returns result in func_to_host_file_result. +func_convert_file_msys_to_cygwin () +{ + $opt_debug + func_to_host_file_result="$1" + if test -n "$1"; then + func_convert_core_msys_to_w32 "$1" + func_cygpath -u "$func_convert_core_msys_to_w32_result" + func_to_host_file_result="$func_cygpath_result" + fi + func_convert_file_check "$1" "$func_to_host_file_result" +} +# end func_convert_file_msys_to_cygwin + + +# func_convert_file_nix_to_cygwin ARG +# Convert file name ARG from *nix to Cygwin format. Requires Cygwin installed +# in a wine environment, working winepath, and LT_CYGPATH set. Returns result +# in func_to_host_file_result. +func_convert_file_nix_to_cygwin () +{ + $opt_debug + func_to_host_file_result="$1" + if test -n "$1"; then + # convert from *nix to w32, then use cygpath to convert from w32 to cygwin. + func_convert_core_file_wine_to_w32 "$1" + func_cygpath -u "$func_convert_core_file_wine_to_w32_result" + func_to_host_file_result="$func_cygpath_result" + fi + func_convert_file_check "$1" "$func_to_host_file_result" +} +# end func_convert_file_nix_to_cygwin + + +############################################# +# $build to $host PATH CONVERSION FUNCTIONS # +############################################# +# invoked via `$to_host_path_cmd ARG' +# +# In each case, ARG is the path to be converted from $build to $host format. +# The result will be available in $func_to_host_path_result. +# +# Path separators are also converted from $build format to $host format. If +# ARG begins or ends with a path separator character, it is preserved (but +# converted to $host format) on output. +# +# All path conversion functions are named using the following convention: +# file name conversion function : func_convert_file_X_to_Y () +# path conversion function : func_convert_path_X_to_Y () +# where, for any given $build/$host combination the 'X_to_Y' value is the +# same. If conversion functions are added for new $build/$host combinations, +# the two new functions must follow this pattern, or func_init_to_host_path_cmd +# will break. + + +# func_init_to_host_path_cmd +# Ensures that function "pointer" variable $to_host_path_cmd is set to the +# appropriate value, based on the value of $to_host_file_cmd. +to_host_path_cmd= +func_init_to_host_path_cmd () +{ + $opt_debug + if test -z "$to_host_path_cmd"; then + func_stripname 'func_convert_file_' '' "$to_host_file_cmd" + to_host_path_cmd="func_convert_path_${func_stripname_result}" + fi +} + + +# func_to_host_path ARG +# Converts the path ARG from $build format to $host format. Return result +# in func_to_host_path_result. +func_to_host_path () +{ + $opt_debug + func_init_to_host_path_cmd + $to_host_path_cmd "$1" +} +# end func_to_host_path + + +# func_convert_path_noop ARG +# Copy ARG to func_to_host_path_result. +func_convert_path_noop () +{ + func_to_host_path_result="$1" +} +# end func_convert_path_noop + + +# func_convert_path_msys_to_w32 ARG +# Convert path ARG from (mingw) MSYS to (mingw) w32 format; automatic +# conversion to w32 is not available inside the cwrapper. Returns result in +# func_to_host_path_result. +func_convert_path_msys_to_w32 () +{ + $opt_debug + func_to_host_path_result="$1" + if test -n "$1"; then + # Remove leading and trailing path separator characters from ARG. MSYS + # behavior is inconsistent here; cygpath turns them into '.;' and ';.'; + # and winepath ignores them completely. + func_stripname : : "$1" + func_to_host_path_tmp1=$func_stripname_result + func_convert_core_msys_to_w32 "$func_to_host_path_tmp1" + func_to_host_path_result="$func_convert_core_msys_to_w32_result" + func_convert_path_check : ";" \ + "$func_to_host_path_tmp1" "$func_to_host_path_result" + func_convert_path_front_back_pathsep ":*" "*:" ";" "$1" + fi +} +# end func_convert_path_msys_to_w32 + + +# func_convert_path_cygwin_to_w32 ARG +# Convert path ARG from Cygwin to w32 format. Returns result in +# func_to_host_file_result. +func_convert_path_cygwin_to_w32 () +{ + $opt_debug + func_to_host_path_result="$1" + if test -n "$1"; then + # See func_convert_path_msys_to_w32: + func_stripname : : "$1" + func_to_host_path_tmp1=$func_stripname_result + func_to_host_path_result=`cygpath -m -p "$func_to_host_path_tmp1"` + func_convert_path_check : ";" \ + "$func_to_host_path_tmp1" "$func_to_host_path_result" + func_convert_path_front_back_pathsep ":*" "*:" ";" "$1" + fi +} +# end func_convert_path_cygwin_to_w32 + + +# func_convert_path_nix_to_w32 ARG +# Convert path ARG from *nix to w32 format. Requires a wine environment and +# a working winepath. Returns result in func_to_host_file_result. +func_convert_path_nix_to_w32 () +{ + $opt_debug + func_to_host_path_result="$1" + if test -n "$1"; then + # See func_convert_path_msys_to_w32: + func_stripname : : "$1" + func_to_host_path_tmp1=$func_stripname_result + func_convert_core_path_wine_to_w32 "$func_to_host_path_tmp1" + func_to_host_path_result="$func_convert_core_path_wine_to_w32_result" + func_convert_path_check : ";" \ + "$func_to_host_path_tmp1" "$func_to_host_path_result" + func_convert_path_front_back_pathsep ":*" "*:" ";" "$1" + fi +} +# end func_convert_path_nix_to_w32 + + +# func_convert_path_msys_to_cygwin ARG +# Convert path ARG from MSYS to Cygwin format. Requires LT_CYGPATH set. +# Returns result in func_to_host_file_result. +func_convert_path_msys_to_cygwin () +{ + $opt_debug + func_to_host_path_result="$1" + if test -n "$1"; then + # See func_convert_path_msys_to_w32: + func_stripname : : "$1" + func_to_host_path_tmp1=$func_stripname_result + func_convert_core_msys_to_w32 "$func_to_host_path_tmp1" + func_cygpath -u -p "$func_convert_core_msys_to_w32_result" + func_to_host_path_result="$func_cygpath_result" + func_convert_path_check : : \ + "$func_to_host_path_tmp1" "$func_to_host_path_result" + func_convert_path_front_back_pathsep ":*" "*:" : "$1" + fi +} +# end func_convert_path_msys_to_cygwin + + +# func_convert_path_nix_to_cygwin ARG +# Convert path ARG from *nix to Cygwin format. Requires Cygwin installed in a +# a wine environment, working winepath, and LT_CYGPATH set. Returns result in +# func_to_host_file_result. +func_convert_path_nix_to_cygwin () +{ + $opt_debug + func_to_host_path_result="$1" + if test -n "$1"; then + # Remove leading and trailing path separator characters from + # ARG. msys behavior is inconsistent here, cygpath turns them + # into '.;' and ';.', and winepath ignores them completely. + func_stripname : : "$1" + func_to_host_path_tmp1=$func_stripname_result + func_convert_core_path_wine_to_w32 "$func_to_host_path_tmp1" + func_cygpath -u -p "$func_convert_core_path_wine_to_w32_result" + func_to_host_path_result="$func_cygpath_result" + func_convert_path_check : : \ + "$func_to_host_path_tmp1" "$func_to_host_path_result" + func_convert_path_front_back_pathsep ":*" "*:" : "$1" + fi +} +# end func_convert_path_nix_to_cygwin + + +# func_mode_compile arg... +func_mode_compile () +{ + $opt_debug + # Get the compilation command and the source file. + base_compile= + srcfile="$nonopt" # always keep a non-empty value in "srcfile" + suppress_opt=yes + suppress_output= + arg_mode=normal + libobj= + later= + pie_flag= + + for arg + do + case $arg_mode in + arg ) + # do not "continue". Instead, add this to base_compile + lastarg="$arg" + arg_mode=normal + ;; + + target ) + libobj="$arg" + arg_mode=normal + continue + ;; + + normal ) + # Accept any command-line options. + case $arg in + -o) + test -n "$libobj" && \ + func_fatal_error "you cannot specify \`-o' more than once" + arg_mode=target + continue + ;; + + -pie | -fpie | -fPIE) + func_append pie_flag " $arg" + continue + ;; + + -shared | -static | -prefer-pic | -prefer-non-pic) + func_append later " $arg" + continue + ;; + + -no-suppress) + suppress_opt=no + continue + ;; + + -Xcompiler) + arg_mode=arg # the next one goes into the "base_compile" arg list + continue # The current "srcfile" will either be retained or + ;; # replaced later. I would guess that would be a bug. + + -Wc,*) + func_stripname '-Wc,' '' "$arg" + args=$func_stripname_result + lastarg= + save_ifs="$IFS"; IFS=',' + for arg in $args; do + IFS="$save_ifs" + func_append_quoted lastarg "$arg" + done + IFS="$save_ifs" + func_stripname ' ' '' "$lastarg" + lastarg=$func_stripname_result + + # Add the arguments to base_compile. + func_append base_compile " $lastarg" + continue + ;; + + *) + # Accept the current argument as the source file. + # The previous "srcfile" becomes the current argument. + # + lastarg="$srcfile" + srcfile="$arg" + ;; + esac # case $arg + ;; + esac # case $arg_mode + + # Aesthetically quote the previous argument. + func_append_quoted base_compile "$lastarg" + done # for arg + + case $arg_mode in + arg) + func_fatal_error "you must specify an argument for -Xcompile" + ;; + target) + func_fatal_error "you must specify a target with \`-o'" + ;; + *) + # Get the name of the library object. + test -z "$libobj" && { + func_basename "$srcfile" + libobj="$func_basename_result" + } + ;; + esac + + # Recognize several different file suffixes. + # If the user specifies -o file.o, it is replaced with file.lo + case $libobj in + *.[cCFSifmso] | \ + *.ada | *.adb | *.ads | *.asm | \ + *.c++ | *.cc | *.ii | *.class | *.cpp | *.cxx | \ + *.[fF][09]? | *.for | *.java | *.go | *.obj | *.sx | *.cu | *.cup) + func_xform "$libobj" + libobj=$func_xform_result + ;; + esac + + case $libobj in + *.lo) func_lo2o "$libobj"; obj=$func_lo2o_result ;; + *) + func_fatal_error "cannot determine name of library object from \`$libobj'" + ;; + esac + + func_infer_tag $base_compile + + for arg in $later; do + case $arg in + -shared) + test "$build_libtool_libs" != yes && \ + func_fatal_configuration "can not build a shared library" + build_old_libs=no + continue + ;; + + -static) + build_libtool_libs=no + build_old_libs=yes + continue + ;; + + -prefer-pic) + pic_mode=yes + continue + ;; + + -prefer-non-pic) + pic_mode=no + continue + ;; + esac + done + + func_quote_for_eval "$libobj" + test "X$libobj" != "X$func_quote_for_eval_result" \ + && $ECHO "X$libobj" | $GREP '[]~#^*{};<>?"'"'"' &()|`$[]' \ + && func_warning "libobj name \`$libobj' may not contain shell special characters." + func_dirname_and_basename "$obj" "/" "" + objname="$func_basename_result" + xdir="$func_dirname_result" + lobj=${xdir}$objdir/$objname + + test -z "$base_compile" && \ + func_fatal_help "you must specify a compilation command" + + # Delete any leftover library objects. + if test "$build_old_libs" = yes; then + removelist="$obj $lobj $libobj ${libobj}T" + else + removelist="$lobj $libobj ${libobj}T" + fi + + # On Cygwin there's no "real" PIC flag so we must build both object types + case $host_os in + cygwin* | mingw* | pw32* | os2* | cegcc*) + pic_mode=default + ;; + esac + if test "$pic_mode" = no && test "$deplibs_check_method" != pass_all; then + # non-PIC code in shared libraries is not supported + pic_mode=default + fi + + # Calculate the filename of the output object if compiler does + # not support -o with -c + if test "$compiler_c_o" = no; then + output_obj=`$ECHO "$srcfile" | $SED 's%^.*/%%; s%\.[^.]*$%%'`.${objext} + lockfile="$output_obj.lock" + else + output_obj= + need_locks=no + lockfile= + fi + + # Lock this critical section if it is needed + # We use this script file to make the link, it avoids creating a new file + if test "$need_locks" = yes; then + until $opt_dry_run || ln "$progpath" "$lockfile" 2>/dev/null; do + func_echo "Waiting for $lockfile to be removed" + sleep 2 + done + elif test "$need_locks" = warn; then + if test -f "$lockfile"; then + $ECHO "\ +*** ERROR, $lockfile exists and contains: +`cat $lockfile 2>/dev/null` + +This indicates that another process is trying to use the same +temporary object file, and libtool could not work around it because +your compiler does not support \`-c' and \`-o' together. If you +repeat this compilation, it may succeed, by chance, but you had better +avoid parallel builds (make -j) in this platform, or get a better +compiler." + + $opt_dry_run || $RM $removelist + exit $EXIT_FAILURE + fi + func_append removelist " $output_obj" + $ECHO "$srcfile" > "$lockfile" + fi + + $opt_dry_run || $RM $removelist + func_append removelist " $lockfile" + trap '$opt_dry_run || $RM $removelist; exit $EXIT_FAILURE' 1 2 15 + + func_to_tool_file "$srcfile" func_convert_file_msys_to_w32 + srcfile=$func_to_tool_file_result + func_quote_for_eval "$srcfile" + qsrcfile=$func_quote_for_eval_result + + # Only build a PIC object if we are building libtool libraries. + if test "$build_libtool_libs" = yes; then + # Without this assignment, base_compile gets emptied. + fbsd_hideous_sh_bug=$base_compile + + if test "$pic_mode" != no; then + command="$base_compile $qsrcfile $pic_flag" + else + # Don't build PIC code + command="$base_compile $qsrcfile" + fi + + func_mkdir_p "$xdir$objdir" + + if test -z "$output_obj"; then + # Place PIC objects in $objdir + func_append command " -o $lobj" + fi + + func_show_eval_locale "$command" \ + 'test -n "$output_obj" && $RM $removelist; exit $EXIT_FAILURE' + + if test "$need_locks" = warn && + test "X`cat $lockfile 2>/dev/null`" != "X$srcfile"; then + $ECHO "\ +*** ERROR, $lockfile contains: +`cat $lockfile 2>/dev/null` + +but it should contain: +$srcfile + +This indicates that another process is trying to use the same +temporary object file, and libtool could not work around it because +your compiler does not support \`-c' and \`-o' together. If you +repeat this compilation, it may succeed, by chance, but you had better +avoid parallel builds (make -j) in this platform, or get a better +compiler." + + $opt_dry_run || $RM $removelist + exit $EXIT_FAILURE + fi + + # Just move the object if needed, then go on to compile the next one + if test -n "$output_obj" && test "X$output_obj" != "X$lobj"; then + func_show_eval '$MV "$output_obj" "$lobj"' \ + 'error=$?; $opt_dry_run || $RM $removelist; exit $error' + fi + + # Allow error messages only from the first compilation. + if test "$suppress_opt" = yes; then + suppress_output=' >/dev/null 2>&1' + fi + fi + + # Only build a position-dependent object if we build old libraries. + if test "$build_old_libs" = yes; then + if test "$pic_mode" != yes; then + # Don't build PIC code + command="$base_compile $qsrcfile$pie_flag" + else + command="$base_compile $qsrcfile $pic_flag" + fi + if test "$compiler_c_o" = yes; then + func_append command " -o $obj" + fi + + # Suppress compiler output if we already did a PIC compilation. + func_append command "$suppress_output" + func_show_eval_locale "$command" \ + '$opt_dry_run || $RM $removelist; exit $EXIT_FAILURE' + + if test "$need_locks" = warn && + test "X`cat $lockfile 2>/dev/null`" != "X$srcfile"; then + $ECHO "\ +*** ERROR, $lockfile contains: +`cat $lockfile 2>/dev/null` + +but it should contain: +$srcfile + +This indicates that another process is trying to use the same +temporary object file, and libtool could not work around it because +your compiler does not support \`-c' and \`-o' together. If you +repeat this compilation, it may succeed, by chance, but you had better +avoid parallel builds (make -j) in this platform, or get a better +compiler." + + $opt_dry_run || $RM $removelist + exit $EXIT_FAILURE + fi + + # Just move the object if needed + if test -n "$output_obj" && test "X$output_obj" != "X$obj"; then + func_show_eval '$MV "$output_obj" "$obj"' \ + 'error=$?; $opt_dry_run || $RM $removelist; exit $error' + fi + fi + + $opt_dry_run || { + func_write_libtool_object "$libobj" "$objdir/$objname" "$objname" + + # Unlock the critical section if it was locked + if test "$need_locks" != no; then + removelist=$lockfile + $RM "$lockfile" + fi + } + + exit $EXIT_SUCCESS +} + +$opt_help || { + test "$opt_mode" = compile && func_mode_compile ${1+"$@"} +} + +func_mode_help () +{ + # We need to display help for each of the modes. + case $opt_mode in + "") + # Generic help is extracted from the usage comments + # at the start of this file. + func_help + ;; + + clean) + $ECHO \ +"Usage: $progname [OPTION]... --mode=clean RM [RM-OPTION]... FILE... + +Remove files from the build directory. + +RM is the name of the program to use to delete files associated with each FILE +(typically \`/bin/rm'). RM-OPTIONS are options (such as \`-f') to be passed +to RM. + +If FILE is a libtool library, object or program, all the files associated +with it are deleted. Otherwise, only FILE itself is deleted using RM." + ;; + + compile) + $ECHO \ +"Usage: $progname [OPTION]... --mode=compile COMPILE-COMMAND... SOURCEFILE + +Compile a source file into a libtool library object. + +This mode accepts the following additional options: + + -o OUTPUT-FILE set the output file name to OUTPUT-FILE + -no-suppress do not suppress compiler output for multiple passes + -prefer-pic try to build PIC objects only + -prefer-non-pic try to build non-PIC objects only + -shared do not build a \`.o' file suitable for static linking + -static only build a \`.o' file suitable for static linking + -Wc,FLAG pass FLAG directly to the compiler + +COMPILE-COMMAND is a command to be used in creating a \`standard' object file +from the given SOURCEFILE. + +The output file name is determined by removing the directory component from +SOURCEFILE, then substituting the C source code suffix \`.c' with the +library object suffix, \`.lo'." + ;; + + execute) + $ECHO \ +"Usage: $progname [OPTION]... --mode=execute COMMAND [ARGS]... + +Automatically set library path, then run a program. + +This mode accepts the following additional options: + + -dlopen FILE add the directory containing FILE to the library path + +This mode sets the library path environment variable according to \`-dlopen' +flags. + +If any of the ARGS are libtool executable wrappers, then they are translated +into their corresponding uninstalled binary, and any of their required library +directories are added to the library path. + +Then, COMMAND is executed, with ARGS as arguments." + ;; + + finish) + $ECHO \ +"Usage: $progname [OPTION]... --mode=finish [LIBDIR]... + +Complete the installation of libtool libraries. + +Each LIBDIR is a directory that contains libtool libraries. + +The commands that this mode executes may require superuser privileges. Use +the \`--dry-run' option if you just want to see what would be executed." + ;; + + install) + $ECHO \ +"Usage: $progname [OPTION]... --mode=install INSTALL-COMMAND... + +Install executables or libraries. + +INSTALL-COMMAND is the installation command. The first component should be +either the \`install' or \`cp' program. + +The following components of INSTALL-COMMAND are treated specially: + + -inst-prefix-dir PREFIX-DIR Use PREFIX-DIR as a staging area for installation + +The rest of the components are interpreted as arguments to that command (only +BSD-compatible install options are recognized)." + ;; + + link) + $ECHO \ +"Usage: $progname [OPTION]... --mode=link LINK-COMMAND... + +Link object files or libraries together to form another library, or to +create an executable program. + +LINK-COMMAND is a command using the C compiler that you would use to create +a program from several object files. + +The following components of LINK-COMMAND are treated specially: + + -all-static do not do any dynamic linking at all + -avoid-version do not add a version suffix if possible + -bindir BINDIR specify path to binaries directory (for systems where + libraries must be found in the PATH setting at runtime) + -dlopen FILE \`-dlpreopen' FILE if it cannot be dlopened at runtime + -dlpreopen FILE link in FILE and add its symbols to lt_preloaded_symbols + -export-dynamic allow symbols from OUTPUT-FILE to be resolved with dlsym(3) + -export-symbols SYMFILE + try to export only the symbols listed in SYMFILE + -export-symbols-regex REGEX + try to export only the symbols matching REGEX + -LLIBDIR search LIBDIR for required installed libraries + -lNAME OUTPUT-FILE requires the installed library libNAME + -module build a library that can dlopened + -no-fast-install disable the fast-install mode + -no-install link a not-installable executable + -no-undefined declare that a library does not refer to external symbols + -o OUTPUT-FILE create OUTPUT-FILE from the specified objects + -objectlist FILE Use a list of object files found in FILE to specify objects + -precious-files-regex REGEX + don't remove output files matching REGEX + -release RELEASE specify package release information + -rpath LIBDIR the created library will eventually be installed in LIBDIR + -R[ ]LIBDIR add LIBDIR to the runtime path of programs and libraries + -shared only do dynamic linking of libtool libraries + -shrext SUFFIX override the standard shared library file extension + -static do not do any dynamic linking of uninstalled libtool libraries + -static-libtool-libs + do not do any dynamic linking of libtool libraries + -version-info CURRENT[:REVISION[:AGE]] + specify library version info [each variable defaults to 0] + -weak LIBNAME declare that the target provides the LIBNAME interface + -Wc,FLAG + -Xcompiler FLAG pass linker-specific FLAG directly to the compiler + -Wl,FLAG + -Xlinker FLAG pass linker-specific FLAG directly to the linker + -XCClinker FLAG pass link-specific FLAG to the compiler driver (CC) + +All other options (arguments beginning with \`-') are ignored. + +Every other argument is treated as a filename. Files ending in \`.la' are +treated as uninstalled libtool libraries, other files are standard or library +object files. + +If the OUTPUT-FILE ends in \`.la', then a libtool library is created, +only library objects (\`.lo' files) may be specified, and \`-rpath' is +required, except when creating a convenience library. + +If OUTPUT-FILE ends in \`.a' or \`.lib', then a standard library is created +using \`ar' and \`ranlib', or on Windows using \`lib'. + +If OUTPUT-FILE ends in \`.lo' or \`.${objext}', then a reloadable object file +is created, otherwise an executable program is created." + ;; + + uninstall) + $ECHO \ +"Usage: $progname [OPTION]... --mode=uninstall RM [RM-OPTION]... FILE... + +Remove libraries from an installation directory. + +RM is the name of the program to use to delete files associated with each FILE +(typically \`/bin/rm'). RM-OPTIONS are options (such as \`-f') to be passed +to RM. + +If FILE is a libtool library, all the files associated with it are deleted. +Otherwise, only FILE itself is deleted using RM." + ;; + + *) + func_fatal_help "invalid operation mode \`$opt_mode'" + ;; + esac + + echo + $ECHO "Try \`$progname --help' for more information about other modes." +} + +# Now that we've collected a possible --mode arg, show help if necessary +if $opt_help; then + if test "$opt_help" = :; then + func_mode_help + else + { + func_help noexit + for opt_mode in compile link execute install finish uninstall clean; do + func_mode_help + done + } | sed -n '1p; 2,$s/^Usage:/ or: /p' + { + func_help noexit + for opt_mode in compile link execute install finish uninstall clean; do + echo + func_mode_help + done + } | + sed '1d + /^When reporting/,/^Report/{ + H + d + } + $x + /information about other modes/d + /more detailed .*MODE/d + s/^Usage:.*--mode=\([^ ]*\) .*/Description of \1 mode:/' + fi + exit $? +fi + + +# func_mode_execute arg... +func_mode_execute () +{ + $opt_debug + # The first argument is the command name. + cmd="$nonopt" + test -z "$cmd" && \ + func_fatal_help "you must specify a COMMAND" + + # Handle -dlopen flags immediately. + for file in $opt_dlopen; do + test -f "$file" \ + || func_fatal_help "\`$file' is not a file" + + dir= + case $file in + *.la) + func_resolve_sysroot "$file" + file=$func_resolve_sysroot_result + + # Check to see that this really is a libtool archive. + func_lalib_unsafe_p "$file" \ + || func_fatal_help "\`$lib' is not a valid libtool archive" + + # Read the libtool library. + dlname= + library_names= + func_source "$file" + + # Skip this library if it cannot be dlopened. + if test -z "$dlname"; then + # Warn if it was a shared library. + test -n "$library_names" && \ + func_warning "\`$file' was not linked with \`-export-dynamic'" + continue + fi + + func_dirname "$file" "" "." + dir="$func_dirname_result" + + if test -f "$dir/$objdir/$dlname"; then + func_append dir "/$objdir" + else + if test ! -f "$dir/$dlname"; then + func_fatal_error "cannot find \`$dlname' in \`$dir' or \`$dir/$objdir'" + fi + fi + ;; + + *.lo) + # Just add the directory containing the .lo file. + func_dirname "$file" "" "." + dir="$func_dirname_result" + ;; + + *) + func_warning "\`-dlopen' is ignored for non-libtool libraries and objects" + continue + ;; + esac + + # Get the absolute pathname. + absdir=`cd "$dir" && pwd` + test -n "$absdir" && dir="$absdir" + + # Now add the directory to shlibpath_var. + if eval "test -z \"\$$shlibpath_var\""; then + eval "$shlibpath_var=\"\$dir\"" + else + eval "$shlibpath_var=\"\$dir:\$$shlibpath_var\"" + fi + done + + # This variable tells wrapper scripts just to set shlibpath_var + # rather than running their programs. + libtool_execute_magic="$magic" + + # Check if any of the arguments is a wrapper script. + args= + for file + do + case $file in + -* | *.la | *.lo ) ;; + *) + # Do a test to see if this is really a libtool program. + if func_ltwrapper_script_p "$file"; then + func_source "$file" + # Transform arg to wrapped name. + file="$progdir/$program" + elif func_ltwrapper_executable_p "$file"; then + func_ltwrapper_scriptname "$file" + func_source "$func_ltwrapper_scriptname_result" + # Transform arg to wrapped name. + file="$progdir/$program" + fi + ;; + esac + # Quote arguments (to preserve shell metacharacters). + func_append_quoted args "$file" + done + + if test "X$opt_dry_run" = Xfalse; then + if test -n "$shlibpath_var"; then + # Export the shlibpath_var. + eval "export $shlibpath_var" + fi + + # Restore saved environment variables + for lt_var in LANG LANGUAGE LC_ALL LC_CTYPE LC_COLLATE LC_MESSAGES + do + eval "if test \"\${save_$lt_var+set}\" = set; then + $lt_var=\$save_$lt_var; export $lt_var + else + $lt_unset $lt_var + fi" + done + + # Now prepare to actually exec the command. + exec_cmd="\$cmd$args" + else + # Display what would be done. + if test -n "$shlibpath_var"; then + eval "\$ECHO \"\$shlibpath_var=\$$shlibpath_var\"" + echo "export $shlibpath_var" + fi + $ECHO "$cmd$args" + exit $EXIT_SUCCESS + fi +} + +test "$opt_mode" = execute && func_mode_execute ${1+"$@"} + + +# func_mode_finish arg... +func_mode_finish () +{ + $opt_debug + libs= + libdirs= + admincmds= + + for opt in "$nonopt" ${1+"$@"} + do + if test -d "$opt"; then + func_append libdirs " $opt" + + elif test -f "$opt"; then + if func_lalib_unsafe_p "$opt"; then + func_append libs " $opt" + else + func_warning "\`$opt' is not a valid libtool archive" + fi + + else + func_fatal_error "invalid argument \`$opt'" + fi + done + + if test -n "$libs"; then + if test -n "$lt_sysroot"; then + sysroot_regex=`$ECHO "$lt_sysroot" | $SED "$sed_make_literal_regex"` + sysroot_cmd="s/\([ ']\)$sysroot_regex/\1/g;" + else + sysroot_cmd= + fi + + # Remove sysroot references + if $opt_dry_run; then + for lib in $libs; do + echo "removing references to $lt_sysroot and \`=' prefixes from $lib" + done + else + tmpdir=`func_mktempdir` + for lib in $libs; do + sed -e "${sysroot_cmd} s/\([ ']-[LR]\)=/\1/g; s/\([ ']\)=/\1/g" $lib \ + > $tmpdir/tmp-la + mv -f $tmpdir/tmp-la $lib + done + ${RM}r "$tmpdir" + fi + fi + + if test -n "$finish_cmds$finish_eval" && test -n "$libdirs"; then + for libdir in $libdirs; do + if test -n "$finish_cmds"; then + # Do each command in the finish commands. + func_execute_cmds "$finish_cmds" 'admincmds="$admincmds +'"$cmd"'"' + fi + if test -n "$finish_eval"; then + # Do the single finish_eval. + eval cmds=\"$finish_eval\" + $opt_dry_run || eval "$cmds" || func_append admincmds " + $cmds" + fi + done + fi + + # Exit here if they wanted silent mode. + $opt_silent && exit $EXIT_SUCCESS + + if test -n "$finish_cmds$finish_eval" && test -n "$libdirs"; then + echo "----------------------------------------------------------------------" + echo "Libraries have been installed in:" + for libdir in $libdirs; do + $ECHO " $libdir" + done + echo + echo "If you ever happen to want to link against installed libraries" + echo "in a given directory, LIBDIR, you must either use libtool, and" + echo "specify the full pathname of the library, or use the \`-LLIBDIR'" + echo "flag during linking and do at least one of the following:" + if test -n "$shlibpath_var"; then + echo " - add LIBDIR to the \`$shlibpath_var' environment variable" + echo " during execution" + fi + if test -n "$runpath_var"; then + echo " - add LIBDIR to the \`$runpath_var' environment variable" + echo " during linking" + fi + if test -n "$hardcode_libdir_flag_spec"; then + libdir=LIBDIR + eval flag=\"$hardcode_libdir_flag_spec\" + + $ECHO " - use the \`$flag' linker flag" + fi + if test -n "$admincmds"; then + $ECHO " - have your system administrator run these commands:$admincmds" + fi + if test -f /etc/ld.so.conf; then + echo " - have your system administrator add LIBDIR to \`/etc/ld.so.conf'" + fi + echo + + echo "See any operating system documentation about shared libraries for" + case $host in + solaris2.[6789]|solaris2.1[0-9]) + echo "more information, such as the ld(1), crle(1) and ld.so(8) manual" + echo "pages." + ;; + *) + echo "more information, such as the ld(1) and ld.so(8) manual pages." + ;; + esac + echo "----------------------------------------------------------------------" + fi + exit $EXIT_SUCCESS +} + +test "$opt_mode" = finish && func_mode_finish ${1+"$@"} + + +# func_mode_install arg... +func_mode_install () +{ + $opt_debug + # There may be an optional sh(1) argument at the beginning of + # install_prog (especially on Windows NT). + if test "$nonopt" = "$SHELL" || test "$nonopt" = /bin/sh || + # Allow the use of GNU shtool's install command. + case $nonopt in *shtool*) :;; *) false;; esac; then + # Aesthetically quote it. + func_quote_for_eval "$nonopt" + install_prog="$func_quote_for_eval_result " + arg=$1 + shift + else + install_prog= + arg=$nonopt + fi + + # The real first argument should be the name of the installation program. + # Aesthetically quote it. + func_quote_for_eval "$arg" + func_append install_prog "$func_quote_for_eval_result" + install_shared_prog=$install_prog + case " $install_prog " in + *[\\\ /]cp\ *) install_cp=: ;; + *) install_cp=false ;; + esac + + # We need to accept at least all the BSD install flags. + dest= + files= + opts= + prev= + install_type= + isdir=no + stripme= + no_mode=: + for arg + do + arg2= + if test -n "$dest"; then + func_append files " $dest" + dest=$arg + continue + fi + + case $arg in + -d) isdir=yes ;; + -f) + if $install_cp; then :; else + prev=$arg + fi + ;; + -g | -m | -o) + prev=$arg + ;; + -s) + stripme=" -s" + continue + ;; + -*) + ;; + *) + # If the previous option needed an argument, then skip it. + if test -n "$prev"; then + if test "x$prev" = x-m && test -n "$install_override_mode"; then + arg2=$install_override_mode + no_mode=false + fi + prev= + else + dest=$arg + continue + fi + ;; + esac + + # Aesthetically quote the argument. + func_quote_for_eval "$arg" + func_append install_prog " $func_quote_for_eval_result" + if test -n "$arg2"; then + func_quote_for_eval "$arg2" + fi + func_append install_shared_prog " $func_quote_for_eval_result" + done + + test -z "$install_prog" && \ + func_fatal_help "you must specify an install program" + + test -n "$prev" && \ + func_fatal_help "the \`$prev' option requires an argument" + + if test -n "$install_override_mode" && $no_mode; then + if $install_cp; then :; else + func_quote_for_eval "$install_override_mode" + func_append install_shared_prog " -m $func_quote_for_eval_result" + fi + fi + + if test -z "$files"; then + if test -z "$dest"; then + func_fatal_help "no file or destination specified" + else + func_fatal_help "you must specify a destination" + fi + fi + + # Strip any trailing slash from the destination. + func_stripname '' '/' "$dest" + dest=$func_stripname_result + + # Check to see that the destination is a directory. + test -d "$dest" && isdir=yes + if test "$isdir" = yes; then + destdir="$dest" + destname= + else + func_dirname_and_basename "$dest" "" "." + destdir="$func_dirname_result" + destname="$func_basename_result" + + # Not a directory, so check to see that there is only one file specified. + set dummy $files; shift + test "$#" -gt 1 && \ + func_fatal_help "\`$dest' is not a directory" + fi + case $destdir in + [\\/]* | [A-Za-z]:[\\/]*) ;; + *) + for file in $files; do + case $file in + *.lo) ;; + *) + func_fatal_help "\`$destdir' must be an absolute directory name" + ;; + esac + done + ;; + esac + + # This variable tells wrapper scripts just to set variables rather + # than running their programs. + libtool_install_magic="$magic" + + staticlibs= + future_libdirs= + current_libdirs= + for file in $files; do + + # Do each installation. + case $file in + *.$libext) + # Do the static libraries later. + func_append staticlibs " $file" + ;; + + *.la) + func_resolve_sysroot "$file" + file=$func_resolve_sysroot_result + + # Check to see that this really is a libtool archive. + func_lalib_unsafe_p "$file" \ + || func_fatal_help "\`$file' is not a valid libtool archive" + + library_names= + old_library= + relink_command= + func_source "$file" + + # Add the libdir to current_libdirs if it is the destination. + if test "X$destdir" = "X$libdir"; then + case "$current_libdirs " in + *" $libdir "*) ;; + *) func_append current_libdirs " $libdir" ;; + esac + else + # Note the libdir as a future libdir. + case "$future_libdirs " in + *" $libdir "*) ;; + *) func_append future_libdirs " $libdir" ;; + esac + fi + + func_dirname "$file" "/" "" + dir="$func_dirname_result" + func_append dir "$objdir" + + if test -n "$relink_command"; then + # Determine the prefix the user has applied to our future dir. + inst_prefix_dir=`$ECHO "$destdir" | $SED -e "s%$libdir\$%%"` + + # Don't allow the user to place us outside of our expected + # location b/c this prevents finding dependent libraries that + # are installed to the same prefix. + # At present, this check doesn't affect windows .dll's that + # are installed into $libdir/../bin (currently, that works fine) + # but it's something to keep an eye on. + test "$inst_prefix_dir" = "$destdir" && \ + func_fatal_error "error: cannot install \`$file' to a directory not ending in $libdir" + + if test -n "$inst_prefix_dir"; then + # Stick the inst_prefix_dir data into the link command. + relink_command=`$ECHO "$relink_command" | $SED "s%@inst_prefix_dir@%-inst-prefix-dir $inst_prefix_dir%"` + else + relink_command=`$ECHO "$relink_command" | $SED "s%@inst_prefix_dir@%%"` + fi + + func_warning "relinking \`$file'" + func_show_eval "$relink_command" \ + 'func_fatal_error "error: relink \`$file'\'' with the above command before installing it"' + fi + + # See the names of the shared library. + set dummy $library_names; shift + if test -n "$1"; then + realname="$1" + shift + + srcname="$realname" + test -n "$relink_command" && srcname="$realname"T + + # Install the shared library and build the symlinks. + func_show_eval "$install_shared_prog $dir/$srcname $destdir/$realname" \ + 'exit $?' + tstripme="$stripme" + case $host_os in + cygwin* | mingw* | pw32* | cegcc*) + case $realname in + *.dll.a) + tstripme="" + ;; + esac + ;; + esac + if test -n "$tstripme" && test -n "$striplib"; then + func_show_eval "$striplib $destdir/$realname" 'exit $?' + fi + + if test "$#" -gt 0; then + # Delete the old symlinks, and create new ones. + # Try `ln -sf' first, because the `ln' binary might depend on + # the symlink we replace! Solaris /bin/ln does not understand -f, + # so we also need to try rm && ln -s. + for linkname + do + test "$linkname" != "$realname" \ + && func_show_eval "(cd $destdir && { $LN_S -f $realname $linkname || { $RM $linkname && $LN_S $realname $linkname; }; })" + done + fi + + # Do each command in the postinstall commands. + lib="$destdir/$realname" + func_execute_cmds "$postinstall_cmds" 'exit $?' + fi + + # Install the pseudo-library for information purposes. + func_basename "$file" + name="$func_basename_result" + instname="$dir/$name"i + func_show_eval "$install_prog $instname $destdir/$name" 'exit $?' + + # Maybe install the static library, too. + test -n "$old_library" && func_append staticlibs " $dir/$old_library" + ;; + + *.lo) + # Install (i.e. copy) a libtool object. + + # Figure out destination file name, if it wasn't already specified. + if test -n "$destname"; then + destfile="$destdir/$destname" + else + func_basename "$file" + destfile="$func_basename_result" + destfile="$destdir/$destfile" + fi + + # Deduce the name of the destination old-style object file. + case $destfile in + *.lo) + func_lo2o "$destfile" + staticdest=$func_lo2o_result + ;; + *.$objext) + staticdest="$destfile" + destfile= + ;; + *) + func_fatal_help "cannot copy a libtool object to \`$destfile'" + ;; + esac + + # Install the libtool object if requested. + test -n "$destfile" && \ + func_show_eval "$install_prog $file $destfile" 'exit $?' + + # Install the old object if enabled. + if test "$build_old_libs" = yes; then + # Deduce the name of the old-style object file. + func_lo2o "$file" + staticobj=$func_lo2o_result + func_show_eval "$install_prog \$staticobj \$staticdest" 'exit $?' + fi + exit $EXIT_SUCCESS + ;; + + *) + # Figure out destination file name, if it wasn't already specified. + if test -n "$destname"; then + destfile="$destdir/$destname" + else + func_basename "$file" + destfile="$func_basename_result" + destfile="$destdir/$destfile" + fi + + # If the file is missing, and there is a .exe on the end, strip it + # because it is most likely a libtool script we actually want to + # install + stripped_ext="" + case $file in + *.exe) + if test ! -f "$file"; then + func_stripname '' '.exe' "$file" + file=$func_stripname_result + stripped_ext=".exe" + fi + ;; + esac + + # Do a test to see if this is really a libtool program. + case $host in + *cygwin* | *mingw*) + if func_ltwrapper_executable_p "$file"; then + func_ltwrapper_scriptname "$file" + wrapper=$func_ltwrapper_scriptname_result + else + func_stripname '' '.exe' "$file" + wrapper=$func_stripname_result + fi + ;; + *) + wrapper=$file + ;; + esac + if func_ltwrapper_script_p "$wrapper"; then + notinst_deplibs= + relink_command= + + func_source "$wrapper" + + # Check the variables that should have been set. + test -z "$generated_by_libtool_version" && \ + func_fatal_error "invalid libtool wrapper script \`$wrapper'" + + finalize=yes + for lib in $notinst_deplibs; do + # Check to see that each library is installed. + libdir= + if test -f "$lib"; then + func_source "$lib" + fi + libfile="$libdir/"`$ECHO "$lib" | $SED 's%^.*/%%g'` ### testsuite: skip nested quoting test + if test -n "$libdir" && test ! -f "$libfile"; then + func_warning "\`$lib' has not been installed in \`$libdir'" + finalize=no + fi + done + + relink_command= + func_source "$wrapper" + + outputname= + if test "$fast_install" = no && test -n "$relink_command"; then + $opt_dry_run || { + if test "$finalize" = yes; then + tmpdir=`func_mktempdir` + func_basename "$file$stripped_ext" + file="$func_basename_result" + outputname="$tmpdir/$file" + # Replace the output file specification. + relink_command=`$ECHO "$relink_command" | $SED 's%@OUTPUT@%'"$outputname"'%g'` + + $opt_silent || { + func_quote_for_expand "$relink_command" + eval "func_echo $func_quote_for_expand_result" + } + if eval "$relink_command"; then : + else + func_error "error: relink \`$file' with the above command before installing it" + $opt_dry_run || ${RM}r "$tmpdir" + continue + fi + file="$outputname" + else + func_warning "cannot relink \`$file'" + fi + } + else + # Install the binary that we compiled earlier. + file=`$ECHO "$file$stripped_ext" | $SED "s%\([^/]*\)$%$objdir/\1%"` + fi + fi + + # remove .exe since cygwin /usr/bin/install will append another + # one anyway + case $install_prog,$host in + */usr/bin/install*,*cygwin*) + case $file:$destfile in + *.exe:*.exe) + # this is ok + ;; + *.exe:*) + destfile=$destfile.exe + ;; + *:*.exe) + func_stripname '' '.exe' "$destfile" + destfile=$func_stripname_result + ;; + esac + ;; + esac + func_show_eval "$install_prog\$stripme \$file \$destfile" 'exit $?' + $opt_dry_run || if test -n "$outputname"; then + ${RM}r "$tmpdir" + fi + ;; + esac + done + + for file in $staticlibs; do + func_basename "$file" + name="$func_basename_result" + + # Set up the ranlib parameters. + oldlib="$destdir/$name" + func_to_tool_file "$oldlib" func_convert_file_msys_to_w32 + tool_oldlib=$func_to_tool_file_result + + func_show_eval "$install_prog \$file \$oldlib" 'exit $?' + + if test -n "$stripme" && test -n "$old_striplib"; then + func_show_eval "$old_striplib $tool_oldlib" 'exit $?' + fi + + # Do each command in the postinstall commands. + func_execute_cmds "$old_postinstall_cmds" 'exit $?' + done + + test -n "$future_libdirs" && \ + func_warning "remember to run \`$progname --finish$future_libdirs'" + + if test -n "$current_libdirs"; then + # Maybe just do a dry run. + $opt_dry_run && current_libdirs=" -n$current_libdirs" + exec_cmd='$SHELL $progpath $preserve_args --finish$current_libdirs' + else + exit $EXIT_SUCCESS + fi +} + +test "$opt_mode" = install && func_mode_install ${1+"$@"} + + +# func_generate_dlsyms outputname originator pic_p +# Extract symbols from dlprefiles and create ${outputname}S.o with +# a dlpreopen symbol table. +func_generate_dlsyms () +{ + $opt_debug + my_outputname="$1" + my_originator="$2" + my_pic_p="${3-no}" + my_prefix=`$ECHO "$my_originator" | sed 's%[^a-zA-Z0-9]%_%g'` + my_dlsyms= + + if test -n "$dlfiles$dlprefiles" || test "$dlself" != no; then + if test -n "$NM" && test -n "$global_symbol_pipe"; then + my_dlsyms="${my_outputname}S.c" + else + func_error "not configured to extract global symbols from dlpreopened files" + fi + fi + + if test -n "$my_dlsyms"; then + case $my_dlsyms in + "") ;; + *.c) + # Discover the nlist of each of the dlfiles. + nlist="$output_objdir/${my_outputname}.nm" + + func_show_eval "$RM $nlist ${nlist}S ${nlist}T" + + # Parse the name list into a source file. + func_verbose "creating $output_objdir/$my_dlsyms" + + $opt_dry_run || $ECHO > "$output_objdir/$my_dlsyms" "\ +/* $my_dlsyms - symbol resolution table for \`$my_outputname' dlsym emulation. */ +/* Generated by $PROGRAM (GNU $PACKAGE$TIMESTAMP) $VERSION */ + +#ifdef __cplusplus +extern \"C\" { +#endif + +#if defined(__GNUC__) && (((__GNUC__ == 4) && (__GNUC_MINOR__ >= 4)) || (__GNUC__ > 4)) +#pragma GCC diagnostic ignored \"-Wstrict-prototypes\" +#endif + +/* Keep this code in sync between libtool.m4, ltmain, lt_system.h, and tests. */ +#if defined(_WIN32) || defined(__CYGWIN__) || defined(_WIN32_WCE) +/* DATA imports from DLLs on WIN32 con't be const, because runtime + relocations are performed -- see ld's documentation on pseudo-relocs. */ +# define LT_DLSYM_CONST +#elif defined(__osf__) +/* This system does not cope well with relocations in const data. */ +# define LT_DLSYM_CONST +#else +# define LT_DLSYM_CONST const +#endif + +/* External symbol declarations for the compiler. */\ +" + + if test "$dlself" = yes; then + func_verbose "generating symbol list for \`$output'" + + $opt_dry_run || echo ': @PROGRAM@ ' > "$nlist" + + # Add our own program objects to the symbol list. + progfiles=`$ECHO "$objs$old_deplibs" | $SP2NL | $SED "$lo2o" | $NL2SP` + for progfile in $progfiles; do + func_to_tool_file "$progfile" func_convert_file_msys_to_w32 + func_verbose "extracting global C symbols from \`$func_to_tool_file_result'" + $opt_dry_run || eval "$NM $func_to_tool_file_result | $global_symbol_pipe >> '$nlist'" + done + + if test -n "$exclude_expsyms"; then + $opt_dry_run || { + eval '$EGREP -v " ($exclude_expsyms)$" "$nlist" > "$nlist"T' + eval '$MV "$nlist"T "$nlist"' + } + fi + + if test -n "$export_symbols_regex"; then + $opt_dry_run || { + eval '$EGREP -e "$export_symbols_regex" "$nlist" > "$nlist"T' + eval '$MV "$nlist"T "$nlist"' + } + fi + + # Prepare the list of exported symbols + if test -z "$export_symbols"; then + export_symbols="$output_objdir/$outputname.exp" + $opt_dry_run || { + $RM $export_symbols + eval "${SED} -n -e '/^: @PROGRAM@ $/d' -e 's/^.* \(.*\)$/\1/p' "'< "$nlist" > "$export_symbols"' + case $host in + *cygwin* | *mingw* | *cegcc* ) + eval "echo EXPORTS "'> "$output_objdir/$outputname.def"' + eval 'cat "$export_symbols" >> "$output_objdir/$outputname.def"' + ;; + esac + } + else + $opt_dry_run || { + eval "${SED} -e 's/\([].[*^$]\)/\\\\\1/g' -e 's/^/ /' -e 's/$/$/'"' < "$export_symbols" > "$output_objdir/$outputname.exp"' + eval '$GREP -f "$output_objdir/$outputname.exp" < "$nlist" > "$nlist"T' + eval '$MV "$nlist"T "$nlist"' + case $host in + *cygwin* | *mingw* | *cegcc* ) + eval "echo EXPORTS "'> "$output_objdir/$outputname.def"' + eval 'cat "$nlist" >> "$output_objdir/$outputname.def"' + ;; + esac + } + fi + fi + + for dlprefile in $dlprefiles; do + func_verbose "extracting global C symbols from \`$dlprefile'" + func_basename "$dlprefile" + name="$func_basename_result" + case $host in + *cygwin* | *mingw* | *cegcc* ) + # if an import library, we need to obtain dlname + if func_win32_import_lib_p "$dlprefile"; then + func_tr_sh "$dlprefile" + eval "curr_lafile=\$libfile_$func_tr_sh_result" + dlprefile_dlbasename="" + if test -n "$curr_lafile" && func_lalib_p "$curr_lafile"; then + # Use subshell, to avoid clobbering current variable values + dlprefile_dlname=`source "$curr_lafile" && echo "$dlname"` + if test -n "$dlprefile_dlname" ; then + func_basename "$dlprefile_dlname" + dlprefile_dlbasename="$func_basename_result" + else + # no lafile. user explicitly requested -dlpreopen . + $sharedlib_from_linklib_cmd "$dlprefile" + dlprefile_dlbasename=$sharedlib_from_linklib_result + fi + fi + $opt_dry_run || { + if test -n "$dlprefile_dlbasename" ; then + eval '$ECHO ": $dlprefile_dlbasename" >> "$nlist"' + else + func_warning "Could not compute DLL name from $name" + eval '$ECHO ": $name " >> "$nlist"' + fi + func_to_tool_file "$dlprefile" func_convert_file_msys_to_w32 + eval "$NM \"$func_to_tool_file_result\" 2>/dev/null | $global_symbol_pipe | + $SED -e '/I __imp/d' -e 's/I __nm_/D /;s/_nm__//' >> '$nlist'" + } + else # not an import lib + $opt_dry_run || { + eval '$ECHO ": $name " >> "$nlist"' + func_to_tool_file "$dlprefile" func_convert_file_msys_to_w32 + eval "$NM \"$func_to_tool_file_result\" 2>/dev/null | $global_symbol_pipe >> '$nlist'" + } + fi + ;; + *) + $opt_dry_run || { + eval '$ECHO ": $name " >> "$nlist"' + func_to_tool_file "$dlprefile" func_convert_file_msys_to_w32 + eval "$NM \"$func_to_tool_file_result\" 2>/dev/null | $global_symbol_pipe >> '$nlist'" + } + ;; + esac + done + + $opt_dry_run || { + # Make sure we have at least an empty file. + test -f "$nlist" || : > "$nlist" + + if test -n "$exclude_expsyms"; then + $EGREP -v " ($exclude_expsyms)$" "$nlist" > "$nlist"T + $MV "$nlist"T "$nlist" + fi + + # Try sorting and uniquifying the output. + if $GREP -v "^: " < "$nlist" | + if sort -k 3 /dev/null 2>&1; then + sort -k 3 + else + sort +2 + fi | + uniq > "$nlist"S; then + : + else + $GREP -v "^: " < "$nlist" > "$nlist"S + fi + + if test -f "$nlist"S; then + eval "$global_symbol_to_cdecl"' < "$nlist"S >> "$output_objdir/$my_dlsyms"' + else + echo '/* NONE */' >> "$output_objdir/$my_dlsyms" + fi + + echo >> "$output_objdir/$my_dlsyms" "\ + +/* The mapping between symbol names and symbols. */ +typedef struct { + const char *name; + void *address; +} lt_dlsymlist; +extern LT_DLSYM_CONST lt_dlsymlist +lt_${my_prefix}_LTX_preloaded_symbols[]; +LT_DLSYM_CONST lt_dlsymlist +lt_${my_prefix}_LTX_preloaded_symbols[] = +{\ + { \"$my_originator\", (void *) 0 }," + + case $need_lib_prefix in + no) + eval "$global_symbol_to_c_name_address" < "$nlist" >> "$output_objdir/$my_dlsyms" + ;; + *) + eval "$global_symbol_to_c_name_address_lib_prefix" < "$nlist" >> "$output_objdir/$my_dlsyms" + ;; + esac + echo >> "$output_objdir/$my_dlsyms" "\ + {0, (void *) 0} +}; + +/* This works around a problem in FreeBSD linker */ +#ifdef FREEBSD_WORKAROUND +static const void *lt_preloaded_setup() { + return lt_${my_prefix}_LTX_preloaded_symbols; +} +#endif + +#ifdef __cplusplus +} +#endif\ +" + } # !$opt_dry_run + + pic_flag_for_symtable= + case "$compile_command " in + *" -static "*) ;; + *) + case $host in + # compiling the symbol table file with pic_flag works around + # a FreeBSD bug that causes programs to crash when -lm is + # linked before any other PIC object. But we must not use + # pic_flag when linking with -static. The problem exists in + # FreeBSD 2.2.6 and is fixed in FreeBSD 3.1. + *-*-freebsd2.*|*-*-freebsd3.0*|*-*-freebsdelf3.0*) + pic_flag_for_symtable=" $pic_flag -DFREEBSD_WORKAROUND" ;; + *-*-hpux*) + pic_flag_for_symtable=" $pic_flag" ;; + *) + if test "X$my_pic_p" != Xno; then + pic_flag_for_symtable=" $pic_flag" + fi + ;; + esac + ;; + esac + symtab_cflags= + for arg in $LTCFLAGS; do + case $arg in + -pie | -fpie | -fPIE) ;; + *) func_append symtab_cflags " $arg" ;; + esac + done + + # Now compile the dynamic symbol file. + func_show_eval '(cd $output_objdir && $LTCC$symtab_cflags -c$no_builtin_flag$pic_flag_for_symtable "$my_dlsyms")' 'exit $?' + + # Clean up the generated files. + func_show_eval '$RM "$output_objdir/$my_dlsyms" "$nlist" "${nlist}S" "${nlist}T"' + + # Transform the symbol file into the correct name. + symfileobj="$output_objdir/${my_outputname}S.$objext" + case $host in + *cygwin* | *mingw* | *cegcc* ) + if test -f "$output_objdir/$my_outputname.def"; then + compile_command=`$ECHO "$compile_command" | $SED "s%@SYMFILE@%$output_objdir/$my_outputname.def $symfileobj%"` + finalize_command=`$ECHO "$finalize_command" | $SED "s%@SYMFILE@%$output_objdir/$my_outputname.def $symfileobj%"` + else + compile_command=`$ECHO "$compile_command" | $SED "s%@SYMFILE@%$symfileobj%"` + finalize_command=`$ECHO "$finalize_command" | $SED "s%@SYMFILE@%$symfileobj%"` + fi + ;; + *) + compile_command=`$ECHO "$compile_command" | $SED "s%@SYMFILE@%$symfileobj%"` + finalize_command=`$ECHO "$finalize_command" | $SED "s%@SYMFILE@%$symfileobj%"` + ;; + esac + ;; + *) + func_fatal_error "unknown suffix for \`$my_dlsyms'" + ;; + esac + else + # We keep going just in case the user didn't refer to + # lt_preloaded_symbols. The linker will fail if global_symbol_pipe + # really was required. + + # Nullify the symbol file. + compile_command=`$ECHO "$compile_command" | $SED "s% @SYMFILE@%%"` + finalize_command=`$ECHO "$finalize_command" | $SED "s% @SYMFILE@%%"` + fi +} + +# func_win32_libid arg +# return the library type of file 'arg' +# +# Need a lot of goo to handle *both* DLLs and import libs +# Has to be a shell function in order to 'eat' the argument +# that is supplied when $file_magic_command is called. +# Despite the name, also deal with 64 bit binaries. +func_win32_libid () +{ + $opt_debug + win32_libid_type="unknown" + win32_fileres=`file -L $1 2>/dev/null` + case $win32_fileres in + *ar\ archive\ import\ library*) # definitely import + win32_libid_type="x86 archive import" + ;; + *ar\ archive*) # could be an import, or static + # Keep the egrep pattern in sync with the one in _LT_CHECK_MAGIC_METHOD. + if eval $OBJDUMP -f $1 | $SED -e '10q' 2>/dev/null | + $EGREP 'file format (pei*-i386(.*architecture: i386)?|pe-arm-wince|pe-x86-64)' >/dev/null; then + func_to_tool_file "$1" func_convert_file_msys_to_w32 + win32_nmres=`eval $NM -f posix -A \"$func_to_tool_file_result\" | + $SED -n -e ' + 1,100{ + / I /{ + s,.*,import, + p + q + } + }'` + case $win32_nmres in + import*) win32_libid_type="x86 archive import";; + *) win32_libid_type="x86 archive static";; + esac + fi + ;; + *DLL*) + win32_libid_type="x86 DLL" + ;; + *executable*) # but shell scripts are "executable" too... + case $win32_fileres in + *MS\ Windows\ PE\ Intel*) + win32_libid_type="x86 DLL" + ;; + esac + ;; + esac + $ECHO "$win32_libid_type" +} + +# func_cygming_dll_for_implib ARG +# +# Platform-specific function to extract the +# name of the DLL associated with the specified +# import library ARG. +# Invoked by eval'ing the libtool variable +# $sharedlib_from_linklib_cmd +# Result is available in the variable +# $sharedlib_from_linklib_result +func_cygming_dll_for_implib () +{ + $opt_debug + sharedlib_from_linklib_result=`$DLLTOOL --identify-strict --identify "$1"` +} + +# func_cygming_dll_for_implib_fallback_core SECTION_NAME LIBNAMEs +# +# The is the core of a fallback implementation of a +# platform-specific function to extract the name of the +# DLL associated with the specified import library LIBNAME. +# +# SECTION_NAME is either .idata$6 or .idata$7, depending +# on the platform and compiler that created the implib. +# +# Echos the name of the DLL associated with the +# specified import library. +func_cygming_dll_for_implib_fallback_core () +{ + $opt_debug + match_literal=`$ECHO "$1" | $SED "$sed_make_literal_regex"` + $OBJDUMP -s --section "$1" "$2" 2>/dev/null | + $SED '/^Contents of section '"$match_literal"':/{ + # Place marker at beginning of archive member dllname section + s/.*/====MARK====/ + p + d + } + # These lines can sometimes be longer than 43 characters, but + # are always uninteresting + /:[ ]*file format pe[i]\{,1\}-/d + /^In archive [^:]*:/d + # Ensure marker is printed + /^====MARK====/p + # Remove all lines with less than 43 characters + /^.\{43\}/!d + # From remaining lines, remove first 43 characters + s/^.\{43\}//' | + $SED -n ' + # Join marker and all lines until next marker into a single line + /^====MARK====/ b para + H + $ b para + b + :para + x + s/\n//g + # Remove the marker + s/^====MARK====// + # Remove trailing dots and whitespace + s/[\. \t]*$// + # Print + /./p' | + # we now have a list, one entry per line, of the stringified + # contents of the appropriate section of all members of the + # archive which possess that section. Heuristic: eliminate + # all those which have a first or second character that is + # a '.' (that is, objdump's representation of an unprintable + # character.) This should work for all archives with less than + # 0x302f exports -- but will fail for DLLs whose name actually + # begins with a literal '.' or a single character followed by + # a '.'. + # + # Of those that remain, print the first one. + $SED -e '/^\./d;/^.\./d;q' +} + +# func_cygming_gnu_implib_p ARG +# This predicate returns with zero status (TRUE) if +# ARG is a GNU/binutils-style import library. Returns +# with nonzero status (FALSE) otherwise. +func_cygming_gnu_implib_p () +{ + $opt_debug + func_to_tool_file "$1" func_convert_file_msys_to_w32 + func_cygming_gnu_implib_tmp=`$NM "$func_to_tool_file_result" | eval "$global_symbol_pipe" | $EGREP ' (_head_[A-Za-z0-9_]+_[ad]l*|[A-Za-z0-9_]+_[ad]l*_iname)$'` + test -n "$func_cygming_gnu_implib_tmp" +} + +# func_cygming_ms_implib_p ARG +# This predicate returns with zero status (TRUE) if +# ARG is an MS-style import library. Returns +# with nonzero status (FALSE) otherwise. +func_cygming_ms_implib_p () +{ + $opt_debug + func_to_tool_file "$1" func_convert_file_msys_to_w32 + func_cygming_ms_implib_tmp=`$NM "$func_to_tool_file_result" | eval "$global_symbol_pipe" | $GREP '_NULL_IMPORT_DESCRIPTOR'` + test -n "$func_cygming_ms_implib_tmp" +} + +# func_cygming_dll_for_implib_fallback ARG +# Platform-specific function to extract the +# name of the DLL associated with the specified +# import library ARG. +# +# This fallback implementation is for use when $DLLTOOL +# does not support the --identify-strict option. +# Invoked by eval'ing the libtool variable +# $sharedlib_from_linklib_cmd +# Result is available in the variable +# $sharedlib_from_linklib_result +func_cygming_dll_for_implib_fallback () +{ + $opt_debug + if func_cygming_gnu_implib_p "$1" ; then + # binutils import library + sharedlib_from_linklib_result=`func_cygming_dll_for_implib_fallback_core '.idata$7' "$1"` + elif func_cygming_ms_implib_p "$1" ; then + # ms-generated import library + sharedlib_from_linklib_result=`func_cygming_dll_for_implib_fallback_core '.idata$6' "$1"` + else + # unknown + sharedlib_from_linklib_result="" + fi +} + + +# func_extract_an_archive dir oldlib +func_extract_an_archive () +{ + $opt_debug + f_ex_an_ar_dir="$1"; shift + f_ex_an_ar_oldlib="$1" + if test "$lock_old_archive_extraction" = yes; then + lockfile=$f_ex_an_ar_oldlib.lock + until $opt_dry_run || ln "$progpath" "$lockfile" 2>/dev/null; do + func_echo "Waiting for $lockfile to be removed" + sleep 2 + done + fi + func_show_eval "(cd \$f_ex_an_ar_dir && $AR x \"\$f_ex_an_ar_oldlib\")" \ + 'stat=$?; rm -f "$lockfile"; exit $stat' + if test "$lock_old_archive_extraction" = yes; then + $opt_dry_run || rm -f "$lockfile" + fi + if ($AR t "$f_ex_an_ar_oldlib" | sort | sort -uc >/dev/null 2>&1); then + : + else + func_fatal_error "object name conflicts in archive: $f_ex_an_ar_dir/$f_ex_an_ar_oldlib" + fi +} + + +# func_extract_archives gentop oldlib ... +func_extract_archives () +{ + $opt_debug + my_gentop="$1"; shift + my_oldlibs=${1+"$@"} + my_oldobjs="" + my_xlib="" + my_xabs="" + my_xdir="" + + for my_xlib in $my_oldlibs; do + # Extract the objects. + case $my_xlib in + [\\/]* | [A-Za-z]:[\\/]*) my_xabs="$my_xlib" ;; + *) my_xabs=`pwd`"/$my_xlib" ;; + esac + func_basename "$my_xlib" + my_xlib="$func_basename_result" + my_xlib_u=$my_xlib + while :; do + case " $extracted_archives " in + *" $my_xlib_u "*) + func_arith $extracted_serial + 1 + extracted_serial=$func_arith_result + my_xlib_u=lt$extracted_serial-$my_xlib ;; + *) break ;; + esac + done + extracted_archives="$extracted_archives $my_xlib_u" + my_xdir="$my_gentop/$my_xlib_u" + + func_mkdir_p "$my_xdir" + + case $host in + *-darwin*) + func_verbose "Extracting $my_xabs" + # Do not bother doing anything if just a dry run + $opt_dry_run || { + darwin_orig_dir=`pwd` + cd $my_xdir || exit $? + darwin_archive=$my_xabs + darwin_curdir=`pwd` + darwin_base_archive=`basename "$darwin_archive"` + darwin_arches=`$LIPO -info "$darwin_archive" 2>/dev/null | $GREP Architectures 2>/dev/null || true` + if test -n "$darwin_arches"; then + darwin_arches=`$ECHO "$darwin_arches" | $SED -e 's/.*are://'` + darwin_arch= + func_verbose "$darwin_base_archive has multiple architectures $darwin_arches" + for darwin_arch in $darwin_arches ; do + func_mkdir_p "unfat-$$/${darwin_base_archive}-${darwin_arch}" + $LIPO -thin $darwin_arch -output "unfat-$$/${darwin_base_archive}-${darwin_arch}/${darwin_base_archive}" "${darwin_archive}" + cd "unfat-$$/${darwin_base_archive}-${darwin_arch}" + func_extract_an_archive "`pwd`" "${darwin_base_archive}" + cd "$darwin_curdir" + $RM "unfat-$$/${darwin_base_archive}-${darwin_arch}/${darwin_base_archive}" + done # $darwin_arches + ## Okay now we've a bunch of thin objects, gotta fatten them up :) + darwin_filelist=`find unfat-$$ -type f -name \*.o -print -o -name \*.lo -print | $SED -e "$basename" | sort -u` + darwin_file= + darwin_files= + for darwin_file in $darwin_filelist; do + darwin_files=`find unfat-$$ -name $darwin_file -print | sort | $NL2SP` + $LIPO -create -output "$darwin_file" $darwin_files + done # $darwin_filelist + $RM -rf unfat-$$ + cd "$darwin_orig_dir" + else + cd $darwin_orig_dir + func_extract_an_archive "$my_xdir" "$my_xabs" + fi # $darwin_arches + } # !$opt_dry_run + ;; + *) + func_extract_an_archive "$my_xdir" "$my_xabs" + ;; + esac + my_oldobjs="$my_oldobjs "`find $my_xdir -name \*.$objext -print -o -name \*.lo -print | sort | $NL2SP` + done + + func_extract_archives_result="$my_oldobjs" +} + + +# func_emit_wrapper [arg=no] +# +# Emit a libtool wrapper script on stdout. +# Don't directly open a file because we may want to +# incorporate the script contents within a cygwin/mingw +# wrapper executable. Must ONLY be called from within +# func_mode_link because it depends on a number of variables +# set therein. +# +# ARG is the value that the WRAPPER_SCRIPT_BELONGS_IN_OBJDIR +# variable will take. If 'yes', then the emitted script +# will assume that the directory in which it is stored is +# the $objdir directory. This is a cygwin/mingw-specific +# behavior. +func_emit_wrapper () +{ + func_emit_wrapper_arg1=${1-no} + + $ECHO "\ +#! $SHELL + +# $output - temporary wrapper script for $objdir/$outputname +# Generated by $PROGRAM (GNU $PACKAGE$TIMESTAMP) $VERSION +# +# The $output program cannot be directly executed until all the libtool +# libraries that it depends on are installed. +# +# This wrapper script should never be moved out of the build directory. +# If it is, it will not operate correctly. + +# Sed substitution that helps us do robust quoting. It backslashifies +# metacharacters that are still active within double-quoted strings. +sed_quote_subst='$sed_quote_subst' + +# Be Bourne compatible +if test -n \"\${ZSH_VERSION+set}\" && (emulate sh) >/dev/null 2>&1; then + emulate sh + NULLCMD=: + # Zsh 3.x and 4.x performs word splitting on \${1+\"\$@\"}, which + # is contrary to our usage. Disable this feature. + alias -g '\${1+\"\$@\"}'='\"\$@\"' + setopt NO_GLOB_SUBST +else + case \`(set -o) 2>/dev/null\` in *posix*) set -o posix;; esac +fi +BIN_SH=xpg4; export BIN_SH # for Tru64 +DUALCASE=1; export DUALCASE # for MKS sh + +# The HP-UX ksh and POSIX shell print the target directory to stdout +# if CDPATH is set. +(unset CDPATH) >/dev/null 2>&1 && unset CDPATH + +relink_command=\"$relink_command\" + +# This environment variable determines our operation mode. +if test \"\$libtool_install_magic\" = \"$magic\"; then + # install mode needs the following variables: + generated_by_libtool_version='$macro_version' + notinst_deplibs='$notinst_deplibs' +else + # When we are sourced in execute mode, \$file and \$ECHO are already set. + if test \"\$libtool_execute_magic\" != \"$magic\"; then + file=\"\$0\"" + + qECHO=`$ECHO "$ECHO" | $SED "$sed_quote_subst"` + $ECHO "\ + +# A function that is used when there is no print builtin or printf. +func_fallback_echo () +{ + eval 'cat <<_LTECHO_EOF +\$1 +_LTECHO_EOF' +} + ECHO=\"$qECHO\" + fi + +# Very basic option parsing. These options are (a) specific to +# the libtool wrapper, (b) are identical between the wrapper +# /script/ and the wrapper /executable/ which is used only on +# windows platforms, and (c) all begin with the string "--lt-" +# (application programs are unlikely to have options which match +# this pattern). +# +# There are only two supported options: --lt-debug and +# --lt-dump-script. There is, deliberately, no --lt-help. +# +# The first argument to this parsing function should be the +# script's $0 value, followed by "$@". +lt_option_debug= +func_parse_lt_options () +{ + lt_script_arg0=\$0 + shift + for lt_opt + do + case \"\$lt_opt\" in + --lt-debug) lt_option_debug=1 ;; + --lt-dump-script) + lt_dump_D=\`\$ECHO \"X\$lt_script_arg0\" | $SED -e 's/^X//' -e 's%/[^/]*$%%'\` + test \"X\$lt_dump_D\" = \"X\$lt_script_arg0\" && lt_dump_D=. + lt_dump_F=\`\$ECHO \"X\$lt_script_arg0\" | $SED -e 's/^X//' -e 's%^.*/%%'\` + cat \"\$lt_dump_D/\$lt_dump_F\" + exit 0 + ;; + --lt-*) + \$ECHO \"Unrecognized --lt- option: '\$lt_opt'\" 1>&2 + exit 1 + ;; + esac + done + + # Print the debug banner immediately: + if test -n \"\$lt_option_debug\"; then + echo \"${outputname}:${output}:\${LINENO}: libtool wrapper (GNU $PACKAGE$TIMESTAMP) $VERSION\" 1>&2 + fi +} + +# Used when --lt-debug. Prints its arguments to stdout +# (redirection is the responsibility of the caller) +func_lt_dump_args () +{ + lt_dump_args_N=1; + for lt_arg + do + \$ECHO \"${outputname}:${output}:\${LINENO}: newargv[\$lt_dump_args_N]: \$lt_arg\" + lt_dump_args_N=\`expr \$lt_dump_args_N + 1\` + done +} + +# Core function for launching the target application +func_exec_program_core () +{ +" + case $host in + # Backslashes separate directories on plain windows + *-*-mingw | *-*-os2* | *-cegcc*) + $ECHO "\ + if test -n \"\$lt_option_debug\"; then + \$ECHO \"${outputname}:${output}:\${LINENO}: newargv[0]: \$progdir\\\\\$program\" 1>&2 + func_lt_dump_args \${1+\"\$@\"} 1>&2 + fi + exec \"\$progdir\\\\\$program\" \${1+\"\$@\"} +" + ;; + + *) + $ECHO "\ + if test -n \"\$lt_option_debug\"; then + \$ECHO \"${outputname}:${output}:\${LINENO}: newargv[0]: \$progdir/\$program\" 1>&2 + func_lt_dump_args \${1+\"\$@\"} 1>&2 + fi + exec \"\$progdir/\$program\" \${1+\"\$@\"} +" + ;; + esac + $ECHO "\ + \$ECHO \"\$0: cannot exec \$program \$*\" 1>&2 + exit 1 +} + +# A function to encapsulate launching the target application +# Strips options in the --lt-* namespace from \$@ and +# launches target application with the remaining arguments. +func_exec_program () +{ + case \" \$* \" in + *\\ --lt-*) + for lt_wr_arg + do + case \$lt_wr_arg in + --lt-*) ;; + *) set x \"\$@\" \"\$lt_wr_arg\"; shift;; + esac + shift + done ;; + esac + func_exec_program_core \${1+\"\$@\"} +} + + # Parse options + func_parse_lt_options \"\$0\" \${1+\"\$@\"} + + # Find the directory that this script lives in. + thisdir=\`\$ECHO \"\$file\" | $SED 's%/[^/]*$%%'\` + test \"x\$thisdir\" = \"x\$file\" && thisdir=. + + # Follow symbolic links until we get to the real thisdir. + file=\`ls -ld \"\$file\" | $SED -n 's/.*-> //p'\` + while test -n \"\$file\"; do + destdir=\`\$ECHO \"\$file\" | $SED 's%/[^/]*\$%%'\` + + # If there was a directory component, then change thisdir. + if test \"x\$destdir\" != \"x\$file\"; then + case \"\$destdir\" in + [\\\\/]* | [A-Za-z]:[\\\\/]*) thisdir=\"\$destdir\" ;; + *) thisdir=\"\$thisdir/\$destdir\" ;; + esac + fi + + file=\`\$ECHO \"\$file\" | $SED 's%^.*/%%'\` + file=\`ls -ld \"\$thisdir/\$file\" | $SED -n 's/.*-> //p'\` + done + + # Usually 'no', except on cygwin/mingw when embedded into + # the cwrapper. + WRAPPER_SCRIPT_BELONGS_IN_OBJDIR=$func_emit_wrapper_arg1 + if test \"\$WRAPPER_SCRIPT_BELONGS_IN_OBJDIR\" = \"yes\"; then + # special case for '.' + if test \"\$thisdir\" = \".\"; then + thisdir=\`pwd\` + fi + # remove .libs from thisdir + case \"\$thisdir\" in + *[\\\\/]$objdir ) thisdir=\`\$ECHO \"\$thisdir\" | $SED 's%[\\\\/][^\\\\/]*$%%'\` ;; + $objdir ) thisdir=. ;; + esac + fi + + # Try to get the absolute directory name. + absdir=\`cd \"\$thisdir\" && pwd\` + test -n \"\$absdir\" && thisdir=\"\$absdir\" +" + + if test "$fast_install" = yes; then + $ECHO "\ + program=lt-'$outputname'$exeext + progdir=\"\$thisdir/$objdir\" + + if test ! -f \"\$progdir/\$program\" || + { file=\`ls -1dt \"\$progdir/\$program\" \"\$progdir/../\$program\" 2>/dev/null | ${SED} 1q\`; \\ + test \"X\$file\" != \"X\$progdir/\$program\"; }; then + + file=\"\$\$-\$program\" + + if test ! -d \"\$progdir\"; then + $MKDIR \"\$progdir\" + else + $RM \"\$progdir/\$file\" + fi" + + $ECHO "\ + + # relink executable if necessary + if test -n \"\$relink_command\"; then + if relink_command_output=\`eval \$relink_command 2>&1\`; then : + else + $ECHO \"\$relink_command_output\" >&2 + $RM \"\$progdir/\$file\" + exit 1 + fi + fi + + $MV \"\$progdir/\$file\" \"\$progdir/\$program\" 2>/dev/null || + { $RM \"\$progdir/\$program\"; + $MV \"\$progdir/\$file\" \"\$progdir/\$program\"; } + $RM \"\$progdir/\$file\" + fi" + else + $ECHO "\ + program='$outputname' + progdir=\"\$thisdir/$objdir\" +" + fi + + $ECHO "\ + + if test -f \"\$progdir/\$program\"; then" + + # fixup the dll searchpath if we need to. + # + # Fix the DLL searchpath if we need to. Do this before prepending + # to shlibpath, because on Windows, both are PATH and uninstalled + # libraries must come first. + if test -n "$dllsearchpath"; then + $ECHO "\ + # Add the dll search path components to the executable PATH + PATH=$dllsearchpath:\$PATH +" + fi + + # Export our shlibpath_var if we have one. + if test "$shlibpath_overrides_runpath" = yes && test -n "$shlibpath_var" && test -n "$temp_rpath"; then + $ECHO "\ + # Add our own library path to $shlibpath_var + $shlibpath_var=\"$temp_rpath\$$shlibpath_var\" + + # Some systems cannot cope with colon-terminated $shlibpath_var + # The second colon is a workaround for a bug in BeOS R4 sed + $shlibpath_var=\`\$ECHO \"\$$shlibpath_var\" | $SED 's/::*\$//'\` + + export $shlibpath_var +" + fi + + $ECHO "\ + if test \"\$libtool_execute_magic\" != \"$magic\"; then + # Run the actual program with our arguments. + func_exec_program \${1+\"\$@\"} + fi + else + # The program doesn't exist. + \$ECHO \"\$0: error: \\\`\$progdir/\$program' does not exist\" 1>&2 + \$ECHO \"This script is just a wrapper for \$program.\" 1>&2 + \$ECHO \"See the $PACKAGE documentation for more information.\" 1>&2 + exit 1 + fi +fi\ +" +} + + +# func_emit_cwrapperexe_src +# emit the source code for a wrapper executable on stdout +# Must ONLY be called from within func_mode_link because +# it depends on a number of variable set therein. +func_emit_cwrapperexe_src () +{ + cat < +#include +#ifdef _MSC_VER +# include +# include +# include +#else +# include +# include +# ifdef __CYGWIN__ +# include +# endif +#endif +#include +#include +#include +#include +#include +#include +#include +#include + +/* declarations of non-ANSI functions */ +#if defined(__MINGW32__) +# ifdef __STRICT_ANSI__ +int _putenv (const char *); +# endif +#elif defined(__CYGWIN__) +# ifdef __STRICT_ANSI__ +char *realpath (const char *, char *); +int putenv (char *); +int setenv (const char *, const char *, int); +# endif +/* #elif defined (other platforms) ... */ +#endif + +/* portability defines, excluding path handling macros */ +#if defined(_MSC_VER) +# define setmode _setmode +# define stat _stat +# define chmod _chmod +# define getcwd _getcwd +# define putenv _putenv +# define S_IXUSR _S_IEXEC +# ifndef _INTPTR_T_DEFINED +# define _INTPTR_T_DEFINED +# define intptr_t int +# endif +#elif defined(__MINGW32__) +# define setmode _setmode +# define stat _stat +# define chmod _chmod +# define getcwd _getcwd +# define putenv _putenv +#elif defined(__CYGWIN__) +# define HAVE_SETENV +# define FOPEN_WB "wb" +/* #elif defined (other platforms) ... */ +#endif + +#if defined(PATH_MAX) +# define LT_PATHMAX PATH_MAX +#elif defined(MAXPATHLEN) +# define LT_PATHMAX MAXPATHLEN +#else +# define LT_PATHMAX 1024 +#endif + +#ifndef S_IXOTH +# define S_IXOTH 0 +#endif +#ifndef S_IXGRP +# define S_IXGRP 0 +#endif + +/* path handling portability macros */ +#ifndef DIR_SEPARATOR +# define DIR_SEPARATOR '/' +# define PATH_SEPARATOR ':' +#endif + +#if defined (_WIN32) || defined (__MSDOS__) || defined (__DJGPP__) || \ + defined (__OS2__) +# define HAVE_DOS_BASED_FILE_SYSTEM +# define FOPEN_WB "wb" +# ifndef DIR_SEPARATOR_2 +# define DIR_SEPARATOR_2 '\\' +# endif +# ifndef PATH_SEPARATOR_2 +# define PATH_SEPARATOR_2 ';' +# endif +#endif + +#ifndef DIR_SEPARATOR_2 +# define IS_DIR_SEPARATOR(ch) ((ch) == DIR_SEPARATOR) +#else /* DIR_SEPARATOR_2 */ +# define IS_DIR_SEPARATOR(ch) \ + (((ch) == DIR_SEPARATOR) || ((ch) == DIR_SEPARATOR_2)) +#endif /* DIR_SEPARATOR_2 */ + +#ifndef PATH_SEPARATOR_2 +# define IS_PATH_SEPARATOR(ch) ((ch) == PATH_SEPARATOR) +#else /* PATH_SEPARATOR_2 */ +# define IS_PATH_SEPARATOR(ch) ((ch) == PATH_SEPARATOR_2) +#endif /* PATH_SEPARATOR_2 */ + +#ifndef FOPEN_WB +# define FOPEN_WB "w" +#endif +#ifndef _O_BINARY +# define _O_BINARY 0 +#endif + +#define XMALLOC(type, num) ((type *) xmalloc ((num) * sizeof(type))) +#define XFREE(stale) do { \ + if (stale) { free ((void *) stale); stale = 0; } \ +} while (0) + +#if defined(LT_DEBUGWRAPPER) +static int lt_debug = 1; +#else +static int lt_debug = 0; +#endif + +const char *program_name = "libtool-wrapper"; /* in case xstrdup fails */ + +void *xmalloc (size_t num); +char *xstrdup (const char *string); +const char *base_name (const char *name); +char *find_executable (const char *wrapper); +char *chase_symlinks (const char *pathspec); +int make_executable (const char *path); +int check_executable (const char *path); +char *strendzap (char *str, const char *pat); +void lt_debugprintf (const char *file, int line, const char *fmt, ...); +void lt_fatal (const char *file, int line, const char *message, ...); +static const char *nonnull (const char *s); +static const char *nonempty (const char *s); +void lt_setenv (const char *name, const char *value); +char *lt_extend_str (const char *orig_value, const char *add, int to_end); +void lt_update_exe_path (const char *name, const char *value); +void lt_update_lib_path (const char *name, const char *value); +char **prepare_spawn (char **argv); +void lt_dump_script (FILE *f); +EOF + + cat <= 0) + && (st.st_mode & (S_IXUSR | S_IXGRP | S_IXOTH))) + return 1; + else + return 0; +} + +int +make_executable (const char *path) +{ + int rval = 0; + struct stat st; + + lt_debugprintf (__FILE__, __LINE__, "(make_executable): %s\n", + nonempty (path)); + if ((!path) || (!*path)) + return 0; + + if (stat (path, &st) >= 0) + { + rval = chmod (path, st.st_mode | S_IXOTH | S_IXGRP | S_IXUSR); + } + return rval; +} + +/* Searches for the full path of the wrapper. Returns + newly allocated full path name if found, NULL otherwise + Does not chase symlinks, even on platforms that support them. +*/ +char * +find_executable (const char *wrapper) +{ + int has_slash = 0; + const char *p; + const char *p_next; + /* static buffer for getcwd */ + char tmp[LT_PATHMAX + 1]; + int tmp_len; + char *concat_name; + + lt_debugprintf (__FILE__, __LINE__, "(find_executable): %s\n", + nonempty (wrapper)); + + if ((wrapper == NULL) || (*wrapper == '\0')) + return NULL; + + /* Absolute path? */ +#if defined (HAVE_DOS_BASED_FILE_SYSTEM) + if (isalpha ((unsigned char) wrapper[0]) && wrapper[1] == ':') + { + concat_name = xstrdup (wrapper); + if (check_executable (concat_name)) + return concat_name; + XFREE (concat_name); + } + else + { +#endif + if (IS_DIR_SEPARATOR (wrapper[0])) + { + concat_name = xstrdup (wrapper); + if (check_executable (concat_name)) + return concat_name; + XFREE (concat_name); + } +#if defined (HAVE_DOS_BASED_FILE_SYSTEM) + } +#endif + + for (p = wrapper; *p; p++) + if (*p == '/') + { + has_slash = 1; + break; + } + if (!has_slash) + { + /* no slashes; search PATH */ + const char *path = getenv ("PATH"); + if (path != NULL) + { + for (p = path; *p; p = p_next) + { + const char *q; + size_t p_len; + for (q = p; *q; q++) + if (IS_PATH_SEPARATOR (*q)) + break; + p_len = q - p; + p_next = (*q == '\0' ? q : q + 1); + if (p_len == 0) + { + /* empty path: current directory */ + if (getcwd (tmp, LT_PATHMAX) == NULL) + lt_fatal (__FILE__, __LINE__, "getcwd failed: %s", + nonnull (strerror (errno))); + tmp_len = strlen (tmp); + concat_name = + XMALLOC (char, tmp_len + 1 + strlen (wrapper) + 1); + memcpy (concat_name, tmp, tmp_len); + concat_name[tmp_len] = '/'; + strcpy (concat_name + tmp_len + 1, wrapper); + } + else + { + concat_name = + XMALLOC (char, p_len + 1 + strlen (wrapper) + 1); + memcpy (concat_name, p, p_len); + concat_name[p_len] = '/'; + strcpy (concat_name + p_len + 1, wrapper); + } + if (check_executable (concat_name)) + return concat_name; + XFREE (concat_name); + } + } + /* not found in PATH; assume curdir */ + } + /* Relative path | not found in path: prepend cwd */ + if (getcwd (tmp, LT_PATHMAX) == NULL) + lt_fatal (__FILE__, __LINE__, "getcwd failed: %s", + nonnull (strerror (errno))); + tmp_len = strlen (tmp); + concat_name = XMALLOC (char, tmp_len + 1 + strlen (wrapper) + 1); + memcpy (concat_name, tmp, tmp_len); + concat_name[tmp_len] = '/'; + strcpy (concat_name + tmp_len + 1, wrapper); + + if (check_executable (concat_name)) + return concat_name; + XFREE (concat_name); + return NULL; +} + +char * +chase_symlinks (const char *pathspec) +{ +#ifndef S_ISLNK + return xstrdup (pathspec); +#else + char buf[LT_PATHMAX]; + struct stat s; + char *tmp_pathspec = xstrdup (pathspec); + char *p; + int has_symlinks = 0; + while (strlen (tmp_pathspec) && !has_symlinks) + { + lt_debugprintf (__FILE__, __LINE__, + "checking path component for symlinks: %s\n", + tmp_pathspec); + if (lstat (tmp_pathspec, &s) == 0) + { + if (S_ISLNK (s.st_mode) != 0) + { + has_symlinks = 1; + break; + } + + /* search backwards for last DIR_SEPARATOR */ + p = tmp_pathspec + strlen (tmp_pathspec) - 1; + while ((p > tmp_pathspec) && (!IS_DIR_SEPARATOR (*p))) + p--; + if ((p == tmp_pathspec) && (!IS_DIR_SEPARATOR (*p))) + { + /* no more DIR_SEPARATORS left */ + break; + } + *p = '\0'; + } + else + { + lt_fatal (__FILE__, __LINE__, + "error accessing file \"%s\": %s", + tmp_pathspec, nonnull (strerror (errno))); + } + } + XFREE (tmp_pathspec); + + if (!has_symlinks) + { + return xstrdup (pathspec); + } + + tmp_pathspec = realpath (pathspec, buf); + if (tmp_pathspec == 0) + { + lt_fatal (__FILE__, __LINE__, + "could not follow symlinks for %s", pathspec); + } + return xstrdup (tmp_pathspec); +#endif +} + +char * +strendzap (char *str, const char *pat) +{ + size_t len, patlen; + + assert (str != NULL); + assert (pat != NULL); + + len = strlen (str); + patlen = strlen (pat); + + if (patlen <= len) + { + str += len - patlen; + if (strcmp (str, pat) == 0) + *str = '\0'; + } + return str; +} + +void +lt_debugprintf (const char *file, int line, const char *fmt, ...) +{ + va_list args; + if (lt_debug) + { + (void) fprintf (stderr, "%s:%s:%d: ", program_name, file, line); + va_start (args, fmt); + (void) vfprintf (stderr, fmt, args); + va_end (args); + } +} + +static void +lt_error_core (int exit_status, const char *file, + int line, const char *mode, + const char *message, va_list ap) +{ + fprintf (stderr, "%s:%s:%d: %s: ", program_name, file, line, mode); + vfprintf (stderr, message, ap); + fprintf (stderr, ".\n"); + + if (exit_status >= 0) + exit (exit_status); +} + +void +lt_fatal (const char *file, int line, const char *message, ...) +{ + va_list ap; + va_start (ap, message); + lt_error_core (EXIT_FAILURE, file, line, "FATAL", message, ap); + va_end (ap); +} + +static const char * +nonnull (const char *s) +{ + return s ? s : "(null)"; +} + +static const char * +nonempty (const char *s) +{ + return (s && !*s) ? "(empty)" : nonnull (s); +} + +void +lt_setenv (const char *name, const char *value) +{ + lt_debugprintf (__FILE__, __LINE__, + "(lt_setenv) setting '%s' to '%s'\n", + nonnull (name), nonnull (value)); + { +#ifdef HAVE_SETENV + /* always make a copy, for consistency with !HAVE_SETENV */ + char *str = xstrdup (value); + setenv (name, str, 1); +#else + int len = strlen (name) + 1 + strlen (value) + 1; + char *str = XMALLOC (char, len); + sprintf (str, "%s=%s", name, value); + if (putenv (str) != EXIT_SUCCESS) + { + XFREE (str); + } +#endif + } +} + +char * +lt_extend_str (const char *orig_value, const char *add, int to_end) +{ + char *new_value; + if (orig_value && *orig_value) + { + int orig_value_len = strlen (orig_value); + int add_len = strlen (add); + new_value = XMALLOC (char, add_len + orig_value_len + 1); + if (to_end) + { + strcpy (new_value, orig_value); + strcpy (new_value + orig_value_len, add); + } + else + { + strcpy (new_value, add); + strcpy (new_value + add_len, orig_value); + } + } + else + { + new_value = xstrdup (add); + } + return new_value; +} + +void +lt_update_exe_path (const char *name, const char *value) +{ + lt_debugprintf (__FILE__, __LINE__, + "(lt_update_exe_path) modifying '%s' by prepending '%s'\n", + nonnull (name), nonnull (value)); + + if (name && *name && value && *value) + { + char *new_value = lt_extend_str (getenv (name), value, 0); + /* some systems can't cope with a ':'-terminated path #' */ + int len = strlen (new_value); + while (((len = strlen (new_value)) > 0) && IS_PATH_SEPARATOR (new_value[len-1])) + { + new_value[len-1] = '\0'; + } + lt_setenv (name, new_value); + XFREE (new_value); + } +} + +void +lt_update_lib_path (const char *name, const char *value) +{ + lt_debugprintf (__FILE__, __LINE__, + "(lt_update_lib_path) modifying '%s' by prepending '%s'\n", + nonnull (name), nonnull (value)); + + if (name && *name && value && *value) + { + char *new_value = lt_extend_str (getenv (name), value, 0); + lt_setenv (name, new_value); + XFREE (new_value); + } +} + +EOF + case $host_os in + mingw*) + cat <<"EOF" + +/* Prepares an argument vector before calling spawn(). + Note that spawn() does not by itself call the command interpreter + (getenv ("COMSPEC") != NULL ? getenv ("COMSPEC") : + ({ OSVERSIONINFO v; v.dwOSVersionInfoSize = sizeof(OSVERSIONINFO); + GetVersionEx(&v); + v.dwPlatformId == VER_PLATFORM_WIN32_NT; + }) ? "cmd.exe" : "command.com"). + Instead it simply concatenates the arguments, separated by ' ', and calls + CreateProcess(). We must quote the arguments since Win32 CreateProcess() + interprets characters like ' ', '\t', '\\', '"' (but not '<' and '>') in a + special way: + - Space and tab are interpreted as delimiters. They are not treated as + delimiters if they are surrounded by double quotes: "...". + - Unescaped double quotes are removed from the input. Their only effect is + that within double quotes, space and tab are treated like normal + characters. + - Backslashes not followed by double quotes are not special. + - But 2*n+1 backslashes followed by a double quote become + n backslashes followed by a double quote (n >= 0): + \" -> " + \\\" -> \" + \\\\\" -> \\" + */ +#define SHELL_SPECIAL_CHARS "\"\\ \001\002\003\004\005\006\007\010\011\012\013\014\015\016\017\020\021\022\023\024\025\026\027\030\031\032\033\034\035\036\037" +#define SHELL_SPACE_CHARS " \001\002\003\004\005\006\007\010\011\012\013\014\015\016\017\020\021\022\023\024\025\026\027\030\031\032\033\034\035\036\037" +char ** +prepare_spawn (char **argv) +{ + size_t argc; + char **new_argv; + size_t i; + + /* Count number of arguments. */ + for (argc = 0; argv[argc] != NULL; argc++) + ; + + /* Allocate new argument vector. */ + new_argv = XMALLOC (char *, argc + 1); + + /* Put quoted arguments into the new argument vector. */ + for (i = 0; i < argc; i++) + { + const char *string = argv[i]; + + if (string[0] == '\0') + new_argv[i] = xstrdup ("\"\""); + else if (strpbrk (string, SHELL_SPECIAL_CHARS) != NULL) + { + int quote_around = (strpbrk (string, SHELL_SPACE_CHARS) != NULL); + size_t length; + unsigned int backslashes; + const char *s; + char *quoted_string; + char *p; + + length = 0; + backslashes = 0; + if (quote_around) + length++; + for (s = string; *s != '\0'; s++) + { + char c = *s; + if (c == '"') + length += backslashes + 1; + length++; + if (c == '\\') + backslashes++; + else + backslashes = 0; + } + if (quote_around) + length += backslashes + 1; + + quoted_string = XMALLOC (char, length + 1); + + p = quoted_string; + backslashes = 0; + if (quote_around) + *p++ = '"'; + for (s = string; *s != '\0'; s++) + { + char c = *s; + if (c == '"') + { + unsigned int j; + for (j = backslashes + 1; j > 0; j--) + *p++ = '\\'; + } + *p++ = c; + if (c == '\\') + backslashes++; + else + backslashes = 0; + } + if (quote_around) + { + unsigned int j; + for (j = backslashes; j > 0; j--) + *p++ = '\\'; + *p++ = '"'; + } + *p = '\0'; + + new_argv[i] = quoted_string; + } + else + new_argv[i] = (char *) string; + } + new_argv[argc] = NULL; + + return new_argv; +} +EOF + ;; + esac + + cat <<"EOF" +void lt_dump_script (FILE* f) +{ +EOF + func_emit_wrapper yes | + $SED -n -e ' +s/^\(.\{79\}\)\(..*\)/\1\\\ +\2/ +h +s/\([\\"]\)/\\\1/g +s/$/\\n/ +s/\([^\n]*\).*/ fputs ("\1", f);/p +g +D' + cat <<"EOF" +} +EOF +} +# end: func_emit_cwrapperexe_src + +# func_win32_import_lib_p ARG +# True if ARG is an import lib, as indicated by $file_magic_cmd +func_win32_import_lib_p () +{ + $opt_debug + case `eval $file_magic_cmd \"\$1\" 2>/dev/null | $SED -e 10q` in + *import*) : ;; + *) false ;; + esac +} + +# func_mode_link arg... +func_mode_link () +{ + $opt_debug + case $host in + *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2* | *-cegcc*) + # It is impossible to link a dll without this setting, and + # we shouldn't force the makefile maintainer to figure out + # which system we are compiling for in order to pass an extra + # flag for every libtool invocation. + # allow_undefined=no + + # FIXME: Unfortunately, there are problems with the above when trying + # to make a dll which has undefined symbols, in which case not + # even a static library is built. For now, we need to specify + # -no-undefined on the libtool link line when we can be certain + # that all symbols are satisfied, otherwise we get a static library. + allow_undefined=yes + ;; + *) + allow_undefined=yes + ;; + esac + libtool_args=$nonopt + base_compile="$nonopt $@" + compile_command=$nonopt + finalize_command=$nonopt + + compile_rpath= + finalize_rpath= + compile_shlibpath= + finalize_shlibpath= + convenience= + old_convenience= + deplibs= + old_deplibs= + compiler_flags= + linker_flags= + dllsearchpath= + lib_search_path=`pwd` + inst_prefix_dir= + new_inherited_linker_flags= + + avoid_version=no + bindir= + dlfiles= + dlprefiles= + dlself=no + export_dynamic=no + export_symbols= + export_symbols_regex= + generated= + libobjs= + ltlibs= + module=no + no_install=no + objs= + non_pic_objects= + precious_files_regex= + prefer_static_libs=no + preload=no + prev= + prevarg= + release= + rpath= + xrpath= + perm_rpath= + temp_rpath= + thread_safe=no + vinfo= + vinfo_number=no + weak_libs= + single_module="${wl}-single_module" + func_infer_tag $base_compile + + # We need to know -static, to get the right output filenames. + for arg + do + case $arg in + -shared) + test "$build_libtool_libs" != yes && \ + func_fatal_configuration "can not build a shared library" + build_old_libs=no + break + ;; + -all-static | -static | -static-libtool-libs) + case $arg in + -all-static) + if test "$build_libtool_libs" = yes && test -z "$link_static_flag"; then + func_warning "complete static linking is impossible in this configuration" + fi + if test -n "$link_static_flag"; then + dlopen_self=$dlopen_self_static + fi + prefer_static_libs=yes + ;; + -static) + if test -z "$pic_flag" && test -n "$link_static_flag"; then + dlopen_self=$dlopen_self_static + fi + prefer_static_libs=built + ;; + -static-libtool-libs) + if test -z "$pic_flag" && test -n "$link_static_flag"; then + dlopen_self=$dlopen_self_static + fi + prefer_static_libs=yes + ;; + esac + build_libtool_libs=no + build_old_libs=yes + break + ;; + esac + done + + # See if our shared archives depend on static archives. + test -n "$old_archive_from_new_cmds" && build_old_libs=yes + + # Go through the arguments, transforming them on the way. + while test "$#" -gt 0; do + arg="$1" + shift + func_quote_for_eval "$arg" + qarg=$func_quote_for_eval_unquoted_result + func_append libtool_args " $func_quote_for_eval_result" + + # If the previous option needs an argument, assign it. + if test -n "$prev"; then + case $prev in + output) + func_append compile_command " @OUTPUT@" + func_append finalize_command " @OUTPUT@" + ;; + esac + + case $prev in + bindir) + bindir="$arg" + prev= + continue + ;; + dlfiles|dlprefiles) + if test "$preload" = no; then + # Add the symbol object into the linking commands. + func_append compile_command " @SYMFILE@" + func_append finalize_command " @SYMFILE@" + preload=yes + fi + case $arg in + *.la | *.lo) ;; # We handle these cases below. + force) + if test "$dlself" = no; then + dlself=needless + export_dynamic=yes + fi + prev= + continue + ;; + self) + if test "$prev" = dlprefiles; then + dlself=yes + elif test "$prev" = dlfiles && test "$dlopen_self" != yes; then + dlself=yes + else + dlself=needless + export_dynamic=yes + fi + prev= + continue + ;; + *) + if test "$prev" = dlfiles; then + func_append dlfiles " $arg" + else + func_append dlprefiles " $arg" + fi + prev= + continue + ;; + esac + ;; + expsyms) + export_symbols="$arg" + test -f "$arg" \ + || func_fatal_error "symbol file \`$arg' does not exist" + prev= + continue + ;; + expsyms_regex) + export_symbols_regex="$arg" + prev= + continue + ;; + framework) + case $host in + *-*-darwin*) + case "$deplibs " in + *" $qarg.ltframework "*) ;; + *) func_append deplibs " $qarg.ltframework" # this is fixed later + ;; + esac + ;; + esac + prev= + continue + ;; + inst_prefix) + inst_prefix_dir="$arg" + prev= + continue + ;; + objectlist) + if test -f "$arg"; then + save_arg=$arg + moreargs= + for fil in `cat "$save_arg"` + do +# func_append moreargs " $fil" + arg=$fil + # A libtool-controlled object. + + # Check to see that this really is a libtool object. + if func_lalib_unsafe_p "$arg"; then + pic_object= + non_pic_object= + + # Read the .lo file + func_source "$arg" + + if test -z "$pic_object" || + test -z "$non_pic_object" || + test "$pic_object" = none && + test "$non_pic_object" = none; then + func_fatal_error "cannot find name of object for \`$arg'" + fi + + # Extract subdirectory from the argument. + func_dirname "$arg" "/" "" + xdir="$func_dirname_result" + + if test "$pic_object" != none; then + # Prepend the subdirectory the object is found in. + pic_object="$xdir$pic_object" + + if test "$prev" = dlfiles; then + if test "$build_libtool_libs" = yes && test "$dlopen_support" = yes; then + func_append dlfiles " $pic_object" + prev= + continue + else + # If libtool objects are unsupported, then we need to preload. + prev=dlprefiles + fi + fi + + # CHECK ME: I think I busted this. -Ossama + if test "$prev" = dlprefiles; then + # Preload the old-style object. + func_append dlprefiles " $pic_object" + prev= + fi + + # A PIC object. + func_append libobjs " $pic_object" + arg="$pic_object" + fi + + # Non-PIC object. + if test "$non_pic_object" != none; then + # Prepend the subdirectory the object is found in. + non_pic_object="$xdir$non_pic_object" + + # A standard non-PIC object + func_append non_pic_objects " $non_pic_object" + if test -z "$pic_object" || test "$pic_object" = none ; then + arg="$non_pic_object" + fi + else + # If the PIC object exists, use it instead. + # $xdir was prepended to $pic_object above. + non_pic_object="$pic_object" + func_append non_pic_objects " $non_pic_object" + fi + else + # Only an error if not doing a dry-run. + if $opt_dry_run; then + # Extract subdirectory from the argument. + func_dirname "$arg" "/" "" + xdir="$func_dirname_result" + + func_lo2o "$arg" + pic_object=$xdir$objdir/$func_lo2o_result + non_pic_object=$xdir$func_lo2o_result + func_append libobjs " $pic_object" + func_append non_pic_objects " $non_pic_object" + else + func_fatal_error "\`$arg' is not a valid libtool object" + fi + fi + done + else + func_fatal_error "link input file \`$arg' does not exist" + fi + arg=$save_arg + prev= + continue + ;; + precious_regex) + precious_files_regex="$arg" + prev= + continue + ;; + release) + release="-$arg" + prev= + continue + ;; + rpath | xrpath) + # We need an absolute path. + case $arg in + [\\/]* | [A-Za-z]:[\\/]*) ;; + *) + func_fatal_error "only absolute run-paths are allowed" + ;; + esac + if test "$prev" = rpath; then + case "$rpath " in + *" $arg "*) ;; + *) func_append rpath " $arg" ;; + esac + else + case "$xrpath " in + *" $arg "*) ;; + *) func_append xrpath " $arg" ;; + esac + fi + prev= + continue + ;; + shrext) + shrext_cmds="$arg" + prev= + continue + ;; + weak) + func_append weak_libs " $arg" + prev= + continue + ;; + xcclinker) + func_append linker_flags " $qarg" + func_append compiler_flags " $qarg" + prev= + func_append compile_command " $qarg" + func_append finalize_command " $qarg" + continue + ;; + xcompiler) + func_append compiler_flags " $qarg" + prev= + func_append compile_command " $qarg" + func_append finalize_command " $qarg" + continue + ;; + xlinker) + func_append linker_flags " $qarg" + func_append compiler_flags " $wl$qarg" + prev= + func_append compile_command " $wl$qarg" + func_append finalize_command " $wl$qarg" + continue + ;; + *) + eval "$prev=\"\$arg\"" + prev= + continue + ;; + esac + fi # test -n "$prev" + + prevarg="$arg" + + case $arg in + -all-static) + if test -n "$link_static_flag"; then + # See comment for -static flag below, for more details. + func_append compile_command " $link_static_flag" + func_append finalize_command " $link_static_flag" + fi + continue + ;; + + -allow-undefined) + # FIXME: remove this flag sometime in the future. + func_fatal_error "\`-allow-undefined' must not be used because it is the default" + ;; + + -avoid-version) + avoid_version=yes + continue + ;; + + -bindir) + prev=bindir + continue + ;; + + -dlopen) + prev=dlfiles + continue + ;; + + -dlpreopen) + prev=dlprefiles + continue + ;; + + -export-dynamic) + export_dynamic=yes + continue + ;; + + -export-symbols | -export-symbols-regex) + if test -n "$export_symbols" || test -n "$export_symbols_regex"; then + func_fatal_error "more than one -exported-symbols argument is not allowed" + fi + if test "X$arg" = "X-export-symbols"; then + prev=expsyms + else + prev=expsyms_regex + fi + continue + ;; + + -framework) + prev=framework + continue + ;; + + -inst-prefix-dir) + prev=inst_prefix + continue + ;; + + # The native IRIX linker understands -LANG:*, -LIST:* and -LNO:* + # so, if we see these flags be careful not to treat them like -L + -L[A-Z][A-Z]*:*) + case $with_gcc/$host in + no/*-*-irix* | /*-*-irix*) + func_append compile_command " $arg" + func_append finalize_command " $arg" + ;; + esac + continue + ;; + + -L*) + func_stripname "-L" '' "$arg" + if test -z "$func_stripname_result"; then + if test "$#" -gt 0; then + func_fatal_error "require no space between \`-L' and \`$1'" + else + func_fatal_error "need path for \`-L' option" + fi + fi + func_resolve_sysroot "$func_stripname_result" + dir=$func_resolve_sysroot_result + # We need an absolute path. + case $dir in + [\\/]* | [A-Za-z]:[\\/]*) ;; + *) + absdir=`cd "$dir" && pwd` + test -z "$absdir" && \ + func_fatal_error "cannot determine absolute directory name of \`$dir'" + dir="$absdir" + ;; + esac + case "$deplibs " in + *" -L$dir "* | *" $arg "*) + # Will only happen for absolute or sysroot arguments + ;; + *) + # Preserve sysroot, but never include relative directories + case $dir in + [\\/]* | [A-Za-z]:[\\/]* | =*) func_append deplibs " $arg" ;; + *) func_append deplibs " -L$dir" ;; + esac + func_append lib_search_path " $dir" + ;; + esac + case $host in + *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2* | *-cegcc*) + testbindir=`$ECHO "$dir" | $SED 's*/lib$*/bin*'` + case :$dllsearchpath: in + *":$dir:"*) ;; + ::) dllsearchpath=$dir;; + *) func_append dllsearchpath ":$dir";; + esac + case :$dllsearchpath: in + *":$testbindir:"*) ;; + ::) dllsearchpath=$testbindir;; + *) func_append dllsearchpath ":$testbindir";; + esac + ;; + esac + continue + ;; + + -l*) + if test "X$arg" = "X-lc" || test "X$arg" = "X-lm"; then + case $host in + *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-beos* | *-cegcc* | *-*-haiku*) + # These systems don't actually have a C or math library (as such) + continue + ;; + *-*-os2*) + # These systems don't actually have a C library (as such) + test "X$arg" = "X-lc" && continue + ;; + *-*-openbsd* | *-*-freebsd* | *-*-dragonfly*) + # Do not include libc due to us having libc/libc_r. + test "X$arg" = "X-lc" && continue + ;; + *-*-rhapsody* | *-*-darwin1.[012]) + # Rhapsody C and math libraries are in the System framework + func_append deplibs " System.ltframework" + continue + ;; + *-*-sco3.2v5* | *-*-sco5v6*) + # Causes problems with __ctype + test "X$arg" = "X-lc" && continue + ;; + *-*-sysv4.2uw2* | *-*-sysv5* | *-*-unixware* | *-*-OpenUNIX*) + # Compiler inserts libc in the correct place for threads to work + test "X$arg" = "X-lc" && continue + ;; + esac + elif test "X$arg" = "X-lc_r"; then + case $host in + *-*-openbsd* | *-*-freebsd* | *-*-dragonfly*) + # Do not include libc_r directly, use -pthread flag. + continue + ;; + esac + fi + func_append deplibs " $arg" + continue + ;; + + -module) + module=yes + continue + ;; + + # Tru64 UNIX uses -model [arg] to determine the layout of C++ + # classes, name mangling, and exception handling. + # Darwin uses the -arch flag to determine output architecture. + -model|-arch|-isysroot|--sysroot) + func_append compiler_flags " $arg" + func_append compile_command " $arg" + func_append finalize_command " $arg" + prev=xcompiler + continue + ;; + + -mt|-mthreads|-kthread|-Kthread|-pthread|-pthreads|--thread-safe \ + |-threads|-fopenmp|-openmp|-mp|-xopenmp|-omp|-qsmp=*) + func_append compiler_flags " $arg" + func_append compile_command " $arg" + func_append finalize_command " $arg" + case "$new_inherited_linker_flags " in + *" $arg "*) ;; + * ) func_append new_inherited_linker_flags " $arg" ;; + esac + continue + ;; + + -multi_module) + single_module="${wl}-multi_module" + continue + ;; + + -no-fast-install) + fast_install=no + continue + ;; + + -no-install) + case $host in + *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2* | *-*-darwin* | *-cegcc*) + # The PATH hackery in wrapper scripts is required on Windows + # and Darwin in order for the loader to find any dlls it needs. + func_warning "\`-no-install' is ignored for $host" + func_warning "assuming \`-no-fast-install' instead" + fast_install=no + ;; + *) no_install=yes ;; + esac + continue + ;; + + -no-undefined) + allow_undefined=no + continue + ;; + + -objectlist) + prev=objectlist + continue + ;; + + -o) prev=output ;; + + -precious-files-regex) + prev=precious_regex + continue + ;; + + -release) + prev=release + continue + ;; + + -rpath) + prev=rpath + continue + ;; + + -R) + prev=xrpath + continue + ;; + + -R*) + func_stripname '-R' '' "$arg" + dir=$func_stripname_result + # We need an absolute path. + case $dir in + [\\/]* | [A-Za-z]:[\\/]*) ;; + =*) + func_stripname '=' '' "$dir" + dir=$lt_sysroot$func_stripname_result + ;; + *) + func_fatal_error "only absolute run-paths are allowed" + ;; + esac + case "$xrpath " in + *" $dir "*) ;; + *) func_append xrpath " $dir" ;; + esac + continue + ;; + + -shared) + # The effects of -shared are defined in a previous loop. + continue + ;; + + -shrext) + prev=shrext + continue + ;; + + -static | -static-libtool-libs) + # The effects of -static are defined in a previous loop. + # We used to do the same as -all-static on platforms that + # didn't have a PIC flag, but the assumption that the effects + # would be equivalent was wrong. It would break on at least + # Digital Unix and AIX. + continue + ;; + + -thread-safe) + thread_safe=yes + continue + ;; + + -version-info) + prev=vinfo + continue + ;; + + -version-number) + prev=vinfo + vinfo_number=yes + continue + ;; + + -weak) + prev=weak + continue + ;; + + -Wc,*) + func_stripname '-Wc,' '' "$arg" + args=$func_stripname_result + arg= + save_ifs="$IFS"; IFS=',' + for flag in $args; do + IFS="$save_ifs" + func_quote_for_eval "$flag" + func_append arg " $func_quote_for_eval_result" + func_append compiler_flags " $func_quote_for_eval_result" + done + IFS="$save_ifs" + func_stripname ' ' '' "$arg" + arg=$func_stripname_result + ;; + + -Wl,*) + func_stripname '-Wl,' '' "$arg" + args=$func_stripname_result + arg= + save_ifs="$IFS"; IFS=',' + for flag in $args; do + IFS="$save_ifs" + func_quote_for_eval "$flag" + func_append arg " $wl$func_quote_for_eval_result" + func_append compiler_flags " $wl$func_quote_for_eval_result" + func_append linker_flags " $func_quote_for_eval_result" + done + IFS="$save_ifs" + func_stripname ' ' '' "$arg" + arg=$func_stripname_result + ;; + + -Xcompiler) + prev=xcompiler + continue + ;; + + -Xlinker) + prev=xlinker + continue + ;; + + -XCClinker) + prev=xcclinker + continue + ;; + + # -msg_* for osf cc + -msg_*) + func_quote_for_eval "$arg" + arg="$func_quote_for_eval_result" + ;; + + # Flags to be passed through unchanged, with rationale: + # -64, -mips[0-9] enable 64-bit mode for the SGI compiler + # -r[0-9][0-9]* specify processor for the SGI compiler + # -xarch=*, -xtarget=* enable 64-bit mode for the Sun compiler + # +DA*, +DD* enable 64-bit mode for the HP compiler + # -q* compiler args for the IBM compiler + # -m*, -t[45]*, -txscale* architecture-specific flags for GCC + # -F/path path to uninstalled frameworks, gcc on darwin + # -p, -pg, --coverage, -fprofile-* profiling flags for GCC + # @file GCC response files + # -tp=* Portland pgcc target processor selection + # --sysroot=* for sysroot support + # -O*, -flto*, -fwhopr*, -fuse-linker-plugin GCC link-time optimization + -64|-mips[0-9]|-r[0-9][0-9]*|-xarch=*|-xtarget=*|+DA*|+DD*|-q*|-m*| \ + -t[45]*|-txscale*|-p|-pg|--coverage|-fprofile-*|-F*|@*|-tp=*|--sysroot=*| \ + -O*|-flto*|-fwhopr*|-fuse-linker-plugin) + func_quote_for_eval "$arg" + arg="$func_quote_for_eval_result" + func_append compile_command " $arg" + func_append finalize_command " $arg" + func_append compiler_flags " $arg" + continue + ;; + + # Some other compiler flag. + -* | +*) + func_quote_for_eval "$arg" + arg="$func_quote_for_eval_result" + ;; + + *.$objext) + # A standard object. + func_append objs " $arg" + ;; + + *.lo) + # A libtool-controlled object. + + # Check to see that this really is a libtool object. + if func_lalib_unsafe_p "$arg"; then + pic_object= + non_pic_object= + + # Read the .lo file + func_source "$arg" + + if test -z "$pic_object" || + test -z "$non_pic_object" || + test "$pic_object" = none && + test "$non_pic_object" = none; then + func_fatal_error "cannot find name of object for \`$arg'" + fi + + # Extract subdirectory from the argument. + func_dirname "$arg" "/" "" + xdir="$func_dirname_result" + + if test "$pic_object" != none; then + # Prepend the subdirectory the object is found in. + pic_object="$xdir$pic_object" + + if test "$prev" = dlfiles; then + if test "$build_libtool_libs" = yes && test "$dlopen_support" = yes; then + func_append dlfiles " $pic_object" + prev= + continue + else + # If libtool objects are unsupported, then we need to preload. + prev=dlprefiles + fi + fi + + # CHECK ME: I think I busted this. -Ossama + if test "$prev" = dlprefiles; then + # Preload the old-style object. + func_append dlprefiles " $pic_object" + prev= + fi + + # A PIC object. + func_append libobjs " $pic_object" + arg="$pic_object" + fi + + # Non-PIC object. + if test "$non_pic_object" != none; then + # Prepend the subdirectory the object is found in. + non_pic_object="$xdir$non_pic_object" + + # A standard non-PIC object + func_append non_pic_objects " $non_pic_object" + if test -z "$pic_object" || test "$pic_object" = none ; then + arg="$non_pic_object" + fi + else + # If the PIC object exists, use it instead. + # $xdir was prepended to $pic_object above. + non_pic_object="$pic_object" + func_append non_pic_objects " $non_pic_object" + fi + else + # Only an error if not doing a dry-run. + if $opt_dry_run; then + # Extract subdirectory from the argument. + func_dirname "$arg" "/" "" + xdir="$func_dirname_result" + + func_lo2o "$arg" + pic_object=$xdir$objdir/$func_lo2o_result + non_pic_object=$xdir$func_lo2o_result + func_append libobjs " $pic_object" + func_append non_pic_objects " $non_pic_object" + else + func_fatal_error "\`$arg' is not a valid libtool object" + fi + fi + ;; + + *.$libext) + # An archive. + func_append deplibs " $arg" + func_append old_deplibs " $arg" + continue + ;; + + *.la) + # A libtool-controlled library. + + func_resolve_sysroot "$arg" + if test "$prev" = dlfiles; then + # This library was specified with -dlopen. + func_append dlfiles " $func_resolve_sysroot_result" + prev= + elif test "$prev" = dlprefiles; then + # The library was specified with -dlpreopen. + func_append dlprefiles " $func_resolve_sysroot_result" + prev= + else + func_append deplibs " $func_resolve_sysroot_result" + fi + continue + ;; + + # Some other compiler argument. + *) + # Unknown arguments in both finalize_command and compile_command need + # to be aesthetically quoted because they are evaled later. + func_quote_for_eval "$arg" + arg="$func_quote_for_eval_result" + ;; + esac # arg + + # Now actually substitute the argument into the commands. + if test -n "$arg"; then + func_append compile_command " $arg" + func_append finalize_command " $arg" + fi + done # argument parsing loop + + test -n "$prev" && \ + func_fatal_help "the \`$prevarg' option requires an argument" + + if test "$export_dynamic" = yes && test -n "$export_dynamic_flag_spec"; then + eval arg=\"$export_dynamic_flag_spec\" + func_append compile_command " $arg" + func_append finalize_command " $arg" + fi + + oldlibs= + # calculate the name of the file, without its directory + func_basename "$output" + outputname="$func_basename_result" + libobjs_save="$libobjs" + + if test -n "$shlibpath_var"; then + # get the directories listed in $shlibpath_var + eval shlib_search_path=\`\$ECHO \"\${$shlibpath_var}\" \| \$SED \'s/:/ /g\'\` + else + shlib_search_path= + fi + eval sys_lib_search_path=\"$sys_lib_search_path_spec\" + eval sys_lib_dlsearch_path=\"$sys_lib_dlsearch_path_spec\" + + func_dirname "$output" "/" "" + output_objdir="$func_dirname_result$objdir" + func_to_tool_file "$output_objdir/" + tool_output_objdir=$func_to_tool_file_result + # Create the object directory. + func_mkdir_p "$output_objdir" + + # Determine the type of output + case $output in + "") + func_fatal_help "you must specify an output file" + ;; + *.$libext) linkmode=oldlib ;; + *.lo | *.$objext) linkmode=obj ;; + *.la) linkmode=lib ;; + *) linkmode=prog ;; # Anything else should be a program. + esac + + specialdeplibs= + + libs= + # Find all interdependent deplibs by searching for libraries + # that are linked more than once (e.g. -la -lb -la) + for deplib in $deplibs; do + if $opt_preserve_dup_deps ; then + case "$libs " in + *" $deplib "*) func_append specialdeplibs " $deplib" ;; + esac + fi + func_append libs " $deplib" + done + + if test "$linkmode" = lib; then + libs="$predeps $libs $compiler_lib_search_path $postdeps" + + # Compute libraries that are listed more than once in $predeps + # $postdeps and mark them as special (i.e., whose duplicates are + # not to be eliminated). + pre_post_deps= + if $opt_duplicate_compiler_generated_deps; then + for pre_post_dep in $predeps $postdeps; do + case "$pre_post_deps " in + *" $pre_post_dep "*) func_append specialdeplibs " $pre_post_deps" ;; + esac + func_append pre_post_deps " $pre_post_dep" + done + fi + pre_post_deps= + fi + + deplibs= + newdependency_libs= + newlib_search_path= + need_relink=no # whether we're linking any uninstalled libtool libraries + notinst_deplibs= # not-installed libtool libraries + notinst_path= # paths that contain not-installed libtool libraries + + case $linkmode in + lib) + passes="conv dlpreopen link" + for file in $dlfiles $dlprefiles; do + case $file in + *.la) ;; + *) + func_fatal_help "libraries can \`-dlopen' only libtool libraries: $file" + ;; + esac + done + ;; + prog) + compile_deplibs= + finalize_deplibs= + alldeplibs=no + newdlfiles= + newdlprefiles= + passes="conv scan dlopen dlpreopen link" + ;; + *) passes="conv" + ;; + esac + + for pass in $passes; do + # The preopen pass in lib mode reverses $deplibs; put it back here + # so that -L comes before libs that need it for instance... + if test "$linkmode,$pass" = "lib,link"; then + ## FIXME: Find the place where the list is rebuilt in the wrong + ## order, and fix it there properly + tmp_deplibs= + for deplib in $deplibs; do + tmp_deplibs="$deplib $tmp_deplibs" + done + deplibs="$tmp_deplibs" + fi + + if test "$linkmode,$pass" = "lib,link" || + test "$linkmode,$pass" = "prog,scan"; then + libs="$deplibs" + deplibs= + fi + if test "$linkmode" = prog; then + case $pass in + dlopen) libs="$dlfiles" ;; + dlpreopen) libs="$dlprefiles" ;; + link) libs="$deplibs %DEPLIBS% $dependency_libs" ;; + esac + fi + if test "$linkmode,$pass" = "lib,dlpreopen"; then + # Collect and forward deplibs of preopened libtool libs + for lib in $dlprefiles; do + # Ignore non-libtool-libs + dependency_libs= + func_resolve_sysroot "$lib" + case $lib in + *.la) func_source "$func_resolve_sysroot_result" ;; + esac + + # Collect preopened libtool deplibs, except any this library + # has declared as weak libs + for deplib in $dependency_libs; do + func_basename "$deplib" + deplib_base=$func_basename_result + case " $weak_libs " in + *" $deplib_base "*) ;; + *) func_append deplibs " $deplib" ;; + esac + done + done + libs="$dlprefiles" + fi + if test "$pass" = dlopen; then + # Collect dlpreopened libraries + save_deplibs="$deplibs" + deplibs= + fi + + for deplib in $libs; do + lib= + found=no + case $deplib in + -mt|-mthreads|-kthread|-Kthread|-pthread|-pthreads|--thread-safe \ + |-threads|-fopenmp|-openmp|-mp|-xopenmp|-omp|-qsmp=*) + if test "$linkmode,$pass" = "prog,link"; then + compile_deplibs="$deplib $compile_deplibs" + finalize_deplibs="$deplib $finalize_deplibs" + else + func_append compiler_flags " $deplib" + if test "$linkmode" = lib ; then + case "$new_inherited_linker_flags " in + *" $deplib "*) ;; + * ) func_append new_inherited_linker_flags " $deplib" ;; + esac + fi + fi + continue + ;; + -l*) + if test "$linkmode" != lib && test "$linkmode" != prog; then + func_warning "\`-l' is ignored for archives/objects" + continue + fi + func_stripname '-l' '' "$deplib" + name=$func_stripname_result + if test "$linkmode" = lib; then + searchdirs="$newlib_search_path $lib_search_path $compiler_lib_search_dirs $sys_lib_search_path $shlib_search_path" + else + searchdirs="$newlib_search_path $lib_search_path $sys_lib_search_path $shlib_search_path" + fi + for searchdir in $searchdirs; do + for search_ext in .la $std_shrext .so .a; do + # Search the libtool library + lib="$searchdir/lib${name}${search_ext}" + if test -f "$lib"; then + if test "$search_ext" = ".la"; then + found=yes + else + found=no + fi + break 2 + fi + done + done + if test "$found" != yes; then + # deplib doesn't seem to be a libtool library + if test "$linkmode,$pass" = "prog,link"; then + compile_deplibs="$deplib $compile_deplibs" + finalize_deplibs="$deplib $finalize_deplibs" + else + deplibs="$deplib $deplibs" + test "$linkmode" = lib && newdependency_libs="$deplib $newdependency_libs" + fi + continue + else # deplib is a libtool library + # If $allow_libtool_libs_with_static_runtimes && $deplib is a stdlib, + # We need to do some special things here, and not later. + if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then + case " $predeps $postdeps " in + *" $deplib "*) + if func_lalib_p "$lib"; then + library_names= + old_library= + func_source "$lib" + for l in $old_library $library_names; do + ll="$l" + done + if test "X$ll" = "X$old_library" ; then # only static version available + found=no + func_dirname "$lib" "" "." + ladir="$func_dirname_result" + lib=$ladir/$old_library + if test "$linkmode,$pass" = "prog,link"; then + compile_deplibs="$deplib $compile_deplibs" + finalize_deplibs="$deplib $finalize_deplibs" + else + deplibs="$deplib $deplibs" + test "$linkmode" = lib && newdependency_libs="$deplib $newdependency_libs" + fi + continue + fi + fi + ;; + *) ;; + esac + fi + fi + ;; # -l + *.ltframework) + if test "$linkmode,$pass" = "prog,link"; then + compile_deplibs="$deplib $compile_deplibs" + finalize_deplibs="$deplib $finalize_deplibs" + else + deplibs="$deplib $deplibs" + if test "$linkmode" = lib ; then + case "$new_inherited_linker_flags " in + *" $deplib "*) ;; + * ) func_append new_inherited_linker_flags " $deplib" ;; + esac + fi + fi + continue + ;; + -L*) + case $linkmode in + lib) + deplibs="$deplib $deplibs" + test "$pass" = conv && continue + newdependency_libs="$deplib $newdependency_libs" + func_stripname '-L' '' "$deplib" + func_resolve_sysroot "$func_stripname_result" + func_append newlib_search_path " $func_resolve_sysroot_result" + ;; + prog) + if test "$pass" = conv; then + deplibs="$deplib $deplibs" + continue + fi + if test "$pass" = scan; then + deplibs="$deplib $deplibs" + else + compile_deplibs="$deplib $compile_deplibs" + finalize_deplibs="$deplib $finalize_deplibs" + fi + func_stripname '-L' '' "$deplib" + func_resolve_sysroot "$func_stripname_result" + func_append newlib_search_path " $func_resolve_sysroot_result" + ;; + *) + func_warning "\`-L' is ignored for archives/objects" + ;; + esac # linkmode + continue + ;; # -L + -R*) + if test "$pass" = link; then + func_stripname '-R' '' "$deplib" + func_resolve_sysroot "$func_stripname_result" + dir=$func_resolve_sysroot_result + # Make sure the xrpath contains only unique directories. + case "$xrpath " in + *" $dir "*) ;; + *) func_append xrpath " $dir" ;; + esac + fi + deplibs="$deplib $deplibs" + continue + ;; + *.la) + func_resolve_sysroot "$deplib" + lib=$func_resolve_sysroot_result + ;; + *.$libext) + if test "$pass" = conv; then + deplibs="$deplib $deplibs" + continue + fi + case $linkmode in + lib) + # Linking convenience modules into shared libraries is allowed, + # but linking other static libraries is non-portable. + case " $dlpreconveniencelibs " in + *" $deplib "*) ;; + *) + valid_a_lib=no + case $deplibs_check_method in + match_pattern*) + set dummy $deplibs_check_method; shift + match_pattern_regex=`expr "$deplibs_check_method" : "$1 \(.*\)"` + if eval "\$ECHO \"$deplib\"" 2>/dev/null | $SED 10q \ + | $EGREP "$match_pattern_regex" > /dev/null; then + valid_a_lib=yes + fi + ;; + pass_all) + valid_a_lib=yes + ;; + esac + if test "$valid_a_lib" != yes; then + echo + $ECHO "*** Warning: Trying to link with static lib archive $deplib." + echo "*** I have the capability to make that library automatically link in when" + echo "*** you link to this library. But I can only do this if you have a" + echo "*** shared version of the library, which you do not appear to have" + echo "*** because the file extensions .$libext of this argument makes me believe" + echo "*** that it is just a static archive that I should not use here." + else + echo + $ECHO "*** Warning: Linking the shared library $output against the" + $ECHO "*** static library $deplib is not portable!" + deplibs="$deplib $deplibs" + fi + ;; + esac + continue + ;; + prog) + if test "$pass" != link; then + deplibs="$deplib $deplibs" + else + compile_deplibs="$deplib $compile_deplibs" + finalize_deplibs="$deplib $finalize_deplibs" + fi + continue + ;; + esac # linkmode + ;; # *.$libext + *.lo | *.$objext) + if test "$pass" = conv; then + deplibs="$deplib $deplibs" + elif test "$linkmode" = prog; then + if test "$pass" = dlpreopen || test "$dlopen_support" != yes || test "$build_libtool_libs" = no; then + # If there is no dlopen support or we're linking statically, + # we need to preload. + func_append newdlprefiles " $deplib" + compile_deplibs="$deplib $compile_deplibs" + finalize_deplibs="$deplib $finalize_deplibs" + else + func_append newdlfiles " $deplib" + fi + fi + continue + ;; + %DEPLIBS%) + alldeplibs=yes + continue + ;; + esac # case $deplib + + if test "$found" = yes || test -f "$lib"; then : + else + func_fatal_error "cannot find the library \`$lib' or unhandled argument \`$deplib'" + fi + + # Check to see that this really is a libtool archive. + func_lalib_unsafe_p "$lib" \ + || func_fatal_error "\`$lib' is not a valid libtool archive" + + func_dirname "$lib" "" "." + ladir="$func_dirname_result" + + dlname= + dlopen= + dlpreopen= + libdir= + library_names= + old_library= + inherited_linker_flags= + # If the library was installed with an old release of libtool, + # it will not redefine variables installed, or shouldnotlink + installed=yes + shouldnotlink=no + avoidtemprpath= + + + # Read the .la file + func_source "$lib" + + # Convert "-framework foo" to "foo.ltframework" + if test -n "$inherited_linker_flags"; then + tmp_inherited_linker_flags=`$ECHO "$inherited_linker_flags" | $SED 's/-framework \([^ $]*\)/\1.ltframework/g'` + for tmp_inherited_linker_flag in $tmp_inherited_linker_flags; do + case " $new_inherited_linker_flags " in + *" $tmp_inherited_linker_flag "*) ;; + *) func_append new_inherited_linker_flags " $tmp_inherited_linker_flag";; + esac + done + fi + dependency_libs=`$ECHO " $dependency_libs" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'` + if test "$linkmode,$pass" = "lib,link" || + test "$linkmode,$pass" = "prog,scan" || + { test "$linkmode" != prog && test "$linkmode" != lib; }; then + test -n "$dlopen" && func_append dlfiles " $dlopen" + test -n "$dlpreopen" && func_append dlprefiles " $dlpreopen" + fi + + if test "$pass" = conv; then + # Only check for convenience libraries + deplibs="$lib $deplibs" + if test -z "$libdir"; then + if test -z "$old_library"; then + func_fatal_error "cannot find name of link library for \`$lib'" + fi + # It is a libtool convenience library, so add in its objects. + func_append convenience " $ladir/$objdir/$old_library" + func_append old_convenience " $ladir/$objdir/$old_library" + elif test "$linkmode" != prog && test "$linkmode" != lib; then + func_fatal_error "\`$lib' is not a convenience library" + fi + tmp_libs= + for deplib in $dependency_libs; do + deplibs="$deplib $deplibs" + if $opt_preserve_dup_deps ; then + case "$tmp_libs " in + *" $deplib "*) func_append specialdeplibs " $deplib" ;; + esac + fi + func_append tmp_libs " $deplib" + done + continue + fi # $pass = conv + + + # Get the name of the library we link against. + linklib= + if test -n "$old_library" && + { test "$prefer_static_libs" = yes || + test "$prefer_static_libs,$installed" = "built,no"; }; then + linklib=$old_library + else + for l in $old_library $library_names; do + linklib="$l" + done + fi + if test -z "$linklib"; then + func_fatal_error "cannot find name of link library for \`$lib'" + fi + + # This library was specified with -dlopen. + if test "$pass" = dlopen; then + if test -z "$libdir"; then + func_fatal_error "cannot -dlopen a convenience library: \`$lib'" + fi + if test -z "$dlname" || + test "$dlopen_support" != yes || + test "$build_libtool_libs" = no; then + # If there is no dlname, no dlopen support or we're linking + # statically, we need to preload. We also need to preload any + # dependent libraries so libltdl's deplib preloader doesn't + # bomb out in the load deplibs phase. + func_append dlprefiles " $lib $dependency_libs" + else + func_append newdlfiles " $lib" + fi + continue + fi # $pass = dlopen + + # We need an absolute path. + case $ladir in + [\\/]* | [A-Za-z]:[\\/]*) abs_ladir="$ladir" ;; + *) + abs_ladir=`cd "$ladir" && pwd` + if test -z "$abs_ladir"; then + func_warning "cannot determine absolute directory name of \`$ladir'" + func_warning "passing it literally to the linker, although it might fail" + abs_ladir="$ladir" + fi + ;; + esac + func_basename "$lib" + laname="$func_basename_result" + + # Find the relevant object directory and library name. + if test "X$installed" = Xyes; then + if test ! -f "$lt_sysroot$libdir/$linklib" && test -f "$abs_ladir/$linklib"; then + func_warning "library \`$lib' was moved." + dir="$ladir" + absdir="$abs_ladir" + libdir="$abs_ladir" + else + dir="$lt_sysroot$libdir" + absdir="$lt_sysroot$libdir" + fi + test "X$hardcode_automatic" = Xyes && avoidtemprpath=yes + else + if test ! -f "$ladir/$objdir/$linklib" && test -f "$abs_ladir/$linklib"; then + dir="$ladir" + absdir="$abs_ladir" + # Remove this search path later + func_append notinst_path " $abs_ladir" + else + dir="$ladir/$objdir" + absdir="$abs_ladir/$objdir" + # Remove this search path later + func_append notinst_path " $abs_ladir" + fi + fi # $installed = yes + func_stripname 'lib' '.la' "$laname" + name=$func_stripname_result + + # This library was specified with -dlpreopen. + if test "$pass" = dlpreopen; then + if test -z "$libdir" && test "$linkmode" = prog; then + func_fatal_error "only libraries may -dlpreopen a convenience library: \`$lib'" + fi + case "$host" in + # special handling for platforms with PE-DLLs. + *cygwin* | *mingw* | *cegcc* ) + # Linker will automatically link against shared library if both + # static and shared are present. Therefore, ensure we extract + # symbols from the import library if a shared library is present + # (otherwise, the dlopen module name will be incorrect). We do + # this by putting the import library name into $newdlprefiles. + # We recover the dlopen module name by 'saving' the la file + # name in a special purpose variable, and (later) extracting the + # dlname from the la file. + if test -n "$dlname"; then + func_tr_sh "$dir/$linklib" + eval "libfile_$func_tr_sh_result=\$abs_ladir/\$laname" + func_append newdlprefiles " $dir/$linklib" + else + func_append newdlprefiles " $dir/$old_library" + # Keep a list of preopened convenience libraries to check + # that they are being used correctly in the link pass. + test -z "$libdir" && \ + func_append dlpreconveniencelibs " $dir/$old_library" + fi + ;; + * ) + # Prefer using a static library (so that no silly _DYNAMIC symbols + # are required to link). + if test -n "$old_library"; then + func_append newdlprefiles " $dir/$old_library" + # Keep a list of preopened convenience libraries to check + # that they are being used correctly in the link pass. + test -z "$libdir" && \ + func_append dlpreconveniencelibs " $dir/$old_library" + # Otherwise, use the dlname, so that lt_dlopen finds it. + elif test -n "$dlname"; then + func_append newdlprefiles " $dir/$dlname" + else + func_append newdlprefiles " $dir/$linklib" + fi + ;; + esac + fi # $pass = dlpreopen + + if test -z "$libdir"; then + # Link the convenience library + if test "$linkmode" = lib; then + deplibs="$dir/$old_library $deplibs" + elif test "$linkmode,$pass" = "prog,link"; then + compile_deplibs="$dir/$old_library $compile_deplibs" + finalize_deplibs="$dir/$old_library $finalize_deplibs" + else + deplibs="$lib $deplibs" # used for prog,scan pass + fi + continue + fi + + + if test "$linkmode" = prog && test "$pass" != link; then + func_append newlib_search_path " $ladir" + deplibs="$lib $deplibs" + + linkalldeplibs=no + if test "$link_all_deplibs" != no || test -z "$library_names" || + test "$build_libtool_libs" = no; then + linkalldeplibs=yes + fi + + tmp_libs= + for deplib in $dependency_libs; do + case $deplib in + -L*) func_stripname '-L' '' "$deplib" + func_resolve_sysroot "$func_stripname_result" + func_append newlib_search_path " $func_resolve_sysroot_result" + ;; + esac + # Need to link against all dependency_libs? + if test "$linkalldeplibs" = yes; then + deplibs="$deplib $deplibs" + else + # Need to hardcode shared library paths + # or/and link against static libraries + newdependency_libs="$deplib $newdependency_libs" + fi + if $opt_preserve_dup_deps ; then + case "$tmp_libs " in + *" $deplib "*) func_append specialdeplibs " $deplib" ;; + esac + fi + func_append tmp_libs " $deplib" + done # for deplib + continue + fi # $linkmode = prog... + + if test "$linkmode,$pass" = "prog,link"; then + if test -n "$library_names" && + { { test "$prefer_static_libs" = no || + test "$prefer_static_libs,$installed" = "built,yes"; } || + test -z "$old_library"; }; then + # We need to hardcode the library path + if test -n "$shlibpath_var" && test -z "$avoidtemprpath" ; then + # Make sure the rpath contains only unique directories. + case "$temp_rpath:" in + *"$absdir:"*) ;; + *) func_append temp_rpath "$absdir:" ;; + esac + fi + + # Hardcode the library path. + # Skip directories that are in the system default run-time + # search path. + case " $sys_lib_dlsearch_path " in + *" $absdir "*) ;; + *) + case "$compile_rpath " in + *" $absdir "*) ;; + *) func_append compile_rpath " $absdir" ;; + esac + ;; + esac + case " $sys_lib_dlsearch_path " in + *" $libdir "*) ;; + *) + case "$finalize_rpath " in + *" $libdir "*) ;; + *) func_append finalize_rpath " $libdir" ;; + esac + ;; + esac + fi # $linkmode,$pass = prog,link... + + if test "$alldeplibs" = yes && + { test "$deplibs_check_method" = pass_all || + { test "$build_libtool_libs" = yes && + test -n "$library_names"; }; }; then + # We only need to search for static libraries + continue + fi + fi + + link_static=no # Whether the deplib will be linked statically + use_static_libs=$prefer_static_libs + if test "$use_static_libs" = built && test "$installed" = yes; then + use_static_libs=no + fi + if test -n "$library_names" && + { test "$use_static_libs" = no || test -z "$old_library"; }; then + case $host in + *cygwin* | *mingw* | *cegcc*) + # No point in relinking DLLs because paths are not encoded + func_append notinst_deplibs " $lib" + need_relink=no + ;; + *) + if test "$installed" = no; then + func_append notinst_deplibs " $lib" + need_relink=yes + fi + ;; + esac + # This is a shared library + + # Warn about portability, can't link against -module's on some + # systems (darwin). Don't bleat about dlopened modules though! + dlopenmodule="" + for dlpremoduletest in $dlprefiles; do + if test "X$dlpremoduletest" = "X$lib"; then + dlopenmodule="$dlpremoduletest" + break + fi + done + if test -z "$dlopenmodule" && test "$shouldnotlink" = yes && test "$pass" = link; then + echo + if test "$linkmode" = prog; then + $ECHO "*** Warning: Linking the executable $output against the loadable module" + else + $ECHO "*** Warning: Linking the shared library $output against the loadable module" + fi + $ECHO "*** $linklib is not portable!" + fi + if test "$linkmode" = lib && + test "$hardcode_into_libs" = yes; then + # Hardcode the library path. + # Skip directories that are in the system default run-time + # search path. + case " $sys_lib_dlsearch_path " in + *" $absdir "*) ;; + *) + case "$compile_rpath " in + *" $absdir "*) ;; + *) func_append compile_rpath " $absdir" ;; + esac + ;; + esac + case " $sys_lib_dlsearch_path " in + *" $libdir "*) ;; + *) + case "$finalize_rpath " in + *" $libdir "*) ;; + *) func_append finalize_rpath " $libdir" ;; + esac + ;; + esac + fi + + if test -n "$old_archive_from_expsyms_cmds"; then + # figure out the soname + set dummy $library_names + shift + realname="$1" + shift + libname=`eval "\\$ECHO \"$libname_spec\""` + # use dlname if we got it. it's perfectly good, no? + if test -n "$dlname"; then + soname="$dlname" + elif test -n "$soname_spec"; then + # bleh windows + case $host in + *cygwin* | mingw* | *cegcc*) + func_arith $current - $age + major=$func_arith_result + versuffix="-$major" + ;; + esac + eval soname=\"$soname_spec\" + else + soname="$realname" + fi + + # Make a new name for the extract_expsyms_cmds to use + soroot="$soname" + func_basename "$soroot" + soname="$func_basename_result" + func_stripname 'lib' '.dll' "$soname" + newlib=libimp-$func_stripname_result.a + + # If the library has no export list, then create one now + if test -f "$output_objdir/$soname-def"; then : + else + func_verbose "extracting exported symbol list from \`$soname'" + func_execute_cmds "$extract_expsyms_cmds" 'exit $?' + fi + + # Create $newlib + if test -f "$output_objdir/$newlib"; then :; else + func_verbose "generating import library for \`$soname'" + func_execute_cmds "$old_archive_from_expsyms_cmds" 'exit $?' + fi + # make sure the library variables are pointing to the new library + dir=$output_objdir + linklib=$newlib + fi # test -n "$old_archive_from_expsyms_cmds" + + if test "$linkmode" = prog || test "$opt_mode" != relink; then + add_shlibpath= + add_dir= + add= + lib_linked=yes + case $hardcode_action in + immediate | unsupported) + if test "$hardcode_direct" = no; then + add="$dir/$linklib" + case $host in + *-*-sco3.2v5.0.[024]*) add_dir="-L$dir" ;; + *-*-sysv4*uw2*) add_dir="-L$dir" ;; + *-*-sysv5OpenUNIX* | *-*-sysv5UnixWare7.[01].[10]* | \ + *-*-unixware7*) add_dir="-L$dir" ;; + *-*-darwin* ) + # if the lib is a (non-dlopened) module then we can not + # link against it, someone is ignoring the earlier warnings + if /usr/bin/file -L $add 2> /dev/null | + $GREP ": [^:]* bundle" >/dev/null ; then + if test "X$dlopenmodule" != "X$lib"; then + $ECHO "*** Warning: lib $linklib is a module, not a shared library" + if test -z "$old_library" ; then + echo + echo "*** And there doesn't seem to be a static archive available" + echo "*** The link will probably fail, sorry" + else + add="$dir/$old_library" + fi + elif test -n "$old_library"; then + add="$dir/$old_library" + fi + fi + esac + elif test "$hardcode_minus_L" = no; then + case $host in + *-*-sunos*) add_shlibpath="$dir" ;; + esac + add_dir="-L$dir" + add="-l$name" + elif test "$hardcode_shlibpath_var" = no; then + add_shlibpath="$dir" + add="-l$name" + else + lib_linked=no + fi + ;; + relink) + if test "$hardcode_direct" = yes && + test "$hardcode_direct_absolute" = no; then + add="$dir/$linklib" + elif test "$hardcode_minus_L" = yes; then + add_dir="-L$absdir" + # Try looking first in the location we're being installed to. + if test -n "$inst_prefix_dir"; then + case $libdir in + [\\/]*) + func_append add_dir " -L$inst_prefix_dir$libdir" + ;; + esac + fi + add="-l$name" + elif test "$hardcode_shlibpath_var" = yes; then + add_shlibpath="$dir" + add="-l$name" + else + lib_linked=no + fi + ;; + *) lib_linked=no ;; + esac + + if test "$lib_linked" != yes; then + func_fatal_configuration "unsupported hardcode properties" + fi + + if test -n "$add_shlibpath"; then + case :$compile_shlibpath: in + *":$add_shlibpath:"*) ;; + *) func_append compile_shlibpath "$add_shlibpath:" ;; + esac + fi + if test "$linkmode" = prog; then + test -n "$add_dir" && compile_deplibs="$add_dir $compile_deplibs" + test -n "$add" && compile_deplibs="$add $compile_deplibs" + else + test -n "$add_dir" && deplibs="$add_dir $deplibs" + test -n "$add" && deplibs="$add $deplibs" + if test "$hardcode_direct" != yes && + test "$hardcode_minus_L" != yes && + test "$hardcode_shlibpath_var" = yes; then + case :$finalize_shlibpath: in + *":$libdir:"*) ;; + *) func_append finalize_shlibpath "$libdir:" ;; + esac + fi + fi + fi + + if test "$linkmode" = prog || test "$opt_mode" = relink; then + add_shlibpath= + add_dir= + add= + # Finalize command for both is simple: just hardcode it. + if test "$hardcode_direct" = yes && + test "$hardcode_direct_absolute" = no; then + add="$libdir/$linklib" + elif test "$hardcode_minus_L" = yes; then + add_dir="-L$libdir" + add="-l$name" + elif test "$hardcode_shlibpath_var" = yes; then + case :$finalize_shlibpath: in + *":$libdir:"*) ;; + *) func_append finalize_shlibpath "$libdir:" ;; + esac + add="-l$name" + elif test "$hardcode_automatic" = yes; then + if test -n "$inst_prefix_dir" && + test -f "$inst_prefix_dir$libdir/$linklib" ; then + add="$inst_prefix_dir$libdir/$linklib" + else + add="$libdir/$linklib" + fi + else + # We cannot seem to hardcode it, guess we'll fake it. + add_dir="-L$libdir" + # Try looking first in the location we're being installed to. + if test -n "$inst_prefix_dir"; then + case $libdir in + [\\/]*) + func_append add_dir " -L$inst_prefix_dir$libdir" + ;; + esac + fi + add="-l$name" + fi + + if test "$linkmode" = prog; then + test -n "$add_dir" && finalize_deplibs="$add_dir $finalize_deplibs" + test -n "$add" && finalize_deplibs="$add $finalize_deplibs" + else + test -n "$add_dir" && deplibs="$add_dir $deplibs" + test -n "$add" && deplibs="$add $deplibs" + fi + fi + elif test "$linkmode" = prog; then + # Here we assume that one of hardcode_direct or hardcode_minus_L + # is not unsupported. This is valid on all known static and + # shared platforms. + if test "$hardcode_direct" != unsupported; then + test -n "$old_library" && linklib="$old_library" + compile_deplibs="$dir/$linklib $compile_deplibs" + finalize_deplibs="$dir/$linklib $finalize_deplibs" + else + compile_deplibs="-l$name -L$dir $compile_deplibs" + finalize_deplibs="-l$name -L$dir $finalize_deplibs" + fi + elif test "$build_libtool_libs" = yes; then + # Not a shared library + if test "$deplibs_check_method" != pass_all; then + # We're trying link a shared library against a static one + # but the system doesn't support it. + + # Just print a warning and add the library to dependency_libs so + # that the program can be linked against the static library. + echo + $ECHO "*** Warning: This system can not link to static lib archive $lib." + echo "*** I have the capability to make that library automatically link in when" + echo "*** you link to this library. But I can only do this if you have a" + echo "*** shared version of the library, which you do not appear to have." + if test "$module" = yes; then + echo "*** But as you try to build a module library, libtool will still create " + echo "*** a static module, that should work as long as the dlopening application" + echo "*** is linked with the -dlopen flag to resolve symbols at runtime." + if test -z "$global_symbol_pipe"; then + echo + echo "*** However, this would only work if libtool was able to extract symbol" + echo "*** lists from a program, using \`nm' or equivalent, but libtool could" + echo "*** not find such a program. So, this module is probably useless." + echo "*** \`nm' from GNU binutils and a full rebuild may help." + fi + if test "$build_old_libs" = no; then + build_libtool_libs=module + build_old_libs=yes + else + build_libtool_libs=no + fi + fi + else + deplibs="$dir/$old_library $deplibs" + link_static=yes + fi + fi # link shared/static library? + + if test "$linkmode" = lib; then + if test -n "$dependency_libs" && + { test "$hardcode_into_libs" != yes || + test "$build_old_libs" = yes || + test "$link_static" = yes; }; then + # Extract -R from dependency_libs + temp_deplibs= + for libdir in $dependency_libs; do + case $libdir in + -R*) func_stripname '-R' '' "$libdir" + temp_xrpath=$func_stripname_result + case " $xrpath " in + *" $temp_xrpath "*) ;; + *) func_append xrpath " $temp_xrpath";; + esac;; + *) func_append temp_deplibs " $libdir";; + esac + done + dependency_libs="$temp_deplibs" + fi + + func_append newlib_search_path " $absdir" + # Link against this library + test "$link_static" = no && newdependency_libs="$abs_ladir/$laname $newdependency_libs" + # ... and its dependency_libs + tmp_libs= + for deplib in $dependency_libs; do + newdependency_libs="$deplib $newdependency_libs" + case $deplib in + -L*) func_stripname '-L' '' "$deplib" + func_resolve_sysroot "$func_stripname_result";; + *) func_resolve_sysroot "$deplib" ;; + esac + if $opt_preserve_dup_deps ; then + case "$tmp_libs " in + *" $func_resolve_sysroot_result "*) + func_append specialdeplibs " $func_resolve_sysroot_result" ;; + esac + fi + func_append tmp_libs " $func_resolve_sysroot_result" + done + + if test "$link_all_deplibs" != no; then + # Add the search paths of all dependency libraries + for deplib in $dependency_libs; do + path= + case $deplib in + -L*) path="$deplib" ;; + *.la) + func_resolve_sysroot "$deplib" + deplib=$func_resolve_sysroot_result + func_dirname "$deplib" "" "." + dir=$func_dirname_result + # We need an absolute path. + case $dir in + [\\/]* | [A-Za-z]:[\\/]*) absdir="$dir" ;; + *) + absdir=`cd "$dir" && pwd` + if test -z "$absdir"; then + func_warning "cannot determine absolute directory name of \`$dir'" + absdir="$dir" + fi + ;; + esac + if $GREP "^installed=no" $deplib > /dev/null; then + case $host in + *-*-darwin*) + depdepl= + eval deplibrary_names=`${SED} -n -e 's/^library_names=\(.*\)$/\1/p' $deplib` + if test -n "$deplibrary_names" ; then + for tmp in $deplibrary_names ; do + depdepl=$tmp + done + if test -f "$absdir/$objdir/$depdepl" ; then + depdepl="$absdir/$objdir/$depdepl" + darwin_install_name=`${OTOOL} -L $depdepl | awk '{if (NR == 2) {print $1;exit}}'` + if test -z "$darwin_install_name"; then + darwin_install_name=`${OTOOL64} -L $depdepl | awk '{if (NR == 2) {print $1;exit}}'` + fi + func_append compiler_flags " ${wl}-dylib_file ${wl}${darwin_install_name}:${depdepl}" + func_append linker_flags " -dylib_file ${darwin_install_name}:${depdepl}" + path= + fi + fi + ;; + *) + path="-L$absdir/$objdir" + ;; + esac + else + eval libdir=`${SED} -n -e 's/^libdir=\(.*\)$/\1/p' $deplib` + test -z "$libdir" && \ + func_fatal_error "\`$deplib' is not a valid libtool archive" + test "$absdir" != "$libdir" && \ + func_warning "\`$deplib' seems to be moved" + + path="-L$absdir" + fi + ;; + esac + case " $deplibs " in + *" $path "*) ;; + *) deplibs="$path $deplibs" ;; + esac + done + fi # link_all_deplibs != no + fi # linkmode = lib + done # for deplib in $libs + if test "$pass" = link; then + if test "$linkmode" = "prog"; then + compile_deplibs="$new_inherited_linker_flags $compile_deplibs" + finalize_deplibs="$new_inherited_linker_flags $finalize_deplibs" + else + compiler_flags="$compiler_flags "`$ECHO " $new_inherited_linker_flags" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'` + fi + fi + dependency_libs="$newdependency_libs" + if test "$pass" = dlpreopen; then + # Link the dlpreopened libraries before other libraries + for deplib in $save_deplibs; do + deplibs="$deplib $deplibs" + done + fi + if test "$pass" != dlopen; then + if test "$pass" != conv; then + # Make sure lib_search_path contains only unique directories. + lib_search_path= + for dir in $newlib_search_path; do + case "$lib_search_path " in + *" $dir "*) ;; + *) func_append lib_search_path " $dir" ;; + esac + done + newlib_search_path= + fi + + if test "$linkmode,$pass" != "prog,link"; then + vars="deplibs" + else + vars="compile_deplibs finalize_deplibs" + fi + for var in $vars dependency_libs; do + # Add libraries to $var in reverse order + eval tmp_libs=\"\$$var\" + new_libs= + for deplib in $tmp_libs; do + # FIXME: Pedantically, this is the right thing to do, so + # that some nasty dependency loop isn't accidentally + # broken: + #new_libs="$deplib $new_libs" + # Pragmatically, this seems to cause very few problems in + # practice: + case $deplib in + -L*) new_libs="$deplib $new_libs" ;; + -R*) ;; + *) + # And here is the reason: when a library appears more + # than once as an explicit dependence of a library, or + # is implicitly linked in more than once by the + # compiler, it is considered special, and multiple + # occurrences thereof are not removed. Compare this + # with having the same library being listed as a + # dependency of multiple other libraries: in this case, + # we know (pedantically, we assume) the library does not + # need to be listed more than once, so we keep only the + # last copy. This is not always right, but it is rare + # enough that we require users that really mean to play + # such unportable linking tricks to link the library + # using -Wl,-lname, so that libtool does not consider it + # for duplicate removal. + case " $specialdeplibs " in + *" $deplib "*) new_libs="$deplib $new_libs" ;; + *) + case " $new_libs " in + *" $deplib "*) ;; + *) new_libs="$deplib $new_libs" ;; + esac + ;; + esac + ;; + esac + done + tmp_libs= + for deplib in $new_libs; do + case $deplib in + -L*) + case " $tmp_libs " in + *" $deplib "*) ;; + *) func_append tmp_libs " $deplib" ;; + esac + ;; + *) func_append tmp_libs " $deplib" ;; + esac + done + eval $var=\"$tmp_libs\" + done # for var + fi + # Last step: remove runtime libs from dependency_libs + # (they stay in deplibs) + tmp_libs= + for i in $dependency_libs ; do + case " $predeps $postdeps $compiler_lib_search_path " in + *" $i "*) + i="" + ;; + esac + if test -n "$i" ; then + func_append tmp_libs " $i" + fi + done + dependency_libs=$tmp_libs + done # for pass + if test "$linkmode" = prog; then + dlfiles="$newdlfiles" + fi + if test "$linkmode" = prog || test "$linkmode" = lib; then + dlprefiles="$newdlprefiles" + fi + + case $linkmode in + oldlib) + if test -n "$dlfiles$dlprefiles" || test "$dlself" != no; then + func_warning "\`-dlopen' is ignored for archives" + fi + + case " $deplibs" in + *\ -l* | *\ -L*) + func_warning "\`-l' and \`-L' are ignored for archives" ;; + esac + + test -n "$rpath" && \ + func_warning "\`-rpath' is ignored for archives" + + test -n "$xrpath" && \ + func_warning "\`-R' is ignored for archives" + + test -n "$vinfo" && \ + func_warning "\`-version-info/-version-number' is ignored for archives" + + test -n "$release" && \ + func_warning "\`-release' is ignored for archives" + + test -n "$export_symbols$export_symbols_regex" && \ + func_warning "\`-export-symbols' is ignored for archives" + + # Now set the variables for building old libraries. + build_libtool_libs=no + oldlibs="$output" + func_append objs "$old_deplibs" + ;; + + lib) + # Make sure we only generate libraries of the form `libNAME.la'. + case $outputname in + lib*) + func_stripname 'lib' '.la' "$outputname" + name=$func_stripname_result + eval shared_ext=\"$shrext_cmds\" + eval libname=\"$libname_spec\" + ;; + *) + test "$module" = no && \ + func_fatal_help "libtool library \`$output' must begin with \`lib'" + + if test "$need_lib_prefix" != no; then + # Add the "lib" prefix for modules if required + func_stripname '' '.la' "$outputname" + name=$func_stripname_result + eval shared_ext=\"$shrext_cmds\" + eval libname=\"$libname_spec\" + else + func_stripname '' '.la' "$outputname" + libname=$func_stripname_result + fi + ;; + esac + + if test -n "$objs"; then + if test "$deplibs_check_method" != pass_all; then + func_fatal_error "cannot build libtool library \`$output' from non-libtool objects on this host:$objs" + else + echo + $ECHO "*** Warning: Linking the shared library $output against the non-libtool" + $ECHO "*** objects $objs is not portable!" + func_append libobjs " $objs" + fi + fi + + test "$dlself" != no && \ + func_warning "\`-dlopen self' is ignored for libtool libraries" + + set dummy $rpath + shift + test "$#" -gt 1 && \ + func_warning "ignoring multiple \`-rpath's for a libtool library" + + install_libdir="$1" + + oldlibs= + if test -z "$rpath"; then + if test "$build_libtool_libs" = yes; then + # Building a libtool convenience library. + # Some compilers have problems with a `.al' extension so + # convenience libraries should have the same extension an + # archive normally would. + oldlibs="$output_objdir/$libname.$libext $oldlibs" + build_libtool_libs=convenience + build_old_libs=yes + fi + + test -n "$vinfo" && \ + func_warning "\`-version-info/-version-number' is ignored for convenience libraries" + + test -n "$release" && \ + func_warning "\`-release' is ignored for convenience libraries" + else + + # Parse the version information argument. + save_ifs="$IFS"; IFS=':' + set dummy $vinfo 0 0 0 + shift + IFS="$save_ifs" + + test -n "$7" && \ + func_fatal_help "too many parameters to \`-version-info'" + + # convert absolute version numbers to libtool ages + # this retains compatibility with .la files and attempts + # to make the code below a bit more comprehensible + + case $vinfo_number in + yes) + number_major="$1" + number_minor="$2" + number_revision="$3" + # + # There are really only two kinds -- those that + # use the current revision as the major version + # and those that subtract age and use age as + # a minor version. But, then there is irix + # which has an extra 1 added just for fun + # + case $version_type in + # correct linux to gnu/linux during the next big refactor + darwin|linux|osf|windows|none) + func_arith $number_major + $number_minor + current=$func_arith_result + age="$number_minor" + revision="$number_revision" + ;; + freebsd-aout|freebsd-elf|qnx|sunos) + current="$number_major" + revision="$number_minor" + age="0" + ;; + irix|nonstopux) + func_arith $number_major + $number_minor + current=$func_arith_result + age="$number_minor" + revision="$number_minor" + lt_irix_increment=no + ;; + esac + ;; + no) + current="$1" + revision="$2" + age="$3" + ;; + esac + + # Check that each of the things are valid numbers. + case $current in + 0|[1-9]|[1-9][0-9]|[1-9][0-9][0-9]|[1-9][0-9][0-9][0-9]|[1-9][0-9][0-9][0-9][0-9]) ;; + *) + func_error "CURRENT \`$current' must be a nonnegative integer" + func_fatal_error "\`$vinfo' is not valid version information" + ;; + esac + + case $revision in + 0|[1-9]|[1-9][0-9]|[1-9][0-9][0-9]|[1-9][0-9][0-9][0-9]|[1-9][0-9][0-9][0-9][0-9]) ;; + *) + func_error "REVISION \`$revision' must be a nonnegative integer" + func_fatal_error "\`$vinfo' is not valid version information" + ;; + esac + + case $age in + 0|[1-9]|[1-9][0-9]|[1-9][0-9][0-9]|[1-9][0-9][0-9][0-9]|[1-9][0-9][0-9][0-9][0-9]) ;; + *) + func_error "AGE \`$age' must be a nonnegative integer" + func_fatal_error "\`$vinfo' is not valid version information" + ;; + esac + + if test "$age" -gt "$current"; then + func_error "AGE \`$age' is greater than the current interface number \`$current'" + func_fatal_error "\`$vinfo' is not valid version information" + fi + + # Calculate the version variables. + major= + versuffix= + verstring= + case $version_type in + none) ;; + + darwin) + # Like Linux, but with the current version available in + # verstring for coding it into the library header + func_arith $current - $age + major=.$func_arith_result + versuffix="$major.$age.$revision" + # Darwin ld doesn't like 0 for these options... + func_arith $current + 1 + minor_current=$func_arith_result + xlcverstring="${wl}-compatibility_version ${wl}$minor_current ${wl}-current_version ${wl}$minor_current.$revision" + verstring="-compatibility_version $minor_current -current_version $minor_current.$revision" + ;; + + freebsd-aout) + major=".$current" + versuffix=".$current.$revision"; + ;; + + freebsd-elf) + major=".$current" + versuffix=".$current" + ;; + + irix | nonstopux) + if test "X$lt_irix_increment" = "Xno"; then + func_arith $current - $age + else + func_arith $current - $age + 1 + fi + major=$func_arith_result + + case $version_type in + nonstopux) verstring_prefix=nonstopux ;; + *) verstring_prefix=sgi ;; + esac + verstring="$verstring_prefix$major.$revision" + + # Add in all the interfaces that we are compatible with. + loop=$revision + while test "$loop" -ne 0; do + func_arith $revision - $loop + iface=$func_arith_result + func_arith $loop - 1 + loop=$func_arith_result + verstring="$verstring_prefix$major.$iface:$verstring" + done + + # Before this point, $major must not contain `.'. + major=.$major + versuffix="$major.$revision" + ;; + + linux) # correct to gnu/linux during the next big refactor + func_arith $current - $age + major=.$func_arith_result + versuffix="$major.$age.$revision" + ;; + + osf) + func_arith $current - $age + major=.$func_arith_result + versuffix=".$current.$age.$revision" + verstring="$current.$age.$revision" + + # Add in all the interfaces that we are compatible with. + loop=$age + while test "$loop" -ne 0; do + func_arith $current - $loop + iface=$func_arith_result + func_arith $loop - 1 + loop=$func_arith_result + verstring="$verstring:${iface}.0" + done + + # Make executables depend on our current version. + func_append verstring ":${current}.0" + ;; + + qnx) + major=".$current" + versuffix=".$current" + ;; + + sunos) + major=".$current" + versuffix=".$current.$revision" + ;; + + windows) + # Use '-' rather than '.', since we only want one + # extension on DOS 8.3 filesystems. + func_arith $current - $age + major=$func_arith_result + versuffix="-$major" + ;; + + *) + func_fatal_configuration "unknown library version type \`$version_type'" + ;; + esac + + # Clear the version info if we defaulted, and they specified a release. + if test -z "$vinfo" && test -n "$release"; then + major= + case $version_type in + darwin) + # we can't check for "0.0" in archive_cmds due to quoting + # problems, so we reset it completely + verstring= + ;; + *) + verstring="0.0" + ;; + esac + if test "$need_version" = no; then + versuffix= + else + versuffix=".0.0" + fi + fi + + # Remove version info from name if versioning should be avoided + if test "$avoid_version" = yes && test "$need_version" = no; then + major= + versuffix= + verstring="" + fi + + # Check to see if the archive will have undefined symbols. + if test "$allow_undefined" = yes; then + if test "$allow_undefined_flag" = unsupported; then + func_warning "undefined symbols not allowed in $host shared libraries" + build_libtool_libs=no + build_old_libs=yes + fi + else + # Don't allow undefined symbols. + allow_undefined_flag="$no_undefined_flag" + fi + + fi + + func_generate_dlsyms "$libname" "$libname" "yes" + func_append libobjs " $symfileobj" + test "X$libobjs" = "X " && libobjs= + + if test "$opt_mode" != relink; then + # Remove our outputs, but don't remove object files since they + # may have been created when compiling PIC objects. + removelist= + tempremovelist=`$ECHO "$output_objdir/*"` + for p in $tempremovelist; do + case $p in + *.$objext | *.gcno) + ;; + $output_objdir/$outputname | $output_objdir/$libname.* | $output_objdir/${libname}${release}.*) + if test "X$precious_files_regex" != "X"; then + if $ECHO "$p" | $EGREP -e "$precious_files_regex" >/dev/null 2>&1 + then + continue + fi + fi + func_append removelist " $p" + ;; + *) ;; + esac + done + test -n "$removelist" && \ + func_show_eval "${RM}r \$removelist" + fi + + # Now set the variables for building old libraries. + if test "$build_old_libs" = yes && test "$build_libtool_libs" != convenience ; then + func_append oldlibs " $output_objdir/$libname.$libext" + + # Transform .lo files to .o files. + oldobjs="$objs "`$ECHO "$libobjs" | $SP2NL | $SED "/\.${libext}$/d; $lo2o" | $NL2SP` + fi + + # Eliminate all temporary directories. + #for path in $notinst_path; do + # lib_search_path=`$ECHO "$lib_search_path " | $SED "s% $path % %g"` + # deplibs=`$ECHO "$deplibs " | $SED "s% -L$path % %g"` + # dependency_libs=`$ECHO "$dependency_libs " | $SED "s% -L$path % %g"` + #done + + if test -n "$xrpath"; then + # If the user specified any rpath flags, then add them. + temp_xrpath= + for libdir in $xrpath; do + func_replace_sysroot "$libdir" + func_append temp_xrpath " -R$func_replace_sysroot_result" + case "$finalize_rpath " in + *" $libdir "*) ;; + *) func_append finalize_rpath " $libdir" ;; + esac + done + if test "$hardcode_into_libs" != yes || test "$build_old_libs" = yes; then + dependency_libs="$temp_xrpath $dependency_libs" + fi + fi + + # Make sure dlfiles contains only unique files that won't be dlpreopened + old_dlfiles="$dlfiles" + dlfiles= + for lib in $old_dlfiles; do + case " $dlprefiles $dlfiles " in + *" $lib "*) ;; + *) func_append dlfiles " $lib" ;; + esac + done + + # Make sure dlprefiles contains only unique files + old_dlprefiles="$dlprefiles" + dlprefiles= + for lib in $old_dlprefiles; do + case "$dlprefiles " in + *" $lib "*) ;; + *) func_append dlprefiles " $lib" ;; + esac + done + + if test "$build_libtool_libs" = yes; then + if test -n "$rpath"; then + case $host in + *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2* | *-*-beos* | *-cegcc* | *-*-haiku*) + # these systems don't actually have a c library (as such)! + ;; + *-*-rhapsody* | *-*-darwin1.[012]) + # Rhapsody C library is in the System framework + func_append deplibs " System.ltframework" + ;; + *-*-netbsd*) + # Don't link with libc until the a.out ld.so is fixed. + ;; + *-*-openbsd* | *-*-freebsd* | *-*-dragonfly*) + # Do not include libc due to us having libc/libc_r. + ;; + *-*-sco3.2v5* | *-*-sco5v6*) + # Causes problems with __ctype + ;; + *-*-sysv4.2uw2* | *-*-sysv5* | *-*-unixware* | *-*-OpenUNIX*) + # Compiler inserts libc in the correct place for threads to work + ;; + *) + # Add libc to deplibs on all other systems if necessary. + if test "$build_libtool_need_lc" = "yes"; then + func_append deplibs " -lc" + fi + ;; + esac + fi + + # Transform deplibs into only deplibs that can be linked in shared. + name_save=$name + libname_save=$libname + release_save=$release + versuffix_save=$versuffix + major_save=$major + # I'm not sure if I'm treating the release correctly. I think + # release should show up in the -l (ie -lgmp5) so we don't want to + # add it in twice. Is that correct? + release="" + versuffix="" + major="" + newdeplibs= + droppeddeps=no + case $deplibs_check_method in + pass_all) + # Don't check for shared/static. Everything works. + # This might be a little naive. We might want to check + # whether the library exists or not. But this is on + # osf3 & osf4 and I'm not really sure... Just + # implementing what was already the behavior. + newdeplibs=$deplibs + ;; + test_compile) + # This code stresses the "libraries are programs" paradigm to its + # limits. Maybe even breaks it. We compile a program, linking it + # against the deplibs as a proxy for the library. Then we can check + # whether they linked in statically or dynamically with ldd. + $opt_dry_run || $RM conftest.c + cat > conftest.c </dev/null` + $nocaseglob + else + potential_libs=`ls $i/$libnameglob[.-]* 2>/dev/null` + fi + for potent_lib in $potential_libs; do + # Follow soft links. + if ls -lLd "$potent_lib" 2>/dev/null | + $GREP " -> " >/dev/null; then + continue + fi + # The statement above tries to avoid entering an + # endless loop below, in case of cyclic links. + # We might still enter an endless loop, since a link + # loop can be closed while we follow links, + # but so what? + potlib="$potent_lib" + while test -h "$potlib" 2>/dev/null; do + potliblink=`ls -ld $potlib | ${SED} 's/.* -> //'` + case $potliblink in + [\\/]* | [A-Za-z]:[\\/]*) potlib="$potliblink";; + *) potlib=`$ECHO "$potlib" | $SED 's,[^/]*$,,'`"$potliblink";; + esac + done + if eval $file_magic_cmd \"\$potlib\" 2>/dev/null | + $SED -e 10q | + $EGREP "$file_magic_regex" > /dev/null; then + func_append newdeplibs " $a_deplib" + a_deplib="" + break 2 + fi + done + done + fi + if test -n "$a_deplib" ; then + droppeddeps=yes + echo + $ECHO "*** Warning: linker path does not have real file for library $a_deplib." + echo "*** I have the capability to make that library automatically link in when" + echo "*** you link to this library. But I can only do this if you have a" + echo "*** shared version of the library, which you do not appear to have" + echo "*** because I did check the linker path looking for a file starting" + if test -z "$potlib" ; then + $ECHO "*** with $libname but no candidates were found. (...for file magic test)" + else + $ECHO "*** with $libname and none of the candidates passed a file format test" + $ECHO "*** using a file magic. Last file checked: $potlib" + fi + fi + ;; + *) + # Add a -L argument. + func_append newdeplibs " $a_deplib" + ;; + esac + done # Gone through all deplibs. + ;; + match_pattern*) + set dummy $deplibs_check_method; shift + match_pattern_regex=`expr "$deplibs_check_method" : "$1 \(.*\)"` + for a_deplib in $deplibs; do + case $a_deplib in + -l*) + func_stripname -l '' "$a_deplib" + name=$func_stripname_result + if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then + case " $predeps $postdeps " in + *" $a_deplib "*) + func_append newdeplibs " $a_deplib" + a_deplib="" + ;; + esac + fi + if test -n "$a_deplib" ; then + libname=`eval "\\$ECHO \"$libname_spec\""` + for i in $lib_search_path $sys_lib_search_path $shlib_search_path; do + potential_libs=`ls $i/$libname[.-]* 2>/dev/null` + for potent_lib in $potential_libs; do + potlib="$potent_lib" # see symlink-check above in file_magic test + if eval "\$ECHO \"$potent_lib\"" 2>/dev/null | $SED 10q | \ + $EGREP "$match_pattern_regex" > /dev/null; then + func_append newdeplibs " $a_deplib" + a_deplib="" + break 2 + fi + done + done + fi + if test -n "$a_deplib" ; then + droppeddeps=yes + echo + $ECHO "*** Warning: linker path does not have real file for library $a_deplib." + echo "*** I have the capability to make that library automatically link in when" + echo "*** you link to this library. But I can only do this if you have a" + echo "*** shared version of the library, which you do not appear to have" + echo "*** because I did check the linker path looking for a file starting" + if test -z "$potlib" ; then + $ECHO "*** with $libname but no candidates were found. (...for regex pattern test)" + else + $ECHO "*** with $libname and none of the candidates passed a file format test" + $ECHO "*** using a regex pattern. Last file checked: $potlib" + fi + fi + ;; + *) + # Add a -L argument. + func_append newdeplibs " $a_deplib" + ;; + esac + done # Gone through all deplibs. + ;; + none | unknown | *) + newdeplibs="" + tmp_deplibs=`$ECHO " $deplibs" | $SED 's/ -lc$//; s/ -[LR][^ ]*//g'` + if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then + for i in $predeps $postdeps ; do + # can't use Xsed below, because $i might contain '/' + tmp_deplibs=`$ECHO " $tmp_deplibs" | $SED "s,$i,,"` + done + fi + case $tmp_deplibs in + *[!\ \ ]*) + echo + if test "X$deplibs_check_method" = "Xnone"; then + echo "*** Warning: inter-library dependencies are not supported in this platform." + else + echo "*** Warning: inter-library dependencies are not known to be supported." + fi + echo "*** All declared inter-library dependencies are being dropped." + droppeddeps=yes + ;; + esac + ;; + esac + versuffix=$versuffix_save + major=$major_save + release=$release_save + libname=$libname_save + name=$name_save + + case $host in + *-*-rhapsody* | *-*-darwin1.[012]) + # On Rhapsody replace the C library with the System framework + newdeplibs=`$ECHO " $newdeplibs" | $SED 's/ -lc / System.ltframework /'` + ;; + esac + + if test "$droppeddeps" = yes; then + if test "$module" = yes; then + echo + echo "*** Warning: libtool could not satisfy all declared inter-library" + $ECHO "*** dependencies of module $libname. Therefore, libtool will create" + echo "*** a static module, that should work as long as the dlopening" + echo "*** application is linked with the -dlopen flag." + if test -z "$global_symbol_pipe"; then + echo + echo "*** However, this would only work if libtool was able to extract symbol" + echo "*** lists from a program, using \`nm' or equivalent, but libtool could" + echo "*** not find such a program. So, this module is probably useless." + echo "*** \`nm' from GNU binutils and a full rebuild may help." + fi + if test "$build_old_libs" = no; then + oldlibs="$output_objdir/$libname.$libext" + build_libtool_libs=module + build_old_libs=yes + else + build_libtool_libs=no + fi + else + echo "*** The inter-library dependencies that have been dropped here will be" + echo "*** automatically added whenever a program is linked with this library" + echo "*** or is declared to -dlopen it." + + if test "$allow_undefined" = no; then + echo + echo "*** Since this library must not contain undefined symbols," + echo "*** because either the platform does not support them or" + echo "*** it was explicitly requested with -no-undefined," + echo "*** libtool will only create a static version of it." + if test "$build_old_libs" = no; then + oldlibs="$output_objdir/$libname.$libext" + build_libtool_libs=module + build_old_libs=yes + else + build_libtool_libs=no + fi + fi + fi + fi + # Done checking deplibs! + deplibs=$newdeplibs + fi + # Time to change all our "foo.ltframework" stuff back to "-framework foo" + case $host in + *-*-darwin*) + newdeplibs=`$ECHO " $newdeplibs" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'` + new_inherited_linker_flags=`$ECHO " $new_inherited_linker_flags" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'` + deplibs=`$ECHO " $deplibs" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'` + ;; + esac + + # move library search paths that coincide with paths to not yet + # installed libraries to the beginning of the library search list + new_libs= + for path in $notinst_path; do + case " $new_libs " in + *" -L$path/$objdir "*) ;; + *) + case " $deplibs " in + *" -L$path/$objdir "*) + func_append new_libs " -L$path/$objdir" ;; + esac + ;; + esac + done + for deplib in $deplibs; do + case $deplib in + -L*) + case " $new_libs " in + *" $deplib "*) ;; + *) func_append new_libs " $deplib" ;; + esac + ;; + *) func_append new_libs " $deplib" ;; + esac + done + deplibs="$new_libs" + + # All the library-specific variables (install_libdir is set above). + library_names= + old_library= + dlname= + + # Test again, we may have decided not to build it any more + if test "$build_libtool_libs" = yes; then + # Remove ${wl} instances when linking with ld. + # FIXME: should test the right _cmds variable. + case $archive_cmds in + *\$LD\ *) wl= ;; + esac + if test "$hardcode_into_libs" = yes; then + # Hardcode the library paths + hardcode_libdirs= + dep_rpath= + rpath="$finalize_rpath" + test "$opt_mode" != relink && rpath="$compile_rpath$rpath" + for libdir in $rpath; do + if test -n "$hardcode_libdir_flag_spec"; then + if test -n "$hardcode_libdir_separator"; then + func_replace_sysroot "$libdir" + libdir=$func_replace_sysroot_result + if test -z "$hardcode_libdirs"; then + hardcode_libdirs="$libdir" + else + # Just accumulate the unique libdirs. + case $hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator in + *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*) + ;; + *) + func_append hardcode_libdirs "$hardcode_libdir_separator$libdir" + ;; + esac + fi + else + eval flag=\"$hardcode_libdir_flag_spec\" + func_append dep_rpath " $flag" + fi + elif test -n "$runpath_var"; then + case "$perm_rpath " in + *" $libdir "*) ;; + *) func_append perm_rpath " $libdir" ;; + esac + fi + done + # Substitute the hardcoded libdirs into the rpath. + if test -n "$hardcode_libdir_separator" && + test -n "$hardcode_libdirs"; then + libdir="$hardcode_libdirs" + eval "dep_rpath=\"$hardcode_libdir_flag_spec\"" + fi + if test -n "$runpath_var" && test -n "$perm_rpath"; then + # We should set the runpath_var. + rpath= + for dir in $perm_rpath; do + func_append rpath "$dir:" + done + eval "$runpath_var='$rpath\$$runpath_var'; export $runpath_var" + fi + test -n "$dep_rpath" && deplibs="$dep_rpath $deplibs" + fi + + shlibpath="$finalize_shlibpath" + test "$opt_mode" != relink && shlibpath="$compile_shlibpath$shlibpath" + if test -n "$shlibpath"; then + eval "$shlibpath_var='$shlibpath\$$shlibpath_var'; export $shlibpath_var" + fi + + # Get the real and link names of the library. + eval shared_ext=\"$shrext_cmds\" + eval library_names=\"$library_names_spec\" + set dummy $library_names + shift + realname="$1" + shift + + if test -n "$soname_spec"; then + eval soname=\"$soname_spec\" + else + soname="$realname" + fi + if test -z "$dlname"; then + dlname=$soname + fi + + lib="$output_objdir/$realname" + linknames= + for link + do + func_append linknames " $link" + done + + # Use standard objects if they are pic + test -z "$pic_flag" && libobjs=`$ECHO "$libobjs" | $SP2NL | $SED "$lo2o" | $NL2SP` + test "X$libobjs" = "X " && libobjs= + + delfiles= + if test -n "$export_symbols" && test -n "$include_expsyms"; then + $opt_dry_run || cp "$export_symbols" "$output_objdir/$libname.uexp" + export_symbols="$output_objdir/$libname.uexp" + func_append delfiles " $export_symbols" + fi + + orig_export_symbols= + case $host_os in + cygwin* | mingw* | cegcc*) + if test -n "$export_symbols" && test -z "$export_symbols_regex"; then + # exporting using user supplied symfile + if test "x`$SED 1q $export_symbols`" != xEXPORTS; then + # and it's NOT already a .def file. Must figure out + # which of the given symbols are data symbols and tag + # them as such. So, trigger use of export_symbols_cmds. + # export_symbols gets reassigned inside the "prepare + # the list of exported symbols" if statement, so the + # include_expsyms logic still works. + orig_export_symbols="$export_symbols" + export_symbols= + always_export_symbols=yes + fi + fi + ;; + esac + + # Prepare the list of exported symbols + if test -z "$export_symbols"; then + if test "$always_export_symbols" = yes || test -n "$export_symbols_regex"; then + func_verbose "generating symbol list for \`$libname.la'" + export_symbols="$output_objdir/$libname.exp" + $opt_dry_run || $RM $export_symbols + cmds=$export_symbols_cmds + save_ifs="$IFS"; IFS='~' + for cmd1 in $cmds; do + IFS="$save_ifs" + # Take the normal branch if the nm_file_list_spec branch + # doesn't work or if tool conversion is not needed. + case $nm_file_list_spec~$to_tool_file_cmd in + *~func_convert_file_noop | *~func_convert_file_msys_to_w32 | ~*) + try_normal_branch=yes + eval cmd=\"$cmd1\" + func_len " $cmd" + len=$func_len_result + ;; + *) + try_normal_branch=no + ;; + esac + if test "$try_normal_branch" = yes \ + && { test "$len" -lt "$max_cmd_len" \ + || test "$max_cmd_len" -le -1; } + then + func_show_eval "$cmd" 'exit $?' + skipped_export=false + elif test -n "$nm_file_list_spec"; then + func_basename "$output" + output_la=$func_basename_result + save_libobjs=$libobjs + save_output=$output + output=${output_objdir}/${output_la}.nm + func_to_tool_file "$output" + libobjs=$nm_file_list_spec$func_to_tool_file_result + func_append delfiles " $output" + func_verbose "creating $NM input file list: $output" + for obj in $save_libobjs; do + func_to_tool_file "$obj" + $ECHO "$func_to_tool_file_result" + done > "$output" + eval cmd=\"$cmd1\" + func_show_eval "$cmd" 'exit $?' + output=$save_output + libobjs=$save_libobjs + skipped_export=false + else + # The command line is too long to execute in one step. + func_verbose "using reloadable object file for export list..." + skipped_export=: + # Break out early, otherwise skipped_export may be + # set to false by a later but shorter cmd. + break + fi + done + IFS="$save_ifs" + if test -n "$export_symbols_regex" && test "X$skipped_export" != "X:"; then + func_show_eval '$EGREP -e "$export_symbols_regex" "$export_symbols" > "${export_symbols}T"' + func_show_eval '$MV "${export_symbols}T" "$export_symbols"' + fi + fi + fi + + if test -n "$export_symbols" && test -n "$include_expsyms"; then + tmp_export_symbols="$export_symbols" + test -n "$orig_export_symbols" && tmp_export_symbols="$orig_export_symbols" + $opt_dry_run || eval '$ECHO "$include_expsyms" | $SP2NL >> "$tmp_export_symbols"' + fi + + if test "X$skipped_export" != "X:" && test -n "$orig_export_symbols"; then + # The given exports_symbols file has to be filtered, so filter it. + func_verbose "filter symbol list for \`$libname.la' to tag DATA exports" + # FIXME: $output_objdir/$libname.filter potentially contains lots of + # 's' commands which not all seds can handle. GNU sed should be fine + # though. Also, the filter scales superlinearly with the number of + # global variables. join(1) would be nice here, but unfortunately + # isn't a blessed tool. + $opt_dry_run || $SED -e '/[ ,]DATA/!d;s,\(.*\)\([ \,].*\),s|^\1$|\1\2|,' < $export_symbols > $output_objdir/$libname.filter + func_append delfiles " $export_symbols $output_objdir/$libname.filter" + export_symbols=$output_objdir/$libname.def + $opt_dry_run || $SED -f $output_objdir/$libname.filter < $orig_export_symbols > $export_symbols + fi + + tmp_deplibs= + for test_deplib in $deplibs; do + case " $convenience " in + *" $test_deplib "*) ;; + *) + func_append tmp_deplibs " $test_deplib" + ;; + esac + done + deplibs="$tmp_deplibs" + + if test -n "$convenience"; then + if test -n "$whole_archive_flag_spec" && + test "$compiler_needs_object" = yes && + test -z "$libobjs"; then + # extract the archives, so we have objects to list. + # TODO: could optimize this to just extract one archive. + whole_archive_flag_spec= + fi + if test -n "$whole_archive_flag_spec"; then + save_libobjs=$libobjs + eval libobjs=\"\$libobjs $whole_archive_flag_spec\" + test "X$libobjs" = "X " && libobjs= + else + gentop="$output_objdir/${outputname}x" + func_append generated " $gentop" + + func_extract_archives $gentop $convenience + func_append libobjs " $func_extract_archives_result" + test "X$libobjs" = "X " && libobjs= + fi + fi + + if test "$thread_safe" = yes && test -n "$thread_safe_flag_spec"; then + eval flag=\"$thread_safe_flag_spec\" + func_append linker_flags " $flag" + fi + + # Make a backup of the uninstalled library when relinking + if test "$opt_mode" = relink; then + $opt_dry_run || eval '(cd $output_objdir && $RM ${realname}U && $MV $realname ${realname}U)' || exit $? + fi + + # Do each of the archive commands. + if test "$module" = yes && test -n "$module_cmds" ; then + if test -n "$export_symbols" && test -n "$module_expsym_cmds"; then + eval test_cmds=\"$module_expsym_cmds\" + cmds=$module_expsym_cmds + else + eval test_cmds=\"$module_cmds\" + cmds=$module_cmds + fi + else + if test -n "$export_symbols" && test -n "$archive_expsym_cmds"; then + eval test_cmds=\"$archive_expsym_cmds\" + cmds=$archive_expsym_cmds + else + eval test_cmds=\"$archive_cmds\" + cmds=$archive_cmds + fi + fi + + if test "X$skipped_export" != "X:" && + func_len " $test_cmds" && + len=$func_len_result && + test "$len" -lt "$max_cmd_len" || test "$max_cmd_len" -le -1; then + : + else + # The command line is too long to link in one step, link piecewise + # or, if using GNU ld and skipped_export is not :, use a linker + # script. + + # Save the value of $output and $libobjs because we want to + # use them later. If we have whole_archive_flag_spec, we + # want to use save_libobjs as it was before + # whole_archive_flag_spec was expanded, because we can't + # assume the linker understands whole_archive_flag_spec. + # This may have to be revisited, in case too many + # convenience libraries get linked in and end up exceeding + # the spec. + if test -z "$convenience" || test -z "$whole_archive_flag_spec"; then + save_libobjs=$libobjs + fi + save_output=$output + func_basename "$output" + output_la=$func_basename_result + + # Clear the reloadable object creation command queue and + # initialize k to one. + test_cmds= + concat_cmds= + objlist= + last_robj= + k=1 + + if test -n "$save_libobjs" && test "X$skipped_export" != "X:" && test "$with_gnu_ld" = yes; then + output=${output_objdir}/${output_la}.lnkscript + func_verbose "creating GNU ld script: $output" + echo 'INPUT (' > $output + for obj in $save_libobjs + do + func_to_tool_file "$obj" + $ECHO "$func_to_tool_file_result" >> $output + done + echo ')' >> $output + func_append delfiles " $output" + func_to_tool_file "$output" + output=$func_to_tool_file_result + elif test -n "$save_libobjs" && test "X$skipped_export" != "X:" && test "X$file_list_spec" != X; then + output=${output_objdir}/${output_la}.lnk + func_verbose "creating linker input file list: $output" + : > $output + set x $save_libobjs + shift + firstobj= + if test "$compiler_needs_object" = yes; then + firstobj="$1 " + shift + fi + for obj + do + func_to_tool_file "$obj" + $ECHO "$func_to_tool_file_result" >> $output + done + func_append delfiles " $output" + func_to_tool_file "$output" + output=$firstobj\"$file_list_spec$func_to_tool_file_result\" + else + if test -n "$save_libobjs"; then + func_verbose "creating reloadable object files..." + output=$output_objdir/$output_la-${k}.$objext + eval test_cmds=\"$reload_cmds\" + func_len " $test_cmds" + len0=$func_len_result + len=$len0 + + # Loop over the list of objects to be linked. + for obj in $save_libobjs + do + func_len " $obj" + func_arith $len + $func_len_result + len=$func_arith_result + if test "X$objlist" = X || + test "$len" -lt "$max_cmd_len"; then + func_append objlist " $obj" + else + # The command $test_cmds is almost too long, add a + # command to the queue. + if test "$k" -eq 1 ; then + # The first file doesn't have a previous command to add. + reload_objs=$objlist + eval concat_cmds=\"$reload_cmds\" + else + # All subsequent reloadable object files will link in + # the last one created. + reload_objs="$objlist $last_robj" + eval concat_cmds=\"\$concat_cmds~$reload_cmds~\$RM $last_robj\" + fi + last_robj=$output_objdir/$output_la-${k}.$objext + func_arith $k + 1 + k=$func_arith_result + output=$output_objdir/$output_la-${k}.$objext + objlist=" $obj" + func_len " $last_robj" + func_arith $len0 + $func_len_result + len=$func_arith_result + fi + done + # Handle the remaining objects by creating one last + # reloadable object file. All subsequent reloadable object + # files will link in the last one created. + test -z "$concat_cmds" || concat_cmds=$concat_cmds~ + reload_objs="$objlist $last_robj" + eval concat_cmds=\"\${concat_cmds}$reload_cmds\" + if test -n "$last_robj"; then + eval concat_cmds=\"\${concat_cmds}~\$RM $last_robj\" + fi + func_append delfiles " $output" + + else + output= + fi + + if ${skipped_export-false}; then + func_verbose "generating symbol list for \`$libname.la'" + export_symbols="$output_objdir/$libname.exp" + $opt_dry_run || $RM $export_symbols + libobjs=$output + # Append the command to create the export file. + test -z "$concat_cmds" || concat_cmds=$concat_cmds~ + eval concat_cmds=\"\$concat_cmds$export_symbols_cmds\" + if test -n "$last_robj"; then + eval concat_cmds=\"\$concat_cmds~\$RM $last_robj\" + fi + fi + + test -n "$save_libobjs" && + func_verbose "creating a temporary reloadable object file: $output" + + # Loop through the commands generated above and execute them. + save_ifs="$IFS"; IFS='~' + for cmd in $concat_cmds; do + IFS="$save_ifs" + $opt_silent || { + func_quote_for_expand "$cmd" + eval "func_echo $func_quote_for_expand_result" + } + $opt_dry_run || eval "$cmd" || { + lt_exit=$? + + # Restore the uninstalled library and exit + if test "$opt_mode" = relink; then + ( cd "$output_objdir" && \ + $RM "${realname}T" && \ + $MV "${realname}U" "$realname" ) + fi + + exit $lt_exit + } + done + IFS="$save_ifs" + + if test -n "$export_symbols_regex" && ${skipped_export-false}; then + func_show_eval '$EGREP -e "$export_symbols_regex" "$export_symbols" > "${export_symbols}T"' + func_show_eval '$MV "${export_symbols}T" "$export_symbols"' + fi + fi + + if ${skipped_export-false}; then + if test -n "$export_symbols" && test -n "$include_expsyms"; then + tmp_export_symbols="$export_symbols" + test -n "$orig_export_symbols" && tmp_export_symbols="$orig_export_symbols" + $opt_dry_run || eval '$ECHO "$include_expsyms" | $SP2NL >> "$tmp_export_symbols"' + fi + + if test -n "$orig_export_symbols"; then + # The given exports_symbols file has to be filtered, so filter it. + func_verbose "filter symbol list for \`$libname.la' to tag DATA exports" + # FIXME: $output_objdir/$libname.filter potentially contains lots of + # 's' commands which not all seds can handle. GNU sed should be fine + # though. Also, the filter scales superlinearly with the number of + # global variables. join(1) would be nice here, but unfortunately + # isn't a blessed tool. + $opt_dry_run || $SED -e '/[ ,]DATA/!d;s,\(.*\)\([ \,].*\),s|^\1$|\1\2|,' < $export_symbols > $output_objdir/$libname.filter + func_append delfiles " $export_symbols $output_objdir/$libname.filter" + export_symbols=$output_objdir/$libname.def + $opt_dry_run || $SED -f $output_objdir/$libname.filter < $orig_export_symbols > $export_symbols + fi + fi + + libobjs=$output + # Restore the value of output. + output=$save_output + + if test -n "$convenience" && test -n "$whole_archive_flag_spec"; then + eval libobjs=\"\$libobjs $whole_archive_flag_spec\" + test "X$libobjs" = "X " && libobjs= + fi + # Expand the library linking commands again to reset the + # value of $libobjs for piecewise linking. + + # Do each of the archive commands. + if test "$module" = yes && test -n "$module_cmds" ; then + if test -n "$export_symbols" && test -n "$module_expsym_cmds"; then + cmds=$module_expsym_cmds + else + cmds=$module_cmds + fi + else + if test -n "$export_symbols" && test -n "$archive_expsym_cmds"; then + cmds=$archive_expsym_cmds + else + cmds=$archive_cmds + fi + fi + fi + + if test -n "$delfiles"; then + # Append the command to remove temporary files to $cmds. + eval cmds=\"\$cmds~\$RM $delfiles\" + fi + + # Add any objects from preloaded convenience libraries + if test -n "$dlprefiles"; then + gentop="$output_objdir/${outputname}x" + func_append generated " $gentop" + + func_extract_archives $gentop $dlprefiles + func_append libobjs " $func_extract_archives_result" + test "X$libobjs" = "X " && libobjs= + fi + + save_ifs="$IFS"; IFS='~' + for cmd in $cmds; do + IFS="$save_ifs" + eval cmd=\"$cmd\" + $opt_silent || { + func_quote_for_expand "$cmd" + eval "func_echo $func_quote_for_expand_result" + } + $opt_dry_run || eval "$cmd" || { + lt_exit=$? + + # Restore the uninstalled library and exit + if test "$opt_mode" = relink; then + ( cd "$output_objdir" && \ + $RM "${realname}T" && \ + $MV "${realname}U" "$realname" ) + fi + + exit $lt_exit + } + done + IFS="$save_ifs" + + # Restore the uninstalled library and exit + if test "$opt_mode" = relink; then + $opt_dry_run || eval '(cd $output_objdir && $RM ${realname}T && $MV $realname ${realname}T && $MV ${realname}U $realname)' || exit $? + + if test -n "$convenience"; then + if test -z "$whole_archive_flag_spec"; then + func_show_eval '${RM}r "$gentop"' + fi + fi + + exit $EXIT_SUCCESS + fi + + # Create links to the real library. + for linkname in $linknames; do + if test "$realname" != "$linkname"; then + func_show_eval '(cd "$output_objdir" && $RM "$linkname" && $LN_S "$realname" "$linkname")' 'exit $?' + fi + done + + # If -module or -export-dynamic was specified, set the dlname. + if test "$module" = yes || test "$export_dynamic" = yes; then + # On all known operating systems, these are identical. + dlname="$soname" + fi + fi + ;; + + obj) + if test -n "$dlfiles$dlprefiles" || test "$dlself" != no; then + func_warning "\`-dlopen' is ignored for objects" + fi + + case " $deplibs" in + *\ -l* | *\ -L*) + func_warning "\`-l' and \`-L' are ignored for objects" ;; + esac + + test -n "$rpath" && \ + func_warning "\`-rpath' is ignored for objects" + + test -n "$xrpath" && \ + func_warning "\`-R' is ignored for objects" + + test -n "$vinfo" && \ + func_warning "\`-version-info' is ignored for objects" + + test -n "$release" && \ + func_warning "\`-release' is ignored for objects" + + case $output in + *.lo) + test -n "$objs$old_deplibs" && \ + func_fatal_error "cannot build library object \`$output' from non-libtool objects" + + libobj=$output + func_lo2o "$libobj" + obj=$func_lo2o_result + ;; + *) + libobj= + obj="$output" + ;; + esac + + # Delete the old objects. + $opt_dry_run || $RM $obj $libobj + + # Objects from convenience libraries. This assumes + # single-version convenience libraries. Whenever we create + # different ones for PIC/non-PIC, this we'll have to duplicate + # the extraction. + reload_conv_objs= + gentop= + # reload_cmds runs $LD directly, so let us get rid of + # -Wl from whole_archive_flag_spec and hope we can get by with + # turning comma into space.. + wl= + + if test -n "$convenience"; then + if test -n "$whole_archive_flag_spec"; then + eval tmp_whole_archive_flags=\"$whole_archive_flag_spec\" + reload_conv_objs=$reload_objs\ `$ECHO "$tmp_whole_archive_flags" | $SED 's|,| |g'` + else + gentop="$output_objdir/${obj}x" + func_append generated " $gentop" + + func_extract_archives $gentop $convenience + reload_conv_objs="$reload_objs $func_extract_archives_result" + fi + fi + + # If we're not building shared, we need to use non_pic_objs + test "$build_libtool_libs" != yes && libobjs="$non_pic_objects" + + # Create the old-style object. + reload_objs="$objs$old_deplibs "`$ECHO "$libobjs" | $SP2NL | $SED "/\.${libext}$/d; /\.lib$/d; $lo2o" | $NL2SP`" $reload_conv_objs" ### testsuite: skip nested quoting test + + output="$obj" + func_execute_cmds "$reload_cmds" 'exit $?' + + # Exit if we aren't doing a library object file. + if test -z "$libobj"; then + if test -n "$gentop"; then + func_show_eval '${RM}r "$gentop"' + fi + + exit $EXIT_SUCCESS + fi + + if test "$build_libtool_libs" != yes; then + if test -n "$gentop"; then + func_show_eval '${RM}r "$gentop"' + fi + + # Create an invalid libtool object if no PIC, so that we don't + # accidentally link it into a program. + # $show "echo timestamp > $libobj" + # $opt_dry_run || eval "echo timestamp > $libobj" || exit $? + exit $EXIT_SUCCESS + fi + + if test -n "$pic_flag" || test "$pic_mode" != default; then + # Only do commands if we really have different PIC objects. + reload_objs="$libobjs $reload_conv_objs" + output="$libobj" + func_execute_cmds "$reload_cmds" 'exit $?' + fi + + if test -n "$gentop"; then + func_show_eval '${RM}r "$gentop"' + fi + + exit $EXIT_SUCCESS + ;; + + prog) + case $host in + *cygwin*) func_stripname '' '.exe' "$output" + output=$func_stripname_result.exe;; + esac + test -n "$vinfo" && \ + func_warning "\`-version-info' is ignored for programs" + + test -n "$release" && \ + func_warning "\`-release' is ignored for programs" + + test "$preload" = yes \ + && test "$dlopen_support" = unknown \ + && test "$dlopen_self" = unknown \ + && test "$dlopen_self_static" = unknown && \ + func_warning "\`LT_INIT([dlopen])' not used. Assuming no dlopen support." + + case $host in + *-*-rhapsody* | *-*-darwin1.[012]) + # On Rhapsody replace the C library is the System framework + compile_deplibs=`$ECHO " $compile_deplibs" | $SED 's/ -lc / System.ltframework /'` + finalize_deplibs=`$ECHO " $finalize_deplibs" | $SED 's/ -lc / System.ltframework /'` + ;; + esac + + case $host in + *-*-darwin*) + # Don't allow lazy linking, it breaks C++ global constructors + # But is supposedly fixed on 10.4 or later (yay!). + if test "$tagname" = CXX ; then + case ${MACOSX_DEPLOYMENT_TARGET-10.0} in + 10.[0123]) + func_append compile_command " ${wl}-bind_at_load" + func_append finalize_command " ${wl}-bind_at_load" + ;; + esac + fi + # Time to change all our "foo.ltframework" stuff back to "-framework foo" + compile_deplibs=`$ECHO " $compile_deplibs" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'` + finalize_deplibs=`$ECHO " $finalize_deplibs" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'` + ;; + esac + + + # move library search paths that coincide with paths to not yet + # installed libraries to the beginning of the library search list + new_libs= + for path in $notinst_path; do + case " $new_libs " in + *" -L$path/$objdir "*) ;; + *) + case " $compile_deplibs " in + *" -L$path/$objdir "*) + func_append new_libs " -L$path/$objdir" ;; + esac + ;; + esac + done + for deplib in $compile_deplibs; do + case $deplib in + -L*) + case " $new_libs " in + *" $deplib "*) ;; + *) func_append new_libs " $deplib" ;; + esac + ;; + *) func_append new_libs " $deplib" ;; + esac + done + compile_deplibs="$new_libs" + + + func_append compile_command " $compile_deplibs" + func_append finalize_command " $finalize_deplibs" + + if test -n "$rpath$xrpath"; then + # If the user specified any rpath flags, then add them. + for libdir in $rpath $xrpath; do + # This is the magic to use -rpath. + case "$finalize_rpath " in + *" $libdir "*) ;; + *) func_append finalize_rpath " $libdir" ;; + esac + done + fi + + # Now hardcode the library paths + rpath= + hardcode_libdirs= + for libdir in $compile_rpath $finalize_rpath; do + if test -n "$hardcode_libdir_flag_spec"; then + if test -n "$hardcode_libdir_separator"; then + if test -z "$hardcode_libdirs"; then + hardcode_libdirs="$libdir" + else + # Just accumulate the unique libdirs. + case $hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator in + *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*) + ;; + *) + func_append hardcode_libdirs "$hardcode_libdir_separator$libdir" + ;; + esac + fi + else + eval flag=\"$hardcode_libdir_flag_spec\" + func_append rpath " $flag" + fi + elif test -n "$runpath_var"; then + case "$perm_rpath " in + *" $libdir "*) ;; + *) func_append perm_rpath " $libdir" ;; + esac + fi + case $host in + *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2* | *-cegcc*) + testbindir=`${ECHO} "$libdir" | ${SED} -e 's*/lib$*/bin*'` + case :$dllsearchpath: in + *":$libdir:"*) ;; + ::) dllsearchpath=$libdir;; + *) func_append dllsearchpath ":$libdir";; + esac + case :$dllsearchpath: in + *":$testbindir:"*) ;; + ::) dllsearchpath=$testbindir;; + *) func_append dllsearchpath ":$testbindir";; + esac + ;; + esac + done + # Substitute the hardcoded libdirs into the rpath. + if test -n "$hardcode_libdir_separator" && + test -n "$hardcode_libdirs"; then + libdir="$hardcode_libdirs" + eval rpath=\" $hardcode_libdir_flag_spec\" + fi + compile_rpath="$rpath" + + rpath= + hardcode_libdirs= + for libdir in $finalize_rpath; do + if test -n "$hardcode_libdir_flag_spec"; then + if test -n "$hardcode_libdir_separator"; then + if test -z "$hardcode_libdirs"; then + hardcode_libdirs="$libdir" + else + # Just accumulate the unique libdirs. + case $hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator in + *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*) + ;; + *) + func_append hardcode_libdirs "$hardcode_libdir_separator$libdir" + ;; + esac + fi + else + eval flag=\"$hardcode_libdir_flag_spec\" + func_append rpath " $flag" + fi + elif test -n "$runpath_var"; then + case "$finalize_perm_rpath " in + *" $libdir "*) ;; + *) func_append finalize_perm_rpath " $libdir" ;; + esac + fi + done + # Substitute the hardcoded libdirs into the rpath. + if test -n "$hardcode_libdir_separator" && + test -n "$hardcode_libdirs"; then + libdir="$hardcode_libdirs" + eval rpath=\" $hardcode_libdir_flag_spec\" + fi + finalize_rpath="$rpath" + + if test -n "$libobjs" && test "$build_old_libs" = yes; then + # Transform all the library objects into standard objects. + compile_command=`$ECHO "$compile_command" | $SP2NL | $SED "$lo2o" | $NL2SP` + finalize_command=`$ECHO "$finalize_command" | $SP2NL | $SED "$lo2o" | $NL2SP` + fi + + func_generate_dlsyms "$outputname" "@PROGRAM@" "no" + + # template prelinking step + if test -n "$prelink_cmds"; then + func_execute_cmds "$prelink_cmds" 'exit $?' + fi + + wrappers_required=yes + case $host in + *cegcc* | *mingw32ce*) + # Disable wrappers for cegcc and mingw32ce hosts, we are cross compiling anyway. + wrappers_required=no + ;; + *cygwin* | *mingw* ) + if test "$build_libtool_libs" != yes; then + wrappers_required=no + fi + ;; + *) + if test "$need_relink" = no || test "$build_libtool_libs" != yes; then + wrappers_required=no + fi + ;; + esac + if test "$wrappers_required" = no; then + # Replace the output file specification. + compile_command=`$ECHO "$compile_command" | $SED 's%@OUTPUT@%'"$output"'%g'` + link_command="$compile_command$compile_rpath" + + # We have no uninstalled library dependencies, so finalize right now. + exit_status=0 + func_show_eval "$link_command" 'exit_status=$?' + + if test -n "$postlink_cmds"; then + func_to_tool_file "$output" + postlink_cmds=`func_echo_all "$postlink_cmds" | $SED -e 's%@OUTPUT@%'"$output"'%g' -e 's%@TOOL_OUTPUT@%'"$func_to_tool_file_result"'%g'` + func_execute_cmds "$postlink_cmds" 'exit $?' + fi + + # Delete the generated files. + if test -f "$output_objdir/${outputname}S.${objext}"; then + func_show_eval '$RM "$output_objdir/${outputname}S.${objext}"' + fi + + exit $exit_status + fi + + if test -n "$compile_shlibpath$finalize_shlibpath"; then + compile_command="$shlibpath_var=\"$compile_shlibpath$finalize_shlibpath\$$shlibpath_var\" $compile_command" + fi + if test -n "$finalize_shlibpath"; then + finalize_command="$shlibpath_var=\"$finalize_shlibpath\$$shlibpath_var\" $finalize_command" + fi + + compile_var= + finalize_var= + if test -n "$runpath_var"; then + if test -n "$perm_rpath"; then + # We should set the runpath_var. + rpath= + for dir in $perm_rpath; do + func_append rpath "$dir:" + done + compile_var="$runpath_var=\"$rpath\$$runpath_var\" " + fi + if test -n "$finalize_perm_rpath"; then + # We should set the runpath_var. + rpath= + for dir in $finalize_perm_rpath; do + func_append rpath "$dir:" + done + finalize_var="$runpath_var=\"$rpath\$$runpath_var\" " + fi + fi + + if test "$no_install" = yes; then + # We don't need to create a wrapper script. + link_command="$compile_var$compile_command$compile_rpath" + # Replace the output file specification. + link_command=`$ECHO "$link_command" | $SED 's%@OUTPUT@%'"$output"'%g'` + # Delete the old output file. + $opt_dry_run || $RM $output + # Link the executable and exit + func_show_eval "$link_command" 'exit $?' + + if test -n "$postlink_cmds"; then + func_to_tool_file "$output" + postlink_cmds=`func_echo_all "$postlink_cmds" | $SED -e 's%@OUTPUT@%'"$output"'%g' -e 's%@TOOL_OUTPUT@%'"$func_to_tool_file_result"'%g'` + func_execute_cmds "$postlink_cmds" 'exit $?' + fi + + exit $EXIT_SUCCESS + fi + + if test "$hardcode_action" = relink; then + # Fast installation is not supported + link_command="$compile_var$compile_command$compile_rpath" + relink_command="$finalize_var$finalize_command$finalize_rpath" + + func_warning "this platform does not like uninstalled shared libraries" + func_warning "\`$output' will be relinked during installation" + else + if test "$fast_install" != no; then + link_command="$finalize_var$compile_command$finalize_rpath" + if test "$fast_install" = yes; then + relink_command=`$ECHO "$compile_var$compile_command$compile_rpath" | $SED 's%@OUTPUT@%\$progdir/\$file%g'` + else + # fast_install is set to needless + relink_command= + fi + else + link_command="$compile_var$compile_command$compile_rpath" + relink_command="$finalize_var$finalize_command$finalize_rpath" + fi + fi + + # Replace the output file specification. + link_command=`$ECHO "$link_command" | $SED 's%@OUTPUT@%'"$output_objdir/$outputname"'%g'` + + # Delete the old output files. + $opt_dry_run || $RM $output $output_objdir/$outputname $output_objdir/lt-$outputname + + func_show_eval "$link_command" 'exit $?' + + if test -n "$postlink_cmds"; then + func_to_tool_file "$output_objdir/$outputname" + postlink_cmds=`func_echo_all "$postlink_cmds" | $SED -e 's%@OUTPUT@%'"$output_objdir/$outputname"'%g' -e 's%@TOOL_OUTPUT@%'"$func_to_tool_file_result"'%g'` + func_execute_cmds "$postlink_cmds" 'exit $?' + fi + + # Now create the wrapper script. + func_verbose "creating $output" + + # Quote the relink command for shipping. + if test -n "$relink_command"; then + # Preserve any variables that may affect compiler behavior + for var in $variables_saved_for_relink; do + if eval test -z \"\${$var+set}\"; then + relink_command="{ test -z \"\${$var+set}\" || $lt_unset $var || { $var=; export $var; }; }; $relink_command" + elif eval var_value=\$$var; test -z "$var_value"; then + relink_command="$var=; export $var; $relink_command" + else + func_quote_for_eval "$var_value" + relink_command="$var=$func_quote_for_eval_result; export $var; $relink_command" + fi + done + relink_command="(cd `pwd`; $relink_command)" + relink_command=`$ECHO "$relink_command" | $SED "$sed_quote_subst"` + fi + + # Only actually do things if not in dry run mode. + $opt_dry_run || { + # win32 will think the script is a binary if it has + # a .exe suffix, so we strip it off here. + case $output in + *.exe) func_stripname '' '.exe' "$output" + output=$func_stripname_result ;; + esac + # test for cygwin because mv fails w/o .exe extensions + case $host in + *cygwin*) + exeext=.exe + func_stripname '' '.exe' "$outputname" + outputname=$func_stripname_result ;; + *) exeext= ;; + esac + case $host in + *cygwin* | *mingw* ) + func_dirname_and_basename "$output" "" "." + output_name=$func_basename_result + output_path=$func_dirname_result + cwrappersource="$output_path/$objdir/lt-$output_name.c" + cwrapper="$output_path/$output_name.exe" + $RM $cwrappersource $cwrapper + trap "$RM $cwrappersource $cwrapper; exit $EXIT_FAILURE" 1 2 15 + + func_emit_cwrapperexe_src > $cwrappersource + + # The wrapper executable is built using the $host compiler, + # because it contains $host paths and files. If cross- + # compiling, it, like the target executable, must be + # executed on the $host or under an emulation environment. + $opt_dry_run || { + $LTCC $LTCFLAGS -o $cwrapper $cwrappersource + $STRIP $cwrapper + } + + # Now, create the wrapper script for func_source use: + func_ltwrapper_scriptname $cwrapper + $RM $func_ltwrapper_scriptname_result + trap "$RM $func_ltwrapper_scriptname_result; exit $EXIT_FAILURE" 1 2 15 + $opt_dry_run || { + # note: this script will not be executed, so do not chmod. + if test "x$build" = "x$host" ; then + $cwrapper --lt-dump-script > $func_ltwrapper_scriptname_result + else + func_emit_wrapper no > $func_ltwrapper_scriptname_result + fi + } + ;; + * ) + $RM $output + trap "$RM $output; exit $EXIT_FAILURE" 1 2 15 + + func_emit_wrapper no > $output + chmod +x $output + ;; + esac + } + exit $EXIT_SUCCESS + ;; + esac + + # See if we need to build an old-fashioned archive. + for oldlib in $oldlibs; do + + if test "$build_libtool_libs" = convenience; then + oldobjs="$libobjs_save $symfileobj" + addlibs="$convenience" + build_libtool_libs=no + else + if test "$build_libtool_libs" = module; then + oldobjs="$libobjs_save" + build_libtool_libs=no + else + oldobjs="$old_deplibs $non_pic_objects" + if test "$preload" = yes && test -f "$symfileobj"; then + func_append oldobjs " $symfileobj" + fi + fi + addlibs="$old_convenience" + fi + + if test -n "$addlibs"; then + gentop="$output_objdir/${outputname}x" + func_append generated " $gentop" + + func_extract_archives $gentop $addlibs + func_append oldobjs " $func_extract_archives_result" + fi + + # Do each command in the archive commands. + if test -n "$old_archive_from_new_cmds" && test "$build_libtool_libs" = yes; then + cmds=$old_archive_from_new_cmds + else + + # Add any objects from preloaded convenience libraries + if test -n "$dlprefiles"; then + gentop="$output_objdir/${outputname}x" + func_append generated " $gentop" + + func_extract_archives $gentop $dlprefiles + func_append oldobjs " $func_extract_archives_result" + fi + + # POSIX demands no paths to be encoded in archives. We have + # to avoid creating archives with duplicate basenames if we + # might have to extract them afterwards, e.g., when creating a + # static archive out of a convenience library, or when linking + # the entirety of a libtool archive into another (currently + # not supported by libtool). + if (for obj in $oldobjs + do + func_basename "$obj" + $ECHO "$func_basename_result" + done | sort | sort -uc >/dev/null 2>&1); then + : + else + echo "copying selected object files to avoid basename conflicts..." + gentop="$output_objdir/${outputname}x" + func_append generated " $gentop" + func_mkdir_p "$gentop" + save_oldobjs=$oldobjs + oldobjs= + counter=1 + for obj in $save_oldobjs + do + func_basename "$obj" + objbase="$func_basename_result" + case " $oldobjs " in + " ") oldobjs=$obj ;; + *[\ /]"$objbase "*) + while :; do + # Make sure we don't pick an alternate name that also + # overlaps. + newobj=lt$counter-$objbase + func_arith $counter + 1 + counter=$func_arith_result + case " $oldobjs " in + *[\ /]"$newobj "*) ;; + *) if test ! -f "$gentop/$newobj"; then break; fi ;; + esac + done + func_show_eval "ln $obj $gentop/$newobj || cp $obj $gentop/$newobj" + func_append oldobjs " $gentop/$newobj" + ;; + *) func_append oldobjs " $obj" ;; + esac + done + fi + func_to_tool_file "$oldlib" func_convert_file_msys_to_w32 + tool_oldlib=$func_to_tool_file_result + eval cmds=\"$old_archive_cmds\" + + func_len " $cmds" + len=$func_len_result + if test "$len" -lt "$max_cmd_len" || test "$max_cmd_len" -le -1; then + cmds=$old_archive_cmds + elif test -n "$archiver_list_spec"; then + func_verbose "using command file archive linking..." + for obj in $oldobjs + do + func_to_tool_file "$obj" + $ECHO "$func_to_tool_file_result" + done > $output_objdir/$libname.libcmd + func_to_tool_file "$output_objdir/$libname.libcmd" + oldobjs=" $archiver_list_spec$func_to_tool_file_result" + cmds=$old_archive_cmds + else + # the command line is too long to link in one step, link in parts + func_verbose "using piecewise archive linking..." + save_RANLIB=$RANLIB + RANLIB=: + objlist= + concat_cmds= + save_oldobjs=$oldobjs + oldobjs= + # Is there a better way of finding the last object in the list? + for obj in $save_oldobjs + do + last_oldobj=$obj + done + eval test_cmds=\"$old_archive_cmds\" + func_len " $test_cmds" + len0=$func_len_result + len=$len0 + for obj in $save_oldobjs + do + func_len " $obj" + func_arith $len + $func_len_result + len=$func_arith_result + func_append objlist " $obj" + if test "$len" -lt "$max_cmd_len"; then + : + else + # the above command should be used before it gets too long + oldobjs=$objlist + if test "$obj" = "$last_oldobj" ; then + RANLIB=$save_RANLIB + fi + test -z "$concat_cmds" || concat_cmds=$concat_cmds~ + eval concat_cmds=\"\${concat_cmds}$old_archive_cmds\" + objlist= + len=$len0 + fi + done + RANLIB=$save_RANLIB + oldobjs=$objlist + if test "X$oldobjs" = "X" ; then + eval cmds=\"\$concat_cmds\" + else + eval cmds=\"\$concat_cmds~\$old_archive_cmds\" + fi + fi + fi + func_execute_cmds "$cmds" 'exit $?' + done + + test -n "$generated" && \ + func_show_eval "${RM}r$generated" + + # Now create the libtool archive. + case $output in + *.la) + old_library= + test "$build_old_libs" = yes && old_library="$libname.$libext" + func_verbose "creating $output" + + # Preserve any variables that may affect compiler behavior + for var in $variables_saved_for_relink; do + if eval test -z \"\${$var+set}\"; then + relink_command="{ test -z \"\${$var+set}\" || $lt_unset $var || { $var=; export $var; }; }; $relink_command" + elif eval var_value=\$$var; test -z "$var_value"; then + relink_command="$var=; export $var; $relink_command" + else + func_quote_for_eval "$var_value" + relink_command="$var=$func_quote_for_eval_result; export $var; $relink_command" + fi + done + # Quote the link command for shipping. + relink_command="(cd `pwd`; $SHELL $progpath $preserve_args --mode=relink $libtool_args @inst_prefix_dir@)" + relink_command=`$ECHO "$relink_command" | $SED "$sed_quote_subst"` + if test "$hardcode_automatic" = yes ; then + relink_command= + fi + + # Only create the output if not a dry run. + $opt_dry_run || { + for installed in no yes; do + if test "$installed" = yes; then + if test -z "$install_libdir"; then + break + fi + output="$output_objdir/$outputname"i + # Replace all uninstalled libtool libraries with the installed ones + newdependency_libs= + for deplib in $dependency_libs; do + case $deplib in + *.la) + func_basename "$deplib" + name="$func_basename_result" + func_resolve_sysroot "$deplib" + eval libdir=`${SED} -n -e 's/^libdir=\(.*\)$/\1/p' $func_resolve_sysroot_result` + test -z "$libdir" && \ + func_fatal_error "\`$deplib' is not a valid libtool archive" + func_append newdependency_libs " ${lt_sysroot:+=}$libdir/$name" + ;; + -L*) + func_stripname -L '' "$deplib" + func_replace_sysroot "$func_stripname_result" + func_append newdependency_libs " -L$func_replace_sysroot_result" + ;; + -R*) + func_stripname -R '' "$deplib" + func_replace_sysroot "$func_stripname_result" + func_append newdependency_libs " -R$func_replace_sysroot_result" + ;; + *) func_append newdependency_libs " $deplib" ;; + esac + done + dependency_libs="$newdependency_libs" + newdlfiles= + + for lib in $dlfiles; do + case $lib in + *.la) + func_basename "$lib" + name="$func_basename_result" + eval libdir=`${SED} -n -e 's/^libdir=\(.*\)$/\1/p' $lib` + test -z "$libdir" && \ + func_fatal_error "\`$lib' is not a valid libtool archive" + func_append newdlfiles " ${lt_sysroot:+=}$libdir/$name" + ;; + *) func_append newdlfiles " $lib" ;; + esac + done + dlfiles="$newdlfiles" + newdlprefiles= + for lib in $dlprefiles; do + case $lib in + *.la) + # Only pass preopened files to the pseudo-archive (for + # eventual linking with the app. that links it) if we + # didn't already link the preopened objects directly into + # the library: + func_basename "$lib" + name="$func_basename_result" + eval libdir=`${SED} -n -e 's/^libdir=\(.*\)$/\1/p' $lib` + test -z "$libdir" && \ + func_fatal_error "\`$lib' is not a valid libtool archive" + func_append newdlprefiles " ${lt_sysroot:+=}$libdir/$name" + ;; + esac + done + dlprefiles="$newdlprefiles" + else + newdlfiles= + for lib in $dlfiles; do + case $lib in + [\\/]* | [A-Za-z]:[\\/]*) abs="$lib" ;; + *) abs=`pwd`"/$lib" ;; + esac + func_append newdlfiles " $abs" + done + dlfiles="$newdlfiles" + newdlprefiles= + for lib in $dlprefiles; do + case $lib in + [\\/]* | [A-Za-z]:[\\/]*) abs="$lib" ;; + *) abs=`pwd`"/$lib" ;; + esac + func_append newdlprefiles " $abs" + done + dlprefiles="$newdlprefiles" + fi + $RM $output + # place dlname in correct position for cygwin + # In fact, it would be nice if we could use this code for all target + # systems that can't hard-code library paths into their executables + # and that have no shared library path variable independent of PATH, + # but it turns out we can't easily determine that from inspecting + # libtool variables, so we have to hard-code the OSs to which it + # applies here; at the moment, that means platforms that use the PE + # object format with DLL files. See the long comment at the top of + # tests/bindir.at for full details. + tdlname=$dlname + case $host,$output,$installed,$module,$dlname in + *cygwin*,*lai,yes,no,*.dll | *mingw*,*lai,yes,no,*.dll | *cegcc*,*lai,yes,no,*.dll) + # If a -bindir argument was supplied, place the dll there. + if test "x$bindir" != x ; + then + func_relative_path "$install_libdir" "$bindir" + tdlname=$func_relative_path_result$dlname + else + # Otherwise fall back on heuristic. + tdlname=../bin/$dlname + fi + ;; + esac + $ECHO > $output "\ +# $outputname - a libtool library file +# Generated by $PROGRAM (GNU $PACKAGE$TIMESTAMP) $VERSION +# +# Please DO NOT delete this file! +# It is necessary for linking the library. + +# The name that we can dlopen(3). +dlname='$tdlname' + +# Names of this library. +library_names='$library_names' + +# The name of the static archive. +old_library='$old_library' + +# Linker flags that can not go in dependency_libs. +inherited_linker_flags='$new_inherited_linker_flags' + +# Libraries that this one depends upon. +dependency_libs='$dependency_libs' + +# Names of additional weak libraries provided by this library +weak_library_names='$weak_libs' + +# Version information for $libname. +current=$current +age=$age +revision=$revision + +# Is this an already installed library? +installed=$installed + +# Should we warn about portability when linking against -modules? +shouldnotlink=$module + +# Files to dlopen/dlpreopen +dlopen='$dlfiles' +dlpreopen='$dlprefiles' + +# Directory that this library needs to be installed in: +libdir='$install_libdir'" + if test "$installed" = no && test "$need_relink" = yes; then + $ECHO >> $output "\ +relink_command=\"$relink_command\"" + fi + done + } + + # Do a symbolic link so that the libtool archive can be found in + # LD_LIBRARY_PATH before the program is installed. + func_show_eval '( cd "$output_objdir" && $RM "$outputname" && $LN_S "../$outputname" "$outputname" )' 'exit $?' + ;; + esac + exit $EXIT_SUCCESS +} + +{ test "$opt_mode" = link || test "$opt_mode" = relink; } && + func_mode_link ${1+"$@"} + + +# func_mode_uninstall arg... +func_mode_uninstall () +{ + $opt_debug + RM="$nonopt" + files= + rmforce= + exit_status=0 + + # This variable tells wrapper scripts just to set variables rather + # than running their programs. + libtool_install_magic="$magic" + + for arg + do + case $arg in + -f) func_append RM " $arg"; rmforce=yes ;; + -*) func_append RM " $arg" ;; + *) func_append files " $arg" ;; + esac + done + + test -z "$RM" && \ + func_fatal_help "you must specify an RM program" + + rmdirs= + + for file in $files; do + func_dirname "$file" "" "." + dir="$func_dirname_result" + if test "X$dir" = X.; then + odir="$objdir" + else + odir="$dir/$objdir" + fi + func_basename "$file" + name="$func_basename_result" + test "$opt_mode" = uninstall && odir="$dir" + + # Remember odir for removal later, being careful to avoid duplicates + if test "$opt_mode" = clean; then + case " $rmdirs " in + *" $odir "*) ;; + *) func_append rmdirs " $odir" ;; + esac + fi + + # Don't error if the file doesn't exist and rm -f was used. + if { test -L "$file"; } >/dev/null 2>&1 || + { test -h "$file"; } >/dev/null 2>&1 || + test -f "$file"; then + : + elif test -d "$file"; then + exit_status=1 + continue + elif test "$rmforce" = yes; then + continue + fi + + rmfiles="$file" + + case $name in + *.la) + # Possibly a libtool archive, so verify it. + if func_lalib_p "$file"; then + func_source $dir/$name + + # Delete the libtool libraries and symlinks. + for n in $library_names; do + func_append rmfiles " $odir/$n" + done + test -n "$old_library" && func_append rmfiles " $odir/$old_library" + + case "$opt_mode" in + clean) + case " $library_names " in + *" $dlname "*) ;; + *) test -n "$dlname" && func_append rmfiles " $odir/$dlname" ;; + esac + test -n "$libdir" && func_append rmfiles " $odir/$name $odir/${name}i" + ;; + uninstall) + if test -n "$library_names"; then + # Do each command in the postuninstall commands. + func_execute_cmds "$postuninstall_cmds" 'test "$rmforce" = yes || exit_status=1' + fi + + if test -n "$old_library"; then + # Do each command in the old_postuninstall commands. + func_execute_cmds "$old_postuninstall_cmds" 'test "$rmforce" = yes || exit_status=1' + fi + # FIXME: should reinstall the best remaining shared library. + ;; + esac + fi + ;; + + *.lo) + # Possibly a libtool object, so verify it. + if func_lalib_p "$file"; then + + # Read the .lo file + func_source $dir/$name + + # Add PIC object to the list of files to remove. + if test -n "$pic_object" && + test "$pic_object" != none; then + func_append rmfiles " $dir/$pic_object" + fi + + # Add non-PIC object to the list of files to remove. + if test -n "$non_pic_object" && + test "$non_pic_object" != none; then + func_append rmfiles " $dir/$non_pic_object" + fi + fi + ;; + + *) + if test "$opt_mode" = clean ; then + noexename=$name + case $file in + *.exe) + func_stripname '' '.exe' "$file" + file=$func_stripname_result + func_stripname '' '.exe' "$name" + noexename=$func_stripname_result + # $file with .exe has already been added to rmfiles, + # add $file without .exe + func_append rmfiles " $file" + ;; + esac + # Do a test to see if this is a libtool program. + if func_ltwrapper_p "$file"; then + if func_ltwrapper_executable_p "$file"; then + func_ltwrapper_scriptname "$file" + relink_command= + func_source $func_ltwrapper_scriptname_result + func_append rmfiles " $func_ltwrapper_scriptname_result" + else + relink_command= + func_source $dir/$noexename + fi + + # note $name still contains .exe if it was in $file originally + # as does the version of $file that was added into $rmfiles + func_append rmfiles " $odir/$name $odir/${name}S.${objext}" + if test "$fast_install" = yes && test -n "$relink_command"; then + func_append rmfiles " $odir/lt-$name" + fi + if test "X$noexename" != "X$name" ; then + func_append rmfiles " $odir/lt-${noexename}.c" + fi + fi + fi + ;; + esac + func_show_eval "$RM $rmfiles" 'exit_status=1' + done + + # Try to remove the ${objdir}s in the directories where we deleted files + for dir in $rmdirs; do + if test -d "$dir"; then + func_show_eval "rmdir $dir >/dev/null 2>&1" + fi + done + + exit $exit_status +} + +{ test "$opt_mode" = uninstall || test "$opt_mode" = clean; } && + func_mode_uninstall ${1+"$@"} + +test -z "$opt_mode" && { + help="$generic_help" + func_fatal_help "you must specify a MODE" +} + +test -z "$exec_cmd" && \ + func_fatal_help "invalid operation mode \`$opt_mode'" + +if test -n "$exec_cmd"; then + eval exec "$exec_cmd" + exit $EXIT_FAILURE +fi + +exit $exit_status + + +# The TAGs below are defined such that we never get into a situation +# in which we disable both kinds of libraries. Given conflicting +# choices, we go for a static library, that is the most portable, +# since we can't tell whether shared libraries were disabled because +# the user asked for that or because the platform doesn't support +# them. This is particularly important on AIX, because we don't +# support having both static and shared libraries enabled at the same +# time on that platform, so we default to a shared-only configuration. +# If a disable-shared tag is given, we'll fallback to a static-only +# configuration. But we'll never go from static-only to shared-only. + +# ### BEGIN LIBTOOL TAG CONFIG: disable-shared +build_libtool_libs=no +build_old_libs=yes +# ### END LIBTOOL TAG CONFIG: disable-shared + +# ### BEGIN LIBTOOL TAG CONFIG: disable-static +build_old_libs=`case $build_libtool_libs in yes) echo no;; *) echo yes;; esac` +# ### END LIBTOOL TAG CONFIG: disable-static + +# Local Variables: +# mode:shell-script +# sh-indentation:2 +# End: +# vi:sw=2 + diff -Naur --exclude=autom4te.cache openssh-7.0p1/ltoptions.m4 openssh-7.0p1-gssapi/ltoptions.m4 --- openssh-7.0p1/ltoptions.m4 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/ltoptions.m4 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,384 @@ +# Helper functions for option handling. -*- Autoconf -*- +# +# Copyright (C) 2004, 2005, 2007, 2008, 2009 Free Software Foundation, +# Inc. +# Written by Gary V. Vaughan, 2004 +# +# This file is free software; the Free Software Foundation gives +# unlimited permission to copy and/or distribute it, with or without +# modifications, as long as this notice is preserved. + +# serial 7 ltoptions.m4 + +# This is to help aclocal find these macros, as it can't see m4_define. +AC_DEFUN([LTOPTIONS_VERSION], [m4_if([1])]) + + +# _LT_MANGLE_OPTION(MACRO-NAME, OPTION-NAME) +# ------------------------------------------ +m4_define([_LT_MANGLE_OPTION], +[[_LT_OPTION_]m4_bpatsubst($1__$2, [[^a-zA-Z0-9_]], [_])]) + + +# _LT_SET_OPTION(MACRO-NAME, OPTION-NAME) +# --------------------------------------- +# Set option OPTION-NAME for macro MACRO-NAME, and if there is a +# matching handler defined, dispatch to it. Other OPTION-NAMEs are +# saved as a flag. +m4_define([_LT_SET_OPTION], +[m4_define(_LT_MANGLE_OPTION([$1], [$2]))dnl +m4_ifdef(_LT_MANGLE_DEFUN([$1], [$2]), + _LT_MANGLE_DEFUN([$1], [$2]), + [m4_warning([Unknown $1 option `$2'])])[]dnl +]) + + +# _LT_IF_OPTION(MACRO-NAME, OPTION-NAME, IF-SET, [IF-NOT-SET]) +# ------------------------------------------------------------ +# Execute IF-SET if OPTION is set, IF-NOT-SET otherwise. +m4_define([_LT_IF_OPTION], +[m4_ifdef(_LT_MANGLE_OPTION([$1], [$2]), [$3], [$4])]) + + +# _LT_UNLESS_OPTIONS(MACRO-NAME, OPTION-LIST, IF-NOT-SET) +# ------------------------------------------------------- +# Execute IF-NOT-SET unless all options in OPTION-LIST for MACRO-NAME +# are set. +m4_define([_LT_UNLESS_OPTIONS], +[m4_foreach([_LT_Option], m4_split(m4_normalize([$2])), + [m4_ifdef(_LT_MANGLE_OPTION([$1], _LT_Option), + [m4_define([$0_found])])])[]dnl +m4_ifdef([$0_found], [m4_undefine([$0_found])], [$3 +])[]dnl +]) + + +# _LT_SET_OPTIONS(MACRO-NAME, OPTION-LIST) +# ---------------------------------------- +# OPTION-LIST is a space-separated list of Libtool options associated +# with MACRO-NAME. If any OPTION has a matching handler declared with +# LT_OPTION_DEFINE, dispatch to that macro; otherwise complain about +# the unknown option and exit. +m4_defun([_LT_SET_OPTIONS], +[# Set options +m4_foreach([_LT_Option], m4_split(m4_normalize([$2])), + [_LT_SET_OPTION([$1], _LT_Option)]) + +m4_if([$1],[LT_INIT],[ + dnl + dnl Simply set some default values (i.e off) if boolean options were not + dnl specified: + _LT_UNLESS_OPTIONS([LT_INIT], [dlopen], [enable_dlopen=no + ]) + _LT_UNLESS_OPTIONS([LT_INIT], [win32-dll], [enable_win32_dll=no + ]) + dnl + dnl If no reference was made to various pairs of opposing options, then + dnl we run the default mode handler for the pair. For example, if neither + dnl `shared' nor `disable-shared' was passed, we enable building of shared + dnl archives by default: + _LT_UNLESS_OPTIONS([LT_INIT], [shared disable-shared], [_LT_ENABLE_SHARED]) + _LT_UNLESS_OPTIONS([LT_INIT], [static disable-static], [_LT_ENABLE_STATIC]) + _LT_UNLESS_OPTIONS([LT_INIT], [pic-only no-pic], [_LT_WITH_PIC]) + _LT_UNLESS_OPTIONS([LT_INIT], [fast-install disable-fast-install], + [_LT_ENABLE_FAST_INSTALL]) + ]) +])# _LT_SET_OPTIONS + + +## --------------------------------- ## +## Macros to handle LT_INIT options. ## +## --------------------------------- ## + +# _LT_MANGLE_DEFUN(MACRO-NAME, OPTION-NAME) +# ----------------------------------------- +m4_define([_LT_MANGLE_DEFUN], +[[_LT_OPTION_DEFUN_]m4_bpatsubst(m4_toupper([$1__$2]), [[^A-Z0-9_]], [_])]) + + +# LT_OPTION_DEFINE(MACRO-NAME, OPTION-NAME, CODE) +# ----------------------------------------------- +m4_define([LT_OPTION_DEFINE], +[m4_define(_LT_MANGLE_DEFUN([$1], [$2]), [$3])[]dnl +])# LT_OPTION_DEFINE + + +# dlopen +# ------ +LT_OPTION_DEFINE([LT_INIT], [dlopen], [enable_dlopen=yes +]) + +AU_DEFUN([AC_LIBTOOL_DLOPEN], +[_LT_SET_OPTION([LT_INIT], [dlopen]) +AC_DIAGNOSE([obsolete], +[$0: Remove this warning and the call to _LT_SET_OPTION when you +put the `dlopen' option into LT_INIT's first parameter.]) +]) + +dnl aclocal-1.4 backwards compatibility: +dnl AC_DEFUN([AC_LIBTOOL_DLOPEN], []) + + +# win32-dll +# --------- +# Declare package support for building win32 dll's. +LT_OPTION_DEFINE([LT_INIT], [win32-dll], +[enable_win32_dll=yes + +case $host in +*-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-cegcc*) + AC_CHECK_TOOL(AS, as, false) + AC_CHECK_TOOL(DLLTOOL, dlltool, false) + AC_CHECK_TOOL(OBJDUMP, objdump, false) + ;; +esac + +test -z "$AS" && AS=as +_LT_DECL([], [AS], [1], [Assembler program])dnl + +test -z "$DLLTOOL" && DLLTOOL=dlltool +_LT_DECL([], [DLLTOOL], [1], [DLL creation program])dnl + +test -z "$OBJDUMP" && OBJDUMP=objdump +_LT_DECL([], [OBJDUMP], [1], [Object dumper program])dnl +])# win32-dll + +AU_DEFUN([AC_LIBTOOL_WIN32_DLL], +[AC_REQUIRE([AC_CANONICAL_HOST])dnl +_LT_SET_OPTION([LT_INIT], [win32-dll]) +AC_DIAGNOSE([obsolete], +[$0: Remove this warning and the call to _LT_SET_OPTION when you +put the `win32-dll' option into LT_INIT's first parameter.]) +]) + +dnl aclocal-1.4 backwards compatibility: +dnl AC_DEFUN([AC_LIBTOOL_WIN32_DLL], []) + + +# _LT_ENABLE_SHARED([DEFAULT]) +# ---------------------------- +# implement the --enable-shared flag, and supports the `shared' and +# `disable-shared' LT_INIT options. +# DEFAULT is either `yes' or `no'. If omitted, it defaults to `yes'. +m4_define([_LT_ENABLE_SHARED], +[m4_define([_LT_ENABLE_SHARED_DEFAULT], [m4_if($1, no, no, yes)])dnl +AC_ARG_ENABLE([shared], + [AS_HELP_STRING([--enable-shared@<:@=PKGS@:>@], + [build shared libraries @<:@default=]_LT_ENABLE_SHARED_DEFAULT[@:>@])], + [p=${PACKAGE-default} + case $enableval in + yes) enable_shared=yes ;; + no) enable_shared=no ;; + *) + enable_shared=no + # Look at the argument we got. We use all the common list separators. + lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR," + for pkg in $enableval; do + IFS="$lt_save_ifs" + if test "X$pkg" = "X$p"; then + enable_shared=yes + fi + done + IFS="$lt_save_ifs" + ;; + esac], + [enable_shared=]_LT_ENABLE_SHARED_DEFAULT) + + _LT_DECL([build_libtool_libs], [enable_shared], [0], + [Whether or not to build shared libraries]) +])# _LT_ENABLE_SHARED + +LT_OPTION_DEFINE([LT_INIT], [shared], [_LT_ENABLE_SHARED([yes])]) +LT_OPTION_DEFINE([LT_INIT], [disable-shared], [_LT_ENABLE_SHARED([no])]) + +# Old names: +AC_DEFUN([AC_ENABLE_SHARED], +[_LT_SET_OPTION([LT_INIT], m4_if([$1], [no], [disable-])[shared]) +]) + +AC_DEFUN([AC_DISABLE_SHARED], +[_LT_SET_OPTION([LT_INIT], [disable-shared]) +]) + +AU_DEFUN([AM_ENABLE_SHARED], [AC_ENABLE_SHARED($@)]) +AU_DEFUN([AM_DISABLE_SHARED], [AC_DISABLE_SHARED($@)]) + +dnl aclocal-1.4 backwards compatibility: +dnl AC_DEFUN([AM_ENABLE_SHARED], []) +dnl AC_DEFUN([AM_DISABLE_SHARED], []) + + + +# _LT_ENABLE_STATIC([DEFAULT]) +# ---------------------------- +# implement the --enable-static flag, and support the `static' and +# `disable-static' LT_INIT options. +# DEFAULT is either `yes' or `no'. If omitted, it defaults to `yes'. +m4_define([_LT_ENABLE_STATIC], +[m4_define([_LT_ENABLE_STATIC_DEFAULT], [m4_if($1, no, no, yes)])dnl +AC_ARG_ENABLE([static], + [AS_HELP_STRING([--enable-static@<:@=PKGS@:>@], + [build static libraries @<:@default=]_LT_ENABLE_STATIC_DEFAULT[@:>@])], + [p=${PACKAGE-default} + case $enableval in + yes) enable_static=yes ;; + no) enable_static=no ;; + *) + enable_static=no + # Look at the argument we got. We use all the common list separators. + lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR," + for pkg in $enableval; do + IFS="$lt_save_ifs" + if test "X$pkg" = "X$p"; then + enable_static=yes + fi + done + IFS="$lt_save_ifs" + ;; + esac], + [enable_static=]_LT_ENABLE_STATIC_DEFAULT) + + _LT_DECL([build_old_libs], [enable_static], [0], + [Whether or not to build static libraries]) +])# _LT_ENABLE_STATIC + +LT_OPTION_DEFINE([LT_INIT], [static], [_LT_ENABLE_STATIC([yes])]) +LT_OPTION_DEFINE([LT_INIT], [disable-static], [_LT_ENABLE_STATIC([no])]) + +# Old names: +AC_DEFUN([AC_ENABLE_STATIC], +[_LT_SET_OPTION([LT_INIT], m4_if([$1], [no], [disable-])[static]) +]) + +AC_DEFUN([AC_DISABLE_STATIC], +[_LT_SET_OPTION([LT_INIT], [disable-static]) +]) + +AU_DEFUN([AM_ENABLE_STATIC], [AC_ENABLE_STATIC($@)]) +AU_DEFUN([AM_DISABLE_STATIC], [AC_DISABLE_STATIC($@)]) + +dnl aclocal-1.4 backwards compatibility: +dnl AC_DEFUN([AM_ENABLE_STATIC], []) +dnl AC_DEFUN([AM_DISABLE_STATIC], []) + + + +# _LT_ENABLE_FAST_INSTALL([DEFAULT]) +# ---------------------------------- +# implement the --enable-fast-install flag, and support the `fast-install' +# and `disable-fast-install' LT_INIT options. +# DEFAULT is either `yes' or `no'. If omitted, it defaults to `yes'. +m4_define([_LT_ENABLE_FAST_INSTALL], +[m4_define([_LT_ENABLE_FAST_INSTALL_DEFAULT], [m4_if($1, no, no, yes)])dnl +AC_ARG_ENABLE([fast-install], + [AS_HELP_STRING([--enable-fast-install@<:@=PKGS@:>@], + [optimize for fast installation @<:@default=]_LT_ENABLE_FAST_INSTALL_DEFAULT[@:>@])], + [p=${PACKAGE-default} + case $enableval in + yes) enable_fast_install=yes ;; + no) enable_fast_install=no ;; + *) + enable_fast_install=no + # Look at the argument we got. We use all the common list separators. + lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR," + for pkg in $enableval; do + IFS="$lt_save_ifs" + if test "X$pkg" = "X$p"; then + enable_fast_install=yes + fi + done + IFS="$lt_save_ifs" + ;; + esac], + [enable_fast_install=]_LT_ENABLE_FAST_INSTALL_DEFAULT) + +_LT_DECL([fast_install], [enable_fast_install], [0], + [Whether or not to optimize for fast installation])dnl +])# _LT_ENABLE_FAST_INSTALL + +LT_OPTION_DEFINE([LT_INIT], [fast-install], [_LT_ENABLE_FAST_INSTALL([yes])]) +LT_OPTION_DEFINE([LT_INIT], [disable-fast-install], [_LT_ENABLE_FAST_INSTALL([no])]) + +# Old names: +AU_DEFUN([AC_ENABLE_FAST_INSTALL], +[_LT_SET_OPTION([LT_INIT], m4_if([$1], [no], [disable-])[fast-install]) +AC_DIAGNOSE([obsolete], +[$0: Remove this warning and the call to _LT_SET_OPTION when you put +the `fast-install' option into LT_INIT's first parameter.]) +]) + +AU_DEFUN([AC_DISABLE_FAST_INSTALL], +[_LT_SET_OPTION([LT_INIT], [disable-fast-install]) +AC_DIAGNOSE([obsolete], +[$0: Remove this warning and the call to _LT_SET_OPTION when you put +the `disable-fast-install' option into LT_INIT's first parameter.]) +]) + +dnl aclocal-1.4 backwards compatibility: +dnl AC_DEFUN([AC_ENABLE_FAST_INSTALL], []) +dnl AC_DEFUN([AM_DISABLE_FAST_INSTALL], []) + + +# _LT_WITH_PIC([MODE]) +# -------------------- +# implement the --with-pic flag, and support the `pic-only' and `no-pic' +# LT_INIT options. +# MODE is either `yes' or `no'. If omitted, it defaults to `both'. +m4_define([_LT_WITH_PIC], +[AC_ARG_WITH([pic], + [AS_HELP_STRING([--with-pic@<:@=PKGS@:>@], + [try to use only PIC/non-PIC objects @<:@default=use both@:>@])], + [lt_p=${PACKAGE-default} + case $withval in + yes|no) pic_mode=$withval ;; + *) + pic_mode=default + # Look at the argument we got. We use all the common list separators. + lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR," + for lt_pkg in $withval; do + IFS="$lt_save_ifs" + if test "X$lt_pkg" = "X$lt_p"; then + pic_mode=yes + fi + done + IFS="$lt_save_ifs" + ;; + esac], + [pic_mode=default]) + +test -z "$pic_mode" && pic_mode=m4_default([$1], [default]) + +_LT_DECL([], [pic_mode], [0], [What type of objects to build])dnl +])# _LT_WITH_PIC + +LT_OPTION_DEFINE([LT_INIT], [pic-only], [_LT_WITH_PIC([yes])]) +LT_OPTION_DEFINE([LT_INIT], [no-pic], [_LT_WITH_PIC([no])]) + +# Old name: +AU_DEFUN([AC_LIBTOOL_PICMODE], +[_LT_SET_OPTION([LT_INIT], [pic-only]) +AC_DIAGNOSE([obsolete], +[$0: Remove this warning and the call to _LT_SET_OPTION when you +put the `pic-only' option into LT_INIT's first parameter.]) +]) + +dnl aclocal-1.4 backwards compatibility: +dnl AC_DEFUN([AC_LIBTOOL_PICMODE], []) + +## ----------------- ## +## LTDL_INIT Options ## +## ----------------- ## + +m4_define([_LTDL_MODE], []) +LT_OPTION_DEFINE([LTDL_INIT], [nonrecursive], + [m4_define([_LTDL_MODE], [nonrecursive])]) +LT_OPTION_DEFINE([LTDL_INIT], [recursive], + [m4_define([_LTDL_MODE], [recursive])]) +LT_OPTION_DEFINE([LTDL_INIT], [subproject], + [m4_define([_LTDL_MODE], [subproject])]) + +m4_define([_LTDL_TYPE], []) +LT_OPTION_DEFINE([LTDL_INIT], [installable], + [m4_define([_LTDL_TYPE], [installable])]) +LT_OPTION_DEFINE([LTDL_INIT], [convenience], + [m4_define([_LTDL_TYPE], [convenience])]) diff -Naur --exclude=autom4te.cache openssh-7.0p1/ltsugar.m4 openssh-7.0p1-gssapi/ltsugar.m4 --- openssh-7.0p1/ltsugar.m4 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/ltsugar.m4 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,123 @@ +# ltsugar.m4 -- libtool m4 base layer. -*-Autoconf-*- +# +# Copyright (C) 2004, 2005, 2007, 2008 Free Software Foundation, Inc. +# Written by Gary V. Vaughan, 2004 +# +# This file is free software; the Free Software Foundation gives +# unlimited permission to copy and/or distribute it, with or without +# modifications, as long as this notice is preserved. + +# serial 6 ltsugar.m4 + +# This is to help aclocal find these macros, as it can't see m4_define. +AC_DEFUN([LTSUGAR_VERSION], [m4_if([0.1])]) + + +# lt_join(SEP, ARG1, [ARG2...]) +# ----------------------------- +# Produce ARG1SEPARG2...SEPARGn, omitting [] arguments and their +# associated separator. +# Needed until we can rely on m4_join from Autoconf 2.62, since all earlier +# versions in m4sugar had bugs. +m4_define([lt_join], +[m4_if([$#], [1], [], + [$#], [2], [[$2]], + [m4_if([$2], [], [], [[$2]_])$0([$1], m4_shift(m4_shift($@)))])]) +m4_define([_lt_join], +[m4_if([$#$2], [2], [], + [m4_if([$2], [], [], [[$1$2]])$0([$1], m4_shift(m4_shift($@)))])]) + + +# lt_car(LIST) +# lt_cdr(LIST) +# ------------ +# Manipulate m4 lists. +# These macros are necessary as long as will still need to support +# Autoconf-2.59 which quotes differently. +m4_define([lt_car], [[$1]]) +m4_define([lt_cdr], +[m4_if([$#], 0, [m4_fatal([$0: cannot be called without arguments])], + [$#], 1, [], + [m4_dquote(m4_shift($@))])]) +m4_define([lt_unquote], $1) + + +# lt_append(MACRO-NAME, STRING, [SEPARATOR]) +# ------------------------------------------ +# Redefine MACRO-NAME to hold its former content plus `SEPARATOR'`STRING'. +# Note that neither SEPARATOR nor STRING are expanded; they are appended +# to MACRO-NAME as is (leaving the expansion for when MACRO-NAME is invoked). +# No SEPARATOR is output if MACRO-NAME was previously undefined (different +# than defined and empty). +# +# This macro is needed until we can rely on Autoconf 2.62, since earlier +# versions of m4sugar mistakenly expanded SEPARATOR but not STRING. +m4_define([lt_append], +[m4_define([$1], + m4_ifdef([$1], [m4_defn([$1])[$3]])[$2])]) + + + +# lt_combine(SEP, PREFIX-LIST, INFIX, SUFFIX1, [SUFFIX2...]) +# ---------------------------------------------------------- +# Produce a SEP delimited list of all paired combinations of elements of +# PREFIX-LIST with SUFFIX1 through SUFFIXn. Each element of the list +# has the form PREFIXmINFIXSUFFIXn. +# Needed until we can rely on m4_combine added in Autoconf 2.62. +m4_define([lt_combine], +[m4_if(m4_eval([$# > 3]), [1], + [m4_pushdef([_Lt_sep], [m4_define([_Lt_sep], m4_defn([lt_car]))])]]dnl +[[m4_foreach([_Lt_prefix], [$2], + [m4_foreach([_Lt_suffix], + ]m4_dquote(m4_dquote(m4_shift(m4_shift(m4_shift($@)))))[, + [_Lt_sep([$1])[]m4_defn([_Lt_prefix])[$3]m4_defn([_Lt_suffix])])])])]) + + +# lt_if_append_uniq(MACRO-NAME, VARNAME, [SEPARATOR], [UNIQ], [NOT-UNIQ]) +# ----------------------------------------------------------------------- +# Iff MACRO-NAME does not yet contain VARNAME, then append it (delimited +# by SEPARATOR if supplied) and expand UNIQ, else NOT-UNIQ. +m4_define([lt_if_append_uniq], +[m4_ifdef([$1], + [m4_if(m4_index([$3]m4_defn([$1])[$3], [$3$2$3]), [-1], + [lt_append([$1], [$2], [$3])$4], + [$5])], + [lt_append([$1], [$2], [$3])$4])]) + + +# lt_dict_add(DICT, KEY, VALUE) +# ----------------------------- +m4_define([lt_dict_add], +[m4_define([$1($2)], [$3])]) + + +# lt_dict_add_subkey(DICT, KEY, SUBKEY, VALUE) +# -------------------------------------------- +m4_define([lt_dict_add_subkey], +[m4_define([$1($2:$3)], [$4])]) + + +# lt_dict_fetch(DICT, KEY, [SUBKEY]) +# ---------------------------------- +m4_define([lt_dict_fetch], +[m4_ifval([$3], + m4_ifdef([$1($2:$3)], [m4_defn([$1($2:$3)])]), + m4_ifdef([$1($2)], [m4_defn([$1($2)])]))]) + + +# lt_if_dict_fetch(DICT, KEY, [SUBKEY], VALUE, IF-TRUE, [IF-FALSE]) +# ----------------------------------------------------------------- +m4_define([lt_if_dict_fetch], +[m4_if(lt_dict_fetch([$1], [$2], [$3]), [$4], + [$5], + [$6])]) + + +# lt_dict_filter(DICT, [SUBKEY], VALUE, [SEPARATOR], KEY, [...]) +# -------------------------------------------------------------- +m4_define([lt_dict_filter], +[m4_if([$5], [], [], + [lt_join(m4_quote(m4_default([$4], [[, ]])), + lt_unquote(m4_split(m4_normalize(m4_foreach(_Lt_key, lt_car([m4_shiftn(4, $@)]), + [lt_if_dict_fetch([$1], _Lt_key, [$2], [$3], [_Lt_key ])])))))])[]dnl +]) diff -Naur --exclude=autom4te.cache openssh-7.0p1/ltversion.m4 openssh-7.0p1-gssapi/ltversion.m4 --- openssh-7.0p1/ltversion.m4 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/ltversion.m4 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,23 @@ +# ltversion.m4 -- version numbers -*- Autoconf -*- +# +# Copyright (C) 2004 Free Software Foundation, Inc. +# Written by Scott James Remnant, 2004 +# +# This file is free software; the Free Software Foundation gives +# unlimited permission to copy and/or distribute it, with or without +# modifications, as long as this notice is preserved. + +# @configure_input@ + +# serial 3337 ltversion.m4 +# This file is part of GNU Libtool + +m4_define([LT_PACKAGE_VERSION], [2.4.2]) +m4_define([LT_PACKAGE_REVISION], [1.3337]) + +AC_DEFUN([LTVERSION_VERSION], +[macro_version='2.4.2' +macro_revision='1.3337' +_LT_DECL(, macro_version, 0, [Which release of libtool.m4 was used?]) +_LT_DECL(, macro_revision, 0) +]) diff -Naur --exclude=autom4te.cache openssh-7.0p1/lt~obsolete.m4 openssh-7.0p1-gssapi/lt~obsolete.m4 --- openssh-7.0p1/lt~obsolete.m4 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/lt~obsolete.m4 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,98 @@ +# lt~obsolete.m4 -- aclocal satisfying obsolete definitions. -*-Autoconf-*- +# +# Copyright (C) 2004, 2005, 2007, 2009 Free Software Foundation, Inc. +# Written by Scott James Remnant, 2004. +# +# This file is free software; the Free Software Foundation gives +# unlimited permission to copy and/or distribute it, with or without +# modifications, as long as this notice is preserved. + +# serial 5 lt~obsolete.m4 + +# These exist entirely to fool aclocal when bootstrapping libtool. +# +# In the past libtool.m4 has provided macros via AC_DEFUN (or AU_DEFUN) +# which have later been changed to m4_define as they aren't part of the +# exported API, or moved to Autoconf or Automake where they belong. +# +# The trouble is, aclocal is a bit thick. It'll see the old AC_DEFUN +# in /usr/share/aclocal/libtool.m4 and remember it, then when it sees us +# using a macro with the same name in our local m4/libtool.m4 it'll +# pull the old libtool.m4 in (it doesn't see our shiny new m4_define +# and doesn't know about Autoconf macros at all.) +# +# So we provide this file, which has a silly filename so it's always +# included after everything else. This provides aclocal with the +# AC_DEFUNs it wants, but when m4 processes it, it doesn't do anything +# because those macros already exist, or will be overwritten later. +# We use AC_DEFUN over AU_DEFUN for compatibility with aclocal-1.6. +# +# Anytime we withdraw an AC_DEFUN or AU_DEFUN, remember to add it here. +# Yes, that means every name once taken will need to remain here until +# we give up compatibility with versions before 1.7, at which point +# we need to keep only those names which we still refer to. + +# This is to help aclocal find these macros, as it can't see m4_define. +AC_DEFUN([LTOBSOLETE_VERSION], [m4_if([1])]) + +m4_ifndef([AC_LIBTOOL_LINKER_OPTION], [AC_DEFUN([AC_LIBTOOL_LINKER_OPTION])]) +m4_ifndef([AC_PROG_EGREP], [AC_DEFUN([AC_PROG_EGREP])]) +m4_ifndef([_LT_AC_PROG_ECHO_BACKSLASH], [AC_DEFUN([_LT_AC_PROG_ECHO_BACKSLASH])]) +m4_ifndef([_LT_AC_SHELL_INIT], [AC_DEFUN([_LT_AC_SHELL_INIT])]) +m4_ifndef([_LT_AC_SYS_LIBPATH_AIX], [AC_DEFUN([_LT_AC_SYS_LIBPATH_AIX])]) +m4_ifndef([_LT_PROG_LTMAIN], [AC_DEFUN([_LT_PROG_LTMAIN])]) +m4_ifndef([_LT_AC_TAGVAR], [AC_DEFUN([_LT_AC_TAGVAR])]) +m4_ifndef([AC_LTDL_ENABLE_INSTALL], [AC_DEFUN([AC_LTDL_ENABLE_INSTALL])]) +m4_ifndef([AC_LTDL_PREOPEN], [AC_DEFUN([AC_LTDL_PREOPEN])]) +m4_ifndef([_LT_AC_SYS_COMPILER], [AC_DEFUN([_LT_AC_SYS_COMPILER])]) +m4_ifndef([_LT_AC_LOCK], [AC_DEFUN([_LT_AC_LOCK])]) +m4_ifndef([AC_LIBTOOL_SYS_OLD_ARCHIVE], [AC_DEFUN([AC_LIBTOOL_SYS_OLD_ARCHIVE])]) +m4_ifndef([_LT_AC_TRY_DLOPEN_SELF], [AC_DEFUN([_LT_AC_TRY_DLOPEN_SELF])]) +m4_ifndef([AC_LIBTOOL_PROG_CC_C_O], [AC_DEFUN([AC_LIBTOOL_PROG_CC_C_O])]) +m4_ifndef([AC_LIBTOOL_SYS_HARD_LINK_LOCKS], [AC_DEFUN([AC_LIBTOOL_SYS_HARD_LINK_LOCKS])]) +m4_ifndef([AC_LIBTOOL_OBJDIR], [AC_DEFUN([AC_LIBTOOL_OBJDIR])]) +m4_ifndef([AC_LTDL_OBJDIR], [AC_DEFUN([AC_LTDL_OBJDIR])]) +m4_ifndef([AC_LIBTOOL_PROG_LD_HARDCODE_LIBPATH], [AC_DEFUN([AC_LIBTOOL_PROG_LD_HARDCODE_LIBPATH])]) +m4_ifndef([AC_LIBTOOL_SYS_LIB_STRIP], [AC_DEFUN([AC_LIBTOOL_SYS_LIB_STRIP])]) +m4_ifndef([AC_PATH_MAGIC], [AC_DEFUN([AC_PATH_MAGIC])]) +m4_ifndef([AC_PROG_LD_GNU], [AC_DEFUN([AC_PROG_LD_GNU])]) +m4_ifndef([AC_PROG_LD_RELOAD_FLAG], [AC_DEFUN([AC_PROG_LD_RELOAD_FLAG])]) +m4_ifndef([AC_DEPLIBS_CHECK_METHOD], [AC_DEFUN([AC_DEPLIBS_CHECK_METHOD])]) +m4_ifndef([AC_LIBTOOL_PROG_COMPILER_NO_RTTI], [AC_DEFUN([AC_LIBTOOL_PROG_COMPILER_NO_RTTI])]) +m4_ifndef([AC_LIBTOOL_SYS_GLOBAL_SYMBOL_PIPE], [AC_DEFUN([AC_LIBTOOL_SYS_GLOBAL_SYMBOL_PIPE])]) +m4_ifndef([AC_LIBTOOL_PROG_COMPILER_PIC], [AC_DEFUN([AC_LIBTOOL_PROG_COMPILER_PIC])]) +m4_ifndef([AC_LIBTOOL_PROG_LD_SHLIBS], [AC_DEFUN([AC_LIBTOOL_PROG_LD_SHLIBS])]) +m4_ifndef([AC_LIBTOOL_POSTDEP_PREDEP], [AC_DEFUN([AC_LIBTOOL_POSTDEP_PREDEP])]) +m4_ifndef([LT_AC_PROG_EGREP], [AC_DEFUN([LT_AC_PROG_EGREP])]) +m4_ifndef([LT_AC_PROG_SED], [AC_DEFUN([LT_AC_PROG_SED])]) +m4_ifndef([_LT_CC_BASENAME], [AC_DEFUN([_LT_CC_BASENAME])]) +m4_ifndef([_LT_COMPILER_BOILERPLATE], [AC_DEFUN([_LT_COMPILER_BOILERPLATE])]) +m4_ifndef([_LT_LINKER_BOILERPLATE], [AC_DEFUN([_LT_LINKER_BOILERPLATE])]) +m4_ifndef([_AC_PROG_LIBTOOL], [AC_DEFUN([_AC_PROG_LIBTOOL])]) +m4_ifndef([AC_LIBTOOL_SETUP], [AC_DEFUN([AC_LIBTOOL_SETUP])]) +m4_ifndef([_LT_AC_CHECK_DLFCN], [AC_DEFUN([_LT_AC_CHECK_DLFCN])]) +m4_ifndef([AC_LIBTOOL_SYS_DYNAMIC_LINKER], [AC_DEFUN([AC_LIBTOOL_SYS_DYNAMIC_LINKER])]) +m4_ifndef([_LT_AC_TAGCONFIG], [AC_DEFUN([_LT_AC_TAGCONFIG])]) +m4_ifndef([AC_DISABLE_FAST_INSTALL], [AC_DEFUN([AC_DISABLE_FAST_INSTALL])]) +m4_ifndef([_LT_AC_LANG_CXX], [AC_DEFUN([_LT_AC_LANG_CXX])]) +m4_ifndef([_LT_AC_LANG_F77], [AC_DEFUN([_LT_AC_LANG_F77])]) +m4_ifndef([_LT_AC_LANG_GCJ], [AC_DEFUN([_LT_AC_LANG_GCJ])]) +m4_ifndef([AC_LIBTOOL_LANG_C_CONFIG], [AC_DEFUN([AC_LIBTOOL_LANG_C_CONFIG])]) +m4_ifndef([_LT_AC_LANG_C_CONFIG], [AC_DEFUN([_LT_AC_LANG_C_CONFIG])]) +m4_ifndef([AC_LIBTOOL_LANG_CXX_CONFIG], [AC_DEFUN([AC_LIBTOOL_LANG_CXX_CONFIG])]) +m4_ifndef([_LT_AC_LANG_CXX_CONFIG], [AC_DEFUN([_LT_AC_LANG_CXX_CONFIG])]) +m4_ifndef([AC_LIBTOOL_LANG_F77_CONFIG], [AC_DEFUN([AC_LIBTOOL_LANG_F77_CONFIG])]) +m4_ifndef([_LT_AC_LANG_F77_CONFIG], [AC_DEFUN([_LT_AC_LANG_F77_CONFIG])]) +m4_ifndef([AC_LIBTOOL_LANG_GCJ_CONFIG], [AC_DEFUN([AC_LIBTOOL_LANG_GCJ_CONFIG])]) +m4_ifndef([_LT_AC_LANG_GCJ_CONFIG], [AC_DEFUN([_LT_AC_LANG_GCJ_CONFIG])]) +m4_ifndef([AC_LIBTOOL_LANG_RC_CONFIG], [AC_DEFUN([AC_LIBTOOL_LANG_RC_CONFIG])]) +m4_ifndef([_LT_AC_LANG_RC_CONFIG], [AC_DEFUN([_LT_AC_LANG_RC_CONFIG])]) +m4_ifndef([AC_LIBTOOL_CONFIG], [AC_DEFUN([AC_LIBTOOL_CONFIG])]) +m4_ifndef([_LT_AC_FILE_LTDLL_C], [AC_DEFUN([_LT_AC_FILE_LTDLL_C])]) +m4_ifndef([_LT_REQUIRED_DARWIN_CHECKS], [AC_DEFUN([_LT_REQUIRED_DARWIN_CHECKS])]) +m4_ifndef([_LT_AC_PROG_CXXCPP], [AC_DEFUN([_LT_AC_PROG_CXXCPP])]) +m4_ifndef([_LT_PREPARE_SED_QUOTE_VARS], [AC_DEFUN([_LT_PREPARE_SED_QUOTE_VARS])]) +m4_ifndef([_LT_PROG_ECHO_BACKSLASH], [AC_DEFUN([_LT_PROG_ECHO_BACKSLASH])]) +m4_ifndef([_LT_PROG_F77], [AC_DEFUN([_LT_PROG_F77])]) +m4_ifndef([_LT_PROG_FC], [AC_DEFUN([_LT_PROG_FC])]) +m4_ifndef([_LT_PROG_CXX], [AC_DEFUN([_LT_PROG_CXX])]) diff -Naur --exclude=autom4te.cache openssh-7.0p1/misc.c openssh-7.0p1-gssapi/misc.c --- openssh-7.0p1/misc.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/misc.c 2015-08-12 17:11:07.000000000 -0500 @@ -160,11 +160,14 @@ #define WHITESPACE " \t\r\n" #define QUOTE "\"" +/* Characters considered as quotations. */ +#define QUOTES "'\"" + /* return next token in configuration line */ char * strdelim(char **s) { - char *old; + char *old, *p, *q; int wspace = 0; if (*s == NULL) @@ -172,6 +175,21 @@ old = *s; + if ((q=strchr(QUOTES, (int) *old)) && *q) + { + /* find next quote character, point old to start of quoted + * string */ + for (p = ++old;*p && *p!=*q; p++) + ; + + /* find start of next token */ + *s = (*p) ? p + strspn(p + 1, WHITESPACE) + 1 : NULL; + + /* terminate 'old' token */ + *p = '\0'; + return (old); + } + *s = strpbrk(*s, WHITESPACE QUOTE "="); if (*s == NULL) return (old); @@ -227,6 +245,20 @@ return copy; } +void +pwfree(struct passwd *pw) +{ + free(pw->pw_name); + free(pw->pw_passwd); + free(pw->pw_gecos); +#ifdef HAVE_PW_CLASS_IN_PASSWD + free(pw->pw_class); +#endif + free(pw->pw_dir); + free(pw->pw_shell); + free(pw); +} + /* * Convert ASCII string to TCP/IP port number. * Port must be >=0 and <=65535. diff -Naur --exclude=autom4te.cache openssh-7.0p1/misc.h openssh-7.0p1-gssapi/misc.h --- openssh-7.0p1/misc.h 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/misc.h 2015-08-12 17:11:07.000000000 -0500 @@ -61,6 +61,7 @@ void sock_set_v6only(int); struct passwd *pwcopy(struct passwd *); +void pwfree(struct passwd *); const char *ssh_gai_strerror(int); typedef struct arglist arglist; diff -Naur --exclude=autom4te.cache openssh-7.0p1/modp_burl.c openssh-7.0p1-gssapi/modp_burl.c --- openssh-7.0p1/modp_burl.c 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/modp_burl.c 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,200 @@ +/* -*- mode: c++; c-basic-offset: 4; indent-tabs-mode: nil; tab-width: 4 -*- */ +/* vi: set expandtab shiftwidth=4 tabstop=4: */ + +/** + * \file + *
+ * BFASTURL.c High performance URL encoder/decoder
+ * http://code.google.com/p/stringencoders/
+ *
+ * Copyright © 2006,2007  Nick Galbreath -- nickg [at] modp [dot] com
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without
+ * modification, are permitted provided that the following conditions are
+ * met:
+ *
+ *   Redistributions of source code must retain the above copyright
+ *   notice, this list of conditions and the following disclaimer.
+ *
+ *   Redistributions in binary form must reproduce the above copyright
+ *   notice, this list of conditions and the following disclaimer in the
+ *   documentation and/or other materials provided with the distribution.
+ *
+ *   Neither the name of the modp.com nor the names of its
+ *   contributors may be used to endorse or promote products derived from
+ *   this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+ * "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
+ * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
+ * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
+ * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
+ * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
+ * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+ * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+ * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+ * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
+ * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+ * This is the standard "new" BSD license:
+ * http://www.opensource.org/licenses/bsd-license.php
+ * 
+ */ + +#include "includes.h" +#ifdef NERSC_MOD + +#include "modp_burl.h" +#include "modp_stdint.h" +#include "modp_burl_data.h" + +int modp_burl_encode(char* dest, const char* src, int len) +{ + + const char* deststart = dest; + const uint8_t* s = (const uint8_t*)src; + const uint8_t* srcend = s + len; + char c; + uint8_t x; + + while (s < srcend) { + x = *s++; + c = (char)gsUrlEncodeMap[x]; + if (c) { + *dest++ = c; + } else { + *dest++ = '%'; + *dest++ = (char)gsHexEncodeMap1[x]; + *dest++ = (char)gsHexEncodeMap2[x]; + /* + is the equiv of this + static const char sHexChars[] = "0123456789ABCDEF"; + *dest++ = (char)sHexChars[x >> 4]; + *dest++ = (char)sHexChars[x & 0x0F]; + */ + } + } + *dest = '\0'; + return (int)(dest - deststart); // compute "strlen" of dest. +} + +/** + * The implementation is identical except it uses a + * different array + */ +int modp_burl_min_encode(char* dest, const char* src, int len) +{ + + const char* deststart = dest; + const uint8_t* s = (const uint8_t*)src; + const uint8_t* srcend = s + len; + char c; + uint8_t x; + + while (s < srcend) { + x = *s++; + c = (char)(gsUrlEncodeMinMap[x]); /** CHANGE HERE **/ + if (c) { + *dest++ = c; + } else { + *dest++ = '%'; + *dest++ = (char) gsHexEncodeMap1[x]; + *dest++ = (char)(gsHexEncodeMap2[x]); + /* + is the equiv of this + static const char sHexChars[] = "0123456789ABCDEF"; + *dest++ = sHexChars[x >> 4]; + *dest++ = sHexChars[x & 0x0F]; + */ + } + } + *dest = '\0'; + return (int)(dest - deststart); // compute "strlen" of dest. +} + +/** + * Give exact size of encoded output string + * without doing the encoding + */ +int modp_burl_encode_strlen(const char* src, const int len) +{ + int count = 0; + const char* srcend = src + len; + while (src < srcend) { + if (gsUrlEncodeMap[ (uint8_t) *src++]) { + count++; + } else { + count += 3; + } + } + return count; +} + +/** + * Give exact size of encoded output string + * without doing the encoding + */ +int modp_burl_min_encode_strlen(const char* src, const int len) +{ + int count = 0; + const char* srcend = src + len; + while (src < srcend) { + if (gsUrlEncodeMinMap[ (uint8_t) *src++]) { + count++; + } else { + count += 3; + } + } + return count; +} + +int modp_burl_decode(char* dest, const char* s, int len) +{ + uint32_t d = 0; // used for decoding %XX + const uint8_t* src = (const uint8_t*) s; + const char* deststart = dest; + const uint8_t* srcend = (const uint8_t*)(src + len); + const uint8_t* srcendloop = (const uint8_t*)(srcend - 2); + + while (src < srcendloop) { + switch (*src) { + case '+': + *dest++ = ' '; + src++; + break; + case '%': + d = (gsHexDecodeMap[(uint32_t)(*(src + 1))] << 4) | + gsHexDecodeMap[(uint32_t)(*(src + 2))]; + if (d < 256) { // if one of the hex chars is bad, d >= 256 + *dest = (char) d; + dest++; + src += 3; + } else { + *dest++ = '%'; + src++; + } + break; + default: + *dest++ = (char) *src++; + } + } + + // handle last two chars + // dont decode "%XX" + while (src < srcend) { + switch (*src) { + case '+': + *dest++ = ' '; + src++; + break; + default: + *dest++ = (char)( *src++); + } + } + + *dest = '\0'; + return (int)(dest - deststart); // compute "strlen" of dest. +} + +#endif /* NERSC_MOD */ diff -Naur --exclude=autom4te.cache openssh-7.0p1/modp_burl.h openssh-7.0p1-gssapi/modp_burl.h --- openssh-7.0p1/modp_burl.h 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/modp_burl.h 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,211 @@ +/* -*- mode: c++; c-basic-offset: 4; indent-tabs-mode: nil; tab-width: 4 -*- */ +/* vi: set expandtab shiftwidth=4 tabstop=4: */ + +/** + * \file + *
+ * High Performance URL Encoder/Decoder
+ *
+ * Copyright © 2006, 2007  Nick Galbreath -- nickg [at] modp [dot] com
+ * All rights reserved.
+ *
+ * http://code.google.com/p/stringencoders/
+ *
+ * Released under bsd license.  See bfast64.c for details.
+ * 
+ */ + +#ifndef COM_MODP_STRINGENCODERS_BURL +#define COM_MODP_STRINGENCODERS_BURL + +#ifdef __cplusplus +#define BEGIN_C extern "C" { +#define END_C } +#else +#define BEGIN_C +#define END_C +#endif + +BEGIN_C + +/** + * Url encode a string. This uses a very strict definition of url + * encoding. The only characters NOT encoded are A-Z, a-z, 0-9, "-", + * "_", ".", along with the space char getting mapped to "+". + * Everything else is escaped using "%HEXHEX" format. This is + * identical to the implementation of php's urlencode and nearly + * identical to Java's UrlEncoder class (they do not escape '*' for + * some reason). + * + * \param[out] dest output string. Must + * \param[in] str The input string + * \param[in] len The length of the input string, excluding any + * final null byte. + */ +int modp_burl_encode(char* dest, const char* str, int len); + +/** + * Url encode a string. This uses a minimal definition of url + * encoding. This works similar to the previous function except '~', + * '!', '$', '\'', '(', ')', '*', ',', ';', ':', '@', '/', '?' are NOT + * escaped. This will allow decoding by standard url-decoders and + * make the encoded urls more readable. + * + * \param[out] dest output string. Must + * \param[in] str The input string + * \param[in] len The length of the input string, excluding any + * final null byte. + */ +int modp_burl_min_encode(char* dest, const char* str, int len); + +/** \brief get size of output string w/o doing actual encoding + * + * \param[in] src input string, not null + * \param[in] len length of input string + * \return length of output string NOT including any final null byte + */ +int modp_burl_min_encode_strlen(const char* src, const int len); + +/** + * Provides the maximum size for output string given + * and input size of A bytes. + */ +#define modp_burl_encode_len(A) (3*A + 1) + +/** + * Given the exact size of output string. + * + * Can be used to allocate the right amount of memory for + * modp_burl_encode. Be sure to add 1 byte for final null. + * + * This is somewhat expensive since it examines every character + * in the input string + * + * \param[in] str The input string + * \param[in] len THe length of the input string, excluding any + * final null byte (i.e. strlen(str)) + * \return the size of the output string, excluding the final + * null byte. + */ +int modp_burl_encode_strlen(const char* str, const int len); + +/** + * URL Decode a string + * + * \param[out] dest The output string. Must be at least (len + 1) + * bytes allocated. This may be the same as the input buffer. + * \param[in] str The input string that is URL encoded. + * \param[in] len The length of the input string (excluding final + * null byte) + * \return the strlen of the output string. + */ +int modp_burl_decode(char* dest, const char* str, int len); + +/** + * Returns memory required to decoded a url-encoded + * string of length A. + * + */ +#define modp_burl_decode_len(A) (A + 1) + +END_C + +#ifdef __cplusplus +#include +#include + +namespace modp { + + inline std::string url_encode(const char* s, size_t len) + { + std::string x(modp_burl_encode_len(len), '\0'); + int d = modp_burl_encode(const_cast(x.data()), s, len); + x.erase(d, std::string::npos); + return x; + } + + inline std::string url_encode(const char* s) + { + return url_encode(s, strlen(s)); + } + + inline std::string url_encode(const std::string& s) + { + return url_encode(s.data(), s.size()); + } + + /** + * Standard (maximal) url encoding. + * + * \param[in,out] s the string to be encoded + * \return a reference to the input string + */ + inline std::string& url_encode(std::string& s) + { + std::string x(url_encode(s.data(), s.size())); + s.swap(x); + return s; + } + + /** + * Minimal Url Encoding + * + * \param[in,out] s the string to be encoded + * \return a reference to the input string + */ + inline std::string& url_min_encode(std::string& s) + { + std::string x(modp_burl_encode_len(s.size()), '\0'); + int d = modp_burl_min_encode(const_cast(x.data()), s.data(), s.size()); + x.erase(d, std::string::npos); + s.swap(x); + return s; + } + + inline std::string url_min_encode(const std::string& s) + { + std::string x(modp_burl_encode_len(s.size()), '\0'); + int d = modp_burl_min_encode(const_cast(x.data()), s.data(), s.size()); + x.erase(d, std::string::npos); + return x; + } + + /** + * Url decode a string. + * This function does not allocate memory. + * + * \param[in,out] s the string to be decoded + * \return a reference to the input string. + * There is no error case, bad characters are passed through + */ + inline std::string& url_decode(std::string& s) + { + int d = modp_burl_decode(const_cast(s.data()), s.data(), s.size()); + s.erase(d, std::string::npos); + return s; + } + + inline std::string url_decode(const char* str) + { + std::string s(str); + url_decode(s); + return s; + } + + inline std::string url_decode(const char* str, size_t len) + { + std::string s(str, len); + url_decode(s); + return s; + } + + inline std::string url_decode(const std::string& s) + { + std::string x(s); + url_decode(x); + return x; + } +} +#endif + +#endif diff -Naur --exclude=autom4te.cache openssh-7.0p1/modp_burl_data.h openssh-7.0p1-gssapi/modp_burl_data.h --- openssh-7.0p1/modp_burl_data.h 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/modp_burl_data.h 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,141 @@ +static const unsigned char gsUrlEncodeMap[256] = { +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '+', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '-', '.', '\0', '0', '1', + '2', '3', '4', '5', '6', '7', '8', '9', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', 'A', 'B', 'C', 'D', 'E', + 'F', 'G', 'H', 'I', 'J', 'K', 'L', 'M', 'N', 'O', + 'P', 'Q', 'R', 'S', 'T', 'U', 'V', 'W', 'X', 'Y', + 'Z', '\0', '\0', '\0', '\0', '_', '\0', 'a', 'b', 'c', + 'd', 'e', 'f', 'g', 'h', 'i', 'j', 'k', 'l', 'm', + 'n', 'o', 'p', 'q', 'r', 's', 't', 'u', 'v', 'w', + 'x', 'y', 'z', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0' +}; + +static const unsigned char gsUrlEncodeMinMap[256] = { +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '+', '!', '\0', '\0', '$', '\0', '\0', '\0', + '(', ')', '*', '\0', ',', '-', '.', '/', '0', '1', + '2', '3', '4', '5', '6', '7', '8', '9', ':', ';', +'\0', '\0', '\0', '?', '@', 'A', 'B', 'C', 'D', 'E', + 'F', 'G', 'H', 'I', 'J', 'K', 'L', 'M', 'N', 'O', + 'P', 'Q', 'R', 'S', 'T', 'U', 'V', 'W', 'X', 'Y', + 'Z', '\0', '\0', '\0', '\0', '_', '\0', 'a', 'b', 'c', + 'd', 'e', 'f', 'g', 'h', 'i', 'j', 'k', 'l', 'm', + 'n', 'o', 'p', 'q', 'r', 's', 't', 'u', 'v', 'w', + 'x', 'y', 'z', '\0', '\0', '\0', '~', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', +'\0', '\0', '\0', '\0', '\0', '\0' +}; + +static const uint32_t gsHexDecodeMap[256] = { +256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, +256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, +256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, +256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, + 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 256, 256, +256, 256, 256, 256, 256, 10, 11, 12, 13, 14, 15, 256, +256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, +256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, +256, 10, 11, 12, 13, 14, 15, 256, 256, 256, 256, 256, +256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, +256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, +256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, +256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, +256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, +256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, +256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, +256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, +256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, +256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, +256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, +256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, 256, +256, 256, 256, 256 +}; + +static const unsigned char gsHexEncodeMap1[256] = { + '0', '0', '0', '0', '0', '0', '0', '0', '0', '0', + '0', '0', '0', '0', '0', '0', '1', '1', '1', '1', + '1', '1', '1', '1', '1', '1', '1', '1', '1', '1', + '1', '1', '2', '2', '2', '2', '2', '2', '2', '2', + '2', '2', '2', '2', '2', '2', '2', '2', '3', '3', + '3', '3', '3', '3', '3', '3', '3', '3', '3', '3', + '3', '3', '3', '3', '4', '4', '4', '4', '4', '4', + '4', '4', '4', '4', '4', '4', '4', '4', '4', '4', + '5', '5', '5', '5', '5', '5', '5', '5', '5', '5', + '5', '5', '5', '5', '5', '5', '6', '6', '6', '6', + '6', '6', '6', '6', '6', '6', '6', '6', '6', '6', + '6', '6', '7', '7', '7', '7', '7', '7', '7', '7', + '7', '7', '7', '7', '7', '7', '7', '7', '8', '8', + '8', '8', '8', '8', '8', '8', '8', '8', '8', '8', + '8', '8', '8', '8', '9', '9', '9', '9', '9', '9', + '9', '9', '9', '9', '9', '9', '9', '9', '9', '9', + 'A', 'A', 'A', 'A', 'A', 'A', 'A', 'A', 'A', 'A', + 'A', 'A', 'A', 'A', 'A', 'A', 'B', 'B', 'B', 'B', + 'B', 'B', 'B', 'B', 'B', 'B', 'B', 'B', 'B', 'B', + 'B', 'B', 'C', 'C', 'C', 'C', 'C', 'C', 'C', 'C', + 'C', 'C', 'C', 'C', 'C', 'C', 'C', 'C', 'D', 'D', + 'D', 'D', 'D', 'D', 'D', 'D', 'D', 'D', 'D', 'D', + 'D', 'D', 'D', 'D', 'E', 'E', 'E', 'E', 'E', 'E', + 'E', 'E', 'E', 'E', 'E', 'E', 'E', 'E', 'E', 'E', + 'F', 'F', 'F', 'F', 'F', 'F', 'F', 'F', 'F', 'F', + 'F', 'F', 'F', 'F', 'F', 'F' +}; + +static const unsigned char gsHexEncodeMap2[256] = { + '0', '1', '2', '3', '4', '5', '6', '7', '8', '9', + 'A', 'B', 'C', 'D', 'E', 'F', '0', '1', '2', '3', + '4', '5', '6', '7', '8', '9', 'A', 'B', 'C', 'D', + 'E', 'F', '0', '1', '2', '3', '4', '5', '6', '7', + '8', '9', 'A', 'B', 'C', 'D', 'E', 'F', '0', '1', + '2', '3', '4', '5', '6', '7', '8', '9', 'A', 'B', + 'C', 'D', 'E', 'F', '0', '1', '2', '3', '4', '5', + '6', '7', '8', '9', 'A', 'B', 'C', 'D', 'E', 'F', + '0', '1', '2', '3', '4', '5', '6', '7', '8', '9', + 'A', 'B', 'C', 'D', 'E', 'F', '0', '1', '2', '3', + '4', '5', '6', '7', '8', '9', 'A', 'B', 'C', 'D', + 'E', 'F', '0', '1', '2', '3', '4', '5', '6', '7', + '8', '9', 'A', 'B', 'C', 'D', 'E', 'F', '0', '1', + '2', '3', '4', '5', '6', '7', '8', '9', 'A', 'B', + 'C', 'D', 'E', 'F', '0', '1', '2', '3', '4', '5', + '6', '7', '8', '9', 'A', 'B', 'C', 'D', 'E', 'F', + '0', '1', '2', '3', '4', '5', '6', '7', '8', '9', + 'A', 'B', 'C', 'D', 'E', 'F', '0', '1', '2', '3', + '4', '5', '6', '7', '8', '9', 'A', 'B', 'C', 'D', + 'E', 'F', '0', '1', '2', '3', '4', '5', '6', '7', + '8', '9', 'A', 'B', 'C', 'D', 'E', 'F', '0', '1', + '2', '3', '4', '5', '6', '7', '8', '9', 'A', 'B', + 'C', 'D', 'E', 'F', '0', '1', '2', '3', '4', '5', + '6', '7', '8', '9', 'A', 'B', 'C', 'D', 'E', 'F', + '0', '1', '2', '3', '4', '5', '6', '7', '8', '9', + 'A', 'B', 'C', 'D', 'E', 'F' +}; + diff -Naur --exclude=autom4te.cache openssh-7.0p1/modp_stdint.h openssh-7.0p1-gssapi/modp_stdint.h --- openssh-7.0p1/modp_stdint.h 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/modp_stdint.h 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,21 @@ +/* vi: set ft=c expandtab shiftwidth=4 tabstop=4: */ +#ifndef MODP_STDINT_H_ +#define MODP_STDINT_H_ + +#ifndef _WIN32 +# include +#else +/* win64 is llp64 so these are the same for 32/64bit + so no check for _WIN64 is required. + */ + typedef unsigned char uint8_t; + typedef signed char int8_t; + typedef unsigned short uint16_t; + typedef signed short int16_t; + typedef unsigned int uint32_t; + typedef signed int int32_t; + typedef unsigned __int64 uint64_t; + typedef signed __int64 int64_t; +#endif + +#endif /* MODP_STDINT_H_ */ diff -Naur --exclude=autom4te.cache openssh-7.0p1/monitor.c openssh-7.0p1-gssapi/monitor.c --- openssh-7.0p1/monitor.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/monitor.c 2015-08-12 17:11:07.000000000 -0500 @@ -157,6 +157,11 @@ int mm_answer_gss_accept_ctx(int, Buffer *); int mm_answer_gss_userok(int, Buffer *); int mm_answer_gss_checkmic(int, Buffer *); +int mm_answer_gss_sign(int, Buffer *); +int mm_answer_gss_error(int, Buffer *); +int mm_answer_gss_indicate_mechs(int, Buffer *); +int mm_answer_gss_localname(int, Buffer *); +int mm_answer_gss_updatecreds(int, Buffer *); #endif #ifdef SSH_AUDIT_EVENTS @@ -204,12 +209,12 @@ {MONITOR_REQ_MODULI, MON_ONCE, mm_answer_moduli}, #endif {MONITOR_REQ_SIGN, MON_ONCE, mm_answer_sign}, - {MONITOR_REQ_PWNAM, MON_ONCE, mm_answer_pwnamallow}, + {MONITOR_REQ_PWNAM, MON_AUTH, mm_answer_pwnamallow}, {MONITOR_REQ_AUTHSERV, MON_ONCE, mm_answer_authserv}, {MONITOR_REQ_AUTH2_READ_BANNER, MON_ONCE, mm_answer_auth2_read_banner}, {MONITOR_REQ_AUTHPASSWORD, MON_AUTH, mm_answer_authpassword}, #ifdef USE_PAM - {MONITOR_REQ_PAM_START, MON_ONCE, mm_answer_pam_start}, + {MONITOR_REQ_PAM_START, MON_ISAUTH, mm_answer_pam_start}, {MONITOR_REQ_PAM_ACCOUNT, 0, mm_answer_pam_account}, {MONITOR_REQ_PAM_INIT_CTX, MON_ISAUTH, mm_answer_pam_init_ctx}, {MONITOR_REQ_PAM_QUERY, MON_ISAUTH, mm_answer_pam_query}, @@ -234,11 +239,23 @@ {MONITOR_REQ_GSSSTEP, MON_ISAUTH, mm_answer_gss_accept_ctx}, {MONITOR_REQ_GSSUSEROK, MON_AUTH, mm_answer_gss_userok}, {MONITOR_REQ_GSSCHECKMIC, MON_ISAUTH, mm_answer_gss_checkmic}, + {MONITOR_REQ_GSSSIGN, MON_ONCE, mm_answer_gss_sign}, + {MONITOR_REQ_GSSERR, MON_ISAUTH | MON_ONCE, mm_answer_gss_error}, + {MONITOR_REQ_GSSMECHS, MON_ISAUTH, mm_answer_gss_indicate_mechs}, + {MONITOR_REQ_GSSLOCALNAME, MON_ISAUTH, mm_answer_gss_localname}, #endif {0, 0, NULL} }; struct mon_table mon_dispatch_postauth20[] = { +#ifdef GSSAPI + {MONITOR_REQ_GSSSETUP, 0, mm_answer_gss_setup_ctx}, + {MONITOR_REQ_GSSSTEP, 0, mm_answer_gss_accept_ctx}, + {MONITOR_REQ_GSSSIGN, 0, mm_answer_gss_sign}, + {MONITOR_REQ_GSSERR, 0, mm_answer_gss_error}, + {MONITOR_REQ_GSSMECHS, 0, mm_answer_gss_indicate_mechs}, + {MONITOR_REQ_GSSUPCREDS, 0, mm_answer_gss_updatecreds}, +#endif #ifdef WITH_OPENSSL {MONITOR_REQ_MODULI, 0, mm_answer_moduli}, #endif @@ -271,8 +288,15 @@ {MONITOR_REQ_SKEYQUERY, MON_ISAUTH, mm_answer_skeyquery}, {MONITOR_REQ_SKEYRESPOND, MON_AUTH, mm_answer_skeyrespond}, #endif +#ifdef GSSAPI + {MONITOR_REQ_GSSSETUP, MON_ISAUTH, mm_answer_gss_setup_ctx}, + {MONITOR_REQ_GSSSTEP, MON_ISAUTH, mm_answer_gss_accept_ctx}, + {MONITOR_REQ_GSSSIGN, MON_ONCE, mm_answer_gss_sign}, + {MONITOR_REQ_GSSUSEROK, MON_AUTH, mm_answer_gss_userok}, + {MONITOR_REQ_GSSMECHS, MON_ISAUTH, mm_answer_gss_indicate_mechs}, +#endif #ifdef USE_PAM - {MONITOR_REQ_PAM_START, MON_ONCE, mm_answer_pam_start}, + {MONITOR_REQ_PAM_START, MON_ISAUTH, mm_answer_pam_start}, {MONITOR_REQ_PAM_ACCOUNT, 0, mm_answer_pam_account}, {MONITOR_REQ_PAM_INIT_CTX, MON_ISAUTH, mm_answer_pam_init_ctx}, {MONITOR_REQ_PAM_QUERY, MON_ISAUTH, mm_answer_pam_query}, @@ -353,6 +377,12 @@ /* Permit requests for moduli and signatures */ monitor_permit(mon_dispatch, MONITOR_REQ_MODULI, 1); monitor_permit(mon_dispatch, MONITOR_REQ_SIGN, 1); +#ifdef GSSAPI + /* and for the GSSAPI key exchange */ + monitor_permit(mon_dispatch, MONITOR_REQ_GSSSETUP, 1); + monitor_permit(mon_dispatch, MONITOR_REQ_GSSERR, 1); + monitor_permit(mon_dispatch, MONITOR_REQ_GSSMECHS, 1); +#endif } else { mon_dispatch = mon_dispatch_proto15; @@ -461,10 +491,21 @@ monitor_permit(mon_dispatch, MONITOR_REQ_MODULI, 1); monitor_permit(mon_dispatch, MONITOR_REQ_SIGN, 1); monitor_permit(mon_dispatch, MONITOR_REQ_TERM, 1); + +#ifdef GSSAPI + /* and for the GSSAPI key exchange */ + monitor_permit(mon_dispatch, MONITOR_REQ_GSSMECHS,1); + monitor_permit(mon_dispatch, MONITOR_REQ_GSSSETUP,1); + monitor_permit(mon_dispatch, MONITOR_REQ_GSSERR,1); +#endif + } else { mon_dispatch = mon_dispatch_postauth15; monitor_permit(mon_dispatch, MONITOR_REQ_TERM, 1); } +#ifdef GSSAPI + monitor_permit(mon_dispatch, MONITOR_REQ_GSSERR, 1); +#endif if (!no_pty_flag) { monitor_permit(mon_dispatch, MONITOR_REQ_PTY, 1); monitor_permit(mon_dispatch, MONITOR_REQ_PTYCLEANUP, 1); @@ -791,14 +832,17 @@ debug3("%s", __func__); - if (authctxt->attempt++ != 0) - fatal("%s: multiple attempts for getpwnam", __func__); - username = buffer_get_string(m, NULL); pwent = getpwnamallow(username); + if (authctxt->user) free(authctxt->user); authctxt->user = xstrdup(username); +#ifdef USE_PAM + if (options.permit_pam_user_change) + setproctitle("%s [priv]", pwent ? "[pam]" : "unknown"); + else +#endif setproctitle("%s [priv]", pwent ? username : "unknown"); free(username); @@ -1862,6 +1906,13 @@ # ifdef OPENSSL_HAS_ECC kex->kex[KEX_ECDH_SHA2] = kexecdh_server; # endif +#ifdef GSSAPI + if (options.gss_keyex) { + kex->kex[KEX_GSS_GRP1_SHA1] = kexgss_server; + kex->kex[KEX_GSS_GRP14_SHA1] = kexgss_server; + kex->kex[KEX_GSS_GEX_SHA1] = kexgss_server; + } +#endif #endif /* WITH_OPENSSL */ kex->kex[KEX_C25519_SHA256] = kexc25519_server; kex->load_host_public_key=&get_hostkey_public_by_type; @@ -1963,6 +2014,9 @@ OM_uint32 major; u_int len; + if (!options.gss_authentication && !options.gss_keyex) + fatal("In GSSAPI monitor when GSSAPI is disabled"); + goid.elements = buffer_get_string(m, &len); goid.length = len; @@ -1990,6 +2044,9 @@ OM_uint32 flags = 0; /* GSI needs this */ u_int len; + if (!options.gss_authentication && !options.gss_keyex) + fatal("In GSSAPI monitor when GSSAPI is disabled"); + in.value = buffer_get_string(m, &len); in.length = len; major = ssh_gssapi_accept_ctx(gsscontext, &in, &out, &flags); @@ -2006,7 +2063,9 @@ if (major == GSS_S_COMPLETE) { monitor_permit(mon_dispatch, MONITOR_REQ_GSSSTEP, 0); monitor_permit(mon_dispatch, MONITOR_REQ_GSSUSEROK, 1); + monitor_permit(mon_dispatch, MONITOR_REQ_GSSSIGN, 1); monitor_permit(mon_dispatch, MONITOR_REQ_GSSCHECKMIC, 1); + monitor_permit(mon_dispatch, MONITOR_REQ_GSSSIGN, 1); } return (0); } @@ -2018,6 +2077,9 @@ OM_uint32 ret; u_int len; + if (!options.gss_authentication && !options.gss_keyex) + fatal("In GSSAPI monitor when GSSAPI is disabled"); + gssbuf.value = buffer_get_string(m, &len); gssbuf.length = len; mic.value = buffer_get_string(m, &len); @@ -2043,8 +2105,18 @@ mm_answer_gss_userok(int sock, Buffer *m) { int authenticated; + int gssapi_keyex; + + if (!options.gss_authentication && !options.gss_keyex) + fatal("In GSSAPI monitor when GSSAPI is disabled"); + + gssapi_keyex = buffer_get_int(m); - authenticated = authctxt->valid && ssh_gssapi_userok(authctxt->user); + if (!options.gss_authentication && !options.gss_keyex) + fatal("In GSSAPI monitor when GSSAPI is disabled"); + + authenticated = authctxt->valid && + ssh_gssapi_userok(authctxt->user, authctxt->pw, gssapi_keyex); buffer_clear(m); buffer_put_int(m, authenticated); @@ -2052,10 +2124,145 @@ debug3("%s: sending result %d", __func__, authenticated); mm_request_send(sock, MONITOR_ANS_GSSUSEROK, m); - auth_method = "gssapi-with-mic"; + if (gssapi_keyex) + auth_method = "gssapi-keyex"; + else + auth_method = "gssapi-with-mic"; /* Monitor loop will terminate if authenticated */ return (authenticated); } + +int +mm_answer_gss_error(int socket, Buffer *m) { + OM_uint32 major,minor; + char *msg; + + msg=ssh_gssapi_last_error(gsscontext,&major,&minor); + buffer_clear(m); + buffer_put_int(m,major); + buffer_put_int(m,minor); + buffer_put_cstring(m,msg); + + mm_request_send(socket,MONITOR_ANS_GSSERR,m); + + free(msg); + + return(0); +} + +int +mm_answer_gss_indicate_mechs(int socket, Buffer *m) { + OM_uint32 major,minor; + gss_OID_set mech_set; + size_t i; + + major=gss_indicate_mechs(&minor, &mech_set); + + buffer_clear(m); + buffer_put_int(m, major); + buffer_put_int(m, mech_set->count); + for (i=0; i < mech_set->count; i++) { + buffer_put_string(m, mech_set->elements[i].elements, + mech_set->elements[i].length); + } + +#if !defined(MECHGLUE) /* mechglue memory management bug ??? */ + gss_release_oid_set(&minor,&mech_set); +#endif + + mm_request_send(socket,MONITOR_ANS_GSSMECHS,m); + + return(0); +} + +int +mm_answer_gss_localname(int socket, Buffer *m) { + char *name; + + ssh_gssapi_localname(&name); + + buffer_clear(m); + if (name) { + buffer_put_cstring(m, name); + debug3("%s: sending result %s", __func__, name); + free(name); + } else { + buffer_put_cstring(m, ""); + debug3("%s: sending result \"\"", __func__); + } + + mm_request_send(socket, MONITOR_ANS_GSSLOCALNAME, m); + + return(0); +} + +int +mm_answer_gss_sign(int socket, Buffer *m) +{ + gss_buffer_desc data; + gss_buffer_desc hash = GSS_C_EMPTY_BUFFER; + OM_uint32 major, minor; + u_int len; + + if (!options.gss_authentication && !options.gss_keyex) + fatal("In GSSAPI monitor when GSSAPI is disabled"); + + data.value = buffer_get_string(m, &len); + data.length = len; + if (data.length != 20) + fatal("%s: data length incorrect: %d", __func__, + (int) data.length); + + /* Save the session ID on the first time around */ + if (session_id2_len == 0) { + session_id2_len = data.length; + session_id2 = xmalloc(session_id2_len); + memcpy(session_id2, data.value, session_id2_len); + } + major = ssh_gssapi_sign(gsscontext, &data, &hash); + + free(data.value); + + buffer_clear(m); + buffer_put_int(m, major); + buffer_put_string(m, hash.value, hash.length); + + mm_request_send(socket, MONITOR_ANS_GSSSIGN, m); + + gss_release_buffer(&minor, &hash); + + /* Turn on getpwnam permissions */ + monitor_permit(mon_dispatch, MONITOR_REQ_PWNAM, 1); + + /* And credential updating, for when rekeying */ + monitor_permit(mon_dispatch, MONITOR_REQ_GSSUPCREDS, 1); + + return (0); +} + +int +mm_answer_gss_updatecreds(int socket, Buffer *m) { + ssh_gssapi_ccache store; + int ok; + + store.filename = buffer_get_string(m, NULL); + store.envvar = buffer_get_string(m, NULL); + store.envval = buffer_get_string(m, NULL); + + ok = ssh_gssapi_update_creds(&store); + + free(store.filename); + free(store.envvar); + free(store.envval); + + buffer_clear(m); + buffer_put_int(m, ok); + + mm_request_send(socket, MONITOR_ANS_GSSUPCREDS, m); + + return(0); +} + #endif /* GSSAPI */ diff -Naur --exclude=autom4te.cache openssh-7.0p1/monitor.h openssh-7.0p1-gssapi/monitor.h --- openssh-7.0p1/monitor.h 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/monitor.h 2015-08-12 17:11:07.000000000 -0500 @@ -65,6 +65,12 @@ MONITOR_REQ_PAM_FREE_CTX = 110, MONITOR_ANS_PAM_FREE_CTX = 111, MONITOR_REQ_AUDIT_EVENT = 112, MONITOR_REQ_AUDIT_COMMAND = 113, + MONITOR_REQ_GSSMECHS = 200, MONITOR_ANS_GSSMECHS = 201, + MONITOR_REQ_GSSLOCALNAME = 202, MONITOR_ANS_GSSLOCALNAME = 203, + MONITOR_REQ_GSSERR = 204, MONITOR_ANS_GSSERR = 205, + MONITOR_REQ_GSSSIGN = 206, MONITOR_ANS_GSSSIGN = 207, + MONITOR_REQ_GSSUPCREDS = 208, MONITOR_ANS_GSSUPCREDS = 209, + }; struct mm_master; diff -Naur --exclude=autom4te.cache openssh-7.0p1/monitor_wrap.c openssh-7.0p1-gssapi/monitor_wrap.c --- openssh-7.0p1/monitor_wrap.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/monitor_wrap.c 2015-08-12 17:11:07.000000000 -0500 @@ -1068,12 +1068,13 @@ } int -mm_ssh_gssapi_userok(char *user) +mm_ssh_gssapi_userok(char *user, struct passwd *pw, int gssapi_keyex) { Buffer m; int authenticated = 0; buffer_init(&m); + buffer_put_int(&m, gssapi_keyex); mm_request_send(pmonitor->m_recvfd, MONITOR_REQ_GSSUSEROK, &m); mm_request_receive_expect(pmonitor->m_recvfd, MONITOR_ANS_GSSUSEROK, @@ -1085,5 +1086,127 @@ debug3("%s: user %sauthenticated",__func__, authenticated ? "" : "not "); return (authenticated); } + +char * +mm_ssh_gssapi_last_error(Gssctxt *ctx, OM_uint32 *major, OM_uint32 *minor) { + Buffer m; + OM_uint32 maj,min; + char *errstr; + + buffer_init(&m); + + mm_request_send(pmonitor->m_recvfd, MONITOR_REQ_GSSERR, &m); + mm_request_receive_expect(pmonitor->m_recvfd, MONITOR_ANS_GSSERR, &m); + + maj = buffer_get_int(&m); + min = buffer_get_int(&m); + + if (major) *major=maj; + if (minor) *minor=min; + + errstr=buffer_get_string(&m,NULL); + + buffer_free(&m); + + return(errstr); +} + +OM_uint32 +mm_gss_indicate_mechs(OM_uint32 *minor_status, gss_OID_set *mech_set) +{ + Buffer m; + OM_uint32 major,minor; + int count; + gss_OID_desc oid; + u_int length; + + buffer_init(&m); + + mm_request_send(pmonitor->m_recvfd, MONITOR_REQ_GSSMECHS, &m); + mm_request_receive_expect(pmonitor->m_recvfd, MONITOR_ANS_GSSMECHS, + &m); + major=buffer_get_int(&m); + count=buffer_get_int(&m); + + gss_create_empty_oid_set(&minor,mech_set); + while(count-->0) { + oid.elements=buffer_get_string(&m,&length); + oid.length=length; + gss_add_oid_set_member(&minor,&oid,mech_set); + } + + buffer_free(&m); + + return(major); +} + +int +mm_ssh_gssapi_localname(char **lname) +{ + Buffer m; + + buffer_init(&m); + mm_request_send(pmonitor->m_recvfd, MONITOR_REQ_GSSLOCALNAME, &m); + + debug3("%s: waiting for MONITOR_ANS_GSSLOCALNAME", __func__); + mm_request_receive_expect(pmonitor->m_recvfd, MONITOR_ANS_GSSLOCALNAME, + &m); + + *lname = buffer_get_string(&m, NULL); + + buffer_free(&m); + if (lname[0] == '\0') { + debug3("%s: gssapi identity mapping failed", __func__); + } else { + debug3("%s: gssapi identity mapped to %s", __func__, *lname); + } + + return(0); +} + +OM_uint32 +mm_ssh_gssapi_sign(Gssctxt *ctx, gss_buffer_desc *data, gss_buffer_desc *hash) +{ + Buffer m; + OM_uint32 major; + u_int len; + + buffer_init(&m); + buffer_put_string(&m, data->value, data->length); + + mm_request_send(pmonitor->m_recvfd, MONITOR_REQ_GSSSIGN, &m); + mm_request_receive_expect(pmonitor->m_recvfd, MONITOR_ANS_GSSSIGN, &m); + + major = buffer_get_int(&m); + hash->value = buffer_get_string(&m, &len); + hash->length = len; + + buffer_free(&m); + + return(major); +} + +int +mm_ssh_gssapi_update_creds(ssh_gssapi_ccache *store) +{ + Buffer m; + int ok; + + buffer_init(&m); + + buffer_put_cstring(&m, store->filename ? store->filename : ""); + buffer_put_cstring(&m, store->envvar ? store->envvar : ""); + buffer_put_cstring(&m, store->envval ? store->envval : ""); + + mm_request_send(pmonitor->m_recvfd, MONITOR_REQ_GSSUPCREDS, &m); + mm_request_receive_expect(pmonitor->m_recvfd, MONITOR_ANS_GSSUPCREDS, &m); + + ok = buffer_get_int(&m); + + buffer_free(&m); + + return (ok); +} + #endif /* GSSAPI */ diff -Naur --exclude=autom4te.cache openssh-7.0p1/monitor_wrap.h openssh-7.0p1-gssapi/monitor_wrap.h --- openssh-7.0p1/monitor_wrap.h 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/monitor_wrap.h 2015-08-12 17:11:07.000000000 -0500 @@ -58,8 +58,14 @@ OM_uint32 mm_ssh_gssapi_server_ctx(Gssctxt **, gss_OID); OM_uint32 mm_ssh_gssapi_accept_ctx(Gssctxt *, gss_buffer_desc *, gss_buffer_desc *, OM_uint32 *); -int mm_ssh_gssapi_userok(char *user); +int mm_ssh_gssapi_userok(char *user, struct passwd *, int gssapi_keyex); OM_uint32 mm_ssh_gssapi_checkmic(Gssctxt *, gss_buffer_t, gss_buffer_t); +OM_uint32 mm_ssh_gssapi_sign(Gssctxt *, gss_buffer_t, gss_buffer_t); +int mm_ssh_gssapi_localname(char **user); +OM_uint32 mm_gss_indicate_mechs(OM_uint32 *minor_status, + gss_OID_set *mech_set); +char *mm_ssh_gssapi_last_error(Gssctxt *ctxt, OM_uint32 *maj, OM_uint32 *min); +int mm_ssh_gssapi_update_creds(ssh_gssapi_ccache *); #endif #ifdef USE_PAM diff -Naur --exclude=autom4te.cache openssh-7.0p1/myproposal.h openssh-7.0p1-gssapi/myproposal.h --- openssh-7.0p1/myproposal.h 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/myproposal.h 2015-08-12 17:11:07.000000000 -0500 @@ -115,6 +115,9 @@ "aes128-cbc,3des-cbc,blowfish-cbc,cast128-cbc," \ "aes192-cbc,aes256-cbc,arcfour,rijndael-cbc@lysator.liu.se" +#define KEX_ENCRYPT_INCLUDE_NONE KEX_SERVER_ENCRYPT \ + ",none" + #define KEX_SERVER_MAC \ "umac-64-etm@openssh.com," \ "umac-128-etm@openssh.com," \ diff -Naur --exclude=autom4te.cache openssh-7.0p1/nersc.c openssh-7.0p1-gssapi/nersc.c --- openssh-7.0p1/nersc.c 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/nersc.c 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,583 @@ +/* + * Author: Scott Campbell, Tom Davis + * Set of functions called by the command instrumentation and logging + * + * notes as follows: + * hostname and source port of the syslog listener are hardcoded into + * the code to prevent issues with configuration - both intentional and otherwise. + * + * ------------------------------------------------------------------------------ + * Instrumented Open SSHD, Copyright (c) *2013*, The + * Regents of the University of California, through Lawrence Berkeley National + * Laboratory (subject to receipt of any required approvals from the U.S. + * Dept. of Energy). All rights reserved. + * + * If you have questions about your rights to use or distribute this software, + * please contact Berkeley Lab's Technology Transfer Department at TTD@lbl.gov + * . + * + * NOTICE. This software is owned by the U.S. Department of Energy. As such, + * the U.S. Government has been granted for itself and others acting on its + * behalf a paid-up, nonexclusive, irrevocable, worldwide license in the + * Software to reproduce, prepare derivative works, and perform publicly and + * display publicly. Beginning five (5) years after the date permission to + * assert copyright is obtained from the U.S. + * Department of Energy, and subject to any subsequent five (5) year renewals, + * the U.S. Government is granted for itself and others acting on its behalf a + * paid-up, nonexclusive, irrevocable, worldwide license in the Software to + * reproduce, prepare derivative works, distribute copies to the public, + * perform publicly and display publicly, and to permit others to do so. + * + * *** License agreement *** + * + * " Instrumented Open SSHD, Copyright (c) 2013, The Regents of the + * University of California, through Lawrence Berkeley National Laboratory + * (subject to receipt of any required approvals from the U.S. Dept. of + * Energy). This software was developed under funding from the DOE Office of + * Advanced Scientific Computing Research* *and is associated with the + * Berkeley Lab OASCR project. All rights reserved." + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * (1) Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * (2) Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * (3) Neither the name of the University of California, Lawrence Berkeley + * National Laboratory, U.S. Dept. of Energy nor the names of its contributors + * may be used to endorse or promote products derived from this software + * without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * *You are under no obligation whatsoever to provide any bug fixes, patches, + * or upgrades to the features, functionality or performance of the source + * code ("Enhancements") to anyone; however, if you choose to make your + * Enhancements available either publicly, or directly to Lawrence Berkeley + * National Laboratory, without imposing a separate written license agreement + * for such Enhancements, then you hereby grant the following license: a + * non-exclusive, royalty-free perpetual license to install, use, modify, + * prepare derivative works, incorporate into other computer software, + * distribute, and sublicense such enhancements or derivative works thereof, + * in binary and source code form.* + * + * ------------------------------------------------------------------------------ + * Additional URL encoding code taken from stringcoders-v3.10.3 source. Thanks! + * ------------------------------------------------------------------------------ + * http://code.google.com/p/stringencoders/ + * + * Copyright © 2006,2007 Nick Galbreath -- nickg [at] modp [dot] com + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are + * met: + * + * Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * + * Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * Neither the name of the modp.com nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS + * "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT + * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR + * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT + * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT + * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE + * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + * + * This is the standard "new" BSD license: + * http://www.opensource.org/licenses/bsd-license.php + */ + + +#include "includes.h" +#ifdef NERSC_MOD + +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + +#include "openbsd-compat/sys-queue.h" +#include "channels.h" +#include "log.h" +#include "misc.h" +#include "xmalloc.h" +#include "version.h" +#include "nersc.h" + +/* this is for the stringencoders data */ +#include "modp_burl.h" +#include "modp_burl_data.h" + +int client_session_id; +int sis_socket = -1; /* socket test varible */ +int sis_connect = -1; /* connect test variable */ +int stun_conn_error = 0; /* track the number of connection errors to the stunnel */ +int stun_write_error = 0; /* track the number of write errors to the stunnel */ + +char n_ntop[NI_MAXHOST] = "X"; +char n_port[NI_MAXHOST] = "X"; + +extern char *__progname; + +static char server_id[128] = "X"; /* + * This is a unique value composed of: + * + * used for the lifetime of the process. + * 128 == max reasonable size expected + */ +#define NERSCMSGBUF 4096 +#define STUN_ERROR_MOD 10 /* + * Filter the number of errors down by this factor + * so that on a busy sustem the local syslog is not + * flooded with anoying and redundant messages + */ + +char interface_list[256] = "X"; /* + * Contains space delimited list of system interfaces. + * at times we may need more than the host name to + * determine the system in question. Fill up and ship + * back to the bro instance to sort out + */ + +void l_syslog(const char *fmt,...) +{ + /* + * Function filtering accidental printing of log messages to + * stderr/stdout when logging messages. + * + * NOTE: for standalong binaries like ssh, some of this code will get + * called since there are common shared objects like channels.o which + * trigger annoying errors to stderr otherwise. + */ + + if ( ! log_is_on_stderr() ) { + va_list args; + + va_start(args, fmt); + do_log(SYSLOG_LEVEL_INFO, fmt, args); + va_end(args); + } +} + + +int get_client_session_id() + { + return client_session_id; + } + +void set_server_id(int parent_pid, char* ntop, int port) + { + /* + * This is called to assert the server id from server_listen() + * in sshd.c . + */ + if ( server_id[0] == 'X' ) { + char hn[64]; + long hid; + + if ( gethostname((char*)hn, 64) == -1 ) + strncpy(hn, "unknown-hostname", sizeof(hn)); + + hid = gethostid(); + snprintf(server_id, 64,"%ld:%s:%i", hid, hn, port); + } + } + +static char* get_server_id() + { + /* + * If this is the first reference to this variable, it may be blank and + * we can try filing it in via the values set up during the sshd run. + */ + const char* env = NULL; + size_t len = 0; + char *cp = NULL; + char *p = NULL; + long hid; + + if( server_id[0] == 'X' ) { + + hid = gethostid(); + /* + * When invoking subsystems, we may have a situation where the + * server id will be incomplete. run an additional test here + * to make sure that n_top and n_port have been filled. if not, + * make a sanity guess based on: + * SSH_CONNECTION=127.0.0.1 33602 127.0.0.1 22 + */ + if ( n_port[0] == 'X' ) { + + if ((env = getenv("SSH_CONNECTION")) != NULL) { + + len = strlen(env); + cp = (char*) xmalloc(len + 1); + strcpy(cp, env); + + p = strtok(cp," "); /* src IP */ + p = strtok(NULL, " "); /* src port */ + + if ( (p = strtok(NULL, " ")) != NULL) /* dst IP */ + strncpy(n_ntop,p,NI_MAXHOST-1); + + if ( (p = strtok(NULL, " ")) != NULL) /* dst port */ + strncpy(n_port,p,NI_MAXHOST-1); + + bzero(cp, len); + free(cp); + } + else { + /* + * Have not been able to extract SSH_CONNECTION from + * the running environment. WTF? + */ + strncpy(n_port, "unknown-port", strlen(n_port)); + strncpy(n_ntop, "unknown-ip", strlen(n_ntop)); + } + } + + char hn[64]; + gethostname((char*)hn, 64); + + snprintf(server_id, 64,"%ld:%s:%s", hid, hn, n_port); + + return (server_id); + } + else + return (server_id); + } + +int set_interface_list() +{ + int iSocket; + struct if_nameindex *pIndex, *pIndex2; + + if ( strlen(interface_list) > 1 ) + return 0; + + if ((iSocket = socket(PF_INET, SOCK_DGRAM, 0)) < 0) { + + perror("socket"); + bzero(interface_list, sizeof(interface_list)); + interface_list[0] = 'S'; + return -1; + } + + bzero(interface_list, sizeof(interface_list)); + + /* + * if_nameindex() returns an array of if_nameindex structures. + * + * if_nametoindex is also defined in , and is as follows: + * + * struct if_nameindex { + * unsigned int if_index; 1, 2, ... + * char *if_name; null terminated name: "le0", ... + * }; + */ + pIndex = pIndex2 = if_nameindex(); + + /* for an error state, pIndex will be NULL */ + while ((pIndex != NULL) && (pIndex->if_name != NULL)) { + + struct ifreq req; + + strncpy(req.ifr_name, pIndex->if_name, IFNAMSIZ); + + if (ioctl(iSocket, SIOCGIFADDR, &req) < 0) { + + if (errno == EADDRNOTAVAIL) { + pIndex++; + continue; + } + + perror("ioctl"); + bzero(interface_list, sizeof(interface_list)); + interface_list[0] = 'I'; + close(iSocket); + + return -1; + } + + /* add a delimiter */ + if ( pIndex > pIndex2 ) + strncat(interface_list, "_", 2); + + size_t nl = strlen(inet_ntoa(((struct sockaddr_in*)&req.ifr_addr)->sin_addr)); + + if ( nl + strlen(interface_list) + 2 < sizeof(interface_list) ) { + + strncat( interface_list, + inet_ntoa(((struct sockaddr_in*)&req.ifr_addr)->sin_addr), + sizeof(interface_list) - nl -1); + } + + pIndex++; + + } + + if ( pIndex2 != NULL ) + if_freenameindex(pIndex2); + + close(iSocket); + + return 0; +} + +static int sis_opentcp(char *hostname, int portnum) +{ + struct sockaddr_in sa = { 0 }; + struct hostent *hp = NULL; + int s, valopt; + fd_set myset; + struct timeval tv; + socklen_t lon; + + s = -1; + sis_connect = -1; + + hp = gethostbyname(hostname); + + if (hp == NULL) { + hp = gethostbyaddr(hostname, strlen(hostname), AF_INET); + if (hp == NULL) { + l_syslog("error resolving stunnel server address, exiting open"); + return(-1); + } + } + + sa.sin_family = AF_INET; + sa.sin_port = htons(portnum); + (void) memcpy(&sa.sin_addr, hp->h_addr, hp->h_length); + + if ((s=socket(PF_INET, SOCK_STREAM, IPPROTO_TCP)) < 0) { + + l_syslog("error opening connection to stunnel listener, exiting open"); + return (-1); + } + + /* now make the socket non-blocking */ + if ( fcntl(s,F_SETFL,FNDELAY) == -1) { + l_syslog("Failure setting socket to no-blocking"); + } + + sis_connect = connect(s, (struct sockaddr *) & sa, sizeof(sa)); + + if ( sis_connect < 0 ) { + + /* + * We might be waiting for the connection to complete - + * quick check for that condition. + */ + if (errno == EINPROGRESS) { + /* sit for 2 seconds */ + tv.tv_sec = 2; + tv.tv_usec = 0; + FD_ZERO(&myset); + FD_SET(s, &myset); + + if (select(s+1, NULL, &myset, NULL, &tv) > 0) { + lon = sizeof(int); + getsockopt(s, SOL_SOCKET, SO_ERROR, (void *)(&valopt), &lon); + + if (valopt) { + if ( ( stun_conn_error % STUN_ERROR_MOD ) == 0 ) { + l_syslog("connection to stunnel rejected/timeout, exiting open, error = %d, %s" , + valopt, strerror(valopt)); + + stun_conn_error++; + close(s); + sis_connect = -1; + return(-1); + } + } + else { + /* sitting around has worked, mark connect as successful */ + sis_connect = 1; + } + } + } + else { + /* some simple sanity filtering for connect errors */ + if ( ( stun_conn_error % STUN_ERROR_MOD ) == 0 ) { + l_syslog("connection to stunnel rejected, exiting open"); + + stun_conn_error++; + close(s); + return(-1); + } + } + } + + return(s); +} + +static int sis_write(char *buffer) +{ + int err = 0; + size_t sent = 0; + + if ( sis_connect != -1 && sis_socket != -1) + sent = send(sis_socket, buffer, strlen(buffer), 0); + + /* this may be a little heavy handed ... */ + if (sent != strlen(buffer) || sis_socket == -1 || sis_connect == -1) { + +#ifndef STUNNEL_PORT + #define STUNNEL_PORT 799 +#endif + +#ifndef STUNNEL_HOST + #define STUNNEL_HOST "localhost" +#endif + /* + * Close the fd since writes are failing, but only + * if there is an error on it already since that would + * close a socket that was never opened ... + */ + if ( stun_write_error > 0 ) { + + close(sis_socket); + sis_socket = -1; + sis_connect = -1; + + /* + * Some simple sanity filtering for connect errors + * this will flag every 10th error starting after #1 + */ + if ( ( stun_write_error % STUN_ERROR_MOD ) == 1 ) { + l_syslog("write to stunnel failed, reopening connection"); + } + + } + + stun_write_error++; + sis_socket = sis_opentcp(STUNNEL_HOST, STUNNEL_PORT); + + if ( sis_socket == -1 || sis_connect == -1 ) { + err = -1; + } + else { + sent = send(sis_socket, buffer, strlen(buffer), 0); + + err=1; + } + + } + + return(err); +} + + +/* + * Main auditing function called by other code + * s_audit( , , ); + */ +void s_audit(const char *_event, const char *fmt, ...) +{ + va_list args; + char msgbuf[NERSCMSGBUF] = ""; + char fmtbuf[NERSCMSGBUF] = ""; + + struct timeval tv; + gettimeofday(&tv, NULL); + + char* t1buf = encode_string( get_server_id(), strlen(get_server_id()) ); + /* get version string */ + + /* + * If --with-nerscmod has not been set in confgure there is no access to + * SSH_AUDITING so we set a token value for the define. + */ +#ifndef NERSC_MOD + #define SSH_AUDITING "XXX" +#endif + char* t2buf = encode_string( SSH_AUDITING, strlen(SSH_AUDITING) ); + /* get interface list */ + set_interface_list(); + char* t3buf = encode_string( interface_list, strlen(interface_list) ); + + /* fmt defines how data provided by args should be formatted */ + va_start(args, fmt); + /* copy the data into msgbuf */ + vsnprintf(msgbuf, sizeof(msgbuf), fmt, args); + va_end(args); + + /* copy event and system data in front of the argument data */ + snprintf(fmtbuf, sizeof(fmtbuf), "%s time=%ld.%ld uristring=%s uristring=%s %s\n", _event, tv.tv_sec, (long int)tv.tv_usec, t2buf, t1buf, msgbuf); + + /*write(STDERR_FILENO, fmtbuf, strlen(fmtbuf)); */ + /*syslog(LOG_NOTICE, fmtbuf); */ + + /* + * If the socket open fails, sis_write() will return a -1. for the time + * being we will just let this ride since we will be reporting + * write failures anyway. + */ + sis_write(fmtbuf); + + free(t1buf); + free(t2buf); + free(t3buf); +} + + +char* encode_string(const char* src, const int len) +{ + /* take a string and return a pointer to the URI encoded version */ + int new_len = modp_burl_encode_len(len); + + char *url_enc_string; + + url_enc_string = xmalloc(new_len); + + if ( url_enc_string == NULL ) + return (char*)src; + else + /* + * We do not test the return here since it + * is done via the call itself. + */ + modp_burl_encode(url_enc_string, src, len); + + return url_enc_string; +} + +#endif /* NERSC_MOD */ diff -Naur --exclude=autom4te.cache openssh-7.0p1/nersc.h openssh-7.0p1-gssapi/nersc.h --- openssh-7.0p1/nersc.h 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/nersc.h 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,15 @@ +/* + * Author: Scott Campbell + * header file + * + * see nersc.c for complete copyright information + * + */ + +int get_client_session_id(); +void set_server_id(int,char*,int); +void s_audit(const char *, const char *, ...); +char* encode_string(const char *, const int len); +int set_interface_list(); + + diff -Naur --exclude=autom4te.cache openssh-7.0p1/openbsd-compat/port-aix.c openssh-7.0p1-gssapi/openbsd-compat/port-aix.c --- openssh-7.0p1/openbsd-compat/port-aix.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/openbsd-compat/port-aix.c 2015-08-12 17:11:07.000000000 -0500 @@ -50,6 +50,7 @@ # include # include # if defined(HAVE_SYS_AUDIT_H) && defined(AIX_LOGINFAILED_4ARG) +# undef T_NULL # include # endif # include diff -Naur --exclude=autom4te.cache openssh-7.0p1/packet.c openssh-7.0p1-gssapi/packet.c --- openssh-7.0p1/packet.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/packet.c 2015-08-12 17:11:07.000000000 -0500 @@ -2228,6 +2228,14 @@ } } +/* this supports the forced rekeying required for the NONE cipher */ +int rekey_requested = 0; +void +ssh_packet_request_rekeying(void) +{ + rekey_requested = 1; +} + #define MAX_PACKETS (1U<<31) int ssh_packet_need_rekeying(struct ssh *ssh) @@ -2236,6 +2244,11 @@ if (ssh->compat & SSH_BUG_NOREKEY) return 0; + if (rekey_requested == 1) + { + rekey_requested = 0; + return 1; + } return (state->p_send.packets > MAX_PACKETS) || (state->p_read.packets > MAX_PACKETS) || @@ -2247,6 +2260,12 @@ state->rekey_interval <= monotime()); } +int +ssh_packet_authentication_state(struct ssh *ssh) +{ + return(ssh->state->after_authentication); +} + void ssh_packet_set_rekey_limits(struct ssh *ssh, u_int32_t bytes, time_t seconds) { @@ -2290,6 +2309,18 @@ return (void *)ssh->state->output; } +void * +packet_get_receive_context(struct ssh *ssh) +{ + return (void*)&(ssh->state->receive_context); +} + +void * +packet_get_send_context(struct ssh *ssh) +{ + return (void*)&(ssh->state->send_context); +} + /* XXX TODO update roaming to new API (does not work anyway) */ /* * Save the state for the real connection, and use a separate state when diff -Naur --exclude=autom4te.cache openssh-7.0p1/packet.h openssh-7.0p1-gssapi/packet.h --- openssh-7.0p1/packet.h 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/packet.h 2015-08-12 17:11:07.000000000 -0500 @@ -155,6 +155,12 @@ void *ssh_packet_get_input(struct ssh *); void *ssh_packet_get_output(struct ssh *); +/* HPN */ +void* packet_get_receive_context(struct ssh *); +void* packet_get_send_context(struct ssh *); +void ssh_packet_request_rekeying(void); +int ssh_packet_authentication_state(struct ssh *); + /* new API */ int sshpkt_start(struct ssh *ssh, u_char type); int sshpkt_send(struct ssh *ssh); diff -Naur --exclude=autom4te.cache openssh-7.0p1/pkg.m4 openssh-7.0p1-gssapi/pkg.m4 --- openssh-7.0p1/pkg.m4 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/pkg.m4 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,214 @@ +# pkg.m4 - Macros to locate and utilise pkg-config. -*- Autoconf -*- +# serial 1 (pkg-config-0.24) +# +# Copyright © 2004 Scott James Remnant . +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. +# +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program that contains a +# configuration script generated by Autoconf, you may include it under +# the same distribution terms that you use for the rest of that program. + +# PKG_PROG_PKG_CONFIG([MIN-VERSION]) +# ---------------------------------- +AC_DEFUN([PKG_PROG_PKG_CONFIG], +[m4_pattern_forbid([^_?PKG_[A-Z_]+$]) +m4_pattern_allow([^PKG_CONFIG(_(PATH|LIBDIR|SYSROOT_DIR|ALLOW_SYSTEM_(CFLAGS|LIBS)))?$]) +m4_pattern_allow([^PKG_CONFIG_(DISABLE_UNINSTALLED|TOP_BUILD_DIR|DEBUG_SPEW)$]) +AC_ARG_VAR([PKG_CONFIG], [path to pkg-config utility]) +AC_ARG_VAR([PKG_CONFIG_PATH], [directories to add to pkg-config's search path]) +AC_ARG_VAR([PKG_CONFIG_LIBDIR], [path overriding pkg-config's built-in search path]) + +if test "x$ac_cv_env_PKG_CONFIG_set" != "xset"; then + AC_PATH_TOOL([PKG_CONFIG], [pkg-config]) +fi +if test -n "$PKG_CONFIG"; then + _pkg_min_version=m4_default([$1], [0.9.0]) + AC_MSG_CHECKING([pkg-config is at least version $_pkg_min_version]) + if $PKG_CONFIG --atleast-pkgconfig-version $_pkg_min_version; then + AC_MSG_RESULT([yes]) + else + AC_MSG_RESULT([no]) + PKG_CONFIG="" + fi +fi[]dnl +])# PKG_PROG_PKG_CONFIG + +# PKG_CHECK_EXISTS(MODULES, [ACTION-IF-FOUND], [ACTION-IF-NOT-FOUND]) +# +# Check to see whether a particular set of modules exists. Similar +# to PKG_CHECK_MODULES(), but does not set variables or print errors. +# +# Please remember that m4 expands AC_REQUIRE([PKG_PROG_PKG_CONFIG]) +# only at the first occurence in configure.ac, so if the first place +# it's called might be skipped (such as if it is within an "if", you +# have to call PKG_CHECK_EXISTS manually +# -------------------------------------------------------------- +AC_DEFUN([PKG_CHECK_EXISTS], +[AC_REQUIRE([PKG_PROG_PKG_CONFIG])dnl +if test -n "$PKG_CONFIG" && \ + AC_RUN_LOG([$PKG_CONFIG --exists --print-errors "$1"]); then + m4_default([$2], [:]) +m4_ifvaln([$3], [else + $3])dnl +fi]) + +# _PKG_CONFIG([VARIABLE], [COMMAND], [MODULES]) +# --------------------------------------------- +m4_define([_PKG_CONFIG], +[if test -n "$$1"; then + pkg_cv_[]$1="$$1" + elif test -n "$PKG_CONFIG"; then + PKG_CHECK_EXISTS([$3], + [pkg_cv_[]$1=`$PKG_CONFIG --[]$2 "$3" 2>/dev/null` + test "x$?" != "x0" && pkg_failed=yes ], + [pkg_failed=yes]) + else + pkg_failed=untried +fi[]dnl +])# _PKG_CONFIG + +# _PKG_SHORT_ERRORS_SUPPORTED +# ----------------------------- +AC_DEFUN([_PKG_SHORT_ERRORS_SUPPORTED], +[AC_REQUIRE([PKG_PROG_PKG_CONFIG]) +if $PKG_CONFIG --atleast-pkgconfig-version 0.20; then + _pkg_short_errors_supported=yes +else + _pkg_short_errors_supported=no +fi[]dnl +])# _PKG_SHORT_ERRORS_SUPPORTED + + +# PKG_CHECK_MODULES(VARIABLE-PREFIX, MODULES, [ACTION-IF-FOUND], +# [ACTION-IF-NOT-FOUND]) +# +# +# Note that if there is a possibility the first call to +# PKG_CHECK_MODULES might not happen, you should be sure to include an +# explicit call to PKG_PROG_PKG_CONFIG in your configure.ac +# +# +# -------------------------------------------------------------- +AC_DEFUN([PKG_CHECK_MODULES], +[AC_REQUIRE([PKG_PROG_PKG_CONFIG])dnl +AC_ARG_VAR([$1][_CFLAGS], [C compiler flags for $1, overriding pkg-config])dnl +AC_ARG_VAR([$1][_LIBS], [linker flags for $1, overriding pkg-config])dnl + +pkg_failed=no +AC_MSG_CHECKING([for $1]) + +_PKG_CONFIG([$1][_CFLAGS], [cflags], [$2]) +_PKG_CONFIG([$1][_LIBS], [libs], [$2]) + +m4_define([_PKG_TEXT], [Alternatively, you may set the environment variables $1[]_CFLAGS +and $1[]_LIBS to avoid the need to call pkg-config. +See the pkg-config man page for more details.]) + +if test $pkg_failed = yes; then + AC_MSG_RESULT([no]) + _PKG_SHORT_ERRORS_SUPPORTED + if test $_pkg_short_errors_supported = yes; then + $1[]_PKG_ERRORS=`$PKG_CONFIG --short-errors --print-errors --cflags --libs "$2" 2>&1` + else + $1[]_PKG_ERRORS=`$PKG_CONFIG --print-errors --cflags --libs "$2" 2>&1` + fi + # Put the nasty error message in config.log where it belongs + echo "$$1[]_PKG_ERRORS" >&AS_MESSAGE_LOG_FD + + m4_default([$4], [AC_MSG_ERROR( +[Package requirements ($2) were not met: + +$$1_PKG_ERRORS + +Consider adjusting the PKG_CONFIG_PATH environment variable if you +installed software in a non-standard prefix. + +_PKG_TEXT])[]dnl + ]) +elif test $pkg_failed = untried; then + AC_MSG_RESULT([no]) + m4_default([$4], [AC_MSG_FAILURE( +[The pkg-config script could not be found or is too old. Make sure it +is in your PATH or set the PKG_CONFIG environment variable to the full +path to pkg-config. + +_PKG_TEXT + +To get pkg-config, see .])[]dnl + ]) +else + $1[]_CFLAGS=$pkg_cv_[]$1[]_CFLAGS + $1[]_LIBS=$pkg_cv_[]$1[]_LIBS + AC_MSG_RESULT([yes]) + $3 +fi[]dnl +])# PKG_CHECK_MODULES + + +# PKG_INSTALLDIR(DIRECTORY) +# ------------------------- +# Substitutes the variable pkgconfigdir as the location where a module +# should install pkg-config .pc files. By default the directory is +# $libdir/pkgconfig, but the default can be changed by passing +# DIRECTORY. The user can override through the --with-pkgconfigdir +# parameter. +AC_DEFUN([PKG_INSTALLDIR], +[m4_pushdef([pkg_default], [m4_default([$1], ['${libdir}/pkgconfig'])]) +m4_pushdef([pkg_description], + [pkg-config installation directory @<:@]pkg_default[@:>@]) +AC_ARG_WITH([pkgconfigdir], + [AS_HELP_STRING([--with-pkgconfigdir], pkg_description)],, + [with_pkgconfigdir=]pkg_default) +AC_SUBST([pkgconfigdir], [$with_pkgconfigdir]) +m4_popdef([pkg_default]) +m4_popdef([pkg_description]) +]) dnl PKG_INSTALLDIR + + +# PKG_NOARCH_INSTALLDIR(DIRECTORY) +# ------------------------- +# Substitutes the variable noarch_pkgconfigdir as the location where a +# module should install arch-independent pkg-config .pc files. By +# default the directory is $datadir/pkgconfig, but the default can be +# changed by passing DIRECTORY. The user can override through the +# --with-noarch-pkgconfigdir parameter. +AC_DEFUN([PKG_NOARCH_INSTALLDIR], +[m4_pushdef([pkg_default], [m4_default([$1], ['${datadir}/pkgconfig'])]) +m4_pushdef([pkg_description], + [pkg-config arch-independent installation directory @<:@]pkg_default[@:>@]) +AC_ARG_WITH([noarch-pkgconfigdir], + [AS_HELP_STRING([--with-noarch-pkgconfigdir], pkg_description)],, + [with_noarch_pkgconfigdir=]pkg_default) +AC_SUBST([noarch_pkgconfigdir], [$with_noarch_pkgconfigdir]) +m4_popdef([pkg_default]) +m4_popdef([pkg_description]) +]) dnl PKG_NOARCH_INSTALLDIR + + +# PKG_CHECK_VAR(VARIABLE, MODULE, CONFIG-VARIABLE, +# [ACTION-IF-FOUND], [ACTION-IF-NOT-FOUND]) +# ------------------------------------------- +# Retrieves the value of the pkg-config variable for the given module. +AC_DEFUN([PKG_CHECK_VAR], +[AC_REQUIRE([PKG_PROG_PKG_CONFIG])dnl +AC_ARG_VAR([$1], [value of $3 for $2, overriding pkg-config])dnl + +_PKG_CONFIG([$1], [variable="][$3]["], [$2]) +AS_VAR_COPY([$1], [pkg_cv_][$1]) + +AS_VAR_IF([$1], [""], [$5], [$4])dnl +])# PKG_CHECK_VAR diff -Naur --exclude=autom4te.cache openssh-7.0p1/progressmeter.c openssh-7.0p1-gssapi/progressmeter.c --- openssh-7.0p1/progressmeter.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/progressmeter.c 2015-08-12 17:11:07.000000000 -0500 @@ -69,6 +69,8 @@ static off_t start_pos; /* initial position of transfer */ static off_t end_pos; /* ending position of transfer */ static off_t cur_pos; /* transfer position as of last refresh */ +static off_t last_pos; +static off_t max_delta_pos = 0; static volatile off_t *counter; /* progress counter */ static long stalled; /* how long we have been stalled */ static int bytes_per_second; /* current speed in bytes per second */ @@ -129,12 +131,17 @@ int hours, minutes, seconds; int i, len; int file_len; + off_t delta_pos; transferred = *counter - (cur_pos ? cur_pos : start_pos); cur_pos = *counter; now = monotime(); bytes_left = end_pos - cur_pos; + delta_pos = cur_pos - last_pos; + if (delta_pos > max_delta_pos) + max_delta_pos = delta_pos; + if (bytes_left > 0) elapsed = now - last_update; else { @@ -159,7 +166,7 @@ /* filename */ buf[0] = '\0'; - file_len = win_size - 35; + file_len = win_size - 45; if (file_len > 0) { len = snprintf(buf, file_len + 1, "\r%s", file); if (len < 0) @@ -176,7 +183,8 @@ percent = ((float)cur_pos / end_pos) * 100; else percent = 100; - snprintf(buf + strlen(buf), win_size - strlen(buf), + + snprintf(buf + strlen(buf), win_size - strlen(buf-8), " %3d%% ", percent); /* amount transferred */ @@ -189,6 +197,15 @@ (off_t)bytes_per_second); strlcat(buf, "/s ", win_size); + /* instantaneous rate */ + if (bytes_left > 0) + format_rate(buf + strlen(buf), win_size - strlen(buf), + delta_pos); + else + format_rate(buf + strlen(buf), win_size - strlen(buf), + max_delta_pos); + strlcat(buf, "/s ", win_size); + /* ETA */ if (!transferred) stalled += elapsed; @@ -225,6 +242,7 @@ atomicio(vwrite, STDOUT_FILENO, buf, win_size - 1); last_update = now; + last_pos = cur_pos; } /*ARGSUSED*/ diff -Naur --exclude=autom4te.cache openssh-7.0p1/readconf.c openssh-7.0p1-gssapi/readconf.c --- openssh-7.0p1/readconf.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/readconf.c 2015-08-12 17:11:07.000000000 -0500 @@ -147,11 +147,15 @@ oClearAllForwardings, oNoHostAuthenticationForLocalhost, oEnableSSHKeysign, oRekeyLimit, oVerifyHostKeyDNS, oConnectTimeout, oAddressFamily, oGssAuthentication, oGssDelegateCreds, + oGssTrustDns, oGssKeyEx, oGssClientIdentity, oGssRenewalRekey, + oGssServerIdentity, oServerAliveInterval, oServerAliveCountMax, oIdentitiesOnly, oSendEnv, oControlPath, oControlMaster, oControlPersist, oHashKnownHosts, oTunnel, oTunnelDevice, oLocalCommand, oPermitLocalCommand, oVisualHostKey, oUseRoaming, + oTcpRcvBufPoll, oTcpRcvBuf, oHPNDisabled, oHPNBufferSize, + oNoneEnabled, oNoneSwitch, oKexAlgorithms, oIPQoS, oRequestTTY, oIgnoreUnknown, oProxyUseFdpass, oCanonicalDomains, oCanonicalizeHostname, oCanonicalizeMaxDots, oCanonicalizeFallbackLocal, oCanonicalizePermittedCNAMEs, @@ -192,10 +196,19 @@ { "afstokenpassing", oUnsupported }, #if defined(GSSAPI) { "gssapiauthentication", oGssAuthentication }, + { "gssapikeyexchange", oGssKeyEx }, { "gssapidelegatecredentials", oGssDelegateCreds }, + { "gssapitrustdns", oGssTrustDns }, + { "gssapiclientidentity", oGssClientIdentity }, + { "gssapiserveridentity", oGssServerIdentity }, + { "gssapirenewalforcesrekey", oGssRenewalRekey }, #else { "gssapiauthentication", oUnsupported }, + { "gssapikeyexchange", oUnsupported }, { "gssapidelegatecredentials", oUnsupported }, + { "gssapitrustdns", oUnsupported }, + { "gssapiclientidentity", oUnsupported }, + { "gssapirenewalforcesrekey", oUnsupported }, #endif { "fallbacktorsh", oDeprecated }, { "usersh", oDeprecated }, @@ -279,6 +292,14 @@ { "pubkeyacceptedkeytypes", oPubkeyAcceptedKeyTypes }, { "ignoreunknown", oIgnoreUnknown }, + { "noneenabled", oNoneEnabled }, + { "noneswitch", oNoneSwitch }, + + { "tcprcvbufpoll", oTcpRcvBufPoll }, + { "tcprcvbuf", oTcpRcvBuf }, + { "hpndisabled", oHPNDisabled }, + { "hpnbuffersize", oHPNBufferSize }, + { NULL, oBadOption } }; @@ -894,10 +915,30 @@ intptr = &options->gss_authentication; goto parse_flag; + case oGssKeyEx: + intptr = &options->gss_keyex; + goto parse_flag; + case oGssDelegateCreds: intptr = &options->gss_deleg_creds; goto parse_flag; + case oGssTrustDns: + intptr = &options->gss_trust_dns; + goto parse_flag; + + case oGssClientIdentity: + charptr = &options->gss_client_identity; + goto parse_string; + + case oGssServerIdentity: + charptr = &options->gss_server_identity; + goto parse_string; + + case oGssRenewalRekey: + intptr = &options->gss_renewal_rekey; + goto parse_flag; + case oBatchMode: intptr = &options->batch_mode; goto parse_flag; @@ -906,6 +947,36 @@ intptr = &options->check_host_ip; goto parse_flag; + case oHPNDisabled: + intptr = &options->hpn_disabled; + goto parse_flag; + + case oHPNBufferSize: + intptr = &options->hpn_buffer_size; + goto parse_int; + + case oTcpRcvBufPoll: + intptr = &options->tcp_rcv_buf_poll; + goto parse_flag; + + case oNoneEnabled: + intptr = &options->none_enabled; + goto parse_flag; + + /* we check to see if the command comes from the */ + /* command line or not. If it does then enable it */ + /* otherwise fail. NONE should never be a default configuration */ + case oNoneSwitch: + if(strcmp(filename,"command-line") == 0) { + intptr = &options->none_switch; + goto parse_flag; + } else { + error("NoneSwitch is found in %.200s.\nYou may only use this configuration option from the command line", filename); + error("Continuing..."); + debug("NoneSwitch directive found in %.200s.", filename); + return 0; + } + case oVerifyHostKeyDNS: intptr = &options->verify_host_key_dns; multistate_ptr = multistate_yesnoask; @@ -1069,6 +1140,10 @@ intptr = &options->connection_attempts; goto parse_int; + case oTcpRcvBuf: + intptr = &options->tcp_rcv_buf; + goto parse_int; + case oCipher: intptr = &options->cipher; arg = strdelim(&s); @@ -1601,7 +1676,12 @@ options->pubkey_authentication = -1; options->challenge_response_authentication = -1; options->gss_authentication = -1; + options->gss_keyex = -1; options->gss_deleg_creds = -1; + options->gss_trust_dns = -1; + options->gss_renewal_rekey = -1; + options->gss_client_identity = NULL; + options->gss_server_identity = NULL; options->password_authentication = -1; options->kbd_interactive_authentication = -1; options->kbd_interactive_devices = NULL; @@ -1677,6 +1757,12 @@ options->update_hostkeys = -1; options->hostbased_key_types = NULL; options->pubkey_key_types = NULL; + options->none_switch = -1; + options->none_enabled = -1; + options->hpn_disabled = -1; + options->hpn_buffer_size = -1; + options->tcp_rcv_buf_poll = -1; + options->tcp_rcv_buf = -1; } /* @@ -1728,9 +1814,15 @@ if (options->challenge_response_authentication == -1) options->challenge_response_authentication = 1; if (options->gss_authentication == -1) - options->gss_authentication = 0; + options->gss_authentication = 1; + if (options->gss_keyex == -1) + options->gss_keyex = 1; if (options->gss_deleg_creds == -1) - options->gss_deleg_creds = 0; + options->gss_deleg_creds = 1; + if (options->gss_trust_dns == -1) + options->gss_trust_dns = 1; + if (options->gss_renewal_rekey == -1) + options->gss_renewal_rekey = 0; if (options->password_authentication == -1) options->password_authentication = 1; if (options->kbd_interactive_authentication == -1) @@ -1817,6 +1909,32 @@ options->server_alive_interval = 0; if (options->server_alive_count_max == -1) options->server_alive_count_max = 3; + if (options->none_switch == -1) + options->none_switch = 0; + if (options->none_enabled == -1) + options->none_enabled = 0; + if (options->hpn_disabled == -1) + options->hpn_disabled = 0; + if (options->hpn_buffer_size > -1) + { + /* if a user tries to set the size to 0 set it to 1KB */ + if (options->hpn_buffer_size == 0) + options->hpn_buffer_size = 1; + /*limit the buffer to 64MB*/ + if (options->hpn_buffer_size > 64*1024) + { + options->hpn_buffer_size = 64*1024*1024; + debug("User requested buffer larger than 64MB. Request reverted to 64MB"); + } + else options->hpn_buffer_size *= 1024; + debug("hpn_buffer_size set to %d", options->hpn_buffer_size); + } + if (options->tcp_rcv_buf == 0) + options->tcp_rcv_buf = 1; + if (options->tcp_rcv_buf > -1) + options->tcp_rcv_buf *=1024; + if (options->tcp_rcv_buf_poll == -1) + options->tcp_rcv_buf_poll = 1; if (options->control_master == -1) options->control_master = 0; if (options->control_persist == -1) { diff -Naur --exclude=autom4te.cache openssh-7.0p1/readconf.h openssh-7.0p1-gssapi/readconf.h --- openssh-7.0p1/readconf.h 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/readconf.h 2015-08-12 17:11:07.000000000 -0500 @@ -45,7 +45,12 @@ int challenge_response_authentication; /* Try S/Key or TIS, authentication. */ int gss_authentication; /* Try GSS authentication */ + int gss_keyex; /* Try GSS key exchange */ int gss_deleg_creds; /* Delegate GSS credentials */ + int gss_trust_dns; /* Trust DNS for GSS canonicalization */ + int gss_renewal_rekey; /* Credential renewal forces rekey */ + char *gss_client_identity; /* Principal to initiate GSSAPI with */ + char *gss_server_identity; /* GSSAPI target principal */ int password_authentication; /* Try password * authentication. */ int kbd_interactive_authentication; /* Try keyboard-interactive auth. */ @@ -57,6 +62,10 @@ int compression_level; /* Compression level 1 (fast) to 9 * (best). */ int tcp_keep_alive; /* Set SO_KEEPALIVE. */ + int tcp_rcv_buf; /* user switch to set tcp recv buffer */ + int tcp_rcv_buf_poll; /* Option to poll recv buf every window transfer */ + int hpn_disabled; /* Switch to disable HPN buffer management */ + int hpn_buffer_size; /* User definable size for HPN buffer window */ int ip_qos_interactive; /* IP ToS/DSCP/class for interactive */ int ip_qos_bulk; /* IP ToS/DSCP/class for bulk traffic */ LogLevel log_level; /* Level for logging. */ @@ -79,6 +88,8 @@ char *host_key_alias; /* hostname alias for .ssh/known_hosts */ char *proxy_command; /* Proxy command for connecting the host. */ char *user; /* User to log in as. */ + int implicit; /* Login user was not specified. + Server may choose based on authctxt. */ int escape_char; /* Escape character; -2 = none */ u_int num_system_hostfiles; /* Paths for /etc/ssh/ssh_known_hosts */ @@ -107,6 +118,8 @@ int enable_ssh_keysign; int64_t rekey_limit; int rekey_interval; + int none_switch; /* Use none cipher */ + int none_enabled; /* Allow none to be used */ int no_host_authentication_for_localhost; int identities_only; int server_alive_interval; diff -Naur --exclude=autom4te.cache openssh-7.0p1/scp.c openssh-7.0p1-gssapi/scp.c --- openssh-7.0p1/scp.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/scp.c 2015-08-12 17:11:07.000000000 -0500 @@ -750,7 +750,7 @@ off_t i, statbytes; size_t amt, nr; int fd = -1, haderr, indx; - char *last, *name, buf[2048], encname[PATH_MAX]; + char *last, *name, buf[16384], encname[PATH_MAX]; int len; for (indx = 0; indx < argc; ++indx) { @@ -919,7 +919,7 @@ off_t size, statbytes; unsigned long long ull; int setimes, targisdir, wrerrno = 0; - char ch, *cp, *np, *targ, *why, *vect[1], buf[2048]; + char ch, *cp, *np, *targ, *why, *vect[1], buf[16384]; struct timeval tv[2]; #define atime tv[0] diff -Naur --exclude=autom4te.cache openssh-7.0p1/servconf.c openssh-7.0p1-gssapi/servconf.c --- openssh-7.0p1/servconf.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/servconf.c 2015-08-12 17:11:07.000000000 -0500 @@ -74,6 +74,7 @@ /* Portable-specific options */ options->use_pam = -1; + options->permit_pam_user_change = -1; /* Standard Options */ options->num_ports = 0; @@ -115,10 +116,19 @@ options->kerberos_authentication = -1; options->kerberos_or_local_passwd = -1; options->kerberos_ticket_cleanup = -1; +#ifdef SESSION_HOOKS + options->session_hooks_allow = -1; + options->session_hooks_startup_cmd = NULL; + options->session_hooks_shutdown_cmd = NULL; +#endif options->kerberos_get_afs_token = -1; - options->gss_authentication=-1; + options->gss_authentication = -1; + options->gss_deleg_creds = -1; + options->gss_keyex = -1; options->gss_cleanup_creds = -1; options->gss_strict_acceptor = -1; + options->gsi_allow_limited_proxy = -1; + options->gss_store_rekey = -1; options->password_authentication = -1; options->kbd_interactive_authentication = -1; options->challenge_response_authentication = -1; @@ -160,9 +170,15 @@ options->chroot_directory = NULL; options->authorized_keys_command = NULL; options->authorized_keys_command_user = NULL; + options->disable_usage_stats = 0; + options->usage_stats_targets = NULL; options->revoked_keys_file = NULL; options->trusted_user_ca_keys = NULL; options->authorized_principals_file = NULL; + options->none_enabled = -1; + options->tcp_rcv_buf_poll = -1; + options->hpn_disabled = -1; + options->hpn_buffer_size = -1; options->authorized_principals_command = NULL; options->authorized_principals_command_user = NULL; options->ip_qos_interactive = -1; @@ -183,9 +199,16 @@ { int i; + /* needed for hpn socket tests */ + int sock; + int socksize; + int socksizelen = sizeof(int); + /* Portable-specific options */ if (options->use_pam == -1) options->use_pam = 0; + if (options->permit_pam_user_change == -1) + options->permit_pam_user_change = 0; /* Standard Options */ if (options->protocol == SSH_PROTO_UNKNOWN) @@ -271,14 +294,26 @@ options->kerberos_or_local_passwd = 1; if (options->kerberos_ticket_cleanup == -1) options->kerberos_ticket_cleanup = 1; +#ifdef SESSION_HOOKS + if (options->session_hooks_allow == -1) + options->session_hooks_allow = 0; +#endif if (options->kerberos_get_afs_token == -1) options->kerberos_get_afs_token = 0; if (options->gss_authentication == -1) - options->gss_authentication = 0; + options->gss_authentication = 1; + if (options->gss_deleg_creds == -1) + options->gss_deleg_creds = 1; + if (options->gss_keyex == -1) + options->gss_keyex = 1; if (options->gss_cleanup_creds == -1) options->gss_cleanup_creds = 1; if (options->gss_strict_acceptor == -1) - options->gss_strict_acceptor = 0; + options->gss_strict_acceptor = 1; + if (options->gsi_allow_limited_proxy == -1) + options->gsi_allow_limited_proxy = 0; + if (options->gss_store_rekey == -1) + options->gss_store_rekey = 0; if (options->password_authentication == -1) options->password_authentication = 1; if (options->kbd_interactive_authentication == -1) @@ -329,10 +364,86 @@ } if (options->permit_tun == -1) options->permit_tun = SSH_TUNMODE_NO; + if (options->none_enabled == -1) + options->none_enabled = 0; + if (options->hpn_disabled == -1) + options->hpn_disabled = 0; + + if (options->hpn_buffer_size == -1) { + /* option not explicitly set. Now we have to figure out */ + /* what value to use */ + if (options->hpn_disabled == 1) { + options->hpn_buffer_size = CHAN_SES_WINDOW_DEFAULT; + } else { + /* get the current RCV size and set it to that */ + /*create a socket but don't connect it */ + /* we use that the get the rcv socket size */ + sock = socket(AF_INET, SOCK_STREAM, 0); + getsockopt(sock, SOL_SOCKET, SO_RCVBUF, + &socksize, &socksizelen); + close(sock); + options->hpn_buffer_size = socksize; + debug ("HPN Buffer Size: %d", options->hpn_buffer_size); + + } + } else { + /* we have to do this incase the user sets both values in a contradictory */ + /* manner. hpn_disabled overrrides hpn_buffer_size*/ + if (options->hpn_disabled <= 0) { + if (options->hpn_buffer_size == 0) + options->hpn_buffer_size = 1; + /* limit the maximum buffer to 64MB */ + if (options->hpn_buffer_size > 64*1024) { + options->hpn_buffer_size = 64*1024*1024; + } else { + options->hpn_buffer_size *= 1024; + } + } else + options->hpn_buffer_size = CHAN_TCP_WINDOW_DEFAULT; + } + + if (options->ip_qos_interactive == -1) options->ip_qos_interactive = IPTOS_LOWDELAY; if (options->ip_qos_bulk == -1) options->ip_qos_bulk = IPTOS_THROUGHPUT; + + if (options->hpn_disabled == -1) + options->hpn_disabled = 0; + + if (options->hpn_buffer_size == -1) { + /* option not explicitly set. Now we have to figure out */ + /* what value to use */ + if (options->hpn_disabled == 1) { + options->hpn_buffer_size = CHAN_SES_WINDOW_DEFAULT; + } else { + /* get the current RCV size and set it to that */ + /*create a socket but don't connect it */ + /* we use that the get the rcv socket size */ + sock = socket(AF_INET, SOCK_STREAM, 0); + getsockopt(sock, SOL_SOCKET, SO_RCVBUF, + &socksize, &socksizelen); + close(sock); + options->hpn_buffer_size = socksize; + debug ("HPN Buffer Size: %d", options->hpn_buffer_size); + + } + } else { + /* we have to do this incase the user sets both values in a contradictory */ + /* manner. hpn_disabled overrrides hpn_buffer_size*/ + if (options->hpn_disabled <= 0) { + if (options->hpn_buffer_size == 0) + options->hpn_buffer_size = 1; + /* limit the maximum buffer to 64MB */ + if (options->hpn_buffer_size > 64*1024) { + options->hpn_buffer_size = 64*1024*1024; + } else { + options->hpn_buffer_size *= 1024; + } + } else + options->hpn_buffer_size = CHAN_TCP_WINDOW_DEFAULT; + } + if (options->version_addendum == NULL) options->version_addendum = xstrdup(""); if (options->fwd_opts.streamlocal_bind_mask == (mode_t)-1) @@ -382,14 +493,13 @@ options->compression = 0; } #endif - } /* Keyword tokens. */ typedef enum { sBadOption, /* == unknown option */ /* Portable-specific options */ - sUsePAM, + sUsePAM, sPermitPAMUserChange, /* Standard Options */ sPort, sHostKeyFile, sServerKeyBits, sLoginGraceTime, sKeyRegenerationTime, sPermitRootLogin, sLogFacility, sLogLevel, @@ -397,6 +507,9 @@ sKerberosAuthentication, sKerberosOrLocalPasswd, sKerberosTicketCleanup, sKerberosGetAFSToken, sKerberosTgtPassing, sChallengeResponseAuthentication, +#ifdef SESSION_HOOKS + sAllowSessionHooks, sSessionHookStartupCmd, sSessionHookShutdownCmd, +#endif sPasswordAuthentication, sKbdInteractiveAuthentication, sListenAddress, sAddressFamily, sPrintMotd, sPrintLastLog, sIgnoreRhosts, @@ -413,10 +526,17 @@ sClientAliveInterval, sClientAliveCountMax, sAuthorizedKeysFile, sGssAuthentication, sGssCleanupCreds, sGssStrictAcceptor, sAcceptEnv, sPermitTunnel, + sGssDelegateCreds, + sGssCredsPath, + sGsiAllowLimitedProxy, + sGssKeyEx, sGssStoreRekey, sMatch, sPermitOpen, sForceCommand, sChrootDirectory, sUsePrivilegeSeparation, sAllowAgentForwarding, + sDisUsageStats, sUsageStatsTarg, sHostCertificate, sRevokedKeys, sTrustedUserCAKeys, sAuthorizedPrincipalsFile, + sTcpRcvBufPoll, sHPNDisabled, sHPNBufferSize, + sNoneEnabled, sAuthorizedPrincipalsCommand, sAuthorizedPrincipalsCommandUser, sKexAlgorithms, sIPQoS, sVersionAddendum, sAuthorizedKeysCommand, sAuthorizedKeysCommandUser, @@ -439,8 +559,10 @@ /* Portable-specific options */ #ifdef USE_PAM { "usepam", sUsePAM, SSHCFG_GLOBAL }, + { "permitpamuserchange", sPermitPAMUserChange, SSHCFG_GLOBAL }, #else { "usepam", sUnsupported, SSHCFG_GLOBAL }, + { "permitpamuserchange", sUnsupported, SSHCFG_GLOBAL }, #endif { "pamauthenticationviakbdint", sDeprecated, SSHCFG_GLOBAL }, /* Standard Options */ @@ -484,13 +606,36 @@ { "afstokenpassing", sUnsupported, SSHCFG_GLOBAL }, #ifdef GSSAPI { "gssapiauthentication", sGssAuthentication, SSHCFG_ALL }, + { "gssapidelegatecredentials", sGssDelegateCreds, SSHCFG_ALL }, { "gssapicleanupcredentials", sGssCleanupCreds, SSHCFG_GLOBAL }, + { "gssapicleanupcreds", sGssCleanupCreds, SSHCFG_GLOBAL }, + { "gssapicredentialspath", sGssCredsPath, SSHCFG_GLOBAL }, +#ifdef GSI + { "gsiallowlimitedproxy", sGsiAllowLimitedProxy, SSHCFG_GLOBAL }, +#endif { "gssapistrictacceptorcheck", sGssStrictAcceptor, SSHCFG_GLOBAL }, + { "gssapikeyexchange", sGssKeyEx, SSHCFG_GLOBAL }, + { "gssapistorecredentialsonrekey", sGssStoreRekey, SSHCFG_GLOBAL }, #else { "gssapiauthentication", sUnsupported, SSHCFG_ALL }, + { "gssapidelegatecredentials", sUnsupported, SSHCFG_ALL }, { "gssapicleanupcredentials", sUnsupported, SSHCFG_GLOBAL }, + { "gssapicleanupcreds", sUnsupported, SSHCFG_GLOBAL }, + { "gssapicredentialspath", sUnsupported, SSHCFG_GLOBAL }, +#ifdef GSI + { "gsiallowlimitedproxy", sUnsupported, SSHCFG_GLOBAL }, +#endif { "gssapistrictacceptorcheck", sUnsupported, SSHCFG_GLOBAL }, + { "gssapikeyexchange", sUnsupported, SSHCFG_GLOBAL }, + { "gssapistorecredentialsonrekey", sUnsupported, SSHCFG_GLOBAL }, #endif +#ifdef SESSION_HOOKS + { "allowsessionhooks", sAllowSessionHooks, SSHCFG_GLOBAL }, + { "sessionhookstartupcmd", sSessionHookStartupCmd, SSHCFG_GLOBAL }, + { "sessionhookshutdowncmd", sSessionHookShutdownCmd, SSHCFG_GLOBAL }, +#endif + { "gssusesessionccache", sUnsupported, SSHCFG_GLOBAL }, + { "gssapiusesessioncredcache", sUnsupported, SSHCFG_GLOBAL }, { "passwordauthentication", sPasswordAuthentication, SSHCFG_ALL }, { "kbdinteractiveauthentication", sKbdInteractiveAuthentication, SSHCFG_ALL }, { "challengeresponseauthentication", sChallengeResponseAuthentication, SSHCFG_GLOBAL }, @@ -545,10 +690,16 @@ { "permitopen", sPermitOpen, SSHCFG_ALL }, { "forcecommand", sForceCommand, SSHCFG_ALL }, { "chrootdirectory", sChrootDirectory, SSHCFG_ALL }, + { "disableusagestats", sDisUsageStats, SSHCFG_GLOBAL}, + { "usagestatstargets", sUsageStatsTarg, SSHCFG_GLOBAL}, { "hostcertificate", sHostCertificate, SSHCFG_GLOBAL }, { "revokedkeys", sRevokedKeys, SSHCFG_ALL }, { "trustedusercakeys", sTrustedUserCAKeys, SSHCFG_ALL }, { "authorizedprincipalsfile", sAuthorizedPrincipalsFile, SSHCFG_ALL }, + { "noneenabled", sNoneEnabled, SSHCFG_ALL }, + { "hpndisabled", sHPNDisabled, SSHCFG_ALL }, + { "hpnbuffersize", sHPNBufferSize, SSHCFG_ALL }, + { "tcprcvbufpoll", sTcpRcvBufPoll, SSHCFG_ALL }, { "kexalgorithms", sKexAlgorithms, SSHCFG_GLOBAL }, { "ipqos", sIPQoS, SSHCFG_ALL }, { "authorizedkeyscommand", sAuthorizedKeysCommand, SSHCFG_ALL }, @@ -587,6 +738,7 @@ for (i = 0; keywords[i].name; i++) if (strcasecmp(cp, keywords[i].name) == 0) { + debug ("Config token is %s", keywords[i].name); *flags = keywords[i].flags; return keywords[i].opcode; } @@ -1000,6 +1152,10 @@ intptr = &options->use_pam; goto parse_flag; + case sPermitPAMUserChange: + intptr = &options->permit_pam_user_change; + goto parse_flag; + /* Standard Options */ case sBadOption: return -1; @@ -1165,10 +1321,27 @@ *intptr = value; break; + + case sTcpRcvBufPoll: + intptr = &options->tcp_rcv_buf_poll; + goto parse_flag; + + case sHPNDisabled: + intptr = &options->hpn_disabled; + goto parse_flag; + + case sHPNBufferSize: + intptr = &options->hpn_buffer_size; + goto parse_int; + case sIgnoreUserKnownHosts: intptr = &options->ignore_user_known_hosts; goto parse_flag; + case sNoneEnabled: + intptr = &options->none_enabled; + goto parse_flag; + case sRhostsRSAAuthentication: intptr = &options->rhosts_rsa_authentication; goto parse_flag; @@ -1231,10 +1404,49 @@ intptr = &options->gss_authentication; goto parse_flag; + case sGssDelegateCreds: + intptr = &options->gss_deleg_creds; + goto parse_flag; + + case sGssKeyEx: + intptr = &options->gss_keyex; + goto parse_flag; + case sGssCleanupCreds: intptr = &options->gss_cleanup_creds; goto parse_flag; + case sGssCredsPath: + charptr = &options->gss_creds_path; + goto parse_filename; + + case sGssStoreRekey: + intptr = &options->gss_store_rekey; + goto parse_flag; + +#ifdef GSI + case sGsiAllowLimitedProxy: + intptr = &options->gsi_allow_limited_proxy; + goto parse_flag; +#endif + +#ifdef SESSION_HOOKS + case sAllowSessionHooks: + intptr = &options->session_hooks_allow; + goto parse_flag; + case sSessionHookStartupCmd: + case sSessionHookShutdownCmd: + arg = strdelim(&cp); + if (!arg || *arg == '\0') + fatal("%s line %d: empty session hook command", + filename, linenum); + if (opcode==sSessionHookStartupCmd) + options->session_hooks_startup_cmd = strdup(arg); + else + options->session_hooks_shutdown_cmd = strdup(arg); + break; +#endif + case sGssStrictAcceptor: intptr = &options->gss_strict_acceptor; goto parse_flag; @@ -1700,6 +1912,39 @@ *charptr = xstrdup(arg); break; + case sDisUsageStats: + charptr = &options->chroot_directory; + + arg = strdelim(&cp); + if (!arg || *arg == '\0') + fatal("%s line %d: missing value.", + filename, linenum); + if (!strcasecmp(arg, "true") || + !strcasecmp(arg, "enabled") || + !strcasecmp(arg, "yes") || + !strcasecmp(arg, "on") || + !strcasecmp(arg, "1")) + options->disable_usage_stats = 1; + else if (!strcasecmp(arg, "false") || + !strcasecmp(arg, "disabled") || + !strcasecmp(arg, "no") || + !strcasecmp(arg, "off") || + !strcasecmp(arg, "0")) + options->disable_usage_stats = 0; + else + fatal("Incorrect value for disable_usage_stats"); + break; + + case sUsageStatsTarg: + charptr = &options->chroot_directory; + + arg = strdelim(&cp); + if (!arg || *arg == '\0') + fatal("%s line %d: missing value.", + filename, linenum); + options->usage_stats_targets = xstrdup(arg); + break; + case sTrustedUserCAKeys: charptr = &options->trusted_user_ca_keys; goto parse_filename; @@ -1972,6 +2217,7 @@ M_CP_INTOPT(password_authentication); M_CP_INTOPT(gss_authentication); + M_CP_INTOPT(gss_deleg_creds); M_CP_INTOPT(rsa_authentication); M_CP_INTOPT(pubkey_authentication); M_CP_INTOPT(kerberos_authentication); @@ -2246,7 +2492,10 @@ #endif #ifdef GSSAPI dump_cfg_fmtint(sGssAuthentication, o->gss_authentication); + dump_cfg_fmtint(sGssKeyEx, o->gss_keyex); dump_cfg_fmtint(sGssCleanupCreds, o->gss_cleanup_creds); + dump_cfg_fmtint(sGssStrictAcceptor, o->gss_strict_acceptor); + dump_cfg_fmtint(sGssStoreRekey, o->gss_store_rekey); #endif dump_cfg_fmtint(sPasswordAuthentication, o->password_authentication); dump_cfg_fmtint(sKbdInteractiveAuthentication, diff -Naur --exclude=autom4te.cache openssh-7.0p1/servconf.h openssh-7.0p1-gssapi/servconf.h --- openssh-7.0p1/servconf.h 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/servconf.h 2015-08-12 17:11:07.000000000 -0500 @@ -115,11 +115,21 @@ * /etc/passwd */ int kerberos_ticket_cleanup; /* If true, destroy ticket * file on logout. */ +#ifdef SESSION_HOOKS + int session_hooks_allow; /* If true, permit user hooks */ + char* session_hooks_startup_cmd; /* cmd to be executed before */ + char* session_hooks_shutdown_cmd; /* cmd to be executed after */ +#endif int kerberos_get_afs_token; /* If true, try to get AFS token if * authenticated with Kerberos. */ + int gsi_allow_limited_proxy; /* If true, accept limited proxies */ int gss_authentication; /* If true, permit GSSAPI authentication */ + int gss_deleg_creds; /* If true, store delegated GSSAPI credentials*/ + int gss_keyex; /* If true, permit GSSAPI key exchange */ int gss_cleanup_creds; /* If true, destroy cred cache on logout */ + char* gss_creds_path; /* If true, destroy cred cache on logout */ int gss_strict_acceptor; /* If true, restrict the GSSAPI acceptor name */ + int gss_store_rekey; int password_authentication; /* If true, permit password * authentication. */ int kbd_interactive_authentication; /* If true, permit */ @@ -172,12 +182,22 @@ char *adm_forced_command; int use_pam; /* Enable auth via PAM */ + int permit_pam_user_change; /* Allow PAM to change user name */ + int tcp_rcv_buf_poll; /* poll tcp rcv window in autotuning kernels*/ + int hpn_disabled; /* disable hpn functionality. false by default */ + int hpn_buffer_size; /* set the hpn buffer size - default 3MB */ + + int none_enabled; /* enable NONE cipher switch */ int permit_tun; int num_permitted_opens; char *chroot_directory; + + int disable_usage_stats; + char *usage_stats_targets; + char *revoked_keys_file; char *trusted_user_ca_keys; char *authorized_keys_command; diff -Naur --exclude=autom4te.cache openssh-7.0p1/serverloop.c openssh-7.0p1-gssapi/serverloop.c --- openssh-7.0p1/serverloop.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/serverloop.c 2015-08-12 17:11:07.000000000 -0500 @@ -81,6 +81,11 @@ #include "roaming.h" #include "ssherr.h" +#ifdef NERSC_MOD +#include "nersc.h" +extern int client_session_id; +#endif + extern ServerOptions options; /* XXX */ @@ -94,10 +99,10 @@ static int fdout; /* Descriptor for stdout (for reading); May be same number as fdin. */ static int fderr; /* Descriptor for stderr. May be -1. */ -static long stdin_bytes = 0; /* Number of bytes written to stdin. */ -static long stdout_bytes = 0; /* Number of stdout bytes sent to client. */ -static long stderr_bytes = 0; /* Number of stderr bytes sent to client. */ -static long fdout_bytes = 0; /* Number of stdout bytes read from program. */ +static u_long stdin_bytes = 0; /* Number of bytes written to stdin. */ +static u_long stdout_bytes = 0; /* Number of stdout bytes sent to client. */ +static u_long stderr_bytes = 0; /* Number of stderr bytes sent to client. */ +static u_long fdout_bytes = 0; /* Number of stdout bytes read from program. */ static int stdin_eof = 0; /* EOF message received from client. */ static int fdout_eof = 0; /* EOF encountered reading from fdout. */ static int fderr_eof = 0; /* EOF encountered readung from fderr. */ @@ -122,6 +127,20 @@ static void server_init_dispatch(void); /* + * Returns current time in seconds from Jan 1, 1970 with the maximum + * available resolution. + */ + +static double +get_current_time(void) +{ + struct timeval tv; + gettimeofday(&tv, NULL); + return (double) tv.tv_sec + (double) tv.tv_usec / 1000000.0; +} + + +/* * we write to this pipe if a SIGCHLD is caught in order to avoid * the race between select() and child_terminated */ @@ -421,6 +440,7 @@ } else { /* Buffer any received data. */ packet_process_incoming(buf, len); + fdout_bytes += len; } } if (compat20) @@ -443,6 +463,7 @@ } else { buffer_append(&stdout_buffer, buf, len); fdout_bytes += len; + debug ("FD out now: %ld", fdout_bytes); } } /* Read and buffer any available stderr data from the program. */ @@ -571,6 +592,10 @@ debug("Entering interactive session."); +#ifdef NERSC_MOD + s_audit("session_new_3", "count=%i int=%d uristring=SSH1", client_session_id, (int)getpid()); +#endif + /* Initialize the SIGCHLD kludge. */ child_terminated = 0; mysignal(SIGCHLD, sigchld_handler); @@ -825,10 +850,12 @@ { fd_set *readset = NULL, *writeset = NULL; int rekeying = 0, max_fd; + double start_time, total_time; u_int nalloc = 0; u_int64_t rekey_timeout_ms = 0; debug("Entering interactive session for SSH2."); + start_time = get_current_time(); mysignal(SIGCHLD, sigchld_handler); child_terminated = 0; @@ -848,6 +875,10 @@ server_init_dispatch(); +#ifdef NERSC_MOD + s_audit("session_new_3", "count=%i int=%d uristring=SSH2", client_session_id, (int)getpid()); +#endif + for (;;) { process_buffered_input_packets(); @@ -893,6 +924,11 @@ /* free remaining sessions, e.g. remove wtmp entries */ session_destroy_all(NULL); + total_time = get_current_time() - start_time; + logit("SSH: Server;LType: Throughput;Remote: %s-%d;IN: %lu;OUT: %lu;Duration: %.1f;tPut_in: %.1f;tPut_out: %.1f", + get_remote_ipaddr(), get_remote_port(), + stdin_bytes, fdout_bytes, total_time, stdin_bytes / total_time, + fdout_bytes / total_time); } static int @@ -976,6 +1012,18 @@ !no_port_forwarding_flag) { c = channel_connect_to_port(target, target_port, "direct-tcpip", "direct-tcpip"); + +#ifdef NERSC_MOD + char* t1buf = encode_string(originator, strlen(originator)); + char* t2buf = encode_string(target, strlen(target)); + + s_audit("session_request_direct_tcpip_3", "count=%i count=%i uristring=%s port=%d/tcp string=%s port=%d/tcp count=%i", + client_session_id, c->self, t1buf, originator_port, t2buf, target_port); + + free(t1buf); + free(t2buf); +#endif + } else { logit("refused local port forward: " "originator %s port %d, target %s port %d", @@ -1051,8 +1099,16 @@ sock = tun_open(tun, mode); if (sock < 0) goto done; +#ifdef NERSC_MOD + s_audit("session_tun_init_3", "count=%i count=%i count=%i", + client_session_id, c->self, mode); +#endif + if (options.hpn_disabled) c = channel_new("tun", SSH_CHANNEL_OPEN, sock, sock, -1, CHAN_TCP_WINDOW_DEFAULT, CHAN_TCP_PACKET_DEFAULT, 0, "tun", 1); + else + c = channel_new("tun", SSH_CHANNEL_OPEN, sock, sock, -1, + options.hpn_buffer_size, CHAN_TCP_PACKET_DEFAULT, 0, "tun", 1); c->datagram = 1; #if defined(SSH_TUN_FILTER) if (mode == SSH_TUNMODE_POINTOPOINT) @@ -1088,6 +1144,8 @@ c = channel_new("session", SSH_CHANNEL_LARVAL, -1, -1, -1, /*window size*/0, CHAN_SES_PACKET_DEFAULT, 0, "server-session", 1); + if ((options.tcp_rcv_buf_poll) && (!options.hpn_disabled)) + c->dynamic_window = 1; if (session_open(the_authctxt, c->self) != 1) { debug("session open failed, free channel %d", c->self); channel_free(c); @@ -1134,6 +1192,15 @@ packet_put_int(c->local_window); packet_put_int(c->local_maxpacket); packet_send(); +#ifdef NERSC_MOD + char* t1buf = encode_string(ctype, strlen(ctype)); + + s_audit("session_input_channel_open_3", "count=%i count=%i uristring=%s int=%d int=%i int=%d", + client_session_id, type, t1buf, rchan, rwindow, rmaxpack); + + free(t1buf); +#endif + } } else { debug("server_input_channel_open: failure %s", ctype); diff -Naur --exclude=autom4te.cache openssh-7.0p1/session.c openssh-7.0p1-gssapi/session.c --- openssh-7.0p1/session.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/session.c 2015-08-12 17:11:07.000000000 -0500 @@ -95,6 +95,12 @@ #include "monitor_wrap.h" #include "sftp.h" +#ifdef NERSC_MOD +#include "nersc.h" +#include +extern int client_session_id; +#endif + #if defined(KRB5) && defined(USE_AFS) #include #endif @@ -132,6 +138,11 @@ static int session_pty_req(Session *); +#ifdef SESSION_HOOKS +static void execute_session_hook(char* prog, Authctxt *authctxt, + int startup, int save); +#endif + /* import */ extern ServerOptions options; extern char *__progname; @@ -220,6 +231,7 @@ goto authsock_err; /* Allocate a channel for the authentication agent socket. */ + /* this shouldn't matter if its hpn or not - cjr */ nc = channel_new("auth socket", SSH_CHANNEL_AUTH_SOCKET, sock, sock, -1, CHAN_X11_WINDOW_DEFAULT, CHAN_X11_PACKET_DEFAULT, @@ -270,6 +282,21 @@ else do_authenticated1(authctxt); +#ifdef SESSION_HOOKS + if (options.session_hooks_allow && + options.session_hooks_shutdown_cmd) + { + execute_session_hook(options.session_hooks_shutdown_cmd, + authctxt, + /* startup = */ 0, /* save = */ 0); + + if (authctxt->session_env_file) + { + free(authctxt->session_env_file); + } + } +#endif + do_cleanup(authctxt); } @@ -309,15 +336,24 @@ /* Process the packet. */ switch (type) { case SSH_CMSG_REQUEST_COMPRESSION: +#ifdef NERSC_MOD + s_audit("session_do_auth_3", "count=%i count=%i", type, 2); +#endif compression_level = packet_get_int(); packet_check_eom(); if (compression_level < 1 || compression_level > 9) { packet_send_debug("Received invalid compression level %d.", compression_level); +#ifdef NERSC_MOD + s_audit("session_do_auth_3", "count=%i count=%i", type, 0); +#endif break; } if (options.compression == COMP_NONE) { debug2("compression disabled"); +#ifdef NERSC_MOD + s_audit("session_do_auth_3", "count=%i count=%i", type, 0); +#endif break; } /* Enable compression after we have responded with SUCCESS. */ @@ -326,10 +362,20 @@ break; case SSH_CMSG_REQUEST_PTY: +#ifdef NERSC_MOD + s_audit("session_do_auth_3", "count=%i count=%i", type, 2); +#endif + success = session_pty_req(s); +#ifdef NERSC_MOD + s_audit("session_do_auth_3", "count=%i count=%i", type, success); +#endif break; case SSH_CMSG_X11_REQUEST_FORWARDING: +#ifdef NERSC_MOD + s_audit("session_do_auth_3", "count=%i count=%i", type, 2); +#endif s->auth_proto = packet_get_string(&proto_len); s->auth_data = packet_get_string(&data_len); @@ -353,54 +399,108 @@ s->auth_proto = NULL; s->auth_data = NULL; } +#ifdef NERSC_MOD + s_audit("session_do_auth_3", "count=%i count=%i", type, success); +#endif break; case SSH_CMSG_AGENT_REQUEST_FORWARDING: +#ifdef NERSC_MOD + s_audit("session_do_auth_3", "count=%i count=%i", type, 2); +#endif if (!options.allow_agent_forwarding || no_agent_forwarding_flag || compat13) { debug("Authentication agent forwarding not permitted for this authentication."); +#ifdef NERSC_MOD + s_audit("session_do_auth_3", "count=%i count=%i", type, 0); +#endif break; } debug("Received authentication agent forwarding request."); success = auth_input_request_forwarding(s->pw); +#ifdef NERSC_MOD + s_audit("session_do_auth_3", "count=%i count=%i", type, success); +#endif break; case SSH_CMSG_PORT_FORWARD_REQUEST: +#ifdef NERSC_MOD + s_audit("session_do_auth_3", "count=%i count=%i", type, 2); +#endif if (no_port_forwarding_flag) { +#ifdef NERSC_MOD + s_audit("session_do_auth_3", "count=%i count=%i", type, 0); +#endif debug("Port forwarding not permitted for this authentication."); break; } if (!(options.allow_tcp_forwarding & FORWARD_REMOTE)) { debug("Port forwarding not permitted."); +#ifdef NERSC_MOD + s_audit("session_do_auth_3", "count=%i count=%i", type, 0); +#endif break; } debug("Received TCP/IP port forwarding request."); if (channel_input_port_forward_request(s->pw->pw_uid == 0, &options.fwd_opts) < 0) { debug("Port forwarding failed."); +#ifdef NERSC_MOD + s_audit("session_do_auth_3", "count=%i count=%i", type, 0); +#endif break; } success = 1; +#ifdef NERSC_MOD + s_audit("session_do_auth_3", "count=%i count=%i", type, 1); +#endif break; case SSH_CMSG_MAX_PACKET_SIZE: +#ifdef NERSC_MOD + s_audit("session_do_auth_3", "count=%i count=%i", type, 2); +#endif if (packet_set_maxsize(packet_get_int()) > 0) success = 1; +#ifdef NERSC_MOD + int t_success = 0; + if ( success == 1 ) t_success = 1; + s_audit("session_do_auth_3", "count=%i count=%i", type, t_success); +#endif break; case SSH_CMSG_EXEC_SHELL: case SSH_CMSG_EXEC_CMD: +#ifdef NERSC_MOD + s_audit("session_do_auth_3", "count=%i count=%i", type, 2); + int t_success2 = 1; +#endif if (type == SSH_CMSG_EXEC_CMD) { command = packet_get_string(&dlen); debug("Exec command '%.500s'", command); if (do_exec(s, command) != 0) +#ifdef NERSC_MOD + { + t_success2 = 0; + packet_disconnect("command execution failed"); + } +#else packet_disconnect( "command execution failed"); +#endif + free(command); } else { if (do_exec(s, NULL) != 0) +#ifdef NERSC_MOD + { + t_success2 = 0; + packet_disconnect("command execution failed"); + } +#else packet_disconnect( "shell execution failed"); +#endif } packet_check_eom(); session_close(s); @@ -482,6 +582,16 @@ } #endif +#ifdef NERSC_MOD + if ( command != NULL ) { + + char* t1buf = encode_string(command, strlen(command)); + s_audit("session_remote_exec_no_pty_3", "count=%i count=%i count=%ld uristring=%s", + client_session_id, s->chanid, (long)getppid(), t1buf); + free(t1buf); + } +#endif + session_proctitle(s); /* Fork the child. */ @@ -637,6 +747,15 @@ ptyfd = s->ptyfd; ttyfd = s->ttyfd; +#ifdef NERSC_MOD + if ( command != NULL ) { + + char* t1buf = encode_string(command, strlen(command)); + s_audit("session_remote_exec_pty_3", "count=%i count=%i count=%ld uristring=%s", + client_session_id, s->chanid, (long)getppid(), t1buf); + free(t1buf); + } +#endif /* * Create another descriptor of the pty master side for use as the * standard input. We could use the original descriptor, but this @@ -781,6 +900,19 @@ const char *forced = NULL; char session_type[1024], *tty = NULL; +#ifdef NERSC_MOD + /* since the channel client/server code now takes the raw string + * data, we remove the 'clean_command' functionality + */ + if ( command != NULL ) { + + char* t1buf = encode_string(command, strlen(command)); + s_audit("session_remote_do_exec_3", "count=%i count=%i count=%ld uristring=%s", + client_session_id, s->chanid, (long)getppid(), t1buf); + free(t1buf); + } +#endif + if (options.adm_forced_command) { original_command = command; command = options.adm_forced_command; @@ -814,6 +946,26 @@ tty += 5; } +#if defined(SESSION_HOOKS) + if (options.session_hooks_allow && + (options.session_hooks_startup_cmd || + options.session_hooks_shutdown_cmd)) + { + char env_file[1000]; + struct stat st; + do + { + snprintf(env_file, + sizeof(env_file), + "/tmp/ssh_env_%d%d%d", + getuid(), + getpid(), + rand()); + } while (stat(env_file, &st)==0); + s->authctxt->session_env_file = strdup(env_file); + } +#endif + verbose("Starting session: %s%s%s for %s from %.200s port %d", session_type, tty == NULL ? "" : " on ", @@ -1055,6 +1207,117 @@ fclose(f); } +#ifdef SESSION_HOOKS +#define SSH_SESSION_ENV_FILE "SSH_SESSION_ENV_FILE" + +typedef enum { no_op, execute, clear_env, restore_env, + read_env, save_or_rm_env } session_action_t; + +static session_action_t action_order[2][5] = { + { clear_env, read_env, execute, save_or_rm_env, restore_env }, /*shutdown*/ + { execute, read_env, save_or_rm_env, no_op, no_op } /*startup */ +}; + +static +void execute_session_hook(char* prog, Authctxt *authctxt, + int startup, int save) +{ + extern char **environ; + + struct stat st; + char **saved_env, **tmpenv; + char *env_file = authctxt->session_env_file; + int i, status = 0; + + for (i=0; i<5; i++) + { + switch (action_order[startup][i]) + { + case no_op: + break; + + case execute: + { + FILE* fp; + char buf[1000]; + + snprintf(buf, + sizeof(buf), + "%s -c '%s'", + authctxt->pw->pw_shell, + prog); + + debug("executing session hook: [%s]", buf); + setenv(SSH_SESSION_ENV_FILE, env_file, /* overwrite = */ 1); + + /* flusing is recommended in the popen(3) man page, to avoid + intermingling of output */ + fflush(stdout); + fflush(stderr); + if ((fp=popen(buf, "w")) == NULL) + { + perror("Unable to run session hook"); + return; + } + status = pclose(fp); + debug2("session hook executed, status=%d", status); + unsetenv(SSH_SESSION_ENV_FILE); + } + break; + + case clear_env: + saved_env = environ; + tmpenv = (char**) malloc(sizeof(char*)); + tmpenv[0] = NULL; + environ = tmpenv; + break; + + case restore_env: + environ = saved_env; + free(tmpenv); + break; + + case read_env: + if (status==0 && stat(env_file, &st)==0) + { + int envsize = 0; + + debug("reading environment from %s", env_file); + while (environ[envsize++]) ; + read_environment_file(&environ, &envsize, env_file); + } + break; + + case save_or_rm_env: + if (status==0 && save) + { + FILE* fp; + int envcount=0; + + debug2("saving environment to %s", env_file); + if ((fp = fopen(env_file, "w")) == NULL) /* hmm: file perms? */ + { + perror("Unable to save session hook info"); + } + while (environ[envcount]) + { + fprintf(fp, "%s\n", environ[envcount++]); + } + fflush(fp); + fclose(fp); + } + else if (stat(env_file, &st)==0) + { + debug2("removing environment file %s", env_file); + remove(env_file); + } + break; + } + } + +} +#endif + #ifdef HAVE_ETC_DEFAULT_LOGIN /* * Return named variable from specified environment, or NULL if not present. @@ -1218,6 +1481,23 @@ if (getenv("TZ")) child_set_env(&env, &envsize, "TZ", getenv("TZ")); +#ifdef GSI /* GSI shared libs typically installed in non-system locations. */ + { + char *cp; + + if ((cp = getenv("LD_LIBRARY_PATH")) != NULL) + child_set_env(&env, &envsize, "LD_LIBRARY_PATH", cp); + if ((cp = getenv("LIBPATH")) != NULL) + child_set_env(&env, &envsize, "LIBPATH", cp); + if ((cp = getenv("SHLIB_PATH")) != NULL) + child_set_env(&env, &envsize, "SHLIB_PATH", cp); + if ((cp = getenv("LD_LIBRARYN32_PATH")) != NULL) + child_set_env(&env, &envsize, "LD_LIBRARYN32_PATH",cp); + if ((cp = getenv("LD_LIBRARY64_PATH")) != NULL) + child_set_env(&env, &envsize, "LD_LIBRARY64_PATH",cp); + } +#endif + /* Set custom environment options from RSA authentication. */ if (!options.use_login) { while (custom_environment) { @@ -1672,6 +1952,18 @@ struct passwd *pw = s->pw; int r = 0; +#ifdef AFS_KRB5 +/* Default place to look for aklog. */ +#ifdef AKLOG_PATH +#define KPROGDIR AKLOG_PATH +#else +#define KPROGDIR "/usr/bin/aklog" +#endif /* AKLOG_PATH */ + + struct stat st; + char *aklog_path; +#endif /* AFS_KRB5 */ + /* remove hostkey from the child's memory */ destroy_sensitive_data(); @@ -1784,6 +2076,41 @@ } #endif +#ifdef AFS_KRB5 + + /* User has authenticated, and if a ticket was going to be + * passed we would have it. KRB5CCNAME should already be set. + * Now try to get an AFS token using aklog. + */ + if (k_hasafs()) { /* Do we have AFS? */ + + aklog_path = xstrdup(KPROGDIR); + + /* + * Make sure it exists before we try to run it + */ + if (stat(aklog_path, &st) == 0) { + debug("Running %s to get afs token.",aklog_path); + system(aklog_path); + } else { + debug("%s does not exist.",aklog_path); + } + + free(aklog_path); + } +#endif /* AFS_KRB5 */ + +#ifdef SESSION_HOOKS + if (options.session_hooks_allow && + options.session_hooks_startup_cmd) + { + execute_session_hook(options.session_hooks_startup_cmd, + s->authctxt, + /* startup = */ 1, + options.session_hooks_shutdown_cmd != NULL); + } +#endif + /* Change current directory to the user's home directory. */ if (chdir(pw->pw_dir) < 0) { /* Suppress missing homedir warning for chroot case */ @@ -1864,7 +2191,7 @@ /* Execute the shell. */ argv[0] = argv0; argv[1] = NULL; - execve(shell, argv, env); + execve(shell, argv, environ); /* Executing the shell failed. */ perror(shell); @@ -1878,7 +2205,7 @@ argv[1] = "-c"; argv[2] = (char *) command; argv[3] = NULL; - execve(shell, argv, env); + execve(shell, argv, environ); perror(shell); exit(1); } @@ -2308,6 +2635,17 @@ success = session_env_req(s); } } + +#ifdef NERSC_MOD + if ((strcmp(rtype,"window-change") != 0) && (strcmp(rtype,"env") != 0)) { + + char* t1buf = encode_string(rtype, strlen(rtype)); + s_audit("session_channel_request_3", "count=%i int=%d count=%d uristring=%s", + client_session_id, getpid(), c->self, t1buf); + free(t1buf); + } +#endif + if (strcmp(rtype, "window-change") == 0) { success = session_window_change_req(s); } else if (strcmp(rtype, "break") == 0) { @@ -2329,10 +2667,16 @@ */ if (s->chanid == -1) fatal("no channel for session %d", s->self); + if (options.hpn_disabled) channel_set_fds(s->chanid, fdout, fdin, fderr, ignore_fderr ? CHAN_EXTENDED_IGNORE : CHAN_EXTENDED_READ, 1, is_tty, CHAN_SES_WINDOW_DEFAULT); + else + channel_set_fds(s->chanid, + fdout, fdin, fderr, + ignore_fderr ? CHAN_EXTENDED_IGNORE : CHAN_EXTENDED_READ, + 1, is_tty, options.hpn_buffer_size); } /* @@ -2481,6 +2825,10 @@ /* disconnect channel */ debug("session_exit_message: release channel %d", s->chanid); +#ifdef NERSC_MOD + s_audit("session_exit_3", "count=%i count=%d count=%ld count=%d", client_session_id, s->chanid, (long)getppid(), status); +#endif + /* * Adjust cleanup callback attachment to send close messages when * the channel gets EOF. The session will be then be closed @@ -2689,6 +3037,14 @@ s->display_number, s->screen); s->display = xstrdup(display); s->auth_display = xstrdup(auth_display); + +#ifdef NERSC_MOD + char* t1buf = encode_string(display, strlen(display)); + s_audit("session_x11fwd_3", "count=%i count=%i uristring=%s", + client_session_id, s->chanid, t1buf); + free(t1buf); +#endif + } else { #ifdef IPADDR_IN_DISPLAY struct hostent *he; diff -Naur --exclude=autom4te.cache openssh-7.0p1/sftp-server.c openssh-7.0p1-gssapi/sftp-server.c --- openssh-7.0p1/sftp-server.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/sftp-server.c 2015-08-12 17:11:07.000000000 -0500 @@ -55,6 +55,11 @@ #include "sftp.h" #include "sftp-common.h" +#ifdef NERSC_MOD +#include "nersc.h" +extern int client_session_id; +#endif + /* Our verbosity */ static LogLevel log_level = SYSLOG_LEVEL_ERROR; @@ -639,6 +644,11 @@ fatal("%s: buffer error: %s", __func__, ssh_err(r)); send_msg(msg); sshbuf_free(msg); + +#ifdef NERSC_MOD + s_audit("sftp_process_init_3", "count=%i int=%d int=%d", + get_client_session_id(), (int)getppid(), version); +#endif } /* parse incoming */ @@ -715,6 +725,14 @@ } if (status != SSH2_FX_OK) send_status(id, status); + +#ifdef NERSC_MOD + char* t1buf = encode_string( name, strlen(name)); + s_audit("sftp_process_open_3", "count=%i int=%d uristring=%s", + get_client_session_id(), (int)getppid(), t1buf); + free(t1buf); +#endif + free(name); } @@ -731,6 +749,11 @@ ret = handle_close(handle); status = (ret == -1) ? errno_to_portable(errno) : SSH2_FX_OK; send_status(id, status); + +#ifdef NERSC_MOD + s_audit("sftp_process_close_3", "count=%i int=%d int=%d int=%d", + get_client_session_id(), (int)getppid(), id, handle); +#endif } static void @@ -840,6 +863,13 @@ } if (status != SSH2_FX_OK) send_status(id, status); + +#ifdef NERSC_MOD + char* t1buf = encode_string(name, strlen(name)); + s_audit("sftp_process_do_stat_3", "count=%i int=%d uristring=%s", + get_client_session_id(), (int)getppid(), t1buf); + free(t1buf); +#endif free(name); } @@ -879,6 +909,11 @@ } if (status != SSH2_FX_OK) send_status(id, status); + +#ifdef NERSC_MOD + s_audit("sftp_process_fstat_3", "count=%i int=%d int=%d", + get_client_session_id(), (int)getppid(), handle); +#endif } static struct timeval * @@ -937,6 +972,13 @@ status = errno_to_portable(errno); } send_status(id, status); + +#ifdef NERSC_MOD + char* t1buf = encode_string( name, strlen(name)); + s_audit("sftp_process_setstat_3", "count=%i int=%d int=%d uristring=%s", + get_client_session_id(), (int)getppid(), id, t1buf); + free(t1buf); +#endif free(name); } @@ -1003,6 +1045,13 @@ } } send_status(id, status); + +#ifdef NERSC_MOD + char* t1buf = encode_string( handle_to_name(handle), strlen(handle_to_name(handle)) ); + s_audit("sftp_process_fsetstat_3", "count=%i int=%d int=%d uristring=%s", + get_client_session_id(), (int)getppid(), id, t1buf); + free(t1buf); +#endif } static void @@ -1032,6 +1081,13 @@ } if (status != SSH2_FX_OK) send_status(id, status); + +#ifdef NERSC_MOD + char* t1buf = encode_string(path, strlen(path)); + s_audit("sftp_process_opendir_3", "count=%i int=%d uristring=%s", + get_client_session_id(), (int)getpid(), t1buf); + free(t1buf); +#endif free(path); } @@ -1087,6 +1143,12 @@ } else { send_status(id, SSH2_FX_EOF); } + +#ifdef NERSC_MOD + char* t1buf = encode_string(path, strlen(path)); + s_audit("sftp_process_readdir_3", "count=%i int=%d uristring=%s", + get_client_session_id(), (int)getppid(), t1buf); +#endif free(stats); } } @@ -1105,6 +1167,12 @@ r = unlink(name); status = (r == -1) ? errno_to_portable(errno) : SSH2_FX_OK; send_status(id, status); + +#ifdef NERSC_MOD + char* t1buf = encode_string(name, strlen(name)); + s_audit("sftp_process_remove_3", "count=%i int=%d uristring=%s", + get_client_session_id(), (int)getppid(), t1buf); +#endif free(name); } @@ -1126,6 +1194,13 @@ r = mkdir(name, mode); status = (r == -1) ? errno_to_portable(errno) : SSH2_FX_OK; send_status(id, status); + +#ifdef NERSC_MOD + char* t1buf = encode_string(name, strlen(name)); + s_audit("sftp_process_mkdir_3", "count=%i int=%d uristring=%s", + get_client_session_id(), (int)getpid(), t1buf); + free(t1buf); +#endif free(name); } @@ -1143,6 +1218,13 @@ r = rmdir(name); status = (r == -1) ? errno_to_portable(errno) : SSH2_FX_OK; send_status(id, status); + +#ifdef NERSC_MOD + char* t1buf = encode_string(name, strlen(name)); + s_audit("sftp_process_rmdir_3", "count=%i int=%d uristring=%s", + get_client_session_id(), (int)getppid(), t1buf); + free(t1buf); +#endif free(name); } @@ -1170,6 +1252,13 @@ s.name = s.long_name = resolvedname; send_names(id, 1, &s); } + +#ifdef NERSC_MOD + char* t1buf = encode_string(path, strlen(path)); + s_audit("sftp_process_realpath_3", "count=%i int=%d uristring=%s", + get_client_session_id(), (int)getppid(), t1buf); + free(t1buf); +#endif free(path); } @@ -1229,6 +1318,17 @@ status = SSH2_FX_OK; } send_status(id, status); + +#ifdef NERSC_MOD + char* t1buf = encode_string( oldpath, strlen(oldpath)); + char* t2buf = encode_string( newpath, strlen(newpath)); + + s_audit("sftp_process_rename_3", "count=%i int=%d uristring=%s uristring=%s", + get_client_session_id(), (int)getppid(), t1buf, t2buf); + + free(t1buf); + free(t2buf); +#endif free(oldpath); free(newpath); } @@ -1255,6 +1355,13 @@ s.name = s.long_name = buf; send_names(id, 1, &s); } + +#ifdef NERSC_MOD + char* t1buf = encode_string( path, strlen(path)); + s_audit("sftp_process_readlink_3", "count=%i int=%d uristring=%s", + get_client_session_id(), (int)getppid(), t1buf); + free(t1buf); +#endif free(path); } @@ -1274,6 +1381,18 @@ r = symlink(oldpath, newpath); status = (r == -1) ? errno_to_portable(errno) : SSH2_FX_OK; send_status(id, status); + +#ifdef NERSC_MOD + char* t1buf = encode_string( oldpath, strlen(oldpath)); + char* t2buf = encode_string( newpath, strlen(newpath)); + + s_audit("sftp_process_symlink_3", "count=%i int=%d uristring=%s uristring=%s", + get_client_session_id(), (int)getppid(), t1buf, t2buf); + + free(t1buf); + free(t2buf); +#endif + free(oldpath); free(newpath); } @@ -1642,6 +1761,13 @@ } } +#ifdef NERSC_MOD + char* t1buf = encode_string(pw->pw_name, strlen(pw->pw_name)); + s_audit("sftp_process_init_3", "count=%i int=%d uristring=%s addr=%s", + get_client_session_id(), (int)getppid(), t1buf, client_addr); + free(t1buf); +#endif + for (;;) { memset(rset, 0, set_size); memset(wset, 0, set_size); diff -Naur --exclude=autom4te.cache openssh-7.0p1/sftp.1 openssh-7.0p1-gssapi/sftp.1 --- openssh-7.0p1/sftp.1 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/sftp.1 2015-08-12 17:11:07.000000000 -0500 @@ -263,7 +263,8 @@ Specify how many requests may be outstanding at any one time. Increasing this may slightly improve file transfer speed but will increase memory usage. -The default is 64 outstanding requests. +The default is 256 outstanding requests providing for 8MB +of outstanding data with a 32KB buffer. .It Fl r Recursively copy entire directories when uploading and downloading. Note that diff -Naur --exclude=autom4te.cache openssh-7.0p1/sftp.c openssh-7.0p1-gssapi/sftp.c --- openssh-7.0p1/sftp.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/sftp.c 2015-08-12 17:11:07.000000000 -0500 @@ -71,7 +71,7 @@ #include "sftp-client.h" #define DEFAULT_COPY_BUFLEN 32768 /* Size of buffer for up/download */ -#define DEFAULT_NUM_REQUESTS 64 /* # concurrent outstanding requests */ +#define DEFAULT_NUM_REQUESTS 256 /* # concurrent outstanding requests */ /* File to read commands from */ FILE* infile; diff -Naur --exclude=autom4te.cache openssh-7.0p1/ssh-globus-usage.c openssh-7.0p1-gssapi/ssh-globus-usage.c --- openssh-7.0p1/ssh-globus-usage.c 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/ssh-globus-usage.c 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,396 @@ +/* + * Copyright 2009 The Board of Trustees of the University + * of Illinois. See the LICENSE file for detailed license information. + * + * Portions, specifically log_usage_stats(), ssh_usage_stats_init(), + * ssh_usage_stats_close(), ssh_usage_ent_s, ssh_usage_tag_e and + * TAG #defines were based on those from Usage Metrics portions of: + * gridftp/server/source/globus_i_gfs_log.c + * + * Copyright 1999-2006 University of Chicago + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +#include "includes.h" + +#ifdef HAVE_GLOBUS_USAGE + +#include +#include + +#include "log.h" +#include "ssh-globus-usage.h" + +static globus_list_t *usage_handle_list = NULL; + +#define SSH_GLOBUS_USAGE_ID 12 +#define SSH_GLOBUS_USAGE_VER 0 + +#define SSH_GLOBUS_DEFAULT_TAGLIST "VvMm" +#define SSH_GLOBUS_ALL_TAGLIST "VvMmIuU" +#define SSH_GLOBUS_TAGCOUNT 25 + +typedef enum ssh_usage_tag_e +{ + SSH_GLOBUS_USAGE_SSH_VER = 'V', + SSH_GLOBUS_USAGE_SSL_VER = 'v', + SSH_GLOBUS_USAGE_METHOD = 'M', + SSH_GLOBUS_USAGE_MECHANISM = 'm', + SSH_GLOBUS_USAGE_CLIENTIP = 'I', + SSH_GLOBUS_USAGE_USERNAME = 'u', + SSH_GLOBUS_USAGE_USERDN = 'U' + /* !! ADD to ALL_TAGLIST above and to globus_usage_stats_send() + invocation below when adding here */ +} ssh_usage_tag_t; + +typedef struct ssh_usage_ent_s +{ + globus_usage_stats_handle_t handle; + char * target; + char * taglist; +} ssh_usage_ent_t; + + +globus_result_t +ssh_usage_stats_init(int disable_usage_stats, char *usage_stats_targets) +{ + globus_result_t result; + char * target_str = NULL; + char * ptr = ptr; + char * target = NULL; + char * entry = NULL; + globus_list_t * list = NULL; + ssh_usage_ent_t * usage_ent = NULL; + + if (disable_usage_stats || !usage_stats_targets) + return GLOBUS_SUCCESS; + + result = globus_module_activate(GLOBUS_USAGE_MODULE); + if (result != GLOBUS_SUCCESS) + { + error("ERROR: couldn't activate USAGE STATS module"); + return result; + } + + target_str = strdup(usage_stats_targets); + if (target_str == NULL) + { + error("ERROR: strdup failure for target_str"); + goto error; + } + debug("Processing usage_stats_target (%s)\n", target_str); + + if(target_str && (strchr(target_str, ',') || strchr(target_str, '!'))) + { + target = target_str; + + do { + usage_ent = (ssh_usage_ent_t *) malloc(sizeof(ssh_usage_ent_t)); + if (usage_ent == NULL) + { + error("ERROR: couldn't allocate for ssh_usage_ent_t"); + goto error; + } + + if ((ptr = strchr(target, ',')) != NULL) + *ptr = '\0'; + + entry = strdup(target); + if (entry == NULL) + { + error("ERROR: strdup failure for target"); + goto error; + } + + if (ptr) + target = ptr + 1; + else + target = NULL; + + if((ptr = strchr(entry, '!')) != NULL) + { + *ptr = '\0'; + usage_ent->taglist = strdup(ptr + 1); + if (usage_ent->taglist == NULL) + { + error("ERROR: strdup failure for taglist"); + goto error; + } + if(strlen(usage_ent->taglist) > SSH_GLOBUS_TAGCOUNT) + { + usage_ent->taglist[SSH_GLOBUS_TAGCOUNT + 1] = '\0'; + } + } + else + { + usage_ent->taglist = strdup(SSH_GLOBUS_DEFAULT_TAGLIST); + if (usage_ent->taglist == NULL) + { + error("ERROR: couldn't allocate for taglist"); + goto error; + } + } + + if(strcasecmp(usage_ent->taglist, "default") == 0) + { + free(usage_ent->taglist); + usage_ent->taglist = strdup(SSH_GLOBUS_DEFAULT_TAGLIST); + if (usage_ent->taglist == NULL) + { + error("ERROR: couldn't allocate for taglist"); + goto error; + } + } + else if(strcasecmp(usage_ent->taglist, "all") == 0) + { + free(usage_ent->taglist); + usage_ent->taglist = strdup(SSH_GLOBUS_ALL_TAGLIST); + if (usage_ent->taglist == NULL) + { + error("ERROR: couldn't allocate for taglist"); + goto error; + } + } + + usage_ent->target = entry; + + globus_list_insert(&usage_handle_list, usage_ent); + } + while(target != NULL); + + free(target_str); + } + else + { + usage_ent = (ssh_usage_ent_t *) malloc(sizeof(ssh_usage_ent_t)); + if (usage_ent == NULL) + { + error("ERROR: couldn't allocate for usage_ent"); + goto error; + } + + usage_ent->target = target_str; + usage_ent->taglist = strdup(SSH_GLOBUS_DEFAULT_TAGLIST); + if (usage_ent->taglist == NULL) + { + error("ERROR: couldn't allocate for taglist"); + goto error; + } + + globus_list_insert(&usage_handle_list, usage_ent); + } + + result = GLOBUS_SUCCESS; + for(list = usage_handle_list; + !globus_list_empty(list); + list = globus_list_rest(list)) + { + usage_ent = (ssh_usage_ent_t *) globus_list_first(list); + + usage_ent->handle = NULL; + if (globus_usage_stats_handle_init( + &usage_ent->handle, + SSH_GLOBUS_USAGE_ID, + SSH_GLOBUS_USAGE_VER, + usage_ent->target) != GLOBUS_SUCCESS) + { + error("USAGE-STATS: Error initializing (%s) (%s)", + usage_ent->target?:"NULL", + usage_ent->taglist?:"NULL"); + result = GLOBUS_FAILURE; + } else + debug("USAGE-STATS: Initialized (%s) (%s)", usage_ent->target?:"NULL", + usage_ent->taglist?:"NULL"); + + } + + return result; + +error: + if (target_str) + { + free(target_str); + target_str = NULL; + } + if (entry) + { + free(target_str); + target_str = NULL; + } + return GLOBUS_FAILURE; +} + +void +ssh_usage_stats_close(int disable_usage_stats) +{ + globus_list_t *list; + + if (disable_usage_stats) + return; + + list = usage_handle_list; + + while(!globus_list_empty(list)) + { + ssh_usage_ent_t *usage_ent; + + usage_ent = (ssh_usage_ent_t *) + globus_list_remove(&list, list); + + if(usage_ent) + { + if(usage_ent->handle) + { + globus_usage_stats_handle_destroy(usage_ent->handle); + } + if(usage_ent->target) + { + free(usage_ent->target); + } + if(usage_ent->taglist) + { + free(usage_ent->taglist); + } + free(usage_ent); + } + } + usage_handle_list = NULL; +} + +static void +log_usage_stats(const char *ssh_release, const char *ssl_release, + const char *method, const char *mechanism, + const char *clientip, + const char *username, const char *userdn) +{ + globus_result_t result; + globus_list_t * list; + ssh_usage_ent_t * usage_ent; + char * keys[SSH_GLOBUS_TAGCOUNT]; + char * values[SSH_GLOBUS_TAGCOUNT]; + char * ptr; + char * key; + char * value; + int i = 0; + char * save_taglist = NULL; + + for(list = usage_handle_list; + !globus_list_empty(list); + list = globus_list_rest(list)) + { + usage_ent = (ssh_usage_ent_t *) globus_list_first(list); + + if(!usage_ent || usage_ent->handle == NULL) + continue; + + if(save_taglist == NULL || + strcmp(save_taglist, usage_ent->taglist) != 0) + { + save_taglist = usage_ent->taglist; + + ptr = usage_ent->taglist; + i = 0; + while(ptr && *ptr) + { + switch(*ptr) + { + case SSH_GLOBUS_USAGE_SSH_VER: + key = "SSH_VER"; + value = (char *) ssh_release; + break; + + case SSH_GLOBUS_USAGE_SSL_VER: + key = "SSL_VER"; + value = (char *) ssl_release; + break; + + case SSH_GLOBUS_USAGE_METHOD: + key = "METHOD"; + value = (char *) method; + break; + + case SSH_GLOBUS_USAGE_MECHANISM: + key = "MECH"; + value = (char *) mechanism?:""; + break; + + case SSH_GLOBUS_USAGE_CLIENTIP: + key = "CLIENTIP"; + value = (char *) clientip?:""; + break; + + case SSH_GLOBUS_USAGE_USERNAME: + key = "USER"; + value = (char *) username?:""; + break; + + case SSH_GLOBUS_USAGE_USERDN: + key = "USERDN"; + value = (char *) userdn?:""; + break; + + default: + key = NULL; + value = NULL; + break; + } + + if(key != NULL && value != NULL) + { + keys[i] = key; + values[i] = value; + i++; + } + + ptr++; + } + } + +#ifdef HAVE_GLOBUS_USAGE_SEND_ARRAY + result = globus_usage_stats_send_array( + usage_ent->handle, i, keys, values); +#else + if (i) + result = globus_usage_stats_send( + usage_ent->handle, i, + i>0?keys[0]:NULL, i>0?values[0]:NULL, + i>1?keys[1]:NULL, i>1?values[1]:NULL, + i>2?keys[2]:NULL, i>2?values[2]:NULL, + i>3?keys[3]:NULL, i>3?values[3]:NULL, + i>4?keys[4]:NULL, i>4?values[4]:NULL, + i>5?keys[5]:NULL, i>5?values[5]:NULL, + i>6?keys[6]:NULL, i>6?values[6]:NULL); +#endif /* HAVE_GLOBUS_USAGE_SEND_ARRAY */ + } + + return; +} +#endif /* HAVE_GLOBUS_USAGE */ + +void +ssh_globus_send_usage_metrics(const char *ssh_release, + const char *ssl_release, + const char *method, + const char *mechanism, + const char *client_ip, + const char *username, + const char *userdn) +{ +#ifdef HAVE_GLOBUS_USAGE + + log_usage_stats(ssh_release, ssl_release, method, mechanism, + client_ip, username, userdn); + +#endif /* HAVE_GLOBUS_USAGE */ +} diff -Naur --exclude=autom4te.cache openssh-7.0p1/ssh-globus-usage.h openssh-7.0p1-gssapi/ssh-globus-usage.h --- openssh-7.0p1/ssh-globus-usage.h 1969-12-31 18:00:00.000000000 -0600 +++ openssh-7.0p1-gssapi/ssh-globus-usage.h 2015-08-12 17:11:07.000000000 -0500 @@ -0,0 +1,48 @@ +/* + * Copyright 2009 The Board of Trustees of the University + * of Illinois. See the LICENSE file for detailed license information. + * + * Portions, specifically ssh_usage_stats_init(), ssh_usage_stats_close() + * were based on those from: gridftp/server/source/globus_i_gfs_log.h + * Copyright 1999-2006 University of Chicago + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +#ifndef __SSH_GLOBUS_USAGE_H +#define __SSH_GLOBUS_USAGE_H + +#include "includes.h" + +#ifdef HAVE_GLOBUS_USAGE + +#include "globus_usage.h" + +globus_result_t +ssh_usage_stats_init(int disable_usage_stats, char *usage_stats_targets); + +void +ssh_usage_stats_close(int disable_usage_stats); + +#endif /* HAVE_GLOBUS_USAGE */ + +void +ssh_globus_send_usage_metrics(const char *ssh_release, + const char *ssl_release, + const char *method, + const char *mechanism, + const char *client_ip, + const char *username, + const char *userdn); + +#endif /* __SSH_GLOBUS_USAGE_H */ diff -Naur --exclude=autom4te.cache openssh-7.0p1/ssh-gss.h openssh-7.0p1-gssapi/ssh-gss.h --- openssh-7.0p1/ssh-gss.h 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/ssh-gss.h 2015-08-12 17:11:07.000000000 -0500 @@ -1,6 +1,6 @@ /* $OpenBSD: ssh-gss.h,v 1.11 2014/02/26 20:28:44 djm Exp $ */ /* - * Copyright (c) 2001-2003 Simon Wilkinson. All rights reserved. + * Copyright (c) 2001-2009 Simon Wilkinson. All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions @@ -34,6 +34,7 @@ #include #endif +#ifndef MECHGLUE #ifdef KRB5 # ifndef HEIMDAL # ifdef HAVE_GSSAPI_GENERIC_H @@ -50,6 +51,7 @@ # endif /* !HEIMDAL */ #endif /* KRB5 */ +#endif /* !MECHGLUE */ /* draft-ietf-secsh-gsskeyex-06 */ #define SSH2_MSG_USERAUTH_GSSAPI_RESPONSE 60 @@ -61,10 +63,22 @@ #define SSH_GSS_OIDTYPE 0x06 +#define SSH2_MSG_KEXGSS_INIT 30 +#define SSH2_MSG_KEXGSS_CONTINUE 31 +#define SSH2_MSG_KEXGSS_COMPLETE 32 +#define SSH2_MSG_KEXGSS_HOSTKEY 33 +#define SSH2_MSG_KEXGSS_ERROR 34 +#define SSH2_MSG_KEXGSS_GROUPREQ 40 +#define SSH2_MSG_KEXGSS_GROUP 41 +#define KEX_GSS_GRP1_SHA1_ID "gss-group1-sha1-" +#define KEX_GSS_GRP14_SHA1_ID "gss-group14-sha1-" +#define KEX_GSS_GEX_SHA1_ID "gss-gex-sha1-" + typedef struct { char *filename; char *envvar; char *envval; + struct passwd *owner; void *data; } ssh_gssapi_ccache; @@ -72,8 +86,12 @@ gss_buffer_desc displayname; gss_buffer_desc exportedname; gss_cred_id_t creds; + gss_name_t name; struct ssh_gssapi_mech_struct *mech; ssh_gssapi_ccache store; + gss_ctx_id_t context; /* needed for globus_gss_assist_map_and_authorize() */ + int used; + int updated; } ssh_gssapi_client; typedef struct ssh_gssapi_mech_struct { @@ -84,6 +102,7 @@ int (*userok) (ssh_gssapi_client *, char *); int (*localname) (ssh_gssapi_client *, char **); void (*storecreds) (ssh_gssapi_client *); + int (*updatecreds) (ssh_gssapi_ccache *, ssh_gssapi_client *); } ssh_gssapi_mech; typedef struct { @@ -91,13 +110,14 @@ OM_uint32 minor; /* both */ gss_ctx_id_t context; /* both */ gss_name_t name; /* both */ - gss_OID oid; /* client */ + gss_OID oid; /* both */ gss_cred_id_t creds; /* server */ gss_name_t client; /* server */ - gss_cred_id_t client_creds; /* server */ + gss_cred_id_t client_creds; /* both */ } Gssctxt; extern ssh_gssapi_mech *supported_mechs[]; +extern Gssctxt *gss_kex_context; int ssh_gssapi_check_oid(Gssctxt *, void *, size_t); void ssh_gssapi_set_oid_data(Gssctxt *, void *, size_t); @@ -119,16 +139,41 @@ void ssh_gssapi_delete_ctx(Gssctxt **); OM_uint32 ssh_gssapi_sign(Gssctxt *, gss_buffer_t, gss_buffer_t); void ssh_gssapi_buildmic(Buffer *, const char *, const char *, const char *); -int ssh_gssapi_check_mechanism(Gssctxt **, gss_OID, const char *); +int ssh_gssapi_check_mechanism(Gssctxt **, gss_OID, const char *, const char *); +OM_uint32 ssh_gssapi_client_identity(Gssctxt *, const char *); +int ssh_gssapi_credentials_updated(Gssctxt *); + +int ssh_gssapi_localname(char **name); +void ssh_gssapi_rekey_creds(); /* In the server */ +typedef int ssh_gssapi_check_fn(Gssctxt **, gss_OID, const char *, + const char *); +char *ssh_gssapi_client_mechanisms(const char *, const char *); +char *ssh_gssapi_kex_mechs(gss_OID_set, ssh_gssapi_check_fn *, const char *, + const char *); +gss_OID ssh_gssapi_id_kex(Gssctxt *, char *, int); +int ssh_gssapi_server_check_mech(Gssctxt **,gss_OID, const char *, + const char *); OM_uint32 ssh_gssapi_server_ctx(Gssctxt **, gss_OID); -int ssh_gssapi_userok(char *name); +int ssh_gssapi_userok(char *name, struct passwd *, int gssapi_keyex); OM_uint32 ssh_gssapi_checkmic(Gssctxt *, gss_buffer_t, gss_buffer_t); void ssh_gssapi_do_child(char ***, u_int *); void ssh_gssapi_cleanup_creds(void); void ssh_gssapi_storecreds(void); +#ifdef MECHGLUE +gss_cred_id_t __gss_get_mechanism_cred + (gss_cred_id_t, /* union_cred */ + gss_OID /* mech_type */ + ); +#endif + +char *ssh_gssapi_server_mechanisms(void); +int ssh_gssapi_oid_table_ok(); + +int ssh_gssapi_update_creds(ssh_gssapi_ccache *store); +void ssh_gssapi_get_client_info(char **userdn, char **mech); #endif /* GSSAPI */ #endif /* _SSH_GSS_H */ diff -Naur --exclude=autom4te.cache openssh-7.0p1/ssh.1 openssh-7.0p1-gssapi/ssh.1 --- openssh-7.0p1/ssh.1 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/ssh.1 2015-08-12 17:11:07.000000000 -0500 @@ -1341,8 +1341,38 @@ explicitly, as that will render the X11 connection insecure (and will require the user to manually copy any required authorization cookies). +.It Ev GSSAPI_MECH_CONF +Applies to mechglue used to support both GSI and Kerberos GSSAPI mechanisms. +Used to specify the location of the mech.conf file that lists the mechanism- +specific GSSAPI libraries (both Kerberos and GSI versions). If +.Ev GSSAPI_MECH_CONF +is not set then /etc/mech.conf is used. This applies to both the clients and +the server. The NCSA GSSAPI mechglue distribution includes a sample mech.conf +file. You will need to edit the library paths in that file and install it in +an appropriate location on your system. If the mech.conf file is not found, +the GSSAPI mechglue library will not load any GSSAPI mechanisms and GSI-OpenSSH +will simply skip GSSAPI authentication. .It Ev HOME Set to the path of the user's home directory. +.It LD_LIBRARY_PATH +The ssh client is typically linked dynamically with Globus +security libraries, which must be present in the dynamic linker's +search path. This typically requires +.Cm $GLOBUS_LOCATION/lib +to be included in the list in the +.Ev LD_LIBRARY_PATH +environment variable, which is set by the +.Cm $GLOBUS_LOCATION/libexec/globus-script-initializer +script, which should be called from any +.Cm ssh +invocation script. +Alternatively, to set +.Ev LD_LIBRARY_PATH +appropriately for the Globus libraries in an interactive shell, source +.Cm $GLOBUS_LOCATION/etc/globus-user-env.sh +(for sh shells) or +.Cm $GLOBUS_LOCATION/etc/globus-user.env.csh +(for csh shells). .It Ev LOGNAME Synonym for .Ev USER ; @@ -1401,6 +1431,18 @@ on to new connections). .It Ev USER Set to the name of the user logging in. +.It Ev X509_CERT_DIR +Used for GSI authentication. Specifies a non-standard location for the +CA certificates directory. +.It Ev X509_USER_CERT +Used for GSI authentication. Specifies a non-standard location for the +certificate to be used for authentication to the server. +.It Ev X509_USER_KEY +Used for GSI authentication. Specifies a non-standard location for the +private key to be used for authentication to the server. +.It Ev X509_USER_PROXY +Used for GSI authentication. Specifies a non-standard location for the +proxy credential to be used for authentication to the server. .El .Pp Additionally, diff -Naur --exclude=autom4te.cache openssh-7.0p1/ssh.c openssh-7.0p1-gssapi/ssh.c --- openssh-7.0p1/ssh.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/ssh.c 2015-08-12 17:11:07.000000000 -0500 @@ -463,6 +463,32 @@ fatal("Can't open user config file %.100s: " "%.100s", config, strerror(errno)); } else { + /* + * Since the config file parsing code aborts if it sees + * options it doesn't recognize, allow users to put + * options specific to compile-time add-ons in alternate + * config files so their primary config file will + * interoperate SSH versions that don't support those + * options. + */ +#ifdef GSSAPI + r = snprintf(buf, sizeof buf, "%s/%s.gssapi", pw->pw_dir, + _PATH_SSH_USER_CONFFILE); + if (r > 0 && (size_t)r < sizeof(buf)) + (void)read_config_file(buf, pw, host, host_arg, &options, 1); +#ifdef GSI + r = snprintf(buf, sizeof buf, "%s/%s.gsi", pw->pw_dir, + _PATH_SSH_USER_CONFFILE); + if (r > 0 && (size_t)r < sizeof(buf)) + (void)read_config_file(buf, pw, host, host_arg, &options, 1); +#endif +#if defined(KRB5) + r = snprintf(buf, sizeof buf, "%s/%s.krb", pw->pw_dir, + _PATH_SSH_USER_CONFFILE); + if (r > 0 && (size_t)r < sizeof(buf)) + (void)read_config_file(buf, pw, host, host_arg, &options, 1); +#endif +#endif r = snprintf(buf, sizeof buf, "%s/%s", pw->pw_dir, _PATH_SSH_USER_CONFFILE); if (r > 0 && (size_t)r < sizeof(buf)) @@ -884,6 +910,10 @@ break; case 'T': options.request_tty = REQUEST_TTY_NO; + /* ensure that the user doesn't try to backdoor a */ + /* null cipher switch on an interactive session */ + /* so explicitly disable it no matter what */ + options.none_switch=0; break; case 'o': line = xstrdup(optarg); @@ -1114,8 +1144,11 @@ seed_rng(); - if (options.user == NULL) + if (options.user == NULL) { options.user = xstrdup(pw->pw_name); + options.implicit = 1; + } + else options.implicit = 0; if (gethostname(thishost, sizeof(thishost)) == -1) fatal("gethostname: %s", strerror(errno)); @@ -1814,6 +1847,9 @@ { Channel *c; int window, packetmax, in, out, err; + int sock; + int socksize; + int socksizelen = sizeof(int); if (stdin_null_flag) { in = open(_PATH_DEVNULL, O_RDONLY); @@ -1834,9 +1870,74 @@ if (!isatty(err)) set_nonblock(err); - window = CHAN_SES_WINDOW_DEFAULT; + /* we need to check to see if what they want to do about buffer */ + /* sizes here. In a hpn to nonhpn connection we want to limit */ + /* the window size to something reasonable in case the far side */ + /* has the large window bug. In hpn to hpn connection we want to */ + /* use the max window size but allow the user to override it */ + /* lastly if they disabled hpn then use the ssh std window size */ + + /* so why don't we just do a getsockopt() here and set the */ + /* ssh window to that? In the case of a autotuning receive */ + /* window the window would get stuck at the initial buffer */ + /* size generally less than 96k. Therefore we need to set the */ + /* maximum ssh window size to the maximum hpn buffer size */ + /* unless the user has specifically set the tcprcvbufpoll */ + /* to no. In which case we *can* just set the window to the */ + /* minimum of the hpn buffer size and tcp receive buffer size */ + + if (tty_flag) + options.hpn_buffer_size = CHAN_SES_WINDOW_DEFAULT; + else + options.hpn_buffer_size = 2*1024*1024; + + if (datafellows & SSH_BUG_LARGEWINDOW) + { + debug("HPN to Non-HPN Connection"); + } + else + { + if (options.tcp_rcv_buf_poll <= 0) + { + sock = socket(AF_INET, SOCK_STREAM, 0); + getsockopt(sock, SOL_SOCKET, SO_RCVBUF, + &socksize, &socksizelen); + close(sock); + debug("socksize %d", socksize); + options.hpn_buffer_size = socksize; + debug ("HPNBufferSize set to TCP RWIN: %d", options.hpn_buffer_size); + } + else + { + if (options.tcp_rcv_buf > 0) + { + /*create a socket but don't connect it */ + /* we use that the get the rcv socket size */ + sock = socket(AF_INET, SOCK_STREAM, 0); + /* if they are using the tcp_rcv_buf option */ + /* attempt to set the buffer size to that */ + if (options.tcp_rcv_buf) + setsockopt(sock, SOL_SOCKET, SO_RCVBUF, (void *)&options.tcp_rcv_buf, + sizeof(options.tcp_rcv_buf)); + getsockopt(sock, SOL_SOCKET, SO_RCVBUF, + &socksize, &socksizelen); + close(sock); + debug("socksize %d", socksize); + options.hpn_buffer_size = socksize; + debug ("HPNBufferSize set to user TCPRcvBuf: %d", options.hpn_buffer_size); + } + } + } + + debug("Final hpn_buffer_size = %d", options.hpn_buffer_size); + + window = options.hpn_buffer_size; + + channel_set_hpn(options.hpn_disabled, options.hpn_buffer_size); + packetmax = CHAN_SES_PACKET_DEFAULT; if (tty_flag) { + window = 4*CHAN_SES_PACKET_DEFAULT; window >>= 1; packetmax >>= 1; } @@ -1845,6 +1946,10 @@ window, packetmax, CHAN_EXTENDED_WRITE, "client-session", /*nonblock*/0); + if ((options.tcp_rcv_buf_poll > 0) && (!options.hpn_disabled)) { + c->dynamic_window = 1; + debug ("Enabled Dynamic Window Scaling"); + } debug3("ssh_session2_open: channel_new: %d", c->self); channel_send_open(c->self); diff -Naur --exclude=autom4te.cache openssh-7.0p1/ssh_config openssh-7.0p1-gssapi/ssh_config --- openssh-7.0p1/ssh_config 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/ssh_config 2015-08-12 17:11:07.000000000 -0500 @@ -24,8 +24,10 @@ # RSAAuthentication yes # PasswordAuthentication yes # HostbasedAuthentication no -# GSSAPIAuthentication no -# GSSAPIDelegateCredentials no +# GSSAPIAuthentication yes +# GSSAPIDelegateCredentials yes +# GSSAPIKeyExchange yes +# GSSAPITrustDNS yes # BatchMode no # CheckHostIP yes # AddressFamily any diff -Naur --exclude=autom4te.cache openssh-7.0p1/ssh_config.5 openssh-7.0p1-gssapi/ssh_config.5 --- openssh-7.0p1/ssh_config.5 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/ssh_config.5 2015-08-12 17:11:07.000000000 -0500 @@ -55,6 +55,12 @@ user's configuration file .Pq Pa ~/.ssh/config .It +GSSAPI configuration file +.Pq Pa $HOME/.ssh/config.gssapi +.It +Kerberos configuration file +.Pq Pa $HOME/.ssh/config.krb +.It system-wide configuration file .Pq Pa /etc/ssh/ssh_config .El @@ -747,13 +753,45 @@ .It Cm GSSAPIAuthentication Specifies whether user authentication based on GSSAPI is allowed. The default is -.Dq no . +.Dq yes . +Note that this option applies to protocol version 2 only. +.It Cm GSSAPIKeyExchange +Specifies whether key exchange based on GSSAPI may be used. When using +GSSAPI key exchange the server need not have a host key. +The default is +.Dq yes . Note that this option applies to protocol version 2 only. +.It Cm GSSAPIClientIdentity +If set, specifies the GSSAPI client identity that ssh should use when +connecting to the server. The default is unset, which means that the default +identity will be used. +.It Cm GSSAPIServerIdentity +If set, specifies the GSSAPI server identity that ssh should expect when +connecting to the server. The default is unset, which means that the +expected GSSAPI server identity will be determined from the target +hostname. .It Cm GSSAPIDelegateCredentials Forward (delegate) credentials to the server. The default is -.Dq no . -Note that this option applies to protocol version 2 only. +.Dq yes . +Note that this option applies to protocol version 2 connections using GSSAPI. +.It Cm GSSAPIRenewalForcesRekey +If set to +.Dq yes +then renewal of the client's GSSAPI credentials will force the rekeying of the +ssh connection. With a compatible server, this can delegate the renewed +credentials to a session on the server. +The default is +.Dq yes . +.It Cm GSSAPITrustDns +Set to +.Dq yes to indicate that the DNS is trusted to securely canonicalize +the name of the host being connected to. If +.Dq no, the hostname entered on the +command line will be passed untouched to the GSSAPI library. +The default is +.Dq yes . +This option only applies to protocol version 2 connections using GSSAPI. .It Cm HashKnownHosts Indicates that .Xr ssh 1 @@ -1168,7 +1206,7 @@ .Cm password ) . The default is: .Bd -literal -offset indent -gssapi-with-mic,hostbased,publickey, +gssapi-keyex,gssapi-with-mic,hostbased,publickey, keyboard-interactive,password .Ed .It Cm Protocol diff -Naur --exclude=autom4te.cache openssh-7.0p1/sshconnect.c openssh-7.0p1-gssapi/sshconnect.c --- openssh-7.0p1/sshconnect.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/sshconnect.c 2015-08-12 17:11:07.000000000 -0500 @@ -267,6 +267,31 @@ } /* + * Set TCP receive buffer if requested. + * Note: tuning needs to happen after the socket is + * created but before the connection happens + * so winscale is negotiated properly -cjr + */ +static void +ssh_set_socket_recvbuf(int sock) +{ + void *buf = (void *)&options.tcp_rcv_buf; + int sz = sizeof(options.tcp_rcv_buf); + int socksize; + int socksizelen = sizeof(int); + + debug("setsockopt Attempting to set SO_RCVBUF to %d", options.tcp_rcv_buf); + if (setsockopt(sock, SOL_SOCKET, SO_RCVBUF, buf, sz) >= 0) { + getsockopt(sock, SOL_SOCKET, SO_RCVBUF, &socksize, &socksizelen); + debug("setsockopt SO_RCVBUF: %.100s %d", strerror(errno), socksize); + } + else + error("Couldn't set socket receive buffer to %d: %.100s", + options.tcp_rcv_buf, strerror(errno)); +} + + +/* * Creates a (possibly privileged) socket for use as the ssh connection. */ static int @@ -282,6 +307,9 @@ } fcntl(sock, F_SETFD, FD_CLOEXEC); + if (options.tcp_rcv_buf > 0) + ssh_set_socket_recvbuf(sock); + /* Bind the socket to an alternative local IP address */ if (options.bind_address == NULL && !privileged) return sock; @@ -524,10 +552,10 @@ /* Send our own protocol version identification. */ if (compat20) { xasprintf(&client_version_string, "SSH-%d.%d-%.100s\r\n", - PROTOCOL_MAJOR_2, PROTOCOL_MINOR_2, SSH_VERSION); + PROTOCOL_MAJOR_2, PROTOCOL_MINOR_2, SSH_RELEASE); } else { xasprintf(&client_version_string, "SSH-%d.%d-%.100s\n", - PROTOCOL_MAJOR_1, minor1, SSH_VERSION); + PROTOCOL_MAJOR_1, minor1, SSH_RELEASE); } if (roaming_atomicio(vwrite, connection_out, client_version_string, strlen(client_version_string)) != strlen(client_version_string)) diff -Naur --exclude=autom4te.cache openssh-7.0p1/sshconnect2.c openssh-7.0p1-gssapi/sshconnect2.c --- openssh-7.0p1/sshconnect2.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/sshconnect2.c 2015-08-12 17:11:07.000000000 -0500 @@ -80,6 +80,12 @@ extern char *client_version_string; extern char *server_version_string; extern Options options; +struct kex *xxx_kex; + +/* tty_flag is set in ssh.c. use this in ssh_userauth2 */ +/* if it is set then prevent the switch to the null cipher */ + +extern int tty_flag; /* * SSH2 key exchange @@ -160,11 +166,37 @@ struct kex *kex; int r; +#ifdef GSSAPI + char *orig = NULL, *gss = NULL; + char *gss_host = NULL; +#endif + xxx_host = host; xxx_hostaddr = hostaddr; myproposal[PROPOSAL_KEX_ALGS] = compat_kex_proposal( options.kex_algorithms); + +#ifdef GSSAPI + if (options.gss_keyex) { + /* Add the GSSAPI mechanisms currently supported on this + * client to the key exchange algorithm proposal */ + orig = myproposal[PROPOSAL_KEX_ALGS]; + + if (options.gss_trust_dns) + gss_host = (char *)get_canonical_hostname(1); + else + gss_host = host; + + gss = ssh_gssapi_client_mechanisms(gss_host, options.gss_client_identity); + if (gss) { + debug("Offering GSSAPI proposal: %s", gss); + xasprintf(&myproposal[PROPOSAL_KEX_ALGS], + "%s,%s", gss, orig); + } + } +#endif + myproposal[PROPOSAL_ENC_ALGS_CTOS] = compat_cipher_proposal(options.ciphers); myproposal[PROPOSAL_ENC_ALGS_STOC] = @@ -193,6 +225,17 @@ order_hostkeyalgs(host, hostaddr, port)); } +#ifdef GSSAPI + /* If we've got GSSAPI algorithms, then we also support the + * 'null' hostkey, as a last resort */ + if (options.gss_keyex && gss) { + orig = myproposal[PROPOSAL_SERVER_HOST_KEY_ALGS]; + xasprintf(&myproposal[PROPOSAL_SERVER_HOST_KEY_ALGS], + "%s,null", orig); + free(gss); + } +#endif + if (options.rekey_limit || options.rekey_interval) packet_set_rekey_limits((u_int32_t)options.rekey_limit, (time_t)options.rekey_interval); @@ -209,12 +252,34 @@ # ifdef OPENSSL_HAS_ECC kex->kex[KEX_ECDH_SHA2] = kexecdh_client; # endif +#ifdef GSSAPI + if (options.gss_keyex) { + kex->kex[KEX_GSS_GRP1_SHA1] = kexgss_client; + kex->kex[KEX_GSS_GRP14_SHA1] = kexgss_client; + kex->kex[KEX_GSS_GEX_SHA1] = kexgss_client; + } +#endif #endif kex->kex[KEX_C25519_SHA256] = kexc25519_client; kex->client_version_string=client_version_string; kex->server_version_string=server_version_string; kex->verify_host_key=&verify_host_key_callback; +#ifdef GSSAPI + if (options.gss_keyex) { + kex->gss_deleg_creds = options.gss_deleg_creds; + kex->gss_trust_dns = options.gss_trust_dns; + kex->gss_client = options.gss_client_identity; + if (options.gss_server_identity) { + kex->gss_host = options.gss_server_identity; + } else { + kex->gss_host = gss_host; + } + } +#endif + + xxx_kex = kex; + dispatch_run(DISPATCH_BLOCK, &kex->done, active_state); if (options.use_roaming && !kex->roaming) { @@ -306,6 +371,7 @@ int input_gssapi_hash(int type, u_int32_t, void *); int input_gssapi_error(int, u_int32_t, void *); int input_gssapi_errtok(int, u_int32_t, void *); +int userauth_gsskeyex(Authctxt *authctxt); #endif void userauth(Authctxt *, char *); @@ -321,6 +387,11 @@ Authmethod authmethods[] = { #ifdef GSSAPI + {"gssapi-keyex", + userauth_gsskeyex, + NULL, + &options.gss_authentication, + NULL}, {"gssapi-with-mic", userauth_gssapi, NULL, @@ -416,6 +487,31 @@ pubkey_cleanup(&authctxt); dispatch_range(SSH2_MSG_USERAUTH_MIN, SSH2_MSG_USERAUTH_MAX, NULL); + /* if the user wants to use the none cipher do it */ + /* post authentication and only if the right conditions are met */ + /* both of the NONE commands must be true and there must be no */ + /* tty allocated */ + if ((options.none_switch == 1) && (options.none_enabled == 1)) + { + if (!tty_flag) /* no null on tty sessions */ + { + char *myproposal[PROPOSAL_MAX] = { }; + + debug("Requesting none rekeying..."); + myproposal[PROPOSAL_ENC_ALGS_STOC] = "none"; + myproposal[PROPOSAL_ENC_ALGS_CTOS] = "none"; + kex_prop2buf(xxx_kex->my,myproposal); + ssh_packet_request_rekeying(); + fprintf(stderr, "WARNING: ENABLED NONE CIPHER\n"); + } + else + { + /* requested NONE cipher when in a tty */ + debug("Cannot switch to NONE cipher with tty allocated"); + fprintf(stderr, "NONE cipher switch disabled when a TTY is allocated\n"); + } + } + debug("Authentication succeeded (%s).", authctxt.method->name); } @@ -627,19 +723,36 @@ static u_int mech = 0; OM_uint32 min; int ok = 0; + char *gss_host = NULL; + + if (!options.gss_authentication) { + verbose("GSSAPI authentication disabled."); + return 0; + } + + if (options.gss_server_identity) + gss_host = (char *)options.gss_server_identity; + else if (options.gss_trust_dns) + gss_host = (char *)get_canonical_hostname(1); + else + gss_host = (char *)authctxt->host; /* Try one GSSAPI method at a time, rather than sending them all at * once. */ if (gss_supported == NULL) - gss_indicate_mechs(&min, &gss_supported); + if (GSS_ERROR(gss_indicate_mechs(&min, &gss_supported))) { + gss_supported = NULL; + return 0; + } /* Check to see if the mechanism is usable before we offer it */ while (mech < gss_supported->count && !ok) { /* My DER encoding requires length<128 */ if (gss_supported->elements[mech].length < 128 && ssh_gssapi_check_mechanism(&gssctxt, - &gss_supported->elements[mech], authctxt->host)) { + &gss_supported->elements[mech], gss_host, + options.gss_client_identity)) { ok = 1; /* Mechanism works */ } else { mech++; @@ -703,7 +816,8 @@ if (status == GSS_S_COMPLETE) { /* send either complete or MIC, depending on mechanism */ - if (!(flags & GSS_C_INTEG_FLAG)) { + if (strcmp(authctxt->method->name,"gssapi")==0 || + (!(flags & GSS_C_INTEG_FLAG))) { packet_start(SSH2_MSG_USERAUTH_GSSAPI_EXCHANGE_COMPLETE); packet_send(); } else { @@ -736,8 +850,8 @@ { Authctxt *authctxt = ctxt; Gssctxt *gssctxt; - int oidlen; - char *oidv; + u_int oidlen; + u_char *oidv; if (authctxt == NULL) fatal("input_gssapi_response: no authentication context"); @@ -850,6 +964,73 @@ free(lang); return 0; } + +#ifdef GSI +extern +const gss_OID_desc * const gss_mech_globus_gssapi_openssl; +#define is_gsi_oid(oid) \ + (oid->length == gss_mech_globus_gssapi_openssl->length && \ + (memcmp(oid->elements, gss_mech_globus_gssapi_openssl->elements, \ + oid->length) == 0)) +#endif + +int +userauth_gsskeyex(Authctxt *authctxt) +{ + Buffer b; + gss_buffer_desc gssbuf; + gss_buffer_desc mic = GSS_C_EMPTY_BUFFER; + OM_uint32 ms; + + static int attempt = 0; + if (attempt++ >= 1) + return (0); + + if (gss_kex_context == NULL) { + debug("No valid Key exchange context"); + return (0); + } + +#ifdef GSI + if (options.implicit && is_gsi_oid(gss_kex_context->oid)) { + ssh_gssapi_buildmic(&b, "", authctxt->service, "gssapi-keyex"); + } else { +#endif + ssh_gssapi_buildmic(&b, authctxt->server_user, authctxt->service, + "gssapi-keyex"); +#ifdef GSI + } +#endif + + gssbuf.value = buffer_ptr(&b); + gssbuf.length = buffer_len(&b); + + if (GSS_ERROR(ssh_gssapi_sign(gss_kex_context, &gssbuf, &mic))) { + buffer_free(&b); + return (0); + } + + packet_start(SSH2_MSG_USERAUTH_REQUEST); +#ifdef GSI + if (options.implicit && is_gsi_oid(gss_kex_context->oid)) { + packet_put_cstring(""); + } else { +#endif + packet_put_cstring(authctxt->server_user); +#ifdef GSI + } +#endif + packet_put_cstring(authctxt->service); + packet_put_cstring(authctxt->method->name); + packet_put_string(mic.value, mic.length); + packet_send(); + + buffer_free(&b); + gss_release_buffer(&ms, &mic); + + return (1); +} + #endif /* GSSAPI */ int diff -Naur --exclude=autom4te.cache openssh-7.0p1/sshd.8 openssh-7.0p1-gssapi/sshd.8 --- openssh-7.0p1/sshd.8 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/sshd.8 2015-08-12 17:11:07.000000000 -0500 @@ -764,6 +764,73 @@ # A CA key, accepted for any host in *.mydomain.com or *.mydomain.org @cert-authority *.mydomain.org,*.mydomain.com ssh-rsa AAAAB5W... .Ed +.Sh ENVIRONMENT +.Nm +will normally set the following environment variables: +.Bl -tag -width "SSH_ORIGINAL_COMMAND" +.It Ev GLOBUS_USAGE_OPTOUT +Setting this environment variable to "1" will disable the reporting +of usage metrics. Usage metrics can also be disabled using the +.Cm DisableUsageStats +setting in +.Xr sshd_config 5 . +.It Ev GLOBUS_USAGE_TARGETS +If +.Cm UsageStatsTargets +is not specified in +.Xr sshd_config 5 , +a comma-separated list of targets (without any tags specified) if +specified in the environment variable +.Ev GLOBUS_USAGE_TARGETS +will be used. +.It Ev GRIDMAP +Applies to GSI authentication/authorization. Specifies the location of the +gridmapfile. If not specified, the gridmap file is assumed to be available at +/etc/grid-security/grid-mapfile for services running as root and at +HOME/.gridmap for services running as non-root where HOME is the home directory +of the effective user from the password file entry. +.It Ev GSSAPI_MECH_CONF +Applies to mechglue used to support both GSI and Kerberos GSSAPI mechanisms. +Used to specify the location of the mech.conf file that lists the mechanism- +specific GSSAPI libraries (both Kerberos and GSI versions). If +.Ev GSSAPI_MECH_CONF +is not set then /etc/mech.conf is used. This applies to both the clients and +the server. The NCSA GSSAPI mechglue distribution includes a sample mech.conf +file. You will need to edit the library paths in that file and install it in +an appropriate location on your system. If the mech.conf file is not found, +the GSSAPI mechglue library will not load any GSSAPI mechanisms and GSI-OpenSSH +will simply skip GSSAPI authentication. +.It LD_LIBRARY_PATH +The sshd server is typically linked dynamically with Globus +security libraries, which must be present in the dynamic linker's +search path. This typically requires +.Cm $GLOBUS_LOCATION/lib +to be included in the list in the +.Ev LD_LIBRARY_PATH +environment variable, which is set by the +.Cm $GLOBUS_LOCATION/libexec/globus-script-initializer +script, which should be called from any +.Cm sshd +startup script. +Alternatively, to set +.Ev LD_LIBRARY_PATH +appropriately for the Globus libraries in an interactive shell, source +.Cm $GLOBUS_LOCATION/etc/globus-user-env.sh +(for sh shells) or +.Cm $GLOBUS_LOCATION/etc/globus-user.env.csh +(for csh shells). +.It Ev X509_CERT_DIR +Used for GSI authentication. Specifies a non-standard location for the +CA certificates directory. +.It Ev X509_USER_CERT +Used for GSI authentication. Specifies a non-standard location for the +certificate to be used for authentication to the client. +.It Ev X509_USER_KEY +Used for GSI authentication. Specifies a non-standard location for the +private key to be used for authentication to the client. +.It Ev X509_USER_PROXY +Used for GSI authentication. Specifies a non-standard location for the +proxy credential to be used for authentication to the client. .Sh FILES .Bl -tag -width Ds -compact .It Pa ~/.hushlogin diff -Naur --exclude=autom4te.cache openssh-7.0p1/sshd.c openssh-7.0p1-gssapi/sshd.c --- openssh-7.0p1/sshd.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/sshd.c 2015-08-12 17:11:07.000000000 -0500 @@ -124,6 +124,11 @@ #include "roaming.h" #include "ssh-sandbox.h" #include "version.h" +#include "ssh-globus-usage.h" + +#ifdef USE_SECURITY_SESSION_API +#include +#endif #include "ssherr.h" #ifndef O_NOCTTY @@ -136,6 +141,14 @@ #define REEXEC_CONFIG_PASS_FD (STDERR_FILENO + 3) #define REEXEC_MIN_FREE_FD (STDERR_FILENO + 4) +#ifdef NERSC_MOD +#include "nersc.h" +extern char n_ntop[NI_MAXHOST]; +extern char n_port[NI_MAXHOST]; +extern int client_session_id; +extern char interface_list[256]; +#endif + extern char *__progname; /* Server configuration options. */ @@ -310,6 +323,20 @@ static void sighup_restart(void) { + +#ifdef NERSC_MOD + + struct addrinfo *ai; + char ntop[NI_MAXHOST], strport[NI_MAXSERV]; + + ai = options.listen_addrs; + + if ( getnameinfo(ai->ai_addr, ai->ai_addrlen,ntop, sizeof(ntop), strport, + sizeof(strport),NI_NUMERICHOST|NI_NUMERICSERV) == 0) { + s_audit("sshd_restart_3", "addr=%s port=%s/tcp", ntop, strport); + } +#endif + logit("Received SIGHUP; restarting."); platform_pre_restart(); close_listen_socks(); @@ -432,7 +459,7 @@ } xasprintf(&server_version_string, "SSH-%d.%d-%.100s%s%s%s", - major, minor, SSH_VERSION, + major, minor, SSH_RELEASE, *options.version_addendum == '\0' ? "" : " ", options.version_addendum, newline); @@ -485,6 +512,9 @@ } debug("Client protocol version %d.%d; client software version %.100s", remote_major, remote_minor, remote_version); + logit("SSH: Server;Ltype: Version;Remote: %s-%d;Protocol: %d.%d;Client: %.100s", + get_remote_ipaddr(), get_remote_port(), + remote_major, remote_minor, remote_version); active_state->compat = compat_datafellows(remote_version); @@ -1155,6 +1185,8 @@ int ret, listen_sock, on = 1; struct addrinfo *ai; char ntop[NI_MAXHOST], strport[NI_MAXSERV]; + int socksize; + int socksizelen = sizeof(int); for (ai = options.listen_addrs; ai; ai = ai->ai_next) { if (ai->ai_family != AF_INET && ai->ai_family != AF_INET6) @@ -1195,6 +1227,11 @@ debug("Bind to port %s on %s.", strport, ntop); + getsockopt(listen_sock, SOL_SOCKET, SO_RCVBUF, + &socksize, &socksizelen); + debug("Server TCP RWIN socket size: %d", socksize); + debug("HPN Buffer Size: %d", options.hpn_buffer_size); + /* Bind the socket to the desired port. */ if (bind(listen_sock, ai->ai_addr, ai->ai_addrlen) < 0) { error("Bind to port %s on %s failed: %.200s.", @@ -1210,6 +1247,15 @@ fatal("listen on [%s]:%s: %.100s", ntop, strport, strerror(errno)); logit("Server listening on %s port %s.", ntop, strport); + +#ifdef NERSC_MOD + /* set using (pid,address,port) */ + set_server_id(getpid(),ntop,(int)options.ports[0]); + + s_audit("sshd_start_3", "addr=%s port=%s/tcp", ntop, strport); + client_session_id=0; + set_interface_list(); +#endif } freeaddrinfo(options.listen_addrs); @@ -1224,6 +1270,16 @@ static void server_accept_loop(int *sock_in, int *sock_out, int *newsock, int *config_s) { + +#ifdef NERSC_MOD + struct addrinfo *ai; + char ntop[NI_MAXHOST], strport[NI_MAXSERV]; + + ai = options.listen_addrs; + struct timeval l_tv; + l_tv.tv_sec = 60; + l_tv.tv_usec = 0; +#endif fd_set *fdset; int i, j, ret, maxfd; int key_used = 0, startups = 0; @@ -1263,7 +1319,27 @@ FD_SET(startup_pipes[i], fdset); /* Wait in select until there is a connection. */ + +#ifndef NERSC_MOD ret = select(maxfd+1, fdset, NULL, NULL, NULL); +#endif + +#ifdef NERSC_MOD + + /* If a connection happens, we break from the loop with some ammount of + * data flagged in the return bits of select. On error we see ret < 0. + * + * This needs to be tested wqith great enthusiasm since there might be corner + * cases of ret == 0 that I am not aware of + */ + l_tv.tv_sec = 60; + l_tv.tv_usec = 0; + + s_audit("sshd_server_heartbeat_3", "count=%i", ret); + + ret = select(maxfd+1, fdset, NULL, NULL, &l_tv); +#endif + if (ret < 0 && errno != EINTR) error("select: %.100s", strerror(errno)); if (received_sigterm) { @@ -1272,6 +1348,13 @@ close_listen_socks(); if (options.pid_file != NULL) unlink(options.pid_file); + +#ifdef NERSC_MOD + if ( getnameinfo(ai->ai_addr, ai->ai_addrlen,ntop, sizeof(ntop), strport, + sizeof(strport),NI_NUMERICHOST|NI_NUMERICSERV) == 0) { + s_audit("sshd_exit_3", "addr=%s port=%s/tcp", ntop, strport); + } +#endif exit(received_sigterm == SIGTERM ? 0 : 255); } if (key_used && key_do_regen) { @@ -1693,6 +1776,13 @@ /* Fill in default values for those options not explicitly set. */ fill_default_server_options(&options); +#ifdef HAVE_GLOBUS_USAGE + if (ssh_usage_stats_init(options.disable_usage_stats, + options.usage_stats_targets) != GLOBUS_SUCCESS) { + error("Error initializing Globus Usage Metrics, but continuing ..."); + } +#endif /* HAVE_GLOBUS_USAGE */ + /* challenge-response is implemented via keyboard interactive */ if (options.challenge_response_authentication) options.kbd_interactive_authentication = 1; @@ -1738,6 +1828,13 @@ exit(1); } +#ifdef NERSC_MOD + /* here we are setting the values for the server id which lives in nersc.c */ + getnameinfo(options.listen_addrs->ai_addr, options.listen_addrs->ai_addrlen, + n_ntop, sizeof(n_ntop), n_port,sizeof(n_port), + NI_NUMERICHOST|NI_NUMERICSERV); +#endif + debug("sshd version %s, %s", SSH_VERSION, #ifdef WITH_OPENSSL SSLeay_version(SSLEAY_VERSION) @@ -1827,10 +1924,13 @@ logit("Disabling protocol version 1. Could not load host key"); options.protocol &= ~SSH_PROTO_1; } +#ifndef GSSAPI + /* The GSSAPI key exchange can run without a host key */ if ((options.protocol & SSH_PROTO_2) && !sensitive_data.have_ssh2_key) { logit("Disabling protocol version 2. Could not load host key"); options.protocol &= ~SSH_PROTO_2; } +#endif if (!(options.protocol & (SSH_PROTO_1|SSH_PROTO_2))) { logit("sshd: no hostkeys available -- exiting."); exit(1); @@ -2135,6 +2235,23 @@ */ remote_ip = get_remote_ipaddr(); +#ifdef NERSC_MOD + + /* here we were setting client_session_id to the current pid + * but will now use a positive random number + * to use as a tracking id for the remainder of the + * session. c_s_i is defined in nersc.c + */ + client_session_id = abs(arc4random() ); + + char* t1buf = encode_string(interface_list, strlen(interface_list)); + + s_audit("sshd_connection_start_3", "count=%i uristring=%s addr=%s port=%i/tcp addr=%s port=%s/tcp count=%ld", + client_session_id, interface_list, remote_ip, remote_port, n_ntop, n_port); + + free(t1buf); +#endif + #ifdef SSH_AUDIT_EVENTS audit_connection_from(remote_ip, remote_port); #endif @@ -2145,6 +2262,63 @@ remote_ip, remote_port, laddr, get_local_port()); free(laddr); +#ifdef USE_SECURITY_SESSION_API + /* + * Create a new security session for use by the new user login if + * the current session is the root session or we are not launched + * by inetd (eg: debugging mode or server mode). We do not + * necessarily need to create a session if we are launched from + * inetd because Panther xinetd will create a session for us. + * + * The only case where this logic will fail is if there is an + * inetd running in a non-root session which is not creating + * new sessions for us. Then all the users will end up in the + * same session (bad). + * + * When the client exits, the session will be destroyed for us + * automatically. + * + * We must create the session before any credentials are stored + * (including AFS pags, which happens a few lines below). + */ + { + OSStatus err = 0; + SecuritySessionId sid = 0; + SessionAttributeBits sattrs = 0; + + err = SessionGetInfo(callerSecuritySession, &sid, &sattrs); + if (err) + error("SessionGetInfo() failed with error %.8X", + (unsigned) err); + else + debug("Current Session ID is %.8X / Session Attributes are %.8X", + (unsigned) sid, (unsigned) sattrs); + + if (inetd_flag && !(sattrs & sessionIsRoot)) + debug("Running in inetd mode in a non-root session... " + "assuming inetd created the session for us."); + else { + debug("Creating new security session..."); + err = SessionCreate(0, sessionHasTTY | sessionIsRemote); + if (err) + error("SessionCreate() failed with error %.8X", + (unsigned) err); + + err = SessionGetInfo(callerSecuritySession, &sid, + &sattrs); + if (err) + error("SessionGetInfo() failed with error %.8X", + (unsigned) err); + else + debug("New Session ID is %.8X / Session Attributes are %.8X", + (unsigned) sid, (unsigned) sattrs); + } + } +#endif + + /* set the HPN options for the child */ + channel_set_hpn(options.hpn_disabled, options.hpn_buffer_size); + /* * We don't want to listen forever unless the other side * successfully authenticates itself. So we set up an alarm which is @@ -2158,6 +2332,13 @@ alarm(options.login_grace_time); sshd_exchange_identification(sock_in, sock_out); +#if defined(AFS_KRB5) + /* If machine has AFS, set process authentication group. */ + if (k_hasafs()) { + k_setpag(); + k_unlog(); + } +#endif /* AFS || AFS_KRB5 */ /* In inetd mode, generate ephemeral key only for proto 1 connections */ if (!compat20 && inetd_flag && sensitive_data.server_key == NULL) @@ -2227,7 +2408,7 @@ #endif #ifdef GSSAPI - if (options.gss_authentication) { + if (options.gss_authentication && options.gss_deleg_creds) { temporarily_use_uid(authctxt->pw); ssh_gssapi_storecreds(); restore_uid(); @@ -2259,8 +2440,13 @@ notify_hostkeys(active_state); /* Start session. */ + do_authenticated(authctxt); +#ifdef NERSC_MOD + s_audit("sshd_connection_end_3", "count=%i addr=%s port=%i/tcp addr=%s port=%s/tcp", + client_session_id, remote_ip, remote_port, n_ntop, n_port); +#endif /* The connection has been terminated. */ packet_get_bytes(&ibytes, &obytes); verbose("Transferred: sent %llu, received %llu bytes", @@ -2548,6 +2734,12 @@ myproposal[PROPOSAL_MAC_ALGS_CTOS] = myproposal[PROPOSAL_MAC_ALGS_STOC] = options.macs; + if (options.none_enabled == 1) { + debug ("WARNING: None cipher enabled"); + myproposal[PROPOSAL_ENC_ALGS_CTOS] = + myproposal[PROPOSAL_ENC_ALGS_STOC] = KEX_ENCRYPT_INCLUDE_NONE; + } + if (options.compression == COMP_NONE) { myproposal[PROPOSAL_COMP_ALGS_CTOS] = myproposal[PROPOSAL_COMP_ALGS_STOC] = "none"; @@ -2563,6 +2755,48 @@ myproposal[PROPOSAL_SERVER_HOST_KEY_ALGS] = compat_pkalg_proposal( list_hostkey_types()); +#ifdef GSSAPI + { + char *orig; + char *gss = NULL; + char *newstr = NULL; + orig = myproposal[PROPOSAL_KEX_ALGS]; + + /* + * If we don't have a host key, then there's no point advertising + * the other key exchange algorithms + */ + + if (strlen(myproposal[PROPOSAL_SERVER_HOST_KEY_ALGS]) == 0) + orig = NULL; + + if (options.gss_keyex) + gss = ssh_gssapi_server_mechanisms(); + else + gss = NULL; + + if (gss && orig) + xasprintf(&newstr, "%s,%s", gss, orig); + else if (gss) + newstr = gss; + else if (orig) + newstr = orig; + + /* + * If we've got GSSAPI mechanisms, then we've got the 'null' host + * key alg, but we can't tell people about it unless its the only + * host key algorithm we support + */ + if (gss && (strlen(myproposal[PROPOSAL_SERVER_HOST_KEY_ALGS])) == 0) + myproposal[PROPOSAL_SERVER_HOST_KEY_ALGS] = "null"; + + if (newstr) + myproposal[PROPOSAL_KEX_ALGS] = newstr; + else + fatal("No supported key exchange algorithms"); + } +#endif + /* start key exchange */ if ((r = kex_setup(active_state, myproposal)) != 0) fatal("kex_setup: %s", ssh_err(r)); @@ -2575,6 +2809,13 @@ # ifdef OPENSSL_HAS_ECC kex->kex[KEX_ECDH_SHA2] = kexecdh_server; # endif +#ifdef GSSAPI + if (options.gss_keyex) { + kex->kex[KEX_GSS_GRP1_SHA1] = kexgss_server; + kex->kex[KEX_GSS_GRP14_SHA1] = kexgss_server; + kex->kex[KEX_GSS_GEX_SHA1] = kexgss_server; + } +#endif #endif kex->kex[KEX_C25519_SHA256] = kexc25519_server; kex->server = 1; diff -Naur --exclude=autom4te.cache openssh-7.0p1/sshd_config openssh-7.0p1-gssapi/sshd_config --- openssh-7.0p1/sshd_config 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/sshd_config 2015-08-12 17:11:07.000000000 -0500 @@ -81,9 +81,17 @@ #KerberosTicketCleanup yes #KerberosGetAFSToken no +# Session hooks: if allowed, specify the commands to execute +#AllowSessionHooks no +#SessionHookStartupCmd /bin/true +#SessionHookShutdownCmd /bin/true + # GSSAPI options -#GSSAPIAuthentication no +#GSSAPIAuthentication yes +#GSSAPIDelegateCredentials yes #GSSAPICleanupCredentials yes +#GSSAPIStrictAcceptorCheck yes +#GSSAPIKeyExchange yes # Set this to 'yes' to enable PAM authentication, account processing, # and session processing. If this is enabled, PAM authentication will @@ -96,6 +104,10 @@ # and ChallengeResponseAuthentication to 'no'. #UsePAM no +# Set to 'yes' to allow the PAM stack to change the user name during +# calls to authentication +#PermitPAMUserChange no + #AllowAgentForwarding yes #AllowTcpForwarding yes #GatewayPorts no @@ -125,9 +137,26 @@ # override default of no subsystems Subsystem sftp /usr/libexec/sftp-server +# the following are HPN related configuration options +# tcp receive buffer polling. disable in non autotuning kernels +#TcpRcvBufPoll yes + +# disable hpn performance boosts +#HPNDisabled no + +# buffer size for hpn to non-hpn connections +#HPNBufferSize 2048 + +# allow the use of the none cipher +#NoneEnabled no + # Example of overriding settings on a per-user basis #Match User anoncvs # X11Forwarding no # AllowTcpForwarding no # PermitTTY no # ForceCommand cvs server + + +# Usage Metrics +#UsageStatsTargets usage-stats.example.edu:4810 diff -Naur --exclude=autom4te.cache openssh-7.0p1/sshd_config.5 openssh-7.0p1-gssapi/sshd_config.5 --- openssh-7.0p1/sshd_config.5 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/sshd_config.5 2015-08-12 17:11:07.000000000 -0500 @@ -569,6 +569,15 @@ See PATTERNS in .Xr ssh_config 5 for more information on patterns. +.It Cm DisableUsageStats +This keyword can be followed by one of the keywords "true", "enabled", "yes", +"on" or "1" to disable reporting of usage metrics. Or it can be set to "false", +"disabled", "no", "off", "0" to enable reporting of usage metrics. Setting the +.Cm GLOBUS_USAGE_OPTOUT +environment variable to "1" will also disable the reporting of usage metrics. +Disabling reporting of usage metrics will cause the +.Cm UsageStatsTargets +setting to be ignored. .It Cm FingerprintHash Specifies the hash algorithm used when logging key fingerprints. Valid options are: @@ -619,7 +628,17 @@ .It Cm GSSAPIAuthentication Specifies whether user authentication based on GSSAPI is allowed. The default is -.Dq no . +.Dq yes . +Note that this option applies to protocol version 2 only. +.It Cm GSSAPIDelegateCredentials +Specifies whether delegated credentials are stored in the user's environment. +The default is +.Dq yes . +.It Cm GSSAPIKeyExchange +Specifies whether key exchange based on GSSAPI is allowed. GSSAPI key exchange +doesn't rely on ssh keys to verify host identity. +The default is +.Dq yes . Note that this option applies to protocol version 2 only. .It Cm GSSAPICleanupCredentials Specifies whether to automatically destroy the user's credentials cache @@ -627,21 +646,44 @@ The default is .Dq yes . Note that this option applies to protocol version 2 only. +.It Cm GSSAPICredentialsPath +If specified, the delegated GSSAPI credential is stored in the +given path, overwriting any existing credentials. +Paths can be specified with syntax similar to the AuthorizedKeysFile +option (i.e., accepting %h and %u tokens). +When using this option, +setting 'GssapiCleanupCredentials no' is recommended, +so logging out of one session +doesn't remove the credentials in use by another session of +the same user. +Currently only implemented for the GSI mechanism. +.It Cm GSIAllowLimitedProxy +Specifies whether to accept limited proxy credentials for +authentication. +The default is +.Dq no . .It Cm GSSAPIStrictAcceptorCheck -Determines whether to be strict about the identity of the GSSAPI acceptor -a client authenticates against. -If set to +Determines whether to be strict about the identity of the GSSAPI acceptor +a client authenticates against. If .Dq yes then the client must authenticate against the .Pa host -service on the current hostname. -If set to +service on the current hostname. If .Dq no -then the client may authenticate against any service key stored in the -machine's default store. -This facility is provided to assist with operation on multi homed machines. +then the client may authenticate against any service key stored in the +machine's default store. This facility is provided to assist with operation +on multi homed machines. The default is .Dq yes . +Note that this option applies only to protocol version 2 GSSAPI connections, +and setting it to +.Dq no +may only work with recent Kerberos GSSAPI libraries. +.It Cm GSSAPIStoreCredentialsOnRekey +Controls whether the user's GSSAPI credentials should be updated following a +successful connection rekeying. This option can be used to accepted renewed +or updated credentials from a compatible client. The default is +.Dq no . .It Cm HostbasedAcceptedKeyTypes Specifies the key types that will be accepted for hostbased authentication as a comma-separated pattern list. @@ -1499,6 +1541,103 @@ .Pp To disable TCP keepalive messages, the value should be set to .Dq no . +.It Cm UsageStatsTargets +This option can be used to specify the target collector hosts to which usage +metrics should be reported. This setting will be ignored if +.Cm DisableUsageStats +is enabled. Multiple targets can be specified separated by comma(s), but no +space(s). Each target specification is of the format +.Pa host:port[!tags]. +Tags control what data elements are reported. The following list specifies +the tags for the corresponding data elements. +.Pp +.Bl -item -offset indent -compact +.It +.Cm V +.Sm off +- OpenSSH version, reported by default. +.Sm on +.It +.Cm v +.Sm off +- SSL version, reported by default. +.Sm on +.It +.Cm M +.Sm off +- User authentication method used such as "gssapi-keyex", "gssapi-with-mic", etc. Reported by default. +.Sm on +.It +.Cm m +.Sm off +- User authentication mechanism used such as "GSI", "Kerberos", etc. Reported by default. +.Sm on +.It +.Cm I +.Sm off +- Client IP address. Not reported by default. +.Sm on +.It +.Cm u +.Sm off +- User name. Not reported by default. +.Sm on +.It +.Cm U +.Sm off +- User DN. Not reported by default. +.Sm on +.Pp +In addition to the above selected information, the following data are +reported to ALL the specified/default target collectors. There's no way to +exclude these from being reported other than by disabling the reporting of +usage metrics altogether: +.Pp +.It +.Cm Component code +.Sm off +- 12 for GSI OpenSSH +.Sm on +.It +.Cm Component Data Format version +.Sm off +- 0 currently +.Sm on +.It +.Cm IP Address +.Sm off +- IP address of reporting server +.Sm on +.It +.Cm Timestamp +.It +.Cm Hostname +.Sm off +- Host name of reporting server +.Sm on +.Pp +If no tags are specified in a host spec, or the special string +.Dq default +is specified, the tags +.Dq VvMm +are assumed. A site could choose to allow a +different set of data to be reported by specifying a different tag set. The +last 3 tags +.Dq I , +.Dq u +and +.Dq U +above are more meant for a local collector that a +site might like to deploy since they could be construed as private information. +The special string +.Dq all +denotes all tags. +.El +.Pp +Usage Metrics reporting is disabled unless +.Cm UsageStatsTargets +is specified. +.Pp .It Cm TrustedUserCAKeys Specifies a file containing public keys of certificate authorities that are trusted to sign user certificates for authentication, or @@ -1575,6 +1714,12 @@ as a non-root user. The default is .Dq no . +.It Cm PermitPAMUserChange +If set to +.Dq yes +this will enable PAM authentication to change the name of the user being +authenticated. The default is +.Dq no . .It Cm UsePrivilegeSeparation Specifies whether .Xr sshd 8 diff -Naur --exclude=autom4te.cache openssh-7.0p1/sshkey.c openssh-7.0p1-gssapi/sshkey.c --- openssh-7.0p1/sshkey.c 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/sshkey.c 2015-08-12 17:11:07.000000000 -0500 @@ -90,6 +90,9 @@ KEY_ED25519_CERT, 0, 1 }, #ifdef WITH_OPENSSL { NULL, "RSA1", KEY_RSA1, 0, 0 }, +#ifdef GSSAPI + { "null", "null", KEY_NULL, 0, 0 }, /* 'null' host key alg for GSSAPI */ +#endif { "ssh-rsa", "RSA", KEY_RSA, 0, 0 }, { "ssh-dss", "DSA", KEY_DSA, 0, 0 }, # ifdef OPENSSL_HAS_ECC diff -Naur --exclude=autom4te.cache openssh-7.0p1/sshkey.h openssh-7.0p1-gssapi/sshkey.h --- openssh-7.0p1/sshkey.h 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/sshkey.h 2015-08-12 17:11:07.000000000 -0500 @@ -62,6 +62,9 @@ KEY_DSA_CERT, KEY_ECDSA_CERT, KEY_ED25519_CERT, +#ifdef GSSAPI + KEY_NULL, /* 'null' host key alg for GSSAPI mechs */ +#endif KEY_UNSPEC }; diff -Naur --exclude=autom4te.cache openssh-7.0p1/version.h openssh-7.0p1-gssapi/version.h --- openssh-7.0p1/version.h 2015-08-11 03:57:29.000000000 -0500 +++ openssh-7.0p1-gssapi/version.h 2015-08-12 17:11:07.000000000 -0500 @@ -1,6 +1,35 @@ /* $OpenBSD: version.h,v 1.74 2015/08/02 09:56:42 djm Exp $ */ +#ifdef GSI +#define GSI_VERSION " GSI" +#else +#define GSI_VERSION "" +#endif + +#ifdef KRB5 +#define KRB5_VERSION " KRB5" +#else +#define KRB5_VERSION "" +#endif + +#ifdef MECHGLUE +#define MGLUE_VERSION " MECHGLUE" +#else +#define MGLUE_VERSION "" +#endif + +#define NCSA_VERSION " GSI_GSSAPI_20150812" + #define SSH_VERSION "OpenSSH_7.0" +#ifdef NERSC_MOD +#define SSH_AUDITING "NMOD_3.12" +#else +#define SSH_AUDITING "" +#endif /* NERSC_MOD */ + #define SSH_PORTABLE "p1" -#define SSH_RELEASE SSH_VERSION SSH_PORTABLE +#define SSH_HPN "-hpn14" + +#define SSH_RELEASE SSH_VERSION SSH_PORTABLE SSH_AUDITING SSH_HPN \ + NCSA_VERSION GSI_VERSION KRB5_VERSION MGLUE_VERSION